generated from TrueCloudLab/basic
Compare commits
1 commit
| Author | SHA1 | Date | |
|---|---|---|---|
| 3970569602 |
59 changed files with 590 additions and 10200 deletions
|
|
@ -1,21 +0,0 @@
|
|||
name: DCO action
|
||||
on: [pull_request]
|
||||
|
||||
jobs:
|
||||
dco:
|
||||
name: DCO
|
||||
runs-on: ubuntu-latest
|
||||
steps:
|
||||
- uses: actions/checkout@v3
|
||||
with:
|
||||
fetch-depth: 0
|
||||
|
||||
- name: Setup Go
|
||||
uses: actions/setup-go@v3
|
||||
with:
|
||||
go-version: '1.23'
|
||||
|
||||
- name: Run commit format checker
|
||||
uses: https://git.frostfs.info/TrueCloudLab/dco-go@v3
|
||||
with:
|
||||
from: 'origin/${{ github.event.pull_request.base.ref }}'
|
||||
|
|
@ -1,73 +0,0 @@
|
|||
name: Tests and linters
|
||||
on: [pull_request]
|
||||
|
||||
jobs:
|
||||
lint:
|
||||
name: Lint
|
||||
runs-on: ubuntu-latest
|
||||
steps:
|
||||
- uses: actions/checkout@v3
|
||||
|
||||
- name: Set up Go
|
||||
uses: actions/setup-go@v3
|
||||
with:
|
||||
go-version: '1.23'
|
||||
cache: true
|
||||
|
||||
- name: Install linters
|
||||
run: make lint-install
|
||||
|
||||
- name: Run linters
|
||||
run: make lint
|
||||
|
||||
tests:
|
||||
name: Tests
|
||||
runs-on: ubuntu-latest
|
||||
strategy:
|
||||
matrix:
|
||||
go_versions: [ '1.22', '1.23' ]
|
||||
fail-fast: false
|
||||
steps:
|
||||
- uses: actions/checkout@v3
|
||||
|
||||
- name: Set up Go
|
||||
uses: actions/setup-go@v3
|
||||
with:
|
||||
go-version: '${{ matrix.go_versions }}'
|
||||
cache: true
|
||||
|
||||
- name: Run tests
|
||||
run: make test
|
||||
|
||||
tests-race:
|
||||
name: Tests with -race
|
||||
runs-on: ubuntu-latest
|
||||
steps:
|
||||
- uses: actions/checkout@v3
|
||||
|
||||
- name: Set up Go
|
||||
uses: actions/setup-go@v3
|
||||
with:
|
||||
go-version: '1.23'
|
||||
cache: true
|
||||
|
||||
- name: Run tests
|
||||
run: go test ./... -count=1 -race
|
||||
|
||||
staticcheck:
|
||||
name: Staticcheck
|
||||
runs-on: ubuntu-latest
|
||||
steps:
|
||||
- uses: actions/checkout@v3
|
||||
|
||||
- name: Set up Go
|
||||
uses: actions/setup-go@v3
|
||||
with:
|
||||
go-version: '1.23'
|
||||
cache: true
|
||||
|
||||
- name: Install staticcheck
|
||||
run: make staticcheck-install
|
||||
|
||||
- name: Run staticcheck
|
||||
run: make staticcheck-run
|
||||
2
.gitattributes
vendored
2
.gitattributes
vendored
|
|
@ -1,4 +1,2 @@
|
|||
/**/*.pb.go -diff -merge
|
||||
/**/*.pb.go linguist-generated=true
|
||||
/**/*_easyjson.go -diff -merge
|
||||
/**/*_easyjson.go linguist-generated=true
|
||||
|
|
|
|||
|
|
@ -12,8 +12,7 @@ run:
|
|||
# output configuration options
|
||||
output:
|
||||
# colored-line-number|line-number|json|tab|checkstyle|code-climate, default is "colored-line-number"
|
||||
formats:
|
||||
- format: tab
|
||||
format: tab
|
||||
|
||||
# all available settings of specific linters
|
||||
linters-settings:
|
||||
|
|
@ -48,7 +47,7 @@ linters:
|
|||
- durationcheck
|
||||
- exhaustive
|
||||
- exportloopref
|
||||
- gofumpt
|
||||
- gofmt
|
||||
- goimports
|
||||
- misspell
|
||||
- whitespace
|
||||
|
|
|
|||
|
|
@ -2,6 +2,13 @@ ci:
|
|||
autofix_prs: false
|
||||
|
||||
repos:
|
||||
- repo: https://github.com/jorisroovers/gitlint
|
||||
rev: v0.19.1
|
||||
hooks:
|
||||
- id: gitlint
|
||||
stages: [commit-msg]
|
||||
- id: gitlint-ci
|
||||
|
||||
- repo: https://github.com/pre-commit/pre-commit-hooks
|
||||
rev: v4.4.0
|
||||
hooks:
|
||||
|
|
@ -19,29 +26,20 @@ repos:
|
|||
exclude: ".key$"
|
||||
|
||||
- repo: https://github.com/shellcheck-py/shellcheck-py
|
||||
rev: v0.9.0.6
|
||||
rev: v0.9.0.2
|
||||
hooks:
|
||||
- id: shellcheck
|
||||
|
||||
- repo: local
|
||||
- repo: https://github.com/golangci/golangci-lint
|
||||
rev: v1.51.2
|
||||
hooks:
|
||||
- id: make-lint
|
||||
name: Run Make Lint
|
||||
entry: make lint
|
||||
language: system
|
||||
pass_filenames: false
|
||||
- id: golangci-lint
|
||||
|
||||
- repo: local
|
||||
hooks:
|
||||
- id: go-unit-tests
|
||||
name: go unit tests
|
||||
entry: make test GOFLAGS=''
|
||||
entry: make test
|
||||
pass_filenames: false
|
||||
types: [go]
|
||||
language: system
|
||||
|
||||
- repo: https://github.com/TekWizely/pre-commit-golang
|
||||
rev: v1.0.0-rc.1
|
||||
hooks:
|
||||
- id: go-staticcheck-repo-mod
|
||||
- id: go-mod-tidy
|
||||
|
|
|
|||
77
Makefile
77
Makefile
|
|
@ -1,77 +0,0 @@
|
|||
#!/usr/bin/make -f
|
||||
|
||||
TRUECLOUDLAB_LINT_VERSION ?= 0.0.6
|
||||
TMP_DIR := .cache
|
||||
OUTPUT_LINT_DIR ?= $(shell pwd)/bin
|
||||
LINT_VERSION ?= 1.60.1
|
||||
LINT_DIR = $(OUTPUT_LINT_DIR)/golangci-lint-$(LINT_VERSION)-v$(TRUECLOUDLAB_LINT_VERSION)
|
||||
EASYJSON_VERSION ?= $(shell go list -f '{{.Version}}' -m github.com/mailru/easyjson)
|
||||
EASYJSON_DIR ?= $(shell pwd)/bin/easyjson-$(EASYJSON_VERSION)
|
||||
|
||||
# Run all code formatters
|
||||
fmts: fmt imports
|
||||
|
||||
# Reformat code
|
||||
fmt:
|
||||
@echo "⇒ Processing gofmt check"
|
||||
@gofumpt -s -w .
|
||||
|
||||
# Reformat imports
|
||||
imports:
|
||||
@echo "⇒ Processing goimports check"
|
||||
@goimports -w .
|
||||
|
||||
# Run Unit Test with go test
|
||||
test: GOFLAGS ?= "-count=1"
|
||||
test:
|
||||
@echo "⇒ Running go test"
|
||||
@GOFLAGS="$(GOFLAGS)" go test ./...
|
||||
|
||||
# Activate pre-commit hooks
|
||||
pre-commit:
|
||||
pre-commit install -t pre-commit -t commit-msg
|
||||
|
||||
# Deactivate pre-commit hooks
|
||||
unpre-commit:
|
||||
pre-commit uninstall -t pre-commit -t commit-msg
|
||||
|
||||
pre-commit-run:
|
||||
@pre-commit run -a --hook-stage manual
|
||||
|
||||
# Install linters
|
||||
lint-install:
|
||||
@mkdir -p $(TMP_DIR)
|
||||
@rm -rf $(TMP_DIR)/linters
|
||||
@git -c advice.detachedHead=false clone --branch v$(TRUECLOUDLAB_LINT_VERSION) https://git.frostfs.info/TrueCloudLab/linters.git $(TMP_DIR)/linters
|
||||
@make -C $(TMP_DIR)/linters lib CGO_ENABLED=1 OUT_DIR=$(OUTPUT_LINT_DIR)
|
||||
@rm -rf $(TMP_DIR)/linters
|
||||
@rmdir $(TMP_DIR) 2>/dev/null || true
|
||||
@CGO_ENABLED=1 GOBIN=$(LINT_DIR) go install github.com/golangci/golangci-lint/cmd/golangci-lint@v$(LINT_VERSION)
|
||||
|
||||
# Run linters
|
||||
lint:
|
||||
@if [ ! -d "$(LINT_DIR)" ]; then \
|
||||
echo "Run make lint-install"; \
|
||||
exit 1; \
|
||||
fi
|
||||
@$(LINT_DIR)/golangci-lint run
|
||||
|
||||
# Install staticcheck
|
||||
staticcheck-install:
|
||||
@go install honnef.co/go/tools/cmd/staticcheck@latest
|
||||
|
||||
# Run staticcheck
|
||||
staticcheck-run:
|
||||
@staticcheck ./...
|
||||
|
||||
easyjson-install:
|
||||
@rm -rf $(EASYJSON_DIR)
|
||||
@mkdir -p $(EASYJSON_DIR)
|
||||
@GOBIN=$(EASYJSON_DIR) go install github.com/mailru/easyjson/...@$(EASYJSON_VERSION)
|
||||
|
||||
generate:
|
||||
@if [ ! -d "$(EASYJSON_DIR)" ]; then \
|
||||
make easyjson-install; \
|
||||
fi
|
||||
find ./ -name "_easyjson.go" -exec rm -rf {} \;
|
||||
$(EASYJSON_DIR)/easyjson ./pkg/chain/chain.go
|
||||
193
chain.go
Normal file
193
chain.go
Normal file
|
|
@ -0,0 +1,193 @@
|
|||
package policyengine
|
||||
|
||||
import (
|
||||
"bytes"
|
||||
"encoding/gob"
|
||||
"fmt"
|
||||
"strings"
|
||||
)
|
||||
|
||||
// Engine ...
|
||||
type Engine interface {
|
||||
// IsAllowed returns status for the operation after all checks.
|
||||
// The second return value signifies whether a matching rule was found.
|
||||
IsAllowed(name Name, namespace string, r Request) (Status, bool)
|
||||
}
|
||||
|
||||
type Chain struct {
|
||||
Rules []Rule
|
||||
}
|
||||
|
||||
func init() {
|
||||
// FIXME #1 (@fyrchik): Introduce more optimal serialization format.
|
||||
gob.Register(Chain{})
|
||||
}
|
||||
|
||||
func (c *Chain) Bytes() []byte {
|
||||
b := bytes.NewBuffer(nil)
|
||||
e := gob.NewEncoder(b)
|
||||
if err := e.Encode(c); err != nil {
|
||||
panic(err)
|
||||
}
|
||||
return b.Bytes()
|
||||
}
|
||||
|
||||
func (c *Chain) DecodeBytes(b []byte) error {
|
||||
r := bytes.NewReader(b)
|
||||
d := gob.NewDecoder(r)
|
||||
return d.Decode(c)
|
||||
}
|
||||
|
||||
type Rule struct {
|
||||
Status Status
|
||||
// Actions the operation is applied to.
|
||||
Action []string
|
||||
// List of the resources the operation is applied to.
|
||||
Resource []string
|
||||
// True iff individual conditions must be combined with the logical OR.
|
||||
// By default AND is used, so _each_ condition must pass.
|
||||
Any bool
|
||||
Condition []Condition
|
||||
}
|
||||
|
||||
type Condition struct {
|
||||
Op ConditionType
|
||||
Object ObjectType
|
||||
Key string
|
||||
Value string
|
||||
}
|
||||
|
||||
type ObjectType byte
|
||||
|
||||
const (
|
||||
ObjectResource ObjectType = iota
|
||||
ObjectRequest
|
||||
ObjectActor
|
||||
)
|
||||
|
||||
// TODO @fyrchik: replace string with int-like type.
|
||||
type ConditionType string
|
||||
|
||||
// TODO @fyrchik: reduce the number of conditions.
|
||||
// Everything from here should be expressable, but we do not need them all.
|
||||
// https://docs.aws.amazon.com/IAM/latest/UserGuide/reference_policies_elements_condition_operators.html
|
||||
const (
|
||||
// String condition operators.
|
||||
CondStringEquals ConditionType = "StringEquals"
|
||||
CondStringNotEquals ConditionType = "StringNotEquals"
|
||||
CondStringEqualsIgnoreCase ConditionType = "StringEqualsIgnoreCase"
|
||||
CondStringNotEqualsIgnoreCase ConditionType = "StringNotEqualsIgnoreCase"
|
||||
CondStringLike ConditionType = "StringLike"
|
||||
CondStringNotLike ConditionType = "StringNotLike"
|
||||
|
||||
// Numeric condition operators.
|
||||
CondNumericEquals ConditionType = "NumericEquals"
|
||||
CondNumericNotEquals ConditionType = "NumericNotEquals"
|
||||
CondNumericLessThan ConditionType = "NumericLessThan"
|
||||
CondNumericLessThanEquals ConditionType = "NumericLessThanEquals"
|
||||
CondNumericGreaterThan ConditionType = "NumericGreaterThan"
|
||||
CondNumericGreaterThanEquals ConditionType = "NumericGreaterThanEquals"
|
||||
|
||||
// Date condition operators.
|
||||
CondDateEquals ConditionType = "DateEquals"
|
||||
CondDateNotEquals ConditionType = "DateNotEquals"
|
||||
CondDateLessThan ConditionType = "DateLessThan"
|
||||
CondDateLessThanEquals ConditionType = "DateLessThanEquals"
|
||||
CondDateGreaterThan ConditionType = "DateGreaterThan"
|
||||
CondDateGreaterThanEquals ConditionType = "DateGreaterThanEquals"
|
||||
|
||||
// Bolean condition operators.
|
||||
CondBool ConditionType = "Bool"
|
||||
|
||||
// IP address condition operators.
|
||||
CondIPAddress ConditionType = "IpAddress"
|
||||
CondNotIPAddress ConditionType = "NotIpAddress"
|
||||
|
||||
// ARN condition operators.
|
||||
CondArnEquals ConditionType = "ArnEquals"
|
||||
CondArnLike ConditionType = "ArnLike"
|
||||
CondArnNotEquals ConditionType = "ArnNotEquals"
|
||||
CondArnNotLike ConditionType = "ArnNotLike"
|
||||
)
|
||||
|
||||
func (c *Condition) Match(obj Request) bool {
|
||||
var val string
|
||||
switch c.Object {
|
||||
case ObjectResource:
|
||||
val = obj.Resource().Property(c.Key)
|
||||
case ObjectRequest:
|
||||
val = obj.Property(c.Key)
|
||||
default:
|
||||
return false
|
||||
}
|
||||
|
||||
switch c.Op {
|
||||
default:
|
||||
panic(fmt.Sprintf("unimplemented: %s", c.Op))
|
||||
case CondStringEquals:
|
||||
return val == c.Value
|
||||
case CondStringNotEquals:
|
||||
return val != c.Value
|
||||
case CondStringEqualsIgnoreCase:
|
||||
return strings.EqualFold(val, c.Value)
|
||||
case CondStringNotEqualsIgnoreCase:
|
||||
return !strings.EqualFold(val, c.Value)
|
||||
case CondStringLike:
|
||||
return globMatch(val, c.Value)
|
||||
case CondStringNotLike:
|
||||
return !globMatch(val, c.Value)
|
||||
}
|
||||
}
|
||||
|
||||
func (r *Rule) Match(req Request) (status Status, matched bool) {
|
||||
found := len(r.Resource) == 0
|
||||
for i := range r.Resource {
|
||||
if globMatch(req.Resource().Name(), r.Resource[i]) {
|
||||
found = true
|
||||
break
|
||||
}
|
||||
}
|
||||
if !found {
|
||||
return NoRuleFound, false
|
||||
}
|
||||
for i := range r.Action {
|
||||
if globMatch(r.Action[i], req.Operation()) {
|
||||
return r.matchCondition(req)
|
||||
}
|
||||
}
|
||||
return NoRuleFound, false
|
||||
}
|
||||
|
||||
func (r *Rule) matchCondition(obj Request) (status Status, matched bool) {
|
||||
if r.Any {
|
||||
return r.matchAny(obj)
|
||||
}
|
||||
return r.matchAll(obj)
|
||||
}
|
||||
func (r *Rule) matchAny(obj Request) (status Status, matched bool) {
|
||||
for i := range r.Condition {
|
||||
if r.Condition[i].Match(obj) {
|
||||
|
||||
return r.Status, true
|
||||
}
|
||||
}
|
||||
return NoRuleFound, false
|
||||
}
|
||||
func (r *Rule) matchAll(obj Request) (status Status, matched bool) {
|
||||
for i := range r.Condition {
|
||||
if !r.Condition[i].Match(obj) {
|
||||
return NoRuleFound, false
|
||||
}
|
||||
}
|
||||
return r.Status, true
|
||||
}
|
||||
|
||||
func (c *Chain) Match(req Request) (status Status, matched bool) {
|
||||
for i := range c.Rules {
|
||||
status, matched := c.Rules[i].Match(req)
|
||||
if matched {
|
||||
return status, true
|
||||
}
|
||||
}
|
||||
return NoRuleFound, false
|
||||
}
|
||||
|
|
@ -1,4 +1,4 @@
|
|||
package chain
|
||||
package policyengine
|
||||
|
||||
// Name represents the place in the request lifecycle where policy is applied.
|
||||
type Name string
|
||||
|
|
@ -7,7 +7,4 @@ const (
|
|||
// Ingress represents chains applied when crossing user/storage network boundary.
|
||||
// It is not applied when talking between nodes.
|
||||
Ingress Name = "ingress"
|
||||
|
||||
// S3 represents chains applied when crossing user/s3 network boundary.
|
||||
S3 Name = "s3"
|
||||
)
|
||||
33
chain_test.go
Normal file
33
chain_test.go
Normal file
|
|
@ -0,0 +1,33 @@
|
|||
package policyengine
|
||||
|
||||
import (
|
||||
"testing"
|
||||
|
||||
"github.com/stretchr/testify/require"
|
||||
)
|
||||
|
||||
func TestEncodeDecode(t *testing.T) {
|
||||
expected := Chain{
|
||||
Rules: []Rule{
|
||||
{
|
||||
Status: Allow,
|
||||
Action: []string{
|
||||
"native::PutObject",
|
||||
},
|
||||
Resource: []string{"*"},
|
||||
Condition: []Condition{
|
||||
{
|
||||
Op: CondStringEquals,
|
||||
Key: "Name",
|
||||
Value: "NNS",
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
}
|
||||
data := expected.Bytes()
|
||||
|
||||
var actual Chain
|
||||
require.NoError(t, actual.DecodeBytes(data))
|
||||
require.Equal(t, expected, actual)
|
||||
}
|
||||
85
docs/ape.md
85
docs/ape.md
|
|
@ -1,85 +0,0 @@
|
|||
# Access policy engine
|
||||
|
||||
## General overview
|
||||
|
||||
### Purpose
|
||||
|
||||
Access policy engine (APE) is aimed at checking if a request can be performed over a resource by looking up the set chains of rules.
|
||||
|
||||
#### Terms
|
||||
|
||||
| Term | Description | Structure overview |
|
||||
| -------------- | -------------------------------------------------------------- | -------------- |
|
||||
| `Request` | The action that is being performed on the `Resource`. | <ul><li>`Operation` - `GetObject`,`PutObject` etc.;</li><li>`Properties` - actor's public key, actor's attributes;</li><li>`Resource`.</li></ul> |
|
||||
| `Resource` | The object that the request is being performed on. Check also [resource.md](./resource.md). | <ul><li>`Name` - strictly formatted string value;</li><li>`Properties`.</li></ul> |
|
||||
| `Chain` | A chain of `Rule`-s defined for a specific target. Chains are strictly distinguished by `Name`-s , i.e. chains with name `ingress` are not intersected with chains with name `s3`. Chains are stored in serialized format. | <ul><li>Base64-encoded `ID`;</li><li>List of `Rule`-s;</li><li>`MatchType` - defines rule status selection priority.</li></ul> |
|
||||
| `Rule` | `Rule` defines which status is returned if `Request` matches all conditions. | <ul><li>`Status`: `Allow`, `AccessDenied`, `QuotaLimitReached`, `NoRuleFound`;</li><li>`Actions` - operation defined by a schema (`GetObject`, `PutContainer` etc.);</li><li>`Resources`;</li><li>`Any` - if `true` then `Reqeust` matches `Rule` if any `Condition` is `true`;</li><li>`Conditions`.</li></ul> |
|
||||
| `Name` | `Name` of a chain (do not confuse with chain ID). `Name` defines a layer of `Chain`'s usage, so chains are distinguished by `Name`-s. Basically, `Name` refers to a protocol. | String value (`ingress`, `s3`, `iam`). |
|
||||
| `Target` | A scope of request. `Target` can be either simple (only namespace; only container; only user; only groups) or compound (namespace + container). | <ul><li>`Namespace`;</li><li>`Container`;</li><li>`User`;</li><li>`Groups`.</li></ul> |
|
||||
| `Engine` | `Engine` checks a request in a scope defined by `Target`. First, it is trying to match a request with rules defined in `LocalOverrideStorage` and, then, in `MorphRuleChainStorage`. | <ul><li>`LocalOverrideStorage` - chains stored in the local override storage have the highest priority</li><li>`MorphRuleChainStorage` - basically, chains stored in `Policy` contract;</li><li>`ChainRouter` - looks up chains and try to match them with `Request`.</li></ul> |
|
||||
|
||||
#### Details
|
||||
|
||||
Here some entities are overviewed in more detail.
|
||||
|
||||
##### Resource
|
||||
|
||||
`Resource`'s name is strictly formatted, the format is defined by a schema (`native`, `aws` etc.). Examples:
|
||||
|
||||
```bash
|
||||
# The resource is the particular object with the address within Root namespace
|
||||
native:object//HRwWbb1bJjRms33kkA21hy4JdPfARaH3fW9NfuNN6Fgj/EbxzAdz5LB4uqxuz6crWKAumBNtZyK2rKsqQP7TdZvwr
|
||||
# The resource is all objects within the container within Root namespace
|
||||
native:object//HRwWbb1bJjRms33kkA21hy4JdPfARaH3fW9NfuNN6Fgj/*
|
||||
# The resource is the particular container within the namespace
|
||||
native:container/namespace1/HRwWbb1bJjRms33kkA21hy4JdPfARaH3fW9NfuNN6Fgj
|
||||
# The resource is all containers within the namespace
|
||||
native:container/namespace1/*
|
||||
```
|
||||
|
||||
##### Rule
|
||||
|
||||
`Rule` works out if:
|
||||
|
||||
1. a requests's operation matches the rule's `Actions`;
|
||||
2. resource name matches the rule's `Resources`;
|
||||
3. if all (or at least one if `Any=true`) conditions in `Condition` is met. Each condition defines how to retrieve
|
||||
and compare the retrieved value. If `Condition`'s `Object` is set to `Resource` then the value is retrieved from the
|
||||
resource's properties (example: container zone attribute). If `Object` is set to `Request`, the it's retrieved from the request's properties (example: actor's public key).
|
||||
|
||||
###### Name matching
|
||||
|
||||
`Resource`'s name in `Rule` may contain wildcard '*' that can be considered as a regular expression:
|
||||
|
||||
```bash
|
||||
# The resource is all objects within the container within Root namespace
|
||||
native:object//HRwWbb1bJjRms33kkA21hy4JdPfARaH3fW9NfuNN6Fgj/*
|
||||
```
|
||||
|
||||
If an incoming request has such a resource name, then names are matched:
|
||||
|
||||
```bash
|
||||
# The resource is all objects within the container within Root namespace
|
||||
native:object//HRwWbb1bJjRms33kkA21hy4JdPfARaH3fW9NfuNN6Fgj/EbxzAdz5LB4uqxuz6crWKAumBNtZyK2rKsqQP7TdZvwr
|
||||
```
|
||||
|
||||
If the incoming request has such a resource name that specifies a container's object within namespace, for instance, `namespicy`,
|
||||
then matching does not work out:
|
||||
|
||||
```bash
|
||||
# The resource is all objects within the container within `namespicy` namespace:
|
||||
native:object/namespicy/HRwWbb1bJjRms33kkA21hy4JdPfARaH3fW9NfuNN6Fgj/EbxzAdz5LB4uqxuz6crWKAumBNtZyK2rKsqQP7TdZvwr
|
||||
```
|
||||
|
||||
##### Engine
|
||||
|
||||
`Engine` is trying to match the request against **the target** looking up chain rules, firstly, in `LocalOverrideStorage` (these rules are also known as *local overrides*) and then in `MorphRuleChainStorage` (contract `Policy`). Both storages iterate chain rules according to the specified priority of the targets: `namespace` -> `container` -> `user` -> `groups`.
|
||||
|
||||
#### Diagrams
|
||||
|
||||
The diagram demonstrates a scenario in Storage node. The request `A` cannot be performed as APE matched
|
||||
the request and returned `Access Denied` status. The request `B` is allowed and the client gets `OK` status.
|
||||
|
||||
|
||||
The diagram demonstrates a complex scenario with S3, IAM and Storage node.
|
||||
|
||||
|
|
@ -1,61 +0,0 @@
|
|||
@startuml s3 ape
|
||||
|
||||
participant "Client" as client
|
||||
|
||||
participant "IAM" as iam
|
||||
participant "IAM -> APE converter" as converter
|
||||
|
||||
box "S3" #HotPink
|
||||
participant "S3 gateway" as s3
|
||||
end box
|
||||
|
||||
box "Access Policy Engine (as s3 middleware)" #LightPink
|
||||
participant "Local override storage" as s3localOverrides
|
||||
participant "Chain router" as s3chainRouter
|
||||
end box
|
||||
|
||||
box "Policy contract (shared)"
|
||||
participant "Morph rule storage" as morphRuleStorage
|
||||
end box
|
||||
|
||||
box "Access Policy Engine (as storage middleware)" #LightGreen
|
||||
participant "Chain Router" as storageChainRouter
|
||||
participant "Local override storage" as storageLocalOverrides
|
||||
end box
|
||||
|
||||
box "Storage node" #Green
|
||||
participant "Object service" as obj
|
||||
participant "Control service" as control
|
||||
end box
|
||||
|
||||
group Request IAM to set a policy
|
||||
client -> iam : Set IAM policy
|
||||
iam -> converter : Convert IAM policy
|
||||
converter -> iam : Return APE chain
|
||||
iam -> morphRuleStorage : Store IAM policy and APE chain
|
||||
iam -> s3localOverrides : Set S3 local overrides
|
||||
iam -> client : OK
|
||||
end
|
||||
|
||||
group Request S3 to set a policy
|
||||
client -> s3 : Set bucket policy
|
||||
s3 -> converter : Convert IAM policy
|
||||
converter -> s3 : Return APE chain
|
||||
s3 -> morphRuleStorage : Store bucket policy and APE chain
|
||||
s3 -> client : OK
|
||||
end
|
||||
|
||||
group Get object
|
||||
client -> s3: GetObject
|
||||
s3 -> s3chainRouter: Check if APE allows request for S3
|
||||
note over s3chainRouter: matching the request with overrides and rules
|
||||
s3chainRouter -> s3: Status: ALLOW
|
||||
s3 -> obj: Get object
|
||||
obj -> storageChainRouter: Check if APE allows the request
|
||||
note over storageChainRouter : matching the request with overrides and rules
|
||||
storageChainRouter -> obj: Status: ALLOW
|
||||
obj -> s3: Response: OK, Object
|
||||
s3 -> client: Response: OK, Object
|
||||
end
|
||||
|
||||
@enduml
|
||||
File diff suppressed because one or more lines are too long
|
Before Width: | Height: | Size: 22 KiB |
|
|
@ -1,46 +0,0 @@
|
|||
@startuml storage node ape
|
||||
!pragma teoz true
|
||||
|
||||
participant "Administrator" as administrator
|
||||
participant "Client" as client
|
||||
|
||||
box "Storage node" #Green
|
||||
participant "Object service" as obj
|
||||
participant "Control service" as control
|
||||
end box
|
||||
|
||||
box "Access Policy Engine" #LightGreen
|
||||
participant "Local override storage" as localOverrides
|
||||
participant "Chain Router" as chainRouter
|
||||
participant "Morph rule storage" as morphRuleStorage
|
||||
end box
|
||||
|
||||
group Set local override
|
||||
client -> control: Add local override
|
||||
control -> localOverrides: Save override in DB
|
||||
localOverrides -> control: OK
|
||||
control -> client: OK
|
||||
end
|
||||
|
||||
group Update state in Policy contract
|
||||
administrator -> morphRuleStorage: Add chain
|
||||
morphRuleStorage -> administrator: OK
|
||||
end
|
||||
|
||||
group Perform a request A
|
||||
client -> obj : Sending a request
|
||||
obj -> chainRouter: Check if APE allows the request
|
||||
note over chainRouter : Fetches local overrides and rules defined for a target/targets and looks for a match
|
||||
chainRouter -> obj: APE returns status: "ACCESS DENIED"
|
||||
obj -> client: Response: "the request is denied"
|
||||
end
|
||||
|
||||
group Perform a request B
|
||||
client -> obj : Sending a request
|
||||
obj -> chainRouter: Check if APE allows the request
|
||||
note over chainRouter : Fetches local overrides and rules defined for a target/targets and looks for a match
|
||||
chainRouter -> obj: APE returns status: "ALLOW"
|
||||
obj -> client: Response: "OK"
|
||||
end
|
||||
|
||||
@enduml
|
||||
File diff suppressed because one or more lines are too long
|
Before Width: | Height: | Size: 17 KiB |
|
|
@ -1,439 +0,0 @@
|
|||
# Policy converters
|
||||
|
||||
This repository contains converters that provide opportunities to
|
||||
transform [AWS IAM policies](https://docs.aws.amazon.com/IAM/latest/UserGuide/reference_policies.html) to inner
|
||||
FrostFS policy format. This document describes such transformations.
|
||||
|
||||
## FrostFS
|
||||
|
||||
As it was mentioned there are converters that transform AWS IAM policies to FrostFS.
|
||||
Here common examples of AWS:
|
||||
|
||||
```json
|
||||
{
|
||||
"Version": "2012-10-17",
|
||||
"Statement": [
|
||||
{
|
||||
"Effect": "Allow",
|
||||
"Action": [
|
||||
"s3:*"
|
||||
],
|
||||
"Resource": "*"
|
||||
}
|
||||
]
|
||||
}
|
||||
```
|
||||
|
||||
and FrostFS:
|
||||
|
||||
```json
|
||||
{
|
||||
"ID": "c29tZS1pZA==",
|
||||
"Rules": [
|
||||
{
|
||||
"Status": "Allow",
|
||||
"Actions": {
|
||||
"Inverted": false,
|
||||
"Names": [
|
||||
"s3:*"
|
||||
]
|
||||
},
|
||||
"Resources": {
|
||||
"Inverted": false,
|
||||
"Names": [
|
||||
"*"
|
||||
]
|
||||
},
|
||||
"Any": false,
|
||||
"Condition": null
|
||||
}
|
||||
],
|
||||
"MatchType": "DenyPriority"
|
||||
}
|
||||
```
|
||||
|
||||
policies.
|
||||
|
||||
Despite there is only one FrostFS format, we have two converters (`s3` and `native`). The reason is S3 gateway and
|
||||
Storage node have different actions and resource naming:
|
||||
|
||||
* S3 has [a lot of methods](https://docs.aws.amazon.com/AmazonS3/latest/API/API_Operations.html) and operates with
|
||||
bucket/object
|
||||
* Storage node has only 6 container and 7 object methods and operates container/object (that has different format)
|
||||
|
||||
The following sections describe each transformation more precisely ([common](#common) sections contains shared concepts)
|
||||
|
||||
### Common
|
||||
|
||||
#### Fields
|
||||
|
||||
Rough json main fields mapping:
|
||||
|
||||
| AWS policy field | FrostFS policy field | Comment |
|
||||
|------------------|----------------------|------------------------------------------------------------------|
|
||||
| `Version` | - | Not applicable |
|
||||
| `Statement` | `Rules` | |
|
||||
| `Effect` | `Status` | |
|
||||
| `Action` | `Actions.Names` | `Actions.Inverted` = false |
|
||||
| `NotAction` | `Actions.Names` | `Actions.Inverted` = true |
|
||||
| `Resource` | `Resources.Names` | `Resources.Inverted` = false |
|
||||
| `NotResource` | `Resources.Names` | `Resources.Inverted` = true |
|
||||
| `Condition` | `Condition` | `Any` = false, that means the conditions must be hold altogether |
|
||||
| `Principal` | - | Expressed via conditions (depends on s3/native converters) |
|
||||
|
||||
### Conditions
|
||||
|
||||
Each condition in FrostFS policy can add requirements to some request/resource properties
|
||||
and consists of the following fields:
|
||||
|
||||
| Field | Description |
|
||||
|----------|-------------------------------------------------------------------------------------------|
|
||||
| `Op` | Condition type operation (`StringEqual`, `NumericEqual` etc) |
|
||||
| `Object` | Property type to which condition can be applied (`Request` property, `Resource` property) |
|
||||
| `Key` | Property key |
|
||||
| `Value` | Property value |
|
||||
|
||||
Conditions operators:
|
||||
|
||||
| AWS conditions operator | FrostFS condition operator | Comment |
|
||||
|-----------------------------|-----------------------------|-------------------------------------------------------------------|
|
||||
| `StringEquals` | `StringEquals` | |
|
||||
| `StringNotEquals` | `StringNotEquals` | |
|
||||
| `StringEqualsIgnoreCase` | `StringEqualsIgnoreCase` | |
|
||||
| `StringNotEqualsIgnoreCase` | `StringNotEqualsIgnoreCase` | |
|
||||
| `StringLike` | `StringLike` | |
|
||||
| `StringNotLike` | `StringNotLike` | |
|
||||
| `NumericEquals` | `NumericEquals` | |
|
||||
| `NumericNotEquals` | `NumericNotEquals` | |
|
||||
| `NumericLessThan` | `NumericLessThan` | |
|
||||
| `NumericLessThanEquals` | `NumericLessThanEquals` | |
|
||||
| `NumericGreaterThan` | `NumericGreaterThan` | |
|
||||
| `NumericGreaterThanEquals` | `NumericGreaterThanEquals` | |
|
||||
| `DateEquals` | `StringEquals` | Date transforms to unix timestamp to be compared as string |
|
||||
| `DateNotEquals` | `StringNotEquals` | Date transforms to unix timestamp to be compared as string |
|
||||
| `DateLessThan` | `StringEqualsIgnoreCase` | Date transforms to unix timestamp to be compared as string |
|
||||
| `DateLessThanEquals` | `StringNotEqualsIgnoreCase` | Date transforms to unix timestamp to be compared as string |
|
||||
| `DateGreaterThan` | `StringLike` | Date transforms to unix timestamp to be compared as string |
|
||||
| `DateGreaterThanEquals` | `StringNotLike` | Date transforms to unix timestamp to be compared as string |
|
||||
| `Bool` | `StringEqualsIgnoreCase` | |
|
||||
| `IpAddress` | `IPAddress` | |
|
||||
| `NotIpAddress` | `NotIPAddress` | |
|
||||
| `ArnEquals` | `StringEquals` | |
|
||||
| `ArnLike` | `StringLike` | |
|
||||
| `ArnNotEquals` | `StringNotEquals` | |
|
||||
| `ArnNotLike` | `StringNotLike` | |
|
||||
| `SliceContains` | `SliceContains` | AWS spec doesn't contain such operator. This is FrostFS extension |
|
||||
|
||||
For example, AWS conditions:
|
||||
|
||||
```json
|
||||
{
|
||||
"Condition": {
|
||||
"ArnEquals": {"key16": ["val16"]},
|
||||
"ArnNotEquals": {"key18": ["val18"]},
|
||||
"ArnNotLike": {"key19": ["val19"]},
|
||||
"Bool": {"key13": ["True"]},
|
||||
"DateEquals": {"key7": ["2006-01-02T15:04:05+07:00"]},
|
||||
"DateGreaterThan": {"key11": ["2006-01-02T15:04:05-01:00"]},
|
||||
"DateGreaterThanEquals": {"key12": ["2006-01-02T15:04:05-03:00"]},
|
||||
"DateLessThan": {"key9": ["2006-01-02T15:04:05+06:00"]},
|
||||
"DateLessThanEquals": {"key10": ["2006-01-02T15:04:05+03:00"]},
|
||||
"DateNotEquals": {"key8": ["2006-01-02T15:04:05Z"]},
|
||||
"NumericEquals": {"key20": ["-20"]},
|
||||
"NumericGreaterThan": {"key24": ["-24.24"]},
|
||||
"NumericGreaterThanEquals": {"key25": ["+25.25"]},
|
||||
"NumericLessThan": {"key22": ["0"]},
|
||||
"NumericLessThanEquals": {"key23": ["23.23"]},
|
||||
"NumericNotEquals": {"key21": ["+21"]},
|
||||
"StringEquals": {"key1": ["val0"]},
|
||||
"StringEqualsIgnoreCase": {"key3": ["val3"]},
|
||||
"StringLike": {"key5": ["val5"]},
|
||||
"StringNotEquals": {"key2": ["val2"]},
|
||||
"StringNotEqualsIgnoreCase": {"key4": ["val4"]},
|
||||
"StringNotLike": {"key6": ["val6"]}
|
||||
}
|
||||
}
|
||||
```
|
||||
|
||||
transforms to FrostFS conditions:
|
||||
|
||||
```json
|
||||
{
|
||||
"Condition": [
|
||||
{"Op": "StringLike", "Object": "Request", "Key": "key5", "Value": "val5"},
|
||||
{"Op": "StringNotEquals", "Object": "Request", "Key": "key2", "Value": "val2"},
|
||||
{"Op": "StringGreaterThan", "Object": "Request", "Key": "key11", "Value": "1136217845"},
|
||||
{"Op": "StringGreaterThanEquals", "Object": "Request", "Key": "key12", "Value": "1136225045"},
|
||||
{"Op": "StringLessThan", "Object": "Request", "Key": "key9", "Value": "1136192645"},
|
||||
{"Op": "StringEqualsIgnoreCase", "Object": "Request", "Key": "key3", "Value": "val3"},
|
||||
{"Op": "StringEquals", "Object": "Request", "Key": "key16", "Value": "val16"},
|
||||
{"Op": "NumericLessThanEquals", "Object": "Request", "Key": "key23", "Value": "23.23"},
|
||||
{"Op": "StringNotEqualsIgnoreCase", "Object": "Request", "Key": "key4", "Value": "val4"},
|
||||
{"Op": "StringEquals", "Object": "Request", "Key": "key1", "Value": "val0"},
|
||||
{"Op": "StringLessThanEquals", "Object": "Request", "Key": "key10", "Value": "1136203445"},
|
||||
{"Op": "NumericGreaterThan", "Object": "Request", "Key": "key24", "Value": "-24.24"},
|
||||
{"Op": "NumericGreaterThanEquals", "Object": "Request", "Key": "key25", "Value": "+25.25"},
|
||||
{"Op": "NumericLessThan", "Object": "Request", "Key": "key22", "Value": "0"},
|
||||
{"Op": "StringNotEquals", "Object": "Request", "Key": "key8", "Value": "1136214245"},
|
||||
{"Op": "NumericEquals", "Object": "Request", "Key": "key20", "Value": "-20"},
|
||||
{"Op": "NumericNotEquals", "Object": "Request", "Key": "key21", "Value": "+21"},
|
||||
{"Op": "StringNotLike", "Object": "Request", "Key": "key6", "Value": "val6"},
|
||||
{"Op": "StringNotEquals", "Object": "Request", "Key": "key18", "Value": "val18"},
|
||||
{"Op": "StringNotLike", "Object": "Request", "Key": "key19", "Value": "val19"},
|
||||
{"Op": "StringEqualsIgnoreCase", "Object": "Request", "Key": "key13", "Value": "True"},
|
||||
{"Op": "StringEquals", "Object": "Request", "Key": "key7", "Value": "1136189045"}
|
||||
]
|
||||
}
|
||||
```
|
||||
|
||||
### S3
|
||||
|
||||
#### Actions
|
||||
|
||||
Each action allows some s3-gw methods, so we must transform action to specific method names
|
||||
(you can see exact mapping in table in [this file](../iam/converter_s3.go)).
|
||||
|
||||
For example the following actions:
|
||||
|
||||
```json
|
||||
{
|
||||
"Action": [
|
||||
"s3:DeleteObject",
|
||||
"iam:CreateUser"
|
||||
]
|
||||
}
|
||||
```
|
||||
|
||||
transforms to
|
||||
|
||||
```json
|
||||
{
|
||||
"Actions": {
|
||||
"Inverted": false,
|
||||
"Names": [
|
||||
"s3:DeleteObject",
|
||||
"s3:DeleteMultipleObjects",
|
||||
"iam:CreateUser"
|
||||
]
|
||||
}
|
||||
}
|
||||
```
|
||||
|
||||
As we can see any `iam:*` action transformed as it is. But `s3:*` actions transforms according to
|
||||
[spec rules](https://docs.aws.amazon.com/service-authorization/latest/reference/list_amazons3.html) and s3-gw
|
||||
[method names](https://git.frostfs.info/TrueCloudLab/frostfs-s3-gw/src/commit/2ab655b909c40db6f7a4e41e07d8b99167f791bd/api/middleware/constants.go#L3-L76).
|
||||
|
||||
#### Resources
|
||||
|
||||
Resource is transformed as it is:
|
||||
|
||||
```json
|
||||
{
|
||||
"Resource": [
|
||||
"arn:aws:s3:::bucket/object"
|
||||
]
|
||||
}
|
||||
```
|
||||
|
||||
```json
|
||||
{
|
||||
"Resources": {
|
||||
"Inverted": false,
|
||||
"Names": [
|
||||
"arn:aws:s3:::bucket/object"
|
||||
]
|
||||
}
|
||||
}
|
||||
```
|
||||
|
||||
#### Principals
|
||||
|
||||
To check user s3-gw uses special condition request property (`Owner`), so when AWS policy contains principal field
|
||||
it transforms to rule with appropriate condition. To get correct `Owner` property value special user resolver
|
||||
(`S3Resolver` interface in [converter_s3 file](../iam/converter_s3.go)) must be provided into convert function.
|
||||
|
||||
For example such AWS json statement:
|
||||
|
||||
```json
|
||||
{
|
||||
"Effect": "Allow",
|
||||
"Action": "*",
|
||||
"Resource": "*",
|
||||
"Principal": {
|
||||
"AWS": "arn:aws:iam::111122223333:user/JohnDoe"
|
||||
}
|
||||
}
|
||||
```
|
||||
|
||||
transforms to the following FrostFS rule:
|
||||
|
||||
```json
|
||||
{
|
||||
"Status": "Allow",
|
||||
"Actions": {
|
||||
"Inverted": false,
|
||||
"Names": [
|
||||
"*"
|
||||
]
|
||||
},
|
||||
"Resources": {
|
||||
"Inverted": false,
|
||||
"Names": [
|
||||
"*"
|
||||
]
|
||||
},
|
||||
"Any": false,
|
||||
"Condition": [
|
||||
{
|
||||
"Op": "StringEquals",
|
||||
"Object": "Request",
|
||||
"Key": "Owner",
|
||||
"Value": "NbUgTSFvPmsRxmGeWpuuGeJUoRoi6PErcM"
|
||||
}
|
||||
]
|
||||
}
|
||||
```
|
||||
|
||||
### Native
|
||||
|
||||
#### Actions
|
||||
|
||||
Each action allows some frostfs methods, so we must transform action to specific method names
|
||||
(you can see exact mapping in table in [this file](../iam/converter_native.go)).
|
||||
|
||||
For example the following actions:
|
||||
|
||||
```json
|
||||
{
|
||||
"Action": [
|
||||
"s3:DeleteObject",
|
||||
"iam:CreateUser"
|
||||
]
|
||||
}
|
||||
```
|
||||
|
||||
transforms to
|
||||
|
||||
```json
|
||||
{
|
||||
"Actions": {
|
||||
"Inverted": false,
|
||||
"Names": [
|
||||
"PutObject",
|
||||
"HeadObject",
|
||||
"GetObject",
|
||||
"RangeObject",
|
||||
"GetContainer",
|
||||
"DeleteObject"
|
||||
]
|
||||
}
|
||||
}
|
||||
```
|
||||
|
||||
> **Note:** Only subset of s3:* actions can be transformed (exact value you can see in mapping table mentioned before).
|
||||
> If all provided actions is not applicable converter function returns appropriate error.
|
||||
|
||||
Native methods (to which original actions are transformed) depend on which methods are invoked by appropriate s3-gw
|
||||
[method](https://git.frostfs.info/TrueCloudLab/frostfs-s3-gw/src/commit/2ab655b909c40db6f7a4e41e07d8b99167f791bd/api/middleware/constants.go#L3-L76).
|
||||
|
||||
So in example above s3-gw during performing DeleteObject methods invokes the following methods:
|
||||
`["PutObject","HeadObject","GetObject","RangeObject","GetContainer","DeleteObject"]`
|
||||
|
||||
#### Resources
|
||||
|
||||
To transform resources the following is being performed:
|
||||
|
||||
* Bucket name is resoled to container id (by providing `NativeResolver` interface implementation to converter)
|
||||
* Object name is transformed to condition with special `FilePath` attribute
|
||||
(that present on every object that was uploaded via s3-gw)
|
||||
|
||||
For example, the following AWS policy statement:
|
||||
|
||||
```json
|
||||
{
|
||||
"Principal": "*",
|
||||
"Effect": "Allow",
|
||||
"Action": "*",
|
||||
"Resource": "arn:aws:s3:::bucket/object"
|
||||
}
|
||||
```
|
||||
|
||||
transforms to FrostFS native policy rule:
|
||||
|
||||
```json
|
||||
{
|
||||
"Status": "Allow",
|
||||
"Actions": {
|
||||
"Inverted": false,
|
||||
"Names": [
|
||||
"*"
|
||||
]
|
||||
},
|
||||
"Resources": {
|
||||
"Inverted": false,
|
||||
"Names": [
|
||||
"native:object//bucket/HFq67qbfhFEiEL7qDXqayo3F78yAvxXSXzwSa2hKM9bH/*",
|
||||
"native:container//bucket/HFq67qbfhFEiEL7qDXqayo3F78yAvxXSXzwSa2hKM9bH"
|
||||
]
|
||||
},
|
||||
"Any": false,
|
||||
"Condition": [
|
||||
{
|
||||
"Op": "StringLike",
|
||||
"Object": "Resource",
|
||||
"Key": "FilePath",
|
||||
"Value": "object"
|
||||
}
|
||||
]
|
||||
}
|
||||
```
|
||||
|
||||
#### Principals
|
||||
|
||||
To check user s3-gw uses special condition request property (`$Actor:publicKey`), so when AWS policy contains principal
|
||||
field it transforms to rule with appropriate condition. To get correct `$Actor:publicKey` property value
|
||||
special user resolver (`NativeResolver` interface in [converter_native file](../iam/converter_native.go)) must be
|
||||
provided into convert function.
|
||||
|
||||
For example such AWS json statement:
|
||||
|
||||
```json
|
||||
{
|
||||
"Effect": "Allow",
|
||||
"Action": "*",
|
||||
"Resource": "*",
|
||||
"Principal": {
|
||||
"AWS": "arn:aws:iam::111122223333:user/JohnDoe"
|
||||
}
|
||||
}
|
||||
```
|
||||
|
||||
transforms to the following FrostFS rule:
|
||||
|
||||
```json
|
||||
{
|
||||
"Status": "Allow",
|
||||
"Actions": {
|
||||
"Inverted": false,
|
||||
"Names": [
|
||||
"*"
|
||||
]
|
||||
},
|
||||
"Resources": {
|
||||
"Inverted": false,
|
||||
"Names": [
|
||||
"native:object/*",
|
||||
"native:container/*"
|
||||
]
|
||||
},
|
||||
"Any": false,
|
||||
"Condition": [
|
||||
{
|
||||
"Op": "StringEquals",
|
||||
"Object": "Request",
|
||||
"Key": "$Actor:publicKey",
|
||||
"Value": "031a6c6fbbdf02ca351745fa86b9ba5a9452d785ac4f7fc2b7548ca2a46c4fcf4a"
|
||||
}
|
||||
]
|
||||
}
|
||||
```
|
||||
|
|
@ -1,20 +0,0 @@
|
|||
# Resource
|
||||
|
||||
From the point of the access policy engine, a resource is an object to which a request is being performed.
|
||||
This can be an object in a container within a namespace, or all objects in a container,
|
||||
or all containers within the root namespace etc.
|
||||
|
||||
A resource can be viewed from two sides:
|
||||
- As part of a [request](../pkg/resource/resource.go). In this case a resource has a name and properties.
|
||||
- As part of rule [chain](../pkg/chain/chain.go): a resource has just a name.
|
||||
|
||||
## Resource name
|
||||
|
||||
A resource name must have a such format that can be processed by a chain router that matches a request
|
||||
either with local overrides or with rules within policy contract to get if this request is allowed to be performed.
|
||||
The main idea of this format is for the chain router to match by full name (`native:object//cnrID/objID`) or
|
||||
wildcard (`native:object//cnrID/*`).
|
||||
|
||||
Check out formats that are defined in the schema: [native formats](../schema/native/consts.go), [s3 formats](../schema/s3/consts.go).
|
||||
You should validate a resource name using [util](../schema/native/util/validation.go) before instantiating a request or
|
||||
before putting it to either to local override storage or the policy contract storage.
|
||||
|
|
@ -1,8 +1,8 @@
|
|||
package chain
|
||||
package policyengine
|
||||
|
||||
import "fmt"
|
||||
|
||||
// Status is the status for policy application.
|
||||
// Status is the status for policy application
|
||||
type Status byte
|
||||
|
||||
const (
|
||||
|
|
@ -1,4 +1,4 @@
|
|||
package util
|
||||
package policyengine
|
||||
|
||||
import (
|
||||
"strings"
|
||||
|
|
@ -9,7 +9,7 @@ import (
|
|||
// ? in pattern correspond to any symbol.
|
||||
// * in pattern correspond to any sequence of symbols.
|
||||
// Currently only '*' in the suffix is supported.
|
||||
func GlobMatch(s, pattern string) bool {
|
||||
func globMatch(s, pattern string) bool {
|
||||
index := strings.IndexByte(pattern, '*')
|
||||
switch index {
|
||||
default:
|
||||
28
go.mod
28
go.mod
|
|
@ -1,35 +1,11 @@
|
|||
module git.frostfs.info/TrueCloudLab/policy-engine
|
||||
|
||||
go 1.22
|
||||
go 1.20
|
||||
|
||||
require (
|
||||
git.frostfs.info/TrueCloudLab/frostfs-contract v0.19.3-0.20240409111539-e7a05a49ff45
|
||||
github.com/google/uuid v1.3.1
|
||||
github.com/mailru/easyjson v0.7.7
|
||||
github.com/nspcc-dev/neo-go v0.105.0
|
||||
github.com/stretchr/testify v1.8.4
|
||||
golang.org/x/exp v0.0.0-20230817173708-d852ddb80c63
|
||||
)
|
||||
require github.com/stretchr/testify v1.8.1
|
||||
|
||||
require (
|
||||
github.com/davecgh/go-spew v1.1.1 // indirect
|
||||
github.com/decred/dcrd/dcrec/secp256k1/v4 v4.0.1 // indirect
|
||||
github.com/golang/snappy v0.0.1 // indirect
|
||||
github.com/hashicorp/golang-lru v0.6.0 // indirect
|
||||
github.com/josharian/intern v1.0.0 // indirect
|
||||
github.com/mr-tron/base58 v1.2.0 // indirect
|
||||
github.com/nspcc-dev/go-ordered-json v0.0.0-20231123160306-3374ff1e7a3c // indirect
|
||||
github.com/nspcc-dev/neo-go/pkg/interop v0.0.0-20231127165613-b35f351f0ba0 // indirect
|
||||
github.com/nspcc-dev/rfc6979 v0.2.0 // indirect
|
||||
github.com/pmezard/go-difflib v1.0.0 // indirect
|
||||
github.com/syndtr/goleveldb v1.0.1-0.20210305035536-64b5b1c73954 // indirect
|
||||
github.com/twmb/murmur3 v1.1.5 // indirect
|
||||
go.etcd.io/bbolt v1.3.8 // indirect
|
||||
go.uber.org/multierr v1.10.0 // indirect
|
||||
go.uber.org/zap v1.26.0 // indirect
|
||||
golang.org/x/crypto v0.17.0 // indirect
|
||||
golang.org/x/sync v0.3.0 // indirect
|
||||
golang.org/x/sys v0.15.0 // indirect
|
||||
golang.org/x/text v0.14.0 // indirect
|
||||
gopkg.in/yaml.v3 v3.0.1 // indirect
|
||||
)
|
||||
|
|
|
|||
167
go.sum
167
go.sum
|
|
@ -1,166 +1,17 @@
|
|||
git.frostfs.info/TrueCloudLab/frostfs-contract v0.19.3-0.20240409111539-e7a05a49ff45 h1:Tp4I+XOLp3VCJORfxSamQtj3RZNISbaLM4WD5iIzXxg=
|
||||
git.frostfs.info/TrueCloudLab/frostfs-contract v0.19.3-0.20240409111539-e7a05a49ff45/go.mod h1:F/fe1OoIDKr5Bz99q4sriuHDuf3aZefZy9ZsCqEtgxc=
|
||||
github.com/beorn7/perks v1.0.1 h1:VlbKKnNfV8bJzeqoa4cOKqO6bYr3WgKZxO8Z16+hsOM=
|
||||
github.com/beorn7/perks v1.0.1/go.mod h1:G2ZrVWU2WbWT9wwq4/hrbKbnv/1ERSJQ0ibhJ6rlkpw=
|
||||
github.com/bits-and-blooms/bitset v1.8.0 h1:FD+XqgOZDUxxZ8hzoBFuV9+cGWY9CslN6d5MS5JVb4c=
|
||||
github.com/bits-and-blooms/bitset v1.8.0/go.mod h1:7hO7Gc7Pp1vODcmWvKMRA9BNmbv6a/7QIWpPxHddWR8=
|
||||
github.com/cespare/xxhash/v2 v2.2.0 h1:DC2CZ1Ep5Y4k3ZQ899DldepgrayRUGE6BBZ/cd9Cj44=
|
||||
github.com/cespare/xxhash/v2 v2.2.0/go.mod h1:VGX0DQ3Q6kWi7AoAeZDth3/j3BFtOZR5XLFGgcrjCOs=
|
||||
github.com/consensys/bavard v0.1.13 h1:oLhMLOFGTLdlda/kma4VOJazblc7IM5y5QPd2A/YjhQ=
|
||||
github.com/consensys/bavard v0.1.13/go.mod h1:9ItSMtA/dXMAiL7BG6bqW2m3NdSEObYWoH223nGHukI=
|
||||
github.com/consensys/gnark-crypto v0.12.2-0.20231013160410-1f65e75b6dfb h1:f0BMgIjhZy4lSRHCXFbQst85f5agZAjtDMixQqBWNpc=
|
||||
github.com/consensys/gnark-crypto v0.12.2-0.20231013160410-1f65e75b6dfb/go.mod h1:v2Gy7L/4ZRosZ7Ivs+9SfUDr0f5UlG+EM5t7MPHiLuY=
|
||||
github.com/cpuguy83/go-md2man/v2 v2.0.0-20190314233015-f79a8a8ca69d h1:U+s90UTSYgptZMwQh2aRr3LuazLJIa+Pg3Kc1ylSYVY=
|
||||
github.com/cpuguy83/go-md2man/v2 v2.0.0-20190314233015-f79a8a8ca69d/go.mod h1:maD7wRr/U5Z6m/iR4s+kqSMx2CaBsrgA7czyZG/E6dU=
|
||||
github.com/davecgh/go-spew v1.1.0/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
|
||||
github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c=
|
||||
github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
|
||||
github.com/decred/dcrd/crypto/blake256 v1.0.0/go.mod h1:sQl2p6Y26YV+ZOcSTP6thNdn47hh8kt6rqSlvmrXFAc=
|
||||
github.com/decred/dcrd/dcrec/secp256k1/v4 v4.0.1 h1:YLtO71vCjJRCBcrPMtQ9nqBsqpA1m5sE92cU+pd5Mcc=
|
||||
github.com/decred/dcrd/dcrec/secp256k1/v4 v4.0.1/go.mod h1:hyedUtir6IdtD/7lIxGeCxkaw7y45JueMRL4DIyJDKs=
|
||||
github.com/fsnotify/fsnotify v1.4.7/go.mod h1:jwhsz4b93w/PPRr/qN1Yymfu8t87LnFCMoQvtojpjFo=
|
||||
github.com/fsnotify/fsnotify v1.4.9 h1:hsms1Qyu0jgnwNXIxa+/V/PDsU6CfLf6CNO8H7IWoS4=
|
||||
github.com/fsnotify/fsnotify v1.4.9/go.mod h1:znqG4EE+3YCdAaPaxE2ZRY/06pZUdp0tY4IgpuI1SZQ=
|
||||
github.com/golang/protobuf v1.2.0/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U=
|
||||
github.com/golang/protobuf v1.4.0-rc.1/go.mod h1:ceaxUfeHdC40wWswd/P6IGgMaK3YpKi5j83Wpe3EHw8=
|
||||
github.com/golang/protobuf v1.4.0-rc.1.0.20200221234624-67d41d38c208/go.mod h1:xKAWHe0F5eneWXFV3EuXVDTCmh+JuBKY0li0aMyXATA=
|
||||
github.com/golang/protobuf v1.4.0-rc.2/go.mod h1:LlEzMj4AhA7rCAGe4KMBDvJI+AwstrUpVNzEA03Pprs=
|
||||
github.com/golang/protobuf v1.4.0-rc.4.0.20200313231945-b860323f09d0/go.mod h1:WU3c8KckQ9AFe+yFwt9sWVRKCVIyN9cPHBJSNnbL67w=
|
||||
github.com/golang/protobuf v1.4.0/go.mod h1:jodUvKwWbYaEsadDk5Fwe5c77LiNKVO9IDvqG2KuDX0=
|
||||
github.com/golang/protobuf v1.4.2/go.mod h1:oDoupMAO8OvCJWAcko0GGGIgR6R6ocIYbsSw735rRwI=
|
||||
github.com/golang/protobuf v1.5.3 h1:KhyjKVUg7Usr/dYsdSqoFveMYd5ko72D+zANwlG1mmg=
|
||||
github.com/golang/protobuf v1.5.3/go.mod h1:XVQd3VNwM+JqD3oG2Ue2ip4fOMUkwXdXDdiuN0vRsmY=
|
||||
github.com/golang/snappy v0.0.1 h1:Qgr9rKW7uDUkrbSmQeiDsGa8SjGyCOGtuasMWwvp2P4=
|
||||
github.com/golang/snappy v0.0.1/go.mod h1:/XxbfmMg8lxefKM7IXC3fBNl/7bRcc72aCRzEWrmP2Q=
|
||||
github.com/google/go-cmp v0.3.0/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU=
|
||||
github.com/google/go-cmp v0.3.1/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU=
|
||||
github.com/google/go-cmp v0.4.0/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE=
|
||||
github.com/google/uuid v1.3.1 h1:KjJaJ9iWZ3jOFZIf1Lqf4laDRCasjl0BCmnEGxkdLb4=
|
||||
github.com/google/uuid v1.3.1/go.mod h1:TIyPZe4MgqvfeYDBFedMoGGpEw/LqOeaOT+nhxU+yHo=
|
||||
github.com/gorilla/websocket v1.4.2 h1:+/TMaTYc4QFitKJxsQ7Yye35DkWvkdLcvGKqM+x0Ufc=
|
||||
github.com/gorilla/websocket v1.4.2/go.mod h1:YR8l580nyteQvAITg2hZ9XVh4b55+EU/adAjf1fMHhE=
|
||||
github.com/hashicorp/golang-lru v0.6.0 h1:uL2shRDx7RTrOrTCUZEGP/wJUFiUI8QT6E7z5o8jga4=
|
||||
github.com/hashicorp/golang-lru v0.6.0/go.mod h1:iADmTwqILo4mZ8BN3D2Q6+9jd8WM5uGBxy+E8yxSoD4=
|
||||
github.com/holiman/uint256 v1.2.0 h1:gpSYcPLWGv4sG43I2mVLiDZCNDh/EpGjSk8tmtxitHM=
|
||||
github.com/holiman/uint256 v1.2.0/go.mod h1:y4ga/t+u+Xwd7CpDgZESaRcWy0I7XMlTMA25ApIH5Jw=
|
||||
github.com/hpcloud/tail v1.0.0/go.mod h1:ab1qPbhIpdTxEkNHXyeSf5vhxWSCs/tWer42PpOxQnU=
|
||||
github.com/josharian/intern v1.0.0 h1:vlS4z54oSdjm0bgjRigI+G1HpF+tI+9rE5LLzOg8HmY=
|
||||
github.com/josharian/intern v1.0.0/go.mod h1:5DoeVV0s6jJacbCEi61lwdGj/aVlrQvzHFFd8Hwg//Y=
|
||||
github.com/mailru/easyjson v0.7.7 h1:UGYAvKxe3sBsEDzO8ZeWOSlIQfWFlxbzLZe7hwFURr0=
|
||||
github.com/mailru/easyjson v0.7.7/go.mod h1:xzfreul335JAWq5oZzymOObrkdz5UnU4kGfJJLY9Nlc=
|
||||
github.com/matttproud/golang_protobuf_extensions v1.0.1 h1:4hp9jkHxhMHkqkrB3Ix0jegS5sx/RkqARlsWZ6pIwiU=
|
||||
github.com/matttproud/golang_protobuf_extensions v1.0.1/go.mod h1:D8He9yQNgCq6Z5Ld7szi9bcBfOoFv/3dc6xSMkL2PC0=
|
||||
github.com/mmcloughlin/addchain v0.4.0 h1:SobOdjm2xLj1KkXN5/n0xTIWyZA2+s99UCY1iPfkHRY=
|
||||
github.com/mmcloughlin/addchain v0.4.0/go.mod h1:A86O+tHqZLMNO4w6ZZ4FlVQEadcoqkyU72HC5wJ4RlU=
|
||||
github.com/mr-tron/base58 v1.2.0 h1:T/HDJBh4ZCPbU39/+c3rRvE0uKBQlU27+QI8LJ4t64o=
|
||||
github.com/mr-tron/base58 v1.2.0/go.mod h1:BinMc/sQntlIE1frQmRFPUoPA1Zkr8VRgBdjWI2mNwc=
|
||||
github.com/nspcc-dev/go-ordered-json v0.0.0-20231123160306-3374ff1e7a3c h1:OOQeE613BH93ICPq3eke5N78gWNeMjcBWkmD2NKyXVg=
|
||||
github.com/nspcc-dev/go-ordered-json v0.0.0-20231123160306-3374ff1e7a3c/go.mod h1:79bEUDEviBHJMFV6Iq6in57FEOCMcRhfQnfaf0ETA5U=
|
||||
github.com/nspcc-dev/neo-go v0.105.0 h1:vtNZYFEFySK8zRDhLzQYha849VzWrcKezlnq/oNQg/w=
|
||||
github.com/nspcc-dev/neo-go v0.105.0/go.mod h1:6pchIHg5okeZO955RxpTh5q0sUI0vtpgPM6Q+no1rlI=
|
||||
github.com/nspcc-dev/neo-go/pkg/interop v0.0.0-20231127165613-b35f351f0ba0 h1:N+dMIBmteXjJpkH6UZ7HmNftuFxkqszfGLbhsEctnv0=
|
||||
github.com/nspcc-dev/neo-go/pkg/interop v0.0.0-20231127165613-b35f351f0ba0/go.mod h1:J/Mk6+nKeKSW4wygkZQFLQ6SkLOSGX5Ga0RuuuktEag=
|
||||
github.com/nspcc-dev/rfc6979 v0.2.0 h1:3e1WNxrN60/6N0DW7+UYisLeZJyfqZTNOjeV/toYvOE=
|
||||
github.com/nspcc-dev/rfc6979 v0.2.0/go.mod h1:exhIh1PdpDC5vQmyEsGvc4YDM/lyQp/452QxGq/UEso=
|
||||
github.com/nxadm/tail v1.4.4 h1:DQuhQpB1tVlglWS2hLQ5OV6B5r8aGxSrPc5Qo6uTN78=
|
||||
github.com/nxadm/tail v1.4.4/go.mod h1:kenIhsEOeOJmVchQTgglprH7qJGnHDVpk1VPCcaMI8A=
|
||||
github.com/onsi/ginkgo v1.6.0/go.mod h1:lLunBs/Ym6LB5Z9jYTR76FiuTmxDTDusOGeTQH+WWjE=
|
||||
github.com/onsi/ginkgo v1.12.1/go.mod h1:zj2OWP4+oCPe1qIXoGWkgMRwljMUYCdkwsT2108oapk=
|
||||
github.com/onsi/ginkgo v1.14.0 h1:2mOpI4JVVPBN+WQRa0WKH2eXR+Ey+uK4n7Zj0aYpIQA=
|
||||
github.com/onsi/ginkgo v1.14.0/go.mod h1:iSB4RoI2tjJc9BBv4NKIKWKya62Rps+oPG/Lv9klQyY=
|
||||
github.com/onsi/gomega v1.7.1/go.mod h1:XdKZgCCFLUoM/7CFJVPcG8C1xQ1AJ0vpAezJrB7JYyY=
|
||||
github.com/onsi/gomega v1.10.1 h1:o0+MgICZLuZ7xjH7Vx6zS/zcu93/BEp1VwkIW1mEXCE=
|
||||
github.com/onsi/gomega v1.10.1/go.mod h1:iN09h71vgCQne3DLsj+A5owkum+a2tYe+TOCB1ybHNo=
|
||||
github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM=
|
||||
github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4=
|
||||
github.com/prometheus/client_golang v1.13.0 h1:b71QUfeo5M8gq2+evJdTPfZhYMAU0uKPkyPJ7TPsloU=
|
||||
github.com/prometheus/client_golang v1.13.0/go.mod h1:vTeo+zgvILHsnnj/39Ou/1fPN5nJFOEMgftOUOmlvYQ=
|
||||
github.com/prometheus/client_model v0.2.0 h1:uq5h0d+GuxiXLJLNABMgp2qUWDPiLvgCzz2dUR+/W/M=
|
||||
github.com/prometheus/client_model v0.2.0/go.mod h1:xMI15A0UPsDsEKsMN9yxemIoYk6Tm2C1GtYGdfGttqA=
|
||||
github.com/prometheus/common v0.37.0 h1:ccBbHCgIiT9uSoFY0vX8H3zsNR5eLt17/RQLUvn8pXE=
|
||||
github.com/prometheus/common v0.37.0/go.mod h1:phzohg0JFMnBEFGxTDbfu3QyL5GI8gTQJFhYO5B3mfA=
|
||||
github.com/prometheus/procfs v0.8.0 h1:ODq8ZFEaYeCaZOJlZZdJA2AbQR98dSHSM1KW/You5mo=
|
||||
github.com/prometheus/procfs v0.8.0/go.mod h1:z7EfXMXOkbkqb9IINtpCn86r/to3BnA0uaxHdg830/4=
|
||||
github.com/russross/blackfriday/v2 v2.0.1 h1:lPqVAte+HuHNfhJ/0LC98ESWRz8afy9tM/0RK8m9o+Q=
|
||||
github.com/russross/blackfriday/v2 v2.0.1/go.mod h1:+Rmxgy9KzJVeS9/2gXHxylqXiyQDYRxCVz55jmeOWTM=
|
||||
github.com/shurcooL/sanitized_anchor_name v1.0.0 h1:PdmoCO6wvbs+7yrJyMORt4/BmY5IYyJwS/kOiWx8mHo=
|
||||
github.com/shurcooL/sanitized_anchor_name v1.0.0/go.mod h1:1NzhyTcUVG4SuEtjjoZeVRXNmyL/1OwPU0+IJeTBvfc=
|
||||
github.com/stretchr/testify v1.8.4 h1:CcVxjf3Q8PM0mHUKJCdn+eZZtm5yQwehR5yeSVQQcUk=
|
||||
github.com/stretchr/testify v1.8.4/go.mod h1:sz/lmYIOXD/1dqDmKjjqLyZ2RngseejIcXlSw2iwfAo=
|
||||
github.com/syndtr/goleveldb v1.0.1-0.20210305035536-64b5b1c73954 h1:xQdMZ1WLrgkkvOZ/LDQxjVxMLdby7osSh4ZEVa5sIjs=
|
||||
github.com/syndtr/goleveldb v1.0.1-0.20210305035536-64b5b1c73954/go.mod h1:u2MKkTVTVJWe5D1rCvame8WqhBd88EuIwODJZ1VHCPM=
|
||||
github.com/twmb/murmur3 v1.1.5 h1:i9OLS9fkuLzBXjt6dptlAEyk58fJsSTXbRg3SgVyqgk=
|
||||
github.com/twmb/murmur3 v1.1.5/go.mod h1:Qq/R7NUyOfr65zD+6Q5IHKsJLwP7exErjN6lyyq3OSQ=
|
||||
github.com/urfave/cli v1.22.5 h1:lNq9sAHXK2qfdI8W+GRItjCEkI+2oR4d+MEHy1CKXoU=
|
||||
github.com/urfave/cli v1.22.5/go.mod h1:Gos4lmkARVdJ6EkW0WaNv/tZAAMe9V7XWyB60NtXRu0=
|
||||
github.com/virtuald/go-ordered-json v0.0.0-20170621173500-b18e6e673d74 h1:JwtAtbp7r/7QSyGz8mKUbYJBg2+6Cd7OjM8o/GNOcVo=
|
||||
github.com/virtuald/go-ordered-json v0.0.0-20170621173500-b18e6e673d74/go.mod h1:RmMWU37GKR2s6pgrIEB4ixgpVCt/cf7dnJv3fuH1J1c=
|
||||
go.etcd.io/bbolt v1.3.8 h1:xs88BrvEv273UsB79e0hcVrlUWmS0a8upikMFhSyAtA=
|
||||
go.etcd.io/bbolt v1.3.8/go.mod h1:N9Mkw9X8x5fupy0IKsmuqVtoGDyxsaDlbk4Rd05IAQw=
|
||||
go.uber.org/goleak v1.2.0 h1:xqgm/S+aQvhWFTtR0XK3Jvg7z8kGV8P4X14IzwN3Eqk=
|
||||
go.uber.org/goleak v1.2.0/go.mod h1:XJYK+MuIchqpmGmUSAzotztawfKvYLUIgg7guXrwVUo=
|
||||
go.uber.org/multierr v1.10.0 h1:S0h4aNzvfcFsC3dRF1jLoaov7oRaKqRGC/pUEJ2yvPQ=
|
||||
go.uber.org/multierr v1.10.0/go.mod h1:20+QtiLqy0Nd6FdQB9TLXag12DsQkrbs3htMFfDN80Y=
|
||||
go.uber.org/zap v1.26.0 h1:sI7k6L95XOKS281NhVKOFCUNIvv9e0w4BF8N3u+tCRo=
|
||||
go.uber.org/zap v1.26.0/go.mod h1:dtElttAiwGvoJ/vj4IwHBS/gXsEu/pZ50mUIRWuG0so=
|
||||
golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACkg1iLfiJU5Ep61QUkGW8qpdssI0+w=
|
||||
golang.org/x/crypto v0.0.0-20200622213623-75b288015ac9/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto=
|
||||
golang.org/x/crypto v0.17.0 h1:r8bRNjWL3GshPW3gkd+RpvzWrZAwPS49OmTGZ/uhM4k=
|
||||
golang.org/x/crypto v0.17.0/go.mod h1:gCAAfMLgwOJRpTjQ2zCCt2OcSfYMTeZVSRtQlPC7Nq4=
|
||||
golang.org/x/exp v0.0.0-20230817173708-d852ddb80c63 h1:m64FZMko/V45gv0bNmrNYoDEq8U5YUhetc9cBWKS1TQ=
|
||||
golang.org/x/exp v0.0.0-20230817173708-d852ddb80c63/go.mod h1:0v4NqG35kSWCMzLaMeX+IQrlSnVE/bqGSyC2cz/9Le8=
|
||||
golang.org/x/mod v0.12.0 h1:rmsUpXtvNzj340zd98LZ4KntptpfRHwpFOHG188oHXc=
|
||||
golang.org/x/mod v0.12.0/go.mod h1:iBbtSCu2XBx23ZKBPSOrRkjjQPZFPuis4dIYUhu/chs=
|
||||
golang.org/x/net v0.0.0-20180906233101-161cd47e91fd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
|
||||
golang.org/x/net v0.0.0-20190404232315-eb5bcb51f2a3/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg=
|
||||
golang.org/x/net v0.0.0-20200520004742-59133d7f0dd7/go.mod h1:qpuaurCH72eLCgpAm/N6yyVIVM9cpaDIP3A8BGJEC5A=
|
||||
golang.org/x/net v0.0.0-20200813134508-3edf25e44fcc/go.mod h1:/O7V0waA8r7cgGh81Ro3o1hOxt32SMVPicZroKQ2sZA=
|
||||
golang.org/x/net v0.17.0 h1:pVaXccu2ozPjCXewfr1S7xza/zcXTity9cCdXQYSjIM=
|
||||
golang.org/x/net v0.17.0/go.mod h1:NxSsAGuq816PNPmqtQdLE42eU2Fs7NoRIZrHJAlaCOE=
|
||||
golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
|
||||
golang.org/x/sync v0.0.0-20210220032951-036812b2e83c/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
|
||||
golang.org/x/sync v0.3.0 h1:ftCYgMx6zT/asHUrPw8BLLscYtGznsLAnjq5RH9P66E=
|
||||
golang.org/x/sync v0.3.0/go.mod h1:FU7BRWz2tNW+3quACPkgCx/L+uEAv1htQ0V83Z9Rj+Y=
|
||||
golang.org/x/sys v0.0.0-20180909124046-d0be0721c37e/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
|
||||
golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
|
||||
golang.org/x/sys v0.0.0-20190412213103-97732733099d/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20190904154756-749cb33beabd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20191005200804-aed5e4c7ecf9/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20191120155948-bd437916bb0e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20200323222414-85ca7c5b95cd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20200519105757-fe76b779f299/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20200814200057-3d37ad5750ed/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.15.0 h1:h48lPFYpsTvQJZF4EKyI4aLHaev3CxivZmv7yZig9pc=
|
||||
golang.org/x/sys v0.15.0/go.mod h1:/VUhepiaJMQUp4+oa/7Zr1D23ma6VTLIYjOOTFZPUcA=
|
||||
golang.org/x/term v0.15.0 h1:y/Oo/a/q3IXu26lQgl04j/gjuBDOBlx7X6Om1j2CPW4=
|
||||
golang.org/x/term v0.15.0/go.mod h1:BDl952bC7+uMoWR75FIrCDx79TPU9oHkTZ9yRbYOrX0=
|
||||
golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ=
|
||||
golang.org/x/text v0.3.2/go.mod h1:bEr9sfX3Q8Zfm5fL9x+3itogRgK3+ptLWKqgva+5dAk=
|
||||
golang.org/x/text v0.3.3/go.mod h1:5Zoc/QRtKVWzQhOtBMvqHzDpF6irO9z98xDceosuGiQ=
|
||||
golang.org/x/text v0.14.0 h1:ScX5w1eTa3QqT8oi6+ziP7dTV1S2+ALU0bI+0zXKWiQ=
|
||||
golang.org/x/text v0.14.0/go.mod h1:18ZOQIKpY8NJVqYksKHtTdi31H5itFRjB5/qKTNYzSU=
|
||||
golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ=
|
||||
golang.org/x/tools v0.12.1-0.20230815132531-74c255bcf846 h1:Vve/L0v7CXXuxUmaMGIEK/dEeq7uiqb5qBgQrZzIE7E=
|
||||
golang.org/x/tools v0.12.1-0.20230815132531-74c255bcf846/go.mod h1:Sc0INKfu04TlqNoRA1hgpFZbhYXHPr4V5DzpSBTPqQM=
|
||||
golang.org/x/xerrors v0.0.0-20191204190536-9bdfabe68543/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0=
|
||||
golang.org/x/xerrors v0.0.0-20200804184101-5ec99f83aff1 h1:go1bK/D/BFZV2I8cIQd1NKEZ+0owSTG1fDTci4IqFcE=
|
||||
golang.org/x/xerrors v0.0.0-20200804184101-5ec99f83aff1/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0=
|
||||
google.golang.org/protobuf v0.0.0-20200109180630-ec00e32a8dfd/go.mod h1:DFci5gLYBciE7Vtevhsrf46CRTquxDuWsQurQQe4oz8=
|
||||
google.golang.org/protobuf v0.0.0-20200221191635-4d8936d0db64/go.mod h1:kwYJMbMJ01Woi6D6+Kah6886xMZcty6N08ah7+eCXa0=
|
||||
google.golang.org/protobuf v0.0.0-20200228230310-ab0ca4ff8a60/go.mod h1:cfTl7dwQJ+fmap5saPgwCLgHXTUD7jkjRqWcaiX5VyM=
|
||||
google.golang.org/protobuf v1.20.1-0.20200309200217-e05f789c0967/go.mod h1:A+miEFZTKqfCUM6K7xSMQL9OKL/b6hQv+e19PK+JZNE=
|
||||
google.golang.org/protobuf v1.21.0/go.mod h1:47Nbq4nVaFHyn7ilMalzfO3qCViNmqZ2kzikPIcrTAo=
|
||||
google.golang.org/protobuf v1.23.0/go.mod h1:EGpADcykh3NcUnDUJcl1+ZksZNG86OlYog2l/sGQquU=
|
||||
google.golang.org/protobuf v1.31.0 h1:g0LDEJHgrBl9N9r17Ru3sqWhkIx2NB67okBHPwC7hs8=
|
||||
google.golang.org/protobuf v1.31.0/go.mod h1:HV8QOd/L58Z+nl8r43ehVNZIU/HEI6OcFqwMG9pJV4I=
|
||||
github.com/stretchr/objx v0.1.0/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME=
|
||||
github.com/stretchr/objx v0.4.0/go.mod h1:YvHI0jy2hoMjB+UWwv71VJQ9isScKT/TqJzVSSt89Yw=
|
||||
github.com/stretchr/objx v0.5.0/go.mod h1:Yh+to48EsGEfYuaHDzXPcE3xhTkx73EhmCGUpEOglKo=
|
||||
github.com/stretchr/testify v1.7.1/go.mod h1:6Fq8oRcR53rry900zMqJjRRixrwX3KX962/h/Wwjteg=
|
||||
github.com/stretchr/testify v1.8.0/go.mod h1:yNjHg4UonilssWZ8iaSj1OCr/vHnekPRkoO+kdMU+MU=
|
||||
github.com/stretchr/testify v1.8.1 h1:w7B6lhMri9wdJUVmEZPGGhZzrYTPvgJArz7wNPgYKsk=
|
||||
github.com/stretchr/testify v1.8.1/go.mod h1:w2LPCIKwWwSfY2zedu0+kehJoqGctiVI29o6fzry7u4=
|
||||
gopkg.in/check.v1 v0.0.0-20161208181325-20d25e280405 h1:yhCVgyC4o1eVCa2tZl7eS0r+SDo693bJlVdllGtEeKM=
|
||||
gopkg.in/check.v1 v0.0.0-20161208181325-20d25e280405/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0=
|
||||
gopkg.in/fsnotify.v1 v1.4.7/go.mod h1:Tz8NjZHkW78fSQdbUxIjBTcgA1z1m8ZHf0WmKUhAMys=
|
||||
gopkg.in/tomb.v1 v1.0.0-20141024135613-dd632973f1e7 h1:uRGJdciOHaEIrze2W8Q3AKkepLTh2hOroT7a+7czfdQ=
|
||||
gopkg.in/tomb.v1 v1.0.0-20141024135613-dd632973f1e7/go.mod h1:dt/ZhP58zS4L8KSrWDmTeBkI65Dw0HsyUHuEVlX15mw=
|
||||
gopkg.in/yaml.v2 v2.2.4/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
|
||||
gopkg.in/yaml.v2 v2.3.0 h1:clyUAQHOM3G0M3f5vQj7LuJrETvjVot3Z5el9nffUtU=
|
||||
gopkg.in/yaml.v2 v2.3.0/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
|
||||
gopkg.in/yaml.v3 v3.0.0-20200313102051-9f266ea9e77c/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM=
|
||||
gopkg.in/yaml.v3 v3.0.1 h1:fxVm/GzAzEWqLHuvctI91KS9hhNmmWOoWu0XTYJS7CA=
|
||||
gopkg.in/yaml.v3 v3.0.1/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM=
|
||||
rsc.io/tmplfunc v0.0.3 h1:53XFQh69AfOa8Tw0Jm7t+GV7KZhOi6jzsCzTtKbMvzU=
|
||||
rsc.io/tmplfunc v0.0.3/go.mod h1:AG3sTPzElb1Io3Yg4voV9AGZJuleGAwaVRxL9M49PhA=
|
||||
|
|
|
|||
425
iam/converter.go
425
iam/converter.go
|
|
@ -1,425 +0,0 @@
|
|||
package iam
|
||||
|
||||
import (
|
||||
"errors"
|
||||
"fmt"
|
||||
"net/netip"
|
||||
"strconv"
|
||||
"strings"
|
||||
"time"
|
||||
"unicode/utf8"
|
||||
|
||||
"git.frostfs.info/TrueCloudLab/policy-engine/pkg/chain"
|
||||
"git.frostfs.info/TrueCloudLab/policy-engine/schema/common"
|
||||
"github.com/nspcc-dev/neo-go/pkg/encoding/fixedn"
|
||||
)
|
||||
|
||||
const (
|
||||
s3ActionAbortMultipartUpload = "s3:AbortMultipartUpload"
|
||||
s3ActionCreateBucket = "s3:CreateBucket"
|
||||
s3ActionDeleteBucket = "s3:DeleteBucket"
|
||||
s3ActionDeleteBucketPolicy = "s3:DeleteBucketPolicy"
|
||||
s3ActionDeleteObject = "s3:DeleteObject"
|
||||
s3ActionDeleteObjectTagging = "s3:DeleteObjectTagging"
|
||||
s3ActionDeleteObjectVersion = "s3:DeleteObjectVersion"
|
||||
s3ActionDeleteObjectVersionTagging = "s3:DeleteObjectVersionTagging"
|
||||
s3ActionGetBucketACL = "s3:GetBucketAcl"
|
||||
s3ActionGetBucketCORS = "s3:GetBucketCORS"
|
||||
s3ActionGetBucketLocation = "s3:GetBucketLocation"
|
||||
s3ActionGetBucketNotification = "s3:GetBucketNotification"
|
||||
s3ActionGetBucketObjectLockConfiguration = "s3:GetBucketObjectLockConfiguration"
|
||||
s3ActionGetBucketPolicy = "s3:GetBucketPolicy"
|
||||
s3ActionGetBucketPolicyStatus = "s3:GetBucketPolicyStatus"
|
||||
s3ActionGetBucketTagging = "s3:GetBucketTagging"
|
||||
s3ActionGetBucketVersioning = "s3:GetBucketVersioning"
|
||||
s3ActionGetLifecycleConfiguration = "s3:GetLifecycleConfiguration"
|
||||
s3ActionGetObject = "s3:GetObject"
|
||||
s3ActionGetObjectACL = "s3:GetObjectAcl"
|
||||
s3ActionGetObjectAttributes = "s3:GetObjectAttributes"
|
||||
s3ActionGetObjectLegalHold = "s3:GetObjectLegalHold"
|
||||
s3ActionGetObjectRetention = "s3:GetObjectRetention"
|
||||
s3ActionGetObjectTagging = "s3:GetObjectTagging"
|
||||
s3ActionGetObjectVersion = "s3:GetObjectVersion"
|
||||
s3ActionGetObjectVersionACL = "s3:GetObjectVersionAcl"
|
||||
s3ActionGetObjectVersionAttributes = "s3:GetObjectVersionAttributes"
|
||||
s3ActionGetObjectVersionTagging = "s3:GetObjectVersionTagging"
|
||||
s3ActionListAllMyBuckets = "s3:ListAllMyBuckets"
|
||||
s3ActionListBucket = "s3:ListBucket"
|
||||
s3ActionListBucketMultipartUploads = "s3:ListBucketMultipartUploads"
|
||||
s3ActionListBucketVersions = "s3:ListBucketVersions"
|
||||
s3ActionListMultipartUploadParts = "s3:ListMultipartUploadParts"
|
||||
s3ActionPutBucketACL = "s3:PutBucketAcl"
|
||||
s3ActionPutBucketCORS = "s3:PutBucketCORS"
|
||||
s3ActionPutBucketNotification = "s3:PutBucketNotification"
|
||||
s3ActionPutBucketObjectLockConfiguration = "s3:PutBucketObjectLockConfiguration"
|
||||
s3ActionPutBucketPolicy = "s3:PutBucketPolicy"
|
||||
s3ActionPutBucketTagging = "s3:PutBucketTagging"
|
||||
s3ActionPutBucketVersioning = "s3:PutBucketVersioning"
|
||||
s3ActionPutLifecycleConfiguration = "s3:PutLifecycleConfiguration"
|
||||
s3ActionPutObject = "s3:PutObject"
|
||||
s3ActionPutObjectACL = "s3:PutObjectAcl"
|
||||
s3ActionPutObjectLegalHold = "s3:PutObjectLegalHold"
|
||||
s3ActionPutObjectRetention = "s3:PutObjectRetention"
|
||||
s3ActionPutObjectTagging = "s3:PutObjectTagging"
|
||||
s3ActionPutObjectVersionACL = "s3:PutObjectVersionAcl"
|
||||
s3ActionPutObjectVersionTagging = "s3:PutObjectVersionTagging"
|
||||
s3ActionPatchObject = "s3:PatchObject"
|
||||
)
|
||||
|
||||
const (
|
||||
condKeyAWSPrincipalARN = "aws:PrincipalArn"
|
||||
condKeyAWSSourceIP = "aws:SourceIp"
|
||||
condKeyAWSPrincipalTagPrefix = "aws:PrincipalTag/"
|
||||
condKeyAWSRequestTagPrefix = "aws:RequestTag/"
|
||||
condKeyAWSResourceTagPrefix = "aws:ResourceTag/"
|
||||
userClaimTagPrefix = "tag-"
|
||||
)
|
||||
|
||||
const (
|
||||
// String condition operators.
|
||||
CondStringEquals string = "StringEquals"
|
||||
CondStringNotEquals string = "StringNotEquals"
|
||||
CondStringEqualsIgnoreCase string = "StringEqualsIgnoreCase"
|
||||
CondStringNotEqualsIgnoreCase string = "StringNotEqualsIgnoreCase"
|
||||
CondStringLike string = "StringLike"
|
||||
CondStringNotLike string = "StringNotLike"
|
||||
|
||||
// Numeric condition operators.
|
||||
CondNumericEquals string = "NumericEquals"
|
||||
CondNumericNotEquals string = "NumericNotEquals"
|
||||
CondNumericLessThan string = "NumericLessThan"
|
||||
CondNumericLessThanEquals string = "NumericLessThanEquals"
|
||||
CondNumericGreaterThan string = "NumericGreaterThan"
|
||||
CondNumericGreaterThanEquals string = "NumericGreaterThanEquals"
|
||||
|
||||
// Date condition operators.
|
||||
CondDateEquals string = "DateEquals"
|
||||
CondDateNotEquals string = "DateNotEquals"
|
||||
CondDateLessThan string = "DateLessThan"
|
||||
CondDateLessThanEquals string = "DateLessThanEquals"
|
||||
CondDateGreaterThan string = "DateGreaterThan"
|
||||
CondDateGreaterThanEquals string = "DateGreaterThanEquals"
|
||||
|
||||
// Bolean condition operators.
|
||||
CondBool string = "Bool"
|
||||
|
||||
// IP address condition operators.
|
||||
CondIPAddress string = "IpAddress"
|
||||
CondNotIPAddress string = "NotIpAddress"
|
||||
|
||||
// ARN condition operators.
|
||||
CondArnEquals string = "ArnEquals"
|
||||
CondArnLike string = "ArnLike"
|
||||
CondArnNotEquals string = "ArnNotEquals"
|
||||
CondArnNotLike string = "ArnNotLike"
|
||||
|
||||
// Custom condition operators.
|
||||
CondSliceContains string = "SliceContains"
|
||||
)
|
||||
|
||||
const (
|
||||
arnIAMPrefix = "arn:aws:iam::"
|
||||
s3ResourcePrefix = "arn:aws:s3:::"
|
||||
s3ActionPrefix = "s3:"
|
||||
iamActionPrefix = "iam:"
|
||||
)
|
||||
|
||||
var (
|
||||
// ErrInvalidPrincipalFormat occurs when principal has unknown/unsupported format.
|
||||
ErrInvalidPrincipalFormat = errors.New("invalid principal format")
|
||||
|
||||
// ErrInvalidResourceFormat occurs when resource has unknown/unsupported format.
|
||||
ErrInvalidResourceFormat = errors.New("invalid resource format")
|
||||
|
||||
// ErrInvalidActionFormat occurs when action has unknown/unsupported format.
|
||||
ErrInvalidActionFormat = errors.New("invalid action format")
|
||||
|
||||
// ErrActionsNotApplicable occurs when failed to convert any actions.
|
||||
ErrActionsNotApplicable = errors.New("actions not applicable")
|
||||
)
|
||||
|
||||
type formPrincipalConditionFunc func(string) chain.Condition
|
||||
|
||||
type transformConditionFunc func(gr GroupedConditions) (GroupedConditions, error)
|
||||
|
||||
func convertToChainConditions(c Conditions, transformer transformConditionFunc) ([]GroupedConditions, error) {
|
||||
conditions, err := convertToChainCondition(c)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
for i := range conditions {
|
||||
if conditions[i], err = transformer(conditions[i]); err != nil {
|
||||
return nil, fmt.Errorf("transform condition: %w", err)
|
||||
}
|
||||
}
|
||||
|
||||
return conditions, nil
|
||||
}
|
||||
|
||||
type GroupedConditions struct {
|
||||
Conditions []chain.Condition
|
||||
Any bool
|
||||
}
|
||||
|
||||
func convertToChainCondition(c Conditions) ([]GroupedConditions, error) {
|
||||
var grouped []GroupedConditions
|
||||
|
||||
for op, KVs := range c {
|
||||
condType, convertValue, err := getConditionTypeAndConverter(op)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
for key, values := range KVs {
|
||||
group := GroupedConditions{
|
||||
Conditions: make([]chain.Condition, len(values)),
|
||||
Any: len(values) > 1,
|
||||
}
|
||||
|
||||
for i, val := range values {
|
||||
converted, err := convertValue(val)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
group.Conditions[i] = chain.Condition{
|
||||
Op: condType,
|
||||
Kind: chain.KindRequest,
|
||||
Key: transformKey(key),
|
||||
Value: converted,
|
||||
}
|
||||
}
|
||||
grouped = append(grouped, group)
|
||||
}
|
||||
}
|
||||
|
||||
return grouped, nil
|
||||
}
|
||||
|
||||
func transformKey(key string) string {
|
||||
tagName, isTag := strings.CutPrefix(key, condKeyAWSPrincipalTagPrefix)
|
||||
if isTag {
|
||||
return fmt.Sprintf(common.PropertyKeyFormatFrostFSIDUserClaim, userClaimTagPrefix+tagName)
|
||||
}
|
||||
|
||||
switch key {
|
||||
case condKeyAWSSourceIP:
|
||||
return common.PropertyKeyFrostFSSourceIP
|
||||
}
|
||||
|
||||
return key
|
||||
}
|
||||
|
||||
func getConditionTypeAndConverter(op string) (chain.ConditionType, convertFunction, error) {
|
||||
switch {
|
||||
case strings.HasPrefix(op, "String"):
|
||||
switch op {
|
||||
case CondStringEquals:
|
||||
return chain.CondStringEquals, noConvertFunction, nil
|
||||
case CondStringNotEquals:
|
||||
return chain.CondStringNotEquals, noConvertFunction, nil
|
||||
case CondStringEqualsIgnoreCase:
|
||||
return chain.CondStringEqualsIgnoreCase, noConvertFunction, nil
|
||||
case CondStringNotEqualsIgnoreCase:
|
||||
return chain.CondStringNotEqualsIgnoreCase, noConvertFunction, nil
|
||||
case CondStringLike:
|
||||
return chain.CondStringLike, noConvertFunction, nil
|
||||
case CondStringNotLike:
|
||||
return chain.CondStringNotLike, noConvertFunction, nil
|
||||
default:
|
||||
return 0, nil, fmt.Errorf("unsupported condition operator: '%s'", op)
|
||||
}
|
||||
case strings.HasPrefix(op, "Arn"):
|
||||
switch op {
|
||||
case CondArnEquals:
|
||||
return chain.CondStringEquals, noConvertFunction, nil
|
||||
case CondArnNotEquals:
|
||||
return chain.CondStringNotEquals, noConvertFunction, nil
|
||||
case CondArnLike:
|
||||
return chain.CondStringLike, noConvertFunction, nil
|
||||
case CondArnNotLike:
|
||||
return chain.CondStringNotLike, noConvertFunction, nil
|
||||
default:
|
||||
return 0, nil, fmt.Errorf("unsupported condition operator: '%s'", op)
|
||||
}
|
||||
case strings.HasPrefix(op, "Numeric"):
|
||||
return numericConditionTypeAndConverter(op)
|
||||
case strings.HasPrefix(op, "Date"):
|
||||
switch op {
|
||||
case CondDateEquals:
|
||||
return chain.CondStringEquals, dateConvertFunction, nil
|
||||
case CondDateNotEquals:
|
||||
return chain.CondStringNotEquals, dateConvertFunction, nil
|
||||
case CondDateLessThan:
|
||||
return chain.CondStringLessThan, dateConvertFunction, nil
|
||||
case CondDateLessThanEquals:
|
||||
return chain.CondStringLessThanEquals, dateConvertFunction, nil
|
||||
case CondDateGreaterThan:
|
||||
return chain.CondStringGreaterThan, dateConvertFunction, nil
|
||||
case CondDateGreaterThanEquals:
|
||||
return chain.CondStringGreaterThanEquals, dateConvertFunction, nil
|
||||
default:
|
||||
return 0, nil, fmt.Errorf("unsupported condition operator: '%s'", op)
|
||||
}
|
||||
case op == CondBool:
|
||||
return chain.CondStringEqualsIgnoreCase, noConvertFunction, nil
|
||||
case op == CondIPAddress:
|
||||
return chain.CondIPAddress, ipConvertFunction, nil
|
||||
case op == CondNotIPAddress:
|
||||
return chain.CondNotIPAddress, ipConvertFunction, nil
|
||||
case op == CondSliceContains:
|
||||
return chain.CondSliceContains, noConvertFunction, nil
|
||||
default:
|
||||
return 0, nil, fmt.Errorf("unsupported condition operator: '%s'", op)
|
||||
}
|
||||
}
|
||||
|
||||
func numericConditionTypeAndConverter(op string) (chain.ConditionType, convertFunction, error) {
|
||||
switch op {
|
||||
case CondNumericEquals:
|
||||
return chain.CondNumericEquals, numericConvertFunction, nil
|
||||
case CondNumericNotEquals:
|
||||
return chain.CondNumericNotEquals, numericConvertFunction, nil
|
||||
case CondNumericLessThan:
|
||||
return chain.CondNumericLessThan, numericConvertFunction, nil
|
||||
case CondNumericLessThanEquals:
|
||||
return chain.CondNumericLessThanEquals, numericConvertFunction, nil
|
||||
case CondNumericGreaterThan:
|
||||
return chain.CondNumericGreaterThan, numericConvertFunction, nil
|
||||
case CondNumericGreaterThanEquals:
|
||||
return chain.CondNumericGreaterThanEquals, numericConvertFunction, nil
|
||||
default:
|
||||
return 0, nil, fmt.Errorf("unsupported condition operator: '%s'", op)
|
||||
}
|
||||
}
|
||||
|
||||
type convertFunction func(string) (string, error)
|
||||
|
||||
func noConvertFunction(val string) (string, error) {
|
||||
return val, nil
|
||||
}
|
||||
|
||||
func numericConvertFunction(val string) (string, error) {
|
||||
if _, err := fixedn.Fixed8FromString(val); err == nil {
|
||||
return val, nil
|
||||
}
|
||||
|
||||
return "", fmt.Errorf("invalid numeric value: '%s'", val)
|
||||
}
|
||||
|
||||
func ipConvertFunction(val string) (string, error) {
|
||||
if _, err := netip.ParsePrefix(val); err != nil {
|
||||
if _, err = netip.ParseAddr(val); err != nil {
|
||||
return "", err
|
||||
}
|
||||
val += "/32"
|
||||
}
|
||||
|
||||
return val, nil
|
||||
}
|
||||
|
||||
func dateConvertFunction(val string) (string, error) {
|
||||
if _, err := strconv.ParseInt(val, 10, 64); err == nil {
|
||||
return val, nil
|
||||
}
|
||||
|
||||
parsed, err := time.Parse(time.RFC3339, val)
|
||||
if err != nil {
|
||||
return "", err
|
||||
}
|
||||
|
||||
return strconv.FormatInt(parsed.UTC().Unix(), 10), nil
|
||||
}
|
||||
|
||||
func parsePrincipalAsIAMUser(principal string) (account string, user string, err error) {
|
||||
if !strings.HasPrefix(principal, arnIAMPrefix) {
|
||||
return "", "", ErrInvalidPrincipalFormat
|
||||
}
|
||||
|
||||
// iam arn format arn:aws:iam::<account>:user/<user-name-with-path>
|
||||
iamResource := strings.TrimPrefix(principal, arnIAMPrefix)
|
||||
sepIndex := strings.Index(iamResource, ":user/")
|
||||
if sepIndex < 0 {
|
||||
return "", "", ErrInvalidPrincipalFormat
|
||||
}
|
||||
|
||||
account = iamResource[:sepIndex]
|
||||
user = iamResource[sepIndex+6:]
|
||||
if len(user) == 0 {
|
||||
return "", "", ErrInvalidPrincipalFormat
|
||||
}
|
||||
|
||||
userNameIndex := strings.LastIndexByte(user, '/')
|
||||
if userNameIndex > -1 {
|
||||
user = user[userNameIndex+1:]
|
||||
if len(user) == 0 {
|
||||
return "", "", ErrInvalidPrincipalFormat
|
||||
}
|
||||
}
|
||||
|
||||
return account, user, nil
|
||||
}
|
||||
|
||||
func validateResource(resource string) error {
|
||||
if resource == Wildcard {
|
||||
return nil
|
||||
}
|
||||
|
||||
if !strings.HasPrefix(resource, s3ResourcePrefix) && !strings.HasPrefix(resource, arnIAMPrefix) {
|
||||
return ErrInvalidResourceFormat
|
||||
}
|
||||
|
||||
index := strings.IndexByte(resource, Wildcard[0])
|
||||
if index != -1 && index != utf8.RuneCountInString(resource)-1 {
|
||||
return ErrInvalidResourceFormat
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func validateAction(action string) (bool, error) {
|
||||
isIAM := strings.HasPrefix(action, iamActionPrefix)
|
||||
if !strings.HasPrefix(action, s3ActionPrefix) && !isIAM {
|
||||
return false, ErrInvalidActionFormat
|
||||
}
|
||||
|
||||
index := strings.IndexByte(action, Wildcard[0])
|
||||
if index != -1 && index != utf8.RuneCountInString(action)-1 {
|
||||
return false, ErrInvalidActionFormat
|
||||
}
|
||||
|
||||
return isIAM, nil
|
||||
}
|
||||
|
||||
func splitGroupedConditions(groupedConditions []GroupedConditions) [][]chain.Condition {
|
||||
var orConditions []chain.Condition
|
||||
commonConditions := make([]chain.Condition, 0, len(groupedConditions))
|
||||
for _, grouped := range groupedConditions {
|
||||
if grouped.Any {
|
||||
orConditions = append(orConditions, grouped.Conditions...)
|
||||
} else {
|
||||
commonConditions = append(commonConditions, grouped.Conditions...)
|
||||
}
|
||||
}
|
||||
|
||||
if len(orConditions) == 0 {
|
||||
return [][]chain.Condition{commonConditions}
|
||||
}
|
||||
|
||||
res := make([][]chain.Condition, len(orConditions))
|
||||
for i, condition := range orConditions {
|
||||
res[i] = append([]chain.Condition{condition}, commonConditions...)
|
||||
}
|
||||
|
||||
return res
|
||||
}
|
||||
|
||||
func formStatus(statement Statement) chain.Status {
|
||||
status := chain.AccessDenied
|
||||
if statement.Effect == AllowEffect {
|
||||
status = chain.Allow
|
||||
}
|
||||
|
||||
return status
|
||||
}
|
||||
|
|
@ -1,427 +0,0 @@
|
|||
package iam
|
||||
|
||||
import (
|
||||
"errors"
|
||||
"fmt"
|
||||
"strings"
|
||||
|
||||
"git.frostfs.info/TrueCloudLab/policy-engine/pkg/chain"
|
||||
"git.frostfs.info/TrueCloudLab/policy-engine/schema/native"
|
||||
)
|
||||
|
||||
const PropertyKeyFilePath = "FilePath"
|
||||
|
||||
var actionToNativeOpMap = map[string][]string{
|
||||
s3ActionAbortMultipartUpload: {native.MethodGetContainer, native.MethodDeleteObject, native.MethodHeadObject, native.MethodGetObject, native.MethodPutObject},
|
||||
s3ActionCreateBucket: {native.MethodGetContainer, native.MethodPutContainer, native.MethodSetContainerEACL, native.MethodGetObject, native.MethodPutObject},
|
||||
s3ActionDeleteBucket: {native.MethodGetContainer, native.MethodDeleteContainer, native.MethodSearchObject, native.MethodHeadObject, native.MethodGetObject},
|
||||
s3ActionDeleteBucketPolicy: {native.MethodGetContainer},
|
||||
s3ActionDeleteObject: {native.MethodGetContainer, native.MethodDeleteObject, native.MethodPutObject, native.MethodHeadObject, native.MethodGetObject, native.MethodRangeObject},
|
||||
s3ActionDeleteObjectTagging: {native.MethodGetContainer, native.MethodHeadObject, native.MethodGetObject, native.MethodPutObject},
|
||||
s3ActionDeleteObjectVersion: {native.MethodGetContainer, native.MethodDeleteObject, native.MethodPutObject, native.MethodHeadObject, native.MethodGetObject, native.MethodRangeObject},
|
||||
s3ActionDeleteObjectVersionTagging: {native.MethodGetContainer, native.MethodHeadObject, native.MethodGetObject, native.MethodPutObject},
|
||||
s3ActionGetBucketACL: {native.MethodGetContainer, native.MethodGetContainerEACL, native.MethodGetObject},
|
||||
s3ActionGetBucketCORS: {native.MethodGetContainer, native.MethodGetObject, native.MethodHeadObject},
|
||||
s3ActionGetBucketLocation: {native.MethodGetContainer},
|
||||
s3ActionGetBucketNotification: {native.MethodGetContainer, native.MethodGetObject, native.MethodHeadObject},
|
||||
s3ActionGetBucketObjectLockConfiguration: {native.MethodGetContainer, native.MethodGetObject},
|
||||
s3ActionGetBucketPolicy: {native.MethodGetContainer},
|
||||
s3ActionGetBucketPolicyStatus: {native.MethodGetContainer},
|
||||
s3ActionGetBucketTagging: {native.MethodGetContainer, native.MethodGetObject},
|
||||
s3ActionGetBucketVersioning: {native.MethodGetContainer, native.MethodGetObject},
|
||||
s3ActionGetLifecycleConfiguration: {native.MethodGetContainer, native.MethodGetObject, native.MethodHeadObject},
|
||||
s3ActionGetObject: {native.MethodGetContainer, native.MethodGetObject, native.MethodHeadObject, native.MethodSearchObject, native.MethodRangeObject, native.MethodHashObject},
|
||||
s3ActionGetObjectACL: {native.MethodGetContainer, native.MethodGetContainerEACL, native.MethodGetObject, native.MethodHeadObject},
|
||||
s3ActionGetObjectAttributes: {native.MethodGetContainer, native.MethodGetObject, native.MethodHeadObject},
|
||||
s3ActionGetObjectLegalHold: {native.MethodGetContainer, native.MethodHeadObject, native.MethodGetObject},
|
||||
s3ActionGetObjectRetention: {native.MethodGetContainer, native.MethodHeadObject, native.MethodGetObject},
|
||||
s3ActionGetObjectTagging: {native.MethodGetContainer, native.MethodHeadObject, native.MethodGetObject},
|
||||
s3ActionGetObjectVersion: {native.MethodGetContainer, native.MethodGetObject, native.MethodHeadObject, native.MethodSearchObject, native.MethodRangeObject, native.MethodHashObject},
|
||||
s3ActionGetObjectVersionACL: {native.MethodGetContainer, native.MethodGetContainerEACL, native.MethodGetObject, native.MethodHeadObject},
|
||||
s3ActionGetObjectVersionAttributes: {native.MethodGetContainer, native.MethodGetObject, native.MethodHeadObject},
|
||||
s3ActionGetObjectVersionTagging: {native.MethodGetContainer, native.MethodHeadObject, native.MethodGetObject},
|
||||
s3ActionListAllMyBuckets: {native.MethodListContainers, native.MethodGetContainer},
|
||||
s3ActionListBucket: {native.MethodGetContainer, native.MethodGetObject, native.MethodHeadObject, native.MethodSearchObject, native.MethodRangeObject, native.MethodHashObject},
|
||||
s3ActionListBucketMultipartUploads: {native.MethodGetContainer, native.MethodGetObject},
|
||||
s3ActionListBucketVersions: {native.MethodGetContainer, native.MethodGetObject, native.MethodHeadObject, native.MethodSearchObject, native.MethodRangeObject, native.MethodHashObject},
|
||||
s3ActionListMultipartUploadParts: {native.MethodGetContainer, native.MethodGetObject},
|
||||
s3ActionPutBucketACL: {native.MethodGetContainer, native.MethodSetContainerEACL, native.MethodGetObject, native.MethodPutObject},
|
||||
s3ActionPutBucketCORS: {native.MethodGetContainer, native.MethodGetObject, native.MethodPutObject},
|
||||
s3ActionPutBucketNotification: {native.MethodGetContainer, native.MethodHeadObject, native.MethodDeleteObject, native.MethodGetObject, native.MethodPutObject},
|
||||
s3ActionPutBucketObjectLockConfiguration: {native.MethodGetContainer, native.MethodGetObject, native.MethodPutObject},
|
||||
s3ActionPutBucketPolicy: {native.MethodGetContainer},
|
||||
s3ActionPutBucketTagging: {native.MethodGetContainer, native.MethodGetObject, native.MethodPutObject},
|
||||
s3ActionPutBucketVersioning: {native.MethodGetContainer, native.MethodGetObject, native.MethodPutObject},
|
||||
s3ActionPutLifecycleConfiguration: {native.MethodGetContainer, native.MethodGetObject, native.MethodHeadObject, native.MethodPutObject, native.MethodDeleteObject},
|
||||
s3ActionPutObject: {native.MethodGetContainer, native.MethodPutObject, native.MethodGetObject, native.MethodHeadObject, native.MethodRangeObject},
|
||||
s3ActionPutObjectACL: {native.MethodGetContainer, native.MethodGetContainerEACL, native.MethodSetContainerEACL, native.MethodGetObject, native.MethodHeadObject},
|
||||
s3ActionPutObjectLegalHold: {native.MethodGetContainer, native.MethodHeadObject, native.MethodGetObject, native.MethodPutObject},
|
||||
s3ActionPutObjectRetention: {native.MethodGetContainer, native.MethodHeadObject, native.MethodGetObject, native.MethodPutObject},
|
||||
s3ActionPutObjectTagging: {native.MethodGetContainer, native.MethodHeadObject, native.MethodGetObject, native.MethodPutObject},
|
||||
s3ActionPutObjectVersionACL: {native.MethodGetContainer, native.MethodGetContainerEACL, native.MethodSetContainerEACL, native.MethodGetObject, native.MethodHeadObject},
|
||||
s3ActionPutObjectVersionTagging: {native.MethodGetContainer, native.MethodHeadObject, native.MethodGetObject, native.MethodPutObject},
|
||||
s3ActionPatchObject: {native.MethodGetContainer, native.MethodGetObject, native.MethodHeadObject, native.MethodPatchObject, native.MethodPutObject, native.MethodRangeObject},
|
||||
}
|
||||
|
||||
var containerNativeOperations = map[string]struct{}{
|
||||
native.MethodPutContainer: {},
|
||||
native.MethodDeleteContainer: {},
|
||||
native.MethodGetContainer: {},
|
||||
native.MethodListContainers: {},
|
||||
native.MethodSetContainerEACL: {},
|
||||
native.MethodGetContainerEACL: {},
|
||||
}
|
||||
|
||||
var objectNativeOperations = map[string]struct{}{
|
||||
native.MethodGetObject: {},
|
||||
native.MethodPutObject: {},
|
||||
native.MethodHeadObject: {},
|
||||
native.MethodDeleteObject: {},
|
||||
native.MethodSearchObject: {},
|
||||
native.MethodRangeObject: {},
|
||||
native.MethodHashObject: {},
|
||||
}
|
||||
|
||||
var errConditionKeyNotApplicable = errors.New("condition key is not applicable")
|
||||
|
||||
type NativeResolver interface {
|
||||
GetUserKey(account, name string) (string, error)
|
||||
GetBucketInfo(bucket string) (*BucketInfo, error)
|
||||
}
|
||||
|
||||
type BucketInfo struct {
|
||||
Namespace string
|
||||
Container string
|
||||
}
|
||||
|
||||
func ConvertToNativeChain(p Policy, resolver NativeResolver) (*chain.Chain, error) {
|
||||
if err := p.Validate(ResourceBasedPolicyType); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
var engineChain chain.Chain
|
||||
|
||||
for _, statement := range p.Statement {
|
||||
status := formStatus(statement)
|
||||
if status != chain.Allow {
|
||||
// Most s3 methods share the same native operations. Deny rules must not affect shared native operations,
|
||||
// therefore this code skips all deny rules for native protocol. Deny is applied for s3 protocol only, in this case.
|
||||
continue
|
||||
}
|
||||
|
||||
action, actionInverted := statement.action()
|
||||
nativeActions, err := formNativeActionNames(action)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
ruleAction := chain.Actions{Inverted: actionInverted, Names: nativeActions}
|
||||
if len(ruleAction.Names) == 0 {
|
||||
continue
|
||||
}
|
||||
|
||||
resource, resourceInverted := statement.resource()
|
||||
groupedResources, err := formNativeResourceNamesAndConditions(resource, resolver, getActionTypes(nativeActions))
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
groupedConditions, err := convertToNativeChainCondition(statement.Conditions, resolver)
|
||||
if err != nil {
|
||||
if errors.Is(err, errConditionKeyNotApplicable) {
|
||||
continue
|
||||
}
|
||||
return nil, err
|
||||
}
|
||||
splitConditions := splitGroupedConditions(groupedConditions)
|
||||
|
||||
principals, principalCondFn, err := getNativePrincipalsAndConditionFunc(statement, resolver)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
for _, groupedResource := range groupedResources {
|
||||
for _, principal := range principals {
|
||||
for _, conditions := range splitConditions {
|
||||
var principalCondition []chain.Condition
|
||||
if principal != Wildcard {
|
||||
principalCondition = []chain.Condition{principalCondFn(principal)}
|
||||
}
|
||||
|
||||
ruleConditions := append(principalCondition, groupedResource.Conditions...)
|
||||
|
||||
r := chain.Rule{
|
||||
Status: status,
|
||||
Actions: ruleAction,
|
||||
Resources: chain.Resources{
|
||||
Inverted: resourceInverted,
|
||||
Names: groupedResource.Names,
|
||||
},
|
||||
Condition: append(ruleConditions, conditions...),
|
||||
}
|
||||
engineChain.Rules = append(engineChain.Rules, r)
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
if len(engineChain.Rules) == 0 {
|
||||
return nil, ErrActionsNotApplicable
|
||||
}
|
||||
|
||||
return &engineChain, nil
|
||||
}
|
||||
|
||||
func getActionTypes(nativeActions []string) ActionTypes {
|
||||
var res ActionTypes
|
||||
for _, action := range nativeActions {
|
||||
if res.Object && res.Container {
|
||||
break
|
||||
}
|
||||
|
||||
_, isObj := objectNativeOperations[action]
|
||||
_, isCnr := containerNativeOperations[action]
|
||||
|
||||
res.Object = res.Object || isObj || action == Wildcard
|
||||
res.Container = res.Container || isCnr || action == Wildcard
|
||||
}
|
||||
|
||||
return res
|
||||
}
|
||||
|
||||
func getNativePrincipalsAndConditionFunc(statement Statement, resolver NativeResolver) ([]string, formPrincipalConditionFunc, error) {
|
||||
var principals []string
|
||||
var op chain.ConditionType
|
||||
statementPrincipal, inverted := statement.principal()
|
||||
if _, ok := statementPrincipal[Wildcard]; ok { // this can be true only if 'inverted' false
|
||||
principals = []string{Wildcard}
|
||||
op = chain.CondStringLike
|
||||
} else {
|
||||
for principalType, principal := range statementPrincipal {
|
||||
if principalType != AWSPrincipalType {
|
||||
return nil, nil, fmt.Errorf("unsupported principal type '%s'", principalType)
|
||||
}
|
||||
parsedPrincipal, err := formNativePrincipal(principal, resolver)
|
||||
if err != nil {
|
||||
return nil, nil, fmt.Errorf("parse principal: %w", err)
|
||||
}
|
||||
principals = append(principals, parsedPrincipal...)
|
||||
}
|
||||
|
||||
op = chain.CondStringEquals
|
||||
if inverted {
|
||||
op = chain.CondStringNotEquals
|
||||
}
|
||||
}
|
||||
|
||||
return principals, func(principal string) chain.Condition {
|
||||
return chain.Condition{
|
||||
Op: op,
|
||||
Kind: chain.KindRequest,
|
||||
Key: native.PropertyKeyActorPublicKey,
|
||||
Value: principal,
|
||||
}
|
||||
}, nil
|
||||
}
|
||||
|
||||
func convertToNativeChainCondition(c Conditions, resolver NativeResolver) ([]GroupedConditions, error) {
|
||||
return convertToChainConditions(c, func(gr GroupedConditions) (GroupedConditions, error) {
|
||||
res := GroupedConditions{
|
||||
Conditions: make([]chain.Condition, 0, len(gr.Conditions)),
|
||||
Any: gr.Any,
|
||||
}
|
||||
|
||||
for i := range gr.Conditions {
|
||||
switch {
|
||||
case gr.Conditions[i].Key == condKeyAWSMFAPresent:
|
||||
return GroupedConditions{}, errConditionKeyNotApplicable
|
||||
case gr.Conditions[i].Key == condKeyAWSPrincipalARN:
|
||||
gr.Conditions[i].Key = native.PropertyKeyActorPublicKey
|
||||
val, err := formPrincipalKey(gr.Conditions[i].Value, resolver)
|
||||
if err != nil {
|
||||
return GroupedConditions{}, err
|
||||
}
|
||||
gr.Conditions[i].Value = val
|
||||
res.Conditions = append(res.Conditions, gr.Conditions[i])
|
||||
case strings.HasPrefix(gr.Conditions[i].Key, condKeyAWSRequestTagPrefix) ||
|
||||
strings.HasPrefix(gr.Conditions[i].Key, condKeyAWSResourceTagPrefix):
|
||||
// Tags exist only in S3 requests, so native protocol should not process such conditions.
|
||||
continue
|
||||
default:
|
||||
res.Conditions = append(res.Conditions, gr.Conditions[i])
|
||||
}
|
||||
}
|
||||
|
||||
return res, nil
|
||||
})
|
||||
}
|
||||
|
||||
type GroupedResources struct {
|
||||
Names []string
|
||||
Conditions []chain.Condition
|
||||
}
|
||||
|
||||
type ActionTypes struct {
|
||||
Object bool
|
||||
Container bool
|
||||
}
|
||||
|
||||
func formNativeResourceNamesAndConditions(names []string, resolver NativeResolver, actionTypes ActionTypes) ([]GroupedResources, error) {
|
||||
if !actionTypes.Object && !actionTypes.Container {
|
||||
return nil, ErrActionsNotApplicable
|
||||
}
|
||||
|
||||
res := make([]GroupedResources, 0, len(names))
|
||||
|
||||
combined := make(map[string]struct{})
|
||||
|
||||
for _, resource := range names {
|
||||
if err := validateResource(resource); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
if resource == Wildcard {
|
||||
res = res[:0]
|
||||
return append(res, formWildcardNativeResource(actionTypes)), nil
|
||||
}
|
||||
|
||||
if !strings.HasPrefix(resource, s3ResourcePrefix) {
|
||||
continue
|
||||
}
|
||||
|
||||
var bkt, obj string
|
||||
s3Resource := strings.TrimPrefix(resource, s3ResourcePrefix)
|
||||
if s3Resource == Wildcard {
|
||||
res = res[:0]
|
||||
return append(res, formWildcardNativeResource(actionTypes)), nil
|
||||
}
|
||||
|
||||
if sepIndex := strings.Index(s3Resource, "/"); sepIndex < 0 {
|
||||
bkt = s3Resource
|
||||
} else {
|
||||
bkt = s3Resource[:sepIndex]
|
||||
obj = s3Resource[sepIndex+1:]
|
||||
if len(obj) == 0 {
|
||||
obj = Wildcard
|
||||
}
|
||||
}
|
||||
|
||||
bktInfo, err := resolver.GetBucketInfo(bkt)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
if obj == Wildcard && actionTypes.Object { // this corresponds to arn:aws:s3:::BUCKET/ or arn:aws:s3:::BUCKET/*
|
||||
combined[fmt.Sprintf(native.ResourceFormatNamespaceContainerObjects, bktInfo.Namespace, bktInfo.Container)] = struct{}{}
|
||||
combined[fmt.Sprintf(native.ResourceFormatNamespaceContainer, bktInfo.Namespace, bktInfo.Container)] = struct{}{}
|
||||
continue
|
||||
}
|
||||
if obj == "" && actionTypes.Container { // this corresponds to arn:aws:s3:::BUCKET
|
||||
combined[fmt.Sprintf(native.ResourceFormatNamespaceContainer, bktInfo.Namespace, bktInfo.Container)] = struct{}{}
|
||||
continue
|
||||
}
|
||||
|
||||
res = append(res, GroupedResources{
|
||||
Names: []string{
|
||||
fmt.Sprintf(native.ResourceFormatNamespaceContainerObjects, bktInfo.Namespace, bktInfo.Container),
|
||||
fmt.Sprintf(native.ResourceFormatNamespaceContainer, bktInfo.Namespace, bktInfo.Container),
|
||||
},
|
||||
Conditions: []chain.Condition{
|
||||
{
|
||||
Op: chain.CondStringLike,
|
||||
Kind: chain.KindResource,
|
||||
Key: PropertyKeyFilePath,
|
||||
Value: obj,
|
||||
},
|
||||
},
|
||||
})
|
||||
}
|
||||
|
||||
if len(combined) != 0 {
|
||||
gr := GroupedResources{Names: make([]string, 0, len(combined))}
|
||||
for key := range combined {
|
||||
gr.Names = append(gr.Names, key)
|
||||
}
|
||||
|
||||
res = append(res, gr)
|
||||
}
|
||||
|
||||
return res, nil
|
||||
}
|
||||
|
||||
func formWildcardNativeResource(actionTypes ActionTypes) GroupedResources {
|
||||
groupedNames := make([]string, 0, 2)
|
||||
if actionTypes.Object {
|
||||
groupedNames = append(groupedNames, native.ResourceFormatAllObjects)
|
||||
}
|
||||
if actionTypes.Container {
|
||||
groupedNames = append(groupedNames, native.ResourceFormatAllContainers)
|
||||
}
|
||||
|
||||
return GroupedResources{Names: groupedNames}
|
||||
}
|
||||
|
||||
func formNativePrincipal(principal []string, resolver NativeResolver) ([]string, error) {
|
||||
res := make([]string, len(principal))
|
||||
|
||||
var err error
|
||||
for i := range principal {
|
||||
if res[i], err = formPrincipalKey(principal[i], resolver); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
}
|
||||
|
||||
return res, nil
|
||||
}
|
||||
|
||||
func formPrincipalKey(principal string, resolver NativeResolver) (string, error) {
|
||||
account, user, err := parsePrincipalAsIAMUser(principal)
|
||||
if err != nil {
|
||||
return "", err
|
||||
}
|
||||
|
||||
key, err := resolver.GetUserKey(account, user)
|
||||
if err != nil {
|
||||
return "", fmt.Errorf("get user key: %w", err)
|
||||
}
|
||||
|
||||
return key, nil
|
||||
}
|
||||
|
||||
func formNativeActionNames(names []string) ([]string, error) {
|
||||
uniqueActions := make(map[string]struct{}, len(names))
|
||||
|
||||
for _, action := range names {
|
||||
if action == Wildcard {
|
||||
return []string{Wildcard}, nil
|
||||
}
|
||||
|
||||
isIAM, err := validateAction(action)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
if isIAM {
|
||||
continue
|
||||
}
|
||||
|
||||
if action[len(s3ActionPrefix):] == Wildcard {
|
||||
return []string{Wildcard}, nil
|
||||
}
|
||||
|
||||
nativeActions := actionToNativeOpMap[action]
|
||||
if len(nativeActions) == 0 {
|
||||
return nil, ErrActionsNotApplicable
|
||||
}
|
||||
|
||||
for _, nativeAction := range nativeActions {
|
||||
uniqueActions[nativeAction] = struct{}{}
|
||||
}
|
||||
}
|
||||
|
||||
res := make([]string, 0, len(uniqueActions))
|
||||
for key := range uniqueActions {
|
||||
res = append(res, key)
|
||||
}
|
||||
|
||||
return res, nil
|
||||
}
|
||||
|
|
@ -1,270 +0,0 @@
|
|||
package iam
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
"strings"
|
||||
|
||||
"git.frostfs.info/TrueCloudLab/policy-engine/pkg/chain"
|
||||
"git.frostfs.info/TrueCloudLab/policy-engine/schema/s3"
|
||||
)
|
||||
|
||||
const condKeyAWSMFAPresent = "aws:MultiFactorAuthPresent"
|
||||
|
||||
var actionToS3OpMap = map[string][]string{
|
||||
s3ActionAbortMultipartUpload: {s3ActionAbortMultipartUpload},
|
||||
s3ActionCreateBucket: {s3ActionCreateBucket},
|
||||
s3ActionDeleteBucket: {s3ActionDeleteBucket},
|
||||
s3ActionDeleteBucketPolicy: {s3ActionDeleteBucketPolicy},
|
||||
s3ActionDeleteObjectTagging: {s3ActionDeleteObjectTagging},
|
||||
s3ActionGetBucketLocation: {s3ActionGetBucketLocation},
|
||||
s3ActionGetBucketNotification: {s3ActionGetBucketNotification},
|
||||
s3ActionGetBucketPolicy: {s3ActionGetBucketPolicy},
|
||||
s3ActionGetBucketPolicyStatus: {s3ActionGetBucketPolicyStatus},
|
||||
s3ActionGetBucketTagging: {s3ActionGetBucketTagging},
|
||||
s3ActionGetBucketVersioning: {s3ActionGetBucketVersioning},
|
||||
s3ActionGetObjectAttributes: {s3ActionGetObjectAttributes},
|
||||
s3ActionGetObjectLegalHold: {s3ActionGetObjectLegalHold},
|
||||
s3ActionGetObjectRetention: {s3ActionGetObjectRetention},
|
||||
s3ActionGetObjectTagging: {s3ActionGetObjectTagging},
|
||||
s3ActionPutBucketNotification: {s3ActionPutBucketNotification},
|
||||
s3ActionPutBucketPolicy: {s3ActionPutBucketPolicy},
|
||||
s3ActionPutBucketVersioning: {s3ActionPutBucketVersioning},
|
||||
s3ActionPutObjectLegalHold: {s3ActionPutObjectLegalHold},
|
||||
s3ActionPutObjectRetention: {s3ActionPutObjectRetention},
|
||||
s3ActionPutObjectTagging: {s3ActionPutObjectTagging},
|
||||
s3ActionPatchObject: {s3ActionPatchObject},
|
||||
|
||||
s3ActionListAllMyBuckets: {"s3:ListBuckets"},
|
||||
s3ActionListBucket: {"s3:HeadBucket", "s3:GetBucketLocation", "s3:ListObjectsV1", "s3:ListObjectsV2"},
|
||||
s3ActionListBucketVersions: {"s3:ListBucketObjectVersions"},
|
||||
s3ActionListBucketMultipartUploads: {"s3:ListMultipartUploads"},
|
||||
s3ActionGetBucketObjectLockConfiguration: {"s3:GetBucketObjectLockConfig"},
|
||||
s3ActionGetLifecycleConfiguration: {"s3:GetBucketLifecycle"},
|
||||
s3ActionGetBucketACL: {"s3:GetBucketACL"},
|
||||
s3ActionGetBucketCORS: {"s3:GetBucketCors"},
|
||||
s3ActionPutBucketTagging: {"s3:PutBucketTagging", "s3:DeleteBucketTagging"},
|
||||
s3ActionPutBucketObjectLockConfiguration: {"s3:PutBucketObjectLockConfig"},
|
||||
s3ActionPutLifecycleConfiguration: {"s3:PutBucketLifecycle", "s3:DeleteBucketLifecycle"},
|
||||
s3ActionPutBucketACL: {"s3:PutBucketACL"},
|
||||
s3ActionPutBucketCORS: {"s3:PutBucketCors", "s3:DeleteBucketCors"},
|
||||
|
||||
s3ActionListMultipartUploadParts: {"s3:ListParts"},
|
||||
s3ActionGetObjectACL: {"s3:GetObjectACL"},
|
||||
s3ActionGetObject: {"s3:GetObject", "s3:HeadObject"},
|
||||
s3ActionGetObjectVersion: {"s3:GetObject", "s3:HeadObject"},
|
||||
s3ActionGetObjectVersionACL: {"s3:GetObjectACL"},
|
||||
s3ActionGetObjectVersionAttributes: {"s3:GetObjectAttributes"},
|
||||
s3ActionGetObjectVersionTagging: {"s3:GetObjectTagging"},
|
||||
s3ActionPutObjectACL: {"s3:PutObjectACL"},
|
||||
s3ActionPutObjectVersionACL: {"s3:PutObjectACL"},
|
||||
s3ActionPutObjectVersionTagging: {"s3:PutObjectTagging"},
|
||||
s3ActionPutObject: {
|
||||
"s3:PutObject", "s3:PostObject", "s3:CopyObject",
|
||||
"s3:UploadPart", "s3:UploadPartCopy", "s3:CreateMultipartUpload", "s3:CompleteMultipartUpload",
|
||||
},
|
||||
s3ActionDeleteObjectVersionTagging: {"s3:DeleteObjectTagging"},
|
||||
s3ActionDeleteObject: {"s3:DeleteObject", "s3:DeleteMultipleObjects"},
|
||||
s3ActionDeleteObjectVersion: {"s3:DeleteObject", "s3:DeleteMultipleObjects"},
|
||||
}
|
||||
|
||||
type S3Resolver interface {
|
||||
GetUserAddress(account, user string) (string, error)
|
||||
}
|
||||
|
||||
func ConvertToS3Chain(p Policy, resolver S3Resolver) (*chain.Chain, error) {
|
||||
if err := p.Validate(ResourceBasedPolicyType); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
var engineChain chain.Chain
|
||||
|
||||
for _, statement := range p.Statement {
|
||||
status := formStatus(statement)
|
||||
|
||||
actions, actionInverted := statement.action()
|
||||
s3Actions, err := formS3ActionNames(actions)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
ruleAction := chain.Actions{Inverted: actionInverted, Names: s3Actions}
|
||||
if len(ruleAction.Names) == 0 {
|
||||
continue
|
||||
}
|
||||
|
||||
resources, resourceInverted := statement.resource()
|
||||
if err := validateS3ResourceNames(resources); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
ruleResource := chain.Resources{Inverted: resourceInverted, Names: resources}
|
||||
|
||||
groupedConditions, err := convertToS3ChainCondition(statement.Conditions, resolver)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
splitConditions := splitGroupedConditions(groupedConditions)
|
||||
|
||||
principals, principalCondFn, err := getS3PrincipalsAndConditionFunc(statement, resolver)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
for _, principal := range principals {
|
||||
for _, conditions := range splitConditions {
|
||||
var principalCondition []chain.Condition
|
||||
if principal != Wildcard {
|
||||
principalCondition = []chain.Condition{principalCondFn(principal)}
|
||||
}
|
||||
|
||||
r := chain.Rule{
|
||||
Status: status,
|
||||
Actions: ruleAction,
|
||||
Resources: ruleResource,
|
||||
Condition: append(principalCondition, conditions...),
|
||||
}
|
||||
engineChain.Rules = append(engineChain.Rules, r)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
if len(engineChain.Rules) == 0 {
|
||||
return nil, ErrActionsNotApplicable
|
||||
}
|
||||
|
||||
return &engineChain, nil
|
||||
}
|
||||
|
||||
func getS3PrincipalsAndConditionFunc(statement Statement, resolver S3Resolver) ([]string, formPrincipalConditionFunc, error) {
|
||||
var principals []string
|
||||
var op chain.ConditionType
|
||||
statementPrincipal, inverted := statement.principal()
|
||||
if _, ok := statementPrincipal[Wildcard]; ok { // this can be true only if 'inverted' false
|
||||
principals = []string{Wildcard}
|
||||
op = chain.CondStringLike
|
||||
} else {
|
||||
for principalType, principal := range statementPrincipal {
|
||||
if principalType != AWSPrincipalType {
|
||||
return nil, nil, fmt.Errorf("unsupported principal type '%s'", principalType)
|
||||
}
|
||||
parsedPrincipal, err := formS3Principal(principal, resolver)
|
||||
if err != nil {
|
||||
return nil, nil, fmt.Errorf("parse principal: %w", err)
|
||||
}
|
||||
principals = append(principals, parsedPrincipal...)
|
||||
}
|
||||
|
||||
op = chain.CondStringEquals
|
||||
if inverted {
|
||||
op = chain.CondStringNotEquals
|
||||
}
|
||||
}
|
||||
|
||||
return principals, func(principal string) chain.Condition {
|
||||
return chain.Condition{
|
||||
Op: op,
|
||||
Kind: chain.KindRequest,
|
||||
Key: s3.PropertyKeyOwner,
|
||||
Value: principal,
|
||||
}
|
||||
}, nil
|
||||
}
|
||||
|
||||
func convertToS3ChainCondition(c Conditions, resolver S3Resolver) ([]GroupedConditions, error) {
|
||||
return convertToChainConditions(c, func(gr GroupedConditions) (GroupedConditions, error) {
|
||||
for i := range gr.Conditions {
|
||||
switch {
|
||||
case gr.Conditions[i].Key == condKeyAWSPrincipalARN:
|
||||
gr.Conditions[i].Key = s3.PropertyKeyOwner
|
||||
val, err := formPrincipalOwner(gr.Conditions[i].Value, resolver)
|
||||
if err != nil {
|
||||
return GroupedConditions{}, err
|
||||
}
|
||||
gr.Conditions[i].Value = val
|
||||
|
||||
case gr.Conditions[i].Key == condKeyAWSMFAPresent:
|
||||
gr.Conditions[i].Key = s3.PropertyKeyAccessBoxAttrMFA
|
||||
case strings.HasPrefix(gr.Conditions[i].Key, condKeyAWSResourceTagPrefix):
|
||||
gr.Conditions[i].Kind = chain.KindResource
|
||||
}
|
||||
}
|
||||
|
||||
return gr, nil
|
||||
})
|
||||
}
|
||||
|
||||
func formS3Principal(principal []string, resolver S3Resolver) ([]string, error) {
|
||||
res := make([]string, len(principal))
|
||||
|
||||
var err error
|
||||
for i := range principal {
|
||||
if res[i], err = formPrincipalOwner(principal[i], resolver); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
}
|
||||
|
||||
return res, nil
|
||||
}
|
||||
|
||||
func formPrincipalOwner(principal string, resolver S3Resolver) (string, error) {
|
||||
account, user, err := parsePrincipalAsIAMUser(principal)
|
||||
if err != nil {
|
||||
return "", err
|
||||
}
|
||||
|
||||
address, err := resolver.GetUserAddress(account, user)
|
||||
if err != nil {
|
||||
return "", fmt.Errorf("get user address: %w", err)
|
||||
}
|
||||
|
||||
return address, nil
|
||||
}
|
||||
|
||||
func validateS3ResourceNames(names []string) error {
|
||||
for i := range names {
|
||||
if err := validateResource(names[i]); err != nil {
|
||||
return err
|
||||
}
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func formS3ActionNames(names []string) ([]string, error) {
|
||||
uniqueActions := make(map[string]struct{}, len(names))
|
||||
|
||||
for _, action := range names {
|
||||
if action == Wildcard {
|
||||
return []string{Wildcard}, nil
|
||||
}
|
||||
|
||||
isIAM, err := validateAction(action)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
if isIAM {
|
||||
uniqueActions[action] = struct{}{}
|
||||
continue
|
||||
}
|
||||
|
||||
if action[len(s3ActionPrefix):] == Wildcard {
|
||||
uniqueActions[action] = struct{}{}
|
||||
continue
|
||||
}
|
||||
|
||||
s3Actions := actionToS3OpMap[action]
|
||||
if len(s3Actions) == 0 {
|
||||
return nil, ErrActionsNotApplicable
|
||||
}
|
||||
|
||||
for _, s3Action := range s3Actions {
|
||||
uniqueActions[s3Action] = struct{}{}
|
||||
}
|
||||
}
|
||||
|
||||
res := make([]string, 0, len(uniqueActions))
|
||||
for key := range uniqueActions {
|
||||
res = append(res, key)
|
||||
}
|
||||
|
||||
return res, nil
|
||||
}
|
||||
File diff suppressed because it is too large
Load diff
329
iam/policy.go
329
iam/policy.go
|
|
@ -1,329 +0,0 @@
|
|||
package iam
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"errors"
|
||||
"fmt"
|
||||
)
|
||||
|
||||
type (
|
||||
// Policy grammar https://docs.aws.amazon.com/IAM/latest/UserGuide/reference_policies_grammar.html
|
||||
Policy struct {
|
||||
Version string `json:"Version,omitempty"`
|
||||
ID string `json:"Id,omitempty"`
|
||||
Statement Statements `json:"Statement"`
|
||||
}
|
||||
|
||||
Statements []Statement
|
||||
|
||||
Statement struct {
|
||||
ID string `json:"Id,omitempty"`
|
||||
SID string `json:"Sid,omitempty"`
|
||||
Principal Principal `json:"Principal,omitempty"`
|
||||
NotPrincipal Principal `json:"NotPrincipal,omitempty"`
|
||||
Effect Effect `json:"Effect"`
|
||||
Action Action `json:"Action,omitempty"`
|
||||
NotAction Action `json:"NotAction,omitempty"`
|
||||
Resource Resource `json:"Resource,omitempty"`
|
||||
NotResource Resource `json:"NotResource,omitempty"`
|
||||
Conditions Conditions `json:"Condition,omitempty"`
|
||||
}
|
||||
|
||||
Principal map[PrincipalType][]string
|
||||
|
||||
Effect string
|
||||
|
||||
Action []string
|
||||
|
||||
Resource []string
|
||||
|
||||
Conditions map[string]Condition
|
||||
|
||||
Condition map[string][]string
|
||||
|
||||
PolicyType int
|
||||
|
||||
PrincipalType string
|
||||
)
|
||||
|
||||
const policyVersion = "2012-10-17"
|
||||
|
||||
const (
|
||||
GeneralPolicyType PolicyType = iota
|
||||
IdentityBasedPolicyType
|
||||
ResourceBasedPolicyType
|
||||
)
|
||||
|
||||
const Wildcard = "*"
|
||||
|
||||
const (
|
||||
AllowEffect Effect = "Allow"
|
||||
DenyEffect Effect = "Deny"
|
||||
)
|
||||
|
||||
func (e Effect) IsValid() bool {
|
||||
return e == AllowEffect || e == DenyEffect
|
||||
}
|
||||
|
||||
const (
|
||||
AWSPrincipalType PrincipalType = "AWS"
|
||||
FederatedPrincipalType PrincipalType = "Federated"
|
||||
ServicePrincipalType PrincipalType = "Service"
|
||||
CanonicalUserPrincipalType PrincipalType = "CanonicalUser"
|
||||
)
|
||||
|
||||
func (p PrincipalType) IsValid() bool {
|
||||
return p == AWSPrincipalType || p == FederatedPrincipalType ||
|
||||
p == ServicePrincipalType || p == CanonicalUserPrincipalType
|
||||
}
|
||||
|
||||
func (s *Statements) UnmarshalJSON(data []byte) error {
|
||||
var list []Statement
|
||||
if err := json.Unmarshal(data, &list); err == nil {
|
||||
*s = list
|
||||
return nil
|
||||
}
|
||||
|
||||
var elem Statement
|
||||
if err := json.Unmarshal(data, &elem); err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
*s = []Statement{elem}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (p *Principal) UnmarshalJSON(data []byte) error {
|
||||
*p = make(Principal)
|
||||
|
||||
var str string
|
||||
|
||||
if err := json.Unmarshal(data, &str); err == nil {
|
||||
if str != Wildcard {
|
||||
return errors.New("invalid IAM string principal")
|
||||
}
|
||||
(*p)[Wildcard] = nil
|
||||
return nil
|
||||
}
|
||||
|
||||
m := make(map[PrincipalType]any)
|
||||
if err := json.Unmarshal(data, &m); err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
for key, val := range m {
|
||||
element, ok := val.(string)
|
||||
if ok {
|
||||
(*p)[key] = []string{element}
|
||||
continue
|
||||
}
|
||||
|
||||
list, ok := val.([]any)
|
||||
if !ok {
|
||||
return errors.New("invalid principal format")
|
||||
}
|
||||
|
||||
resList := make([]string, len(list))
|
||||
for i := range list {
|
||||
val, ok := list[i].(string)
|
||||
if !ok {
|
||||
return errors.New("invalid principal format")
|
||||
}
|
||||
resList[i] = val
|
||||
}
|
||||
|
||||
(*p)[key] = resList
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (a *Action) UnmarshalJSON(data []byte) error {
|
||||
var list []string
|
||||
if err := json.Unmarshal(data, &list); err == nil {
|
||||
*a = list
|
||||
return nil
|
||||
}
|
||||
|
||||
var elem string
|
||||
if err := json.Unmarshal(data, &elem); err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
*a = []string{elem}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (r *Resource) UnmarshalJSON(data []byte) error {
|
||||
var list []string
|
||||
if err := json.Unmarshal(data, &list); err == nil {
|
||||
*r = list
|
||||
return nil
|
||||
}
|
||||
|
||||
var elem string
|
||||
if err := json.Unmarshal(data, &elem); err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
*r = []string{elem}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (c *Condition) UnmarshalJSON(data []byte) error {
|
||||
*c = make(Condition)
|
||||
|
||||
m := make(map[string]any)
|
||||
if err := json.Unmarshal(data, &m); err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
for key, val := range m {
|
||||
element, ok := val.(string)
|
||||
if ok {
|
||||
(*c)[key] = []string{element}
|
||||
continue
|
||||
}
|
||||
|
||||
list, ok := val.([]any)
|
||||
if !ok {
|
||||
return errors.New("invalid principal format")
|
||||
}
|
||||
|
||||
resList := make([]string, len(list))
|
||||
for i := range list {
|
||||
val, ok := list[i].(string)
|
||||
if !ok {
|
||||
return errors.New("invalid principal format")
|
||||
}
|
||||
resList[i] = val
|
||||
}
|
||||
|
||||
(*c)[key] = resList
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (p Policy) Validate(typ PolicyType) error {
|
||||
if err := p.validate(); err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
switch typ {
|
||||
case IdentityBasedPolicyType:
|
||||
return p.validateIdentityBased()
|
||||
case ResourceBasedPolicyType:
|
||||
return p.validateResourceBased()
|
||||
default:
|
||||
return nil
|
||||
}
|
||||
}
|
||||
|
||||
func (p Policy) validate() error {
|
||||
if p.Version != policyVersion {
|
||||
return fmt.Errorf("invalid policy version, expected '%s', actual: '%s'", policyVersion, p.Version)
|
||||
}
|
||||
|
||||
if len(p.Statement) == 0 {
|
||||
return errors.New("'Statement' is missing")
|
||||
}
|
||||
|
||||
sids := make(map[string]struct{}, len(p.Statement))
|
||||
for _, statement := range p.Statement {
|
||||
if _, ok := sids[statement.SID]; ok && statement.SID != "" {
|
||||
return fmt.Errorf("duplicate 'SID': %s", statement.SID)
|
||||
}
|
||||
sids[statement.SID] = struct{}{}
|
||||
if !statement.Effect.IsValid() {
|
||||
return fmt.Errorf("unknown effect: '%s'", statement.Effect)
|
||||
}
|
||||
if len(statement.Action) != 0 && len(statement.NotAction) != 0 {
|
||||
return errors.New("'Actions' and 'NotAction' are mutually exclusive")
|
||||
}
|
||||
if statement.Resource != nil && statement.NotResource != nil {
|
||||
return errors.New("'Resources' and 'NotResource' are mutually exclusive")
|
||||
}
|
||||
if len(statement.Resource) == 0 && len(statement.NotResource) == 0 {
|
||||
return errors.New("one of 'Resources'/'NotResource' must be provided")
|
||||
}
|
||||
if len(statement.Principal) != 0 && len(statement.NotPrincipal) != 0 {
|
||||
return errors.New("'Principal' and 'NotPrincipal' are mutually exclusive")
|
||||
}
|
||||
if len(statement.NotPrincipal) != 0 && statement.Effect != DenyEffect {
|
||||
return errors.New("using 'NotPrincipal' with effect 'Allow' is not supported")
|
||||
}
|
||||
|
||||
principal, _ := statement.principal()
|
||||
if err := principal.validate(); err != nil {
|
||||
return err
|
||||
}
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (p Policy) validateIdentityBased() error {
|
||||
if len(p.ID) != 0 {
|
||||
return errors.New("'Id' is not allowed for identity-based policy")
|
||||
}
|
||||
|
||||
for _, statement := range p.Statement {
|
||||
if len(statement.Principal) != 0 || len(statement.NotPrincipal) != 0 {
|
||||
return errors.New("'Principal' and 'NotPrincipal' are not allowed for identity-based policy")
|
||||
}
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (p Policy) validateResourceBased() error {
|
||||
for _, statement := range p.Statement {
|
||||
if len(statement.Principal) == 0 && len(statement.NotPrincipal) == 0 {
|
||||
return errors.New("'Principal' or 'NotPrincipal' must be provided for resource-based policy")
|
||||
}
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (s Statement) principal() (Principal, bool) {
|
||||
if len(s.NotPrincipal) != 0 {
|
||||
return s.NotPrincipal, true
|
||||
}
|
||||
|
||||
return s.Principal, false
|
||||
}
|
||||
|
||||
func (s Statement) action() (Action, bool) {
|
||||
if len(s.NotAction) != 0 {
|
||||
return s.NotAction, true
|
||||
}
|
||||
|
||||
return s.Action, false
|
||||
}
|
||||
|
||||
func (s Statement) resource() (Resource, bool) {
|
||||
if len(s.NotResource) != 0 {
|
||||
return s.NotResource, true
|
||||
}
|
||||
|
||||
return s.Resource, false
|
||||
}
|
||||
|
||||
func (p Principal) validate() error {
|
||||
if _, ok := p[Wildcard]; ok && len(p) == 1 {
|
||||
return nil
|
||||
}
|
||||
|
||||
for key := range p {
|
||||
if !key.IsValid() {
|
||||
return fmt.Errorf("unknown principal type: '%s'", key)
|
||||
}
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
|
@ -1,551 +0,0 @@
|
|||
package iam
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"testing"
|
||||
|
||||
"git.frostfs.info/TrueCloudLab/policy-engine/pkg/chain"
|
||||
"git.frostfs.info/TrueCloudLab/policy-engine/pkg/engine"
|
||||
"git.frostfs.info/TrueCloudLab/policy-engine/pkg/engine/inmemory"
|
||||
"git.frostfs.info/TrueCloudLab/policy-engine/pkg/resource/testutil"
|
||||
"git.frostfs.info/TrueCloudLab/policy-engine/schema/s3"
|
||||
"github.com/stretchr/testify/require"
|
||||
)
|
||||
|
||||
func TestUnmarshalIAMPolicy(t *testing.T) {
|
||||
t.Run("simple fields", func(t *testing.T) {
|
||||
policy := `{
|
||||
"Version": "2012-10-17",
|
||||
"Id": "PutObjPolicy",
|
||||
"Statement": {
|
||||
"Sid": "DenyObjectsThatAreNotSSEKMS",
|
||||
"Principal": "*",
|
||||
"Effect": "Deny",
|
||||
"Action": "s3:PutObject",
|
||||
"Resource": "arn:aws:s3:::DOC-EXAMPLE-BUCKET/*",
|
||||
"Condition": {
|
||||
"Null": {
|
||||
"s3:x-amz-server-side-encryption-aws-kms-key-id": "true"
|
||||
}
|
||||
}
|
||||
}
|
||||
}`
|
||||
|
||||
expected := Policy{
|
||||
Version: "2012-10-17",
|
||||
ID: "PutObjPolicy",
|
||||
Statement: []Statement{{
|
||||
SID: "DenyObjectsThatAreNotSSEKMS",
|
||||
Principal: map[PrincipalType][]string{
|
||||
"*": nil,
|
||||
},
|
||||
Effect: DenyEffect,
|
||||
Action: []string{"s3:PutObject"},
|
||||
Resource: []string{"arn:aws:s3:::DOC-EXAMPLE-BUCKET/*"},
|
||||
Conditions: map[string]Condition{
|
||||
"Null": {
|
||||
"s3:x-amz-server-side-encryption-aws-kms-key-id": {"true"},
|
||||
},
|
||||
},
|
||||
}},
|
||||
}
|
||||
|
||||
var p Policy
|
||||
err := json.Unmarshal([]byte(policy), &p)
|
||||
require.NoError(t, err)
|
||||
require.Equal(t, expected, p)
|
||||
})
|
||||
|
||||
t.Run("complex fields", func(t *testing.T) {
|
||||
policy := `{
|
||||
"Version": "2012-10-17",
|
||||
"Statement": [{
|
||||
"Principal":{
|
||||
"AWS":[
|
||||
"arn:aws:iam::111122223333:user/JohnDoe"
|
||||
]
|
||||
},
|
||||
"Effect": "Allow",
|
||||
"Action": [
|
||||
"s3:PutObject"
|
||||
],
|
||||
"Resource": [
|
||||
"arn:aws:s3:::DOC-EXAMPLE-BUCKET/*"
|
||||
],
|
||||
"Condition": {
|
||||
"StringEquals": {
|
||||
"s3:RequestObjectTag/Department": ["Finance"]
|
||||
}
|
||||
}
|
||||
}]
|
||||
}`
|
||||
|
||||
expected := Policy{
|
||||
Version: "2012-10-17",
|
||||
Statement: []Statement{{
|
||||
Principal: map[PrincipalType][]string{
|
||||
AWSPrincipalType: {"arn:aws:iam::111122223333:user/JohnDoe"},
|
||||
},
|
||||
Effect: AllowEffect,
|
||||
Action: []string{"s3:PutObject"},
|
||||
Resource: []string{"arn:aws:s3:::DOC-EXAMPLE-BUCKET/*"},
|
||||
Conditions: map[string]Condition{
|
||||
"StringEquals": {
|
||||
"s3:RequestObjectTag/Department": {"Finance"},
|
||||
},
|
||||
},
|
||||
}},
|
||||
}
|
||||
|
||||
var p Policy
|
||||
err := json.Unmarshal([]byte(policy), &p)
|
||||
require.NoError(t, err)
|
||||
require.Equal(t, expected, p)
|
||||
|
||||
raw, err := json.Marshal(expected)
|
||||
require.NoError(t, err)
|
||||
require.JSONEq(t, policy, string(raw))
|
||||
})
|
||||
|
||||
t.Run("check principal AWS", func(t *testing.T) {
|
||||
policy := `{
|
||||
"Statement": [{
|
||||
"Principal":{
|
||||
"AWS":"arn:aws:iam::111122223333:user/JohnDoe"
|
||||
}
|
||||
}]
|
||||
}`
|
||||
|
||||
expected := Policy{
|
||||
Statement: []Statement{{
|
||||
Principal: map[PrincipalType][]string{
|
||||
AWSPrincipalType: {"arn:aws:iam::111122223333:user/JohnDoe"},
|
||||
},
|
||||
}},
|
||||
}
|
||||
|
||||
var p Policy
|
||||
err := json.Unmarshal([]byte(policy), &p)
|
||||
require.NoError(t, err)
|
||||
require.Equal(t, expected, p)
|
||||
})
|
||||
|
||||
t.Run("native example", func(t *testing.T) {
|
||||
policy := `
|
||||
{
|
||||
"Version": "xyz",
|
||||
"Statement": [
|
||||
{
|
||||
"Effect": "Allow",
|
||||
"Action": [
|
||||
"native:*",
|
||||
"s3:PutObject",
|
||||
"s3:GetObject"
|
||||
],
|
||||
"Resource": ["*"],
|
||||
"Principal": {"FrostFS": ["did:frostfs:039e3ee771a223361fe7862f532e9511b57baaae3c3e2622682e99d0e660f7671"]},
|
||||
"Condition": {"StringEquals": {"native::object::attribute": "iamuser-admin"}}
|
||||
}
|
||||
]
|
||||
}`
|
||||
|
||||
var p Policy
|
||||
err := json.Unmarshal([]byte(policy), &p)
|
||||
require.NoError(t, err)
|
||||
})
|
||||
|
||||
t.Run("condition array", func(t *testing.T) {
|
||||
policy := `
|
||||
{
|
||||
"Statement": [{
|
||||
"Condition": {"StringLike": {"ec2:InstanceType": ["t1.*", "t2.*", "m3.*"]}}
|
||||
}]
|
||||
}`
|
||||
|
||||
expected := Policy{
|
||||
Statement: []Statement{{
|
||||
Conditions: map[string]Condition{
|
||||
"StringLike": {"ec2:InstanceType": {"t1.*", "t2.*", "m3.*"}},
|
||||
},
|
||||
}},
|
||||
}
|
||||
|
||||
var p Policy
|
||||
err := json.Unmarshal([]byte(policy), &p)
|
||||
require.NoError(t, err)
|
||||
require.Equal(t, expected, p)
|
||||
})
|
||||
|
||||
t.Run("'Not*' fields", func(t *testing.T) {
|
||||
policy := `
|
||||
{
|
||||
"Id": "PutObjPolicy",
|
||||
"Statement": [{
|
||||
"NotPrincipal": {"AWS":["arn:aws:iam::111122223333:user/Alice"]},
|
||||
"Effect": "Deny",
|
||||
"NotAction": "s3:PutObject",
|
||||
"NotResource": "arn:aws:s3:::DOC-EXAMPLE-BUCKET/*"
|
||||
}]
|
||||
}`
|
||||
|
||||
expected := Policy{
|
||||
ID: "PutObjPolicy",
|
||||
Statement: []Statement{{
|
||||
NotPrincipal: map[PrincipalType][]string{
|
||||
AWSPrincipalType: {"arn:aws:iam::111122223333:user/Alice"},
|
||||
},
|
||||
Effect: DenyEffect,
|
||||
NotAction: []string{"s3:PutObject"},
|
||||
NotResource: []string{"arn:aws:s3:::DOC-EXAMPLE-BUCKET/*"},
|
||||
}},
|
||||
}
|
||||
|
||||
var p Policy
|
||||
err := json.Unmarshal([]byte(policy), &p)
|
||||
require.NoError(t, err)
|
||||
require.Equal(t, expected, p)
|
||||
})
|
||||
}
|
||||
|
||||
func TestValidatePolicies(t *testing.T) {
|
||||
for _, tc := range []struct {
|
||||
name string
|
||||
policy Policy
|
||||
typ PolicyType
|
||||
isValid bool
|
||||
}{
|
||||
{
|
||||
name: "valid permission boundaries",
|
||||
policy: Policy{
|
||||
Version: policyVersion,
|
||||
Statement: []Statement{{
|
||||
Effect: AllowEffect,
|
||||
Action: []string{"s3:*", "cloudwatch:*", "ec2:*"},
|
||||
Resource: []string{Wildcard},
|
||||
}},
|
||||
},
|
||||
typ: GeneralPolicyType,
|
||||
isValid: true,
|
||||
},
|
||||
{
|
||||
name: "general invalid effect",
|
||||
policy: Policy{
|
||||
Version: policyVersion,
|
||||
Statement: []Statement{{
|
||||
Effect: "dummy",
|
||||
Action: []string{"s3:*", "cloudwatch:*", "ec2:*"},
|
||||
Resource: []string{Wildcard},
|
||||
}},
|
||||
},
|
||||
typ: GeneralPolicyType,
|
||||
isValid: false,
|
||||
},
|
||||
{
|
||||
name: "general invalid principal block",
|
||||
policy: Policy{
|
||||
Version: policyVersion,
|
||||
Statement: []Statement{{
|
||||
Effect: AllowEffect,
|
||||
Action: []string{"s3:*", "cloudwatch:*", "ec2:*"},
|
||||
Resource: []string{Wildcard},
|
||||
Principal: map[PrincipalType][]string{Wildcard: nil},
|
||||
NotPrincipal: map[PrincipalType][]string{Wildcard: nil},
|
||||
}},
|
||||
},
|
||||
typ: GeneralPolicyType,
|
||||
isValid: false,
|
||||
},
|
||||
{
|
||||
name: "general invalid not principal",
|
||||
policy: Policy{
|
||||
Version: policyVersion,
|
||||
Statement: []Statement{{
|
||||
Effect: AllowEffect,
|
||||
Action: []string{"s3:*", "cloudwatch:*", "ec2:*"},
|
||||
Resource: []string{Wildcard},
|
||||
NotPrincipal: map[PrincipalType][]string{AWSPrincipalType: {"arn:aws:iam::111122223333:user/Alice"}},
|
||||
}},
|
||||
},
|
||||
typ: GeneralPolicyType,
|
||||
isValid: false,
|
||||
},
|
||||
{
|
||||
name: "general invalid principal type",
|
||||
policy: Policy{
|
||||
Version: policyVersion,
|
||||
Statement: []Statement{{
|
||||
Effect: AllowEffect,
|
||||
Action: []string{"s3:*", "cloudwatch:*", "ec2:*"},
|
||||
Resource: []string{Wildcard},
|
||||
NotPrincipal: map[PrincipalType][]string{"dummy": {"arn:aws:iam::111122223333:user/Alice"}},
|
||||
}},
|
||||
},
|
||||
typ: GeneralPolicyType,
|
||||
isValid: false,
|
||||
},
|
||||
{
|
||||
name: "general invalid action block",
|
||||
policy: Policy{
|
||||
Version: policyVersion,
|
||||
Statement: []Statement{{
|
||||
Effect: AllowEffect,
|
||||
Action: []string{"s3:*", "cloudwatch:*", "ec2:*"},
|
||||
NotAction: []string{"iam:*"},
|
||||
Resource: []string{Wildcard},
|
||||
}},
|
||||
},
|
||||
typ: GeneralPolicyType,
|
||||
isValid: false,
|
||||
},
|
||||
{
|
||||
name: "general invalid resource block",
|
||||
policy: Policy{
|
||||
Version: policyVersion,
|
||||
Statement: []Statement{{
|
||||
Effect: AllowEffect,
|
||||
Resource: []string{Wildcard},
|
||||
NotResource: []string{"arn:aws:s3:::DOC-EXAMPLE-BUCKET/*"},
|
||||
}},
|
||||
},
|
||||
typ: GeneralPolicyType,
|
||||
isValid: false,
|
||||
},
|
||||
{
|
||||
name: "invalid resource block",
|
||||
policy: Policy{
|
||||
Version: policyVersion,
|
||||
Statement: []Statement{{
|
||||
Effect: AllowEffect,
|
||||
Resource: []string{},
|
||||
NotResource: []string{"arn:aws:s3:::DOC-EXAMPLE-BUCKET/*"},
|
||||
}},
|
||||
},
|
||||
typ: GeneralPolicyType,
|
||||
isValid: false,
|
||||
},
|
||||
{
|
||||
name: "missing resource block",
|
||||
policy: Policy{
|
||||
Version: policyVersion,
|
||||
Statement: []Statement{{
|
||||
Effect: AllowEffect,
|
||||
}},
|
||||
},
|
||||
typ: GeneralPolicyType,
|
||||
isValid: false,
|
||||
},
|
||||
{
|
||||
name: "missing statement block",
|
||||
policy: Policy{},
|
||||
typ: GeneralPolicyType,
|
||||
isValid: false,
|
||||
},
|
||||
{
|
||||
name: "duplicate sid",
|
||||
policy: Policy{
|
||||
Version: policyVersion,
|
||||
Statement: []Statement{
|
||||
{
|
||||
SID: "sid",
|
||||
Effect: AllowEffect,
|
||||
Action: []string{"s3:*"},
|
||||
Resource: []string{Wildcard},
|
||||
},
|
||||
{
|
||||
SID: "sid",
|
||||
Effect: AllowEffect,
|
||||
Action: []string{"cloudwatch:*"},
|
||||
Resource: []string{Wildcard},
|
||||
}},
|
||||
},
|
||||
typ: GeneralPolicyType,
|
||||
isValid: false,
|
||||
},
|
||||
{
|
||||
name: "missing version",
|
||||
policy: Policy{
|
||||
Statement: []Statement{{
|
||||
Effect: AllowEffect,
|
||||
Action: []string{"s3:*"},
|
||||
Resource: []string{Wildcard},
|
||||
}},
|
||||
},
|
||||
typ: GeneralPolicyType,
|
||||
isValid: false,
|
||||
},
|
||||
{
|
||||
name: "identity based valid",
|
||||
policy: Policy{
|
||||
Version: policyVersion,
|
||||
Statement: []Statement{{
|
||||
Effect: AllowEffect,
|
||||
Action: []string{"s3:PutObject"},
|
||||
Resource: []string{Wildcard},
|
||||
}},
|
||||
},
|
||||
typ: IdentityBasedPolicyType,
|
||||
isValid: true,
|
||||
},
|
||||
{
|
||||
name: "identity based invalid because of id presence",
|
||||
policy: Policy{
|
||||
ID: "some-id",
|
||||
Version: policyVersion,
|
||||
Statement: []Statement{{
|
||||
Effect: AllowEffect,
|
||||
Action: []string{"s3:PutObject"},
|
||||
Resource: []string{Wildcard},
|
||||
}},
|
||||
},
|
||||
typ: IdentityBasedPolicyType,
|
||||
isValid: false,
|
||||
},
|
||||
{
|
||||
name: "identity based invalid because of principal presence",
|
||||
policy: Policy{
|
||||
Version: policyVersion,
|
||||
Statement: []Statement{{
|
||||
Effect: AllowEffect,
|
||||
Action: []string{"s3:PutObject"},
|
||||
Resource: []string{Wildcard},
|
||||
Principal: map[PrincipalType][]string{AWSPrincipalType: {"arn:aws:iam::111122223333:user/Alice"}},
|
||||
}},
|
||||
},
|
||||
typ: IdentityBasedPolicyType,
|
||||
isValid: false,
|
||||
},
|
||||
{
|
||||
name: "identity based invalid because of not principal presence",
|
||||
policy: Policy{
|
||||
Version: policyVersion,
|
||||
Statement: []Statement{{
|
||||
Effect: AllowEffect,
|
||||
Action: []string{"s3:PutObject"},
|
||||
Resource: []string{Wildcard},
|
||||
NotPrincipal: map[PrincipalType][]string{AWSPrincipalType: {"arn:aws:iam::111122223333:user/Alice"}},
|
||||
}},
|
||||
},
|
||||
typ: IdentityBasedPolicyType,
|
||||
isValid: false,
|
||||
},
|
||||
{
|
||||
name: "resource based valid principal",
|
||||
policy: Policy{
|
||||
Version: policyVersion,
|
||||
Statement: []Statement{{
|
||||
Effect: DenyEffect,
|
||||
Action: []string{"s3:PutObject"},
|
||||
Resource: []string{Wildcard},
|
||||
Principal: map[PrincipalType][]string{AWSPrincipalType: {"arn:aws:iam::111122223333:user/Alice"}},
|
||||
}},
|
||||
},
|
||||
typ: ResourceBasedPolicyType,
|
||||
isValid: true,
|
||||
},
|
||||
{
|
||||
name: "resource based valid not principal",
|
||||
policy: Policy{
|
||||
ID: "some-id",
|
||||
Version: policyVersion,
|
||||
Statement: []Statement{{
|
||||
Effect: DenyEffect,
|
||||
Action: []string{"s3:PutObject"},
|
||||
Resource: []string{Wildcard},
|
||||
NotPrincipal: map[PrincipalType][]string{AWSPrincipalType: {"arn:aws:iam::111122223333:user/Alice"}},
|
||||
}},
|
||||
},
|
||||
typ: ResourceBasedPolicyType,
|
||||
isValid: true,
|
||||
},
|
||||
{
|
||||
name: "resource based invalid missing principal",
|
||||
policy: Policy{
|
||||
ID: "some-id",
|
||||
Version: policyVersion,
|
||||
Statement: []Statement{{
|
||||
Effect: AllowEffect,
|
||||
Action: []string{"s3:PutObject"},
|
||||
Resource: []string{Wildcard},
|
||||
}},
|
||||
},
|
||||
typ: ResourceBasedPolicyType,
|
||||
isValid: false,
|
||||
},
|
||||
} {
|
||||
t.Run(tc.name, func(t *testing.T) {
|
||||
err := tc.policy.Validate(tc.typ)
|
||||
if tc.isValid {
|
||||
require.NoError(t, err)
|
||||
} else {
|
||||
require.Error(t, err)
|
||||
}
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
func TestProcessDenyFirst(t *testing.T) {
|
||||
identityBasedPolicyStr := `
|
||||
{
|
||||
"Version": "2012-10-17",
|
||||
"Statement": [
|
||||
{
|
||||
"Effect": "Allow",
|
||||
"Principal": {
|
||||
"AWS": [ "arn:aws:iam::root:user/user-name" ]
|
||||
},
|
||||
"Action": ["s3:PutObject" ],
|
||||
"Resource": "arn:aws:s3:::*"
|
||||
}
|
||||
]
|
||||
}
|
||||
`
|
||||
|
||||
resourceBasedPolicyStr := `
|
||||
{
|
||||
"Version": "2012-10-17",
|
||||
"Statement": [
|
||||
{
|
||||
"Effect": "Deny",
|
||||
"Principal": "*",
|
||||
"Action": "s3:*",
|
||||
"Resource": [ "arn:aws:s3:::test-bucket/*" ]
|
||||
}
|
||||
]
|
||||
}
|
||||
`
|
||||
|
||||
var identityPolicy Policy
|
||||
err := json.Unmarshal([]byte(identityBasedPolicyStr), &identityPolicy)
|
||||
require.NoError(t, err)
|
||||
|
||||
var resourcePolicy Policy
|
||||
err = json.Unmarshal([]byte(resourceBasedPolicyStr), &resourcePolicy)
|
||||
require.NoError(t, err)
|
||||
|
||||
mockResolver := newMockUserResolver([]string{"root/user-name"}, []string{"test-bucket"}, "")
|
||||
|
||||
identityNativePolicy, err := ConvertToS3Chain(identityPolicy, mockResolver)
|
||||
require.NoError(t, err)
|
||||
identityNativePolicy.MatchType = chain.MatchTypeFirstMatch
|
||||
|
||||
resourceNativePolicy, err := ConvertToS3Chain(resourcePolicy, mockResolver)
|
||||
require.NoError(t, err)
|
||||
|
||||
s := inmemory.NewInMemory()
|
||||
|
||||
target := engine.NamespaceTarget("ns")
|
||||
|
||||
_, _, err = s.MorphRuleChainStorage().AddMorphRuleChain(chain.S3, target, identityNativePolicy)
|
||||
require.NoError(t, err)
|
||||
|
||||
_, _, err = s.MorphRuleChainStorage().AddMorphRuleChain(chain.S3, target, resourceNativePolicy)
|
||||
require.NoError(t, err)
|
||||
|
||||
resource := testutil.NewResource("arn:aws:s3:::test-bucket/object", nil)
|
||||
request := testutil.NewRequest("s3:PutObject", resource, map[string]string{s3.PropertyKeyOwner: mockResolver.users["root/user-name"]})
|
||||
|
||||
status, found, err := s.IsAllowed(chain.S3, engine.NewRequestTarget("ns", ""), request)
|
||||
require.NoError(t, err)
|
||||
require.True(t, found)
|
||||
require.Equal(t, chain.AccessDenied, status)
|
||||
}
|
||||
76
inmemory.go
Normal file
76
inmemory.go
Normal file
|
|
@ -0,0 +1,76 @@
|
|||
package policyengine
|
||||
|
||||
type inmemory struct {
|
||||
namespace map[Name][]chain
|
||||
resource map[Name][]chain
|
||||
local map[Name][]*Chain
|
||||
}
|
||||
|
||||
type chain struct {
|
||||
object string
|
||||
chain *Chain
|
||||
}
|
||||
|
||||
// NewInMemory returns new inmemory instance of chain storage.
|
||||
func NewInMemory() CachedChainStorage {
|
||||
return &inmemory{
|
||||
namespace: make(map[Name][]chain),
|
||||
resource: make(map[Name][]chain),
|
||||
local: make(map[Name][]*Chain),
|
||||
}
|
||||
}
|
||||
|
||||
// TODO параметры для actor (IP)
|
||||
// TODO
|
||||
func (s *inmemory) IsAllowed(name Name, namespace string, r Request) (Status, bool) {
|
||||
var ruleFound bool
|
||||
if local, ok := s.local[name]; ok {
|
||||
for _, c := range local {
|
||||
if status, matched := c.Match(r); matched && status != Allow {
|
||||
return status, true
|
||||
}
|
||||
}
|
||||
}
|
||||
if cs, ok := s.namespace[name]; ok {
|
||||
status, ok := matchArray(cs, namespace, r)
|
||||
if ok && status != Allow {
|
||||
return status, true
|
||||
}
|
||||
ruleFound = ruleFound || ok
|
||||
}
|
||||
if cs, ok := s.resource[name]; ok {
|
||||
status, ok := matchArray(cs, r.Resource().Name(), r)
|
||||
if ok {
|
||||
return status, true
|
||||
}
|
||||
ruleFound = ruleFound || ok
|
||||
}
|
||||
if ruleFound {
|
||||
return Allow, true
|
||||
}
|
||||
return NoRuleFound, false
|
||||
}
|
||||
|
||||
func matchArray(cs []chain, object string, r Request) (Status, bool) {
|
||||
for _, c := range cs {
|
||||
if !globMatch(object, c.object) {
|
||||
continue
|
||||
}
|
||||
if status, matched := c.chain.Match(r); matched {
|
||||
return status, true
|
||||
}
|
||||
}
|
||||
return NoRuleFound, false
|
||||
}
|
||||
|
||||
func (s *inmemory) AddResourceChain(name Name, resource string, c *Chain) {
|
||||
s.resource[name] = append(s.resource[name], chain{resource, c})
|
||||
}
|
||||
|
||||
func (s *inmemory) AddNameSpaceChain(name Name, namespace string, c *Chain) {
|
||||
s.namespace[name] = append(s.namespace[name], chain{namespace, c})
|
||||
}
|
||||
|
||||
func (s *inmemory) AddOverride(name Name, c *Chain) {
|
||||
s.local[name] = append(s.local[name], c)
|
||||
}
|
||||
166
inmemory_test.go
Normal file
166
inmemory_test.go
Normal file
|
|
@ -0,0 +1,166 @@
|
|||
package policyengine
|
||||
|
||||
import (
|
||||
"testing"
|
||||
|
||||
"github.com/stretchr/testify/require"
|
||||
)
|
||||
|
||||
func TestInmemory(t *testing.T) {
|
||||
const (
|
||||
object = "native::object::abc/xyz"
|
||||
container = "native::object::abc/*"
|
||||
namespace = "Tenant1"
|
||||
actor1 = "owner1"
|
||||
actor2 = "owner2"
|
||||
)
|
||||
|
||||
s := NewInMemory()
|
||||
|
||||
// Object which was put via S3.
|
||||
res := newResource(object, map[string]string{"FromS3": "true"})
|
||||
// Request initiating from the trusted subnet and actor.
|
||||
reqGood := newRequest("native::object::put", res, map[string]string{
|
||||
"SourceIP": "10.1.1.12",
|
||||
"Actor": actor1,
|
||||
})
|
||||
|
||||
status, ok := s.IsAllowed(Ingress, namespace, reqGood)
|
||||
require.Equal(t, NoRuleFound, status)
|
||||
require.False(t, ok)
|
||||
|
||||
s.AddNameSpaceChain(Ingress, namespace, &Chain{
|
||||
Rules: []Rule{
|
||||
{ // Restrict to remove ANY object from the namespace.
|
||||
Status: AccessDenied,
|
||||
Action: []string{"native::object::delete"},
|
||||
Resource: []string{"native::object::*"},
|
||||
},
|
||||
{ // Allow to put object only from the trusted subnet AND trusted actor, deny otherwise.
|
||||
Status: AccessDenied,
|
||||
Action: []string{"native::object::put"},
|
||||
Resource: []string{"native::object::*"},
|
||||
Any: true,
|
||||
Condition: []Condition{
|
||||
{
|
||||
Op: CondStringNotLike,
|
||||
Object: ObjectRequest,
|
||||
Key: "SourceIP",
|
||||
Value: "10.1.1.*",
|
||||
},
|
||||
{
|
||||
Op: CondStringNotEquals,
|
||||
Object: ObjectRequest,
|
||||
Key: "Actor",
|
||||
Value: actor1,
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
})
|
||||
|
||||
s.AddResourceChain(Ingress, container, &Chain{
|
||||
Rules: []Rule{
|
||||
{ // Allow to actor2 to get objects from the specific container only if they have `Department=HR` attribute.
|
||||
Status: Allow,
|
||||
Action: []string{"native::object::get"},
|
||||
Resource: []string{"native::object::abc/*"},
|
||||
Condition: []Condition{
|
||||
{
|
||||
Op: CondStringEquals,
|
||||
Object: ObjectResource,
|
||||
Key: "Department",
|
||||
Value: "HR",
|
||||
},
|
||||
{
|
||||
Op: CondStringEquals,
|
||||
Object: ObjectRequest,
|
||||
Key: "Actor",
|
||||
Value: actor2,
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
})
|
||||
|
||||
t.Run("bad subnet, namespace deny", func(t *testing.T) {
|
||||
// Request initiating from the untrusted subnet.
|
||||
reqBadIP := newRequest("native::object::put", res, map[string]string{
|
||||
"SourceIP": "10.122.1.20",
|
||||
"Actor": actor1,
|
||||
})
|
||||
status, ok := s.IsAllowed(Ingress, namespace, reqBadIP)
|
||||
require.Equal(t, AccessDenied, status)
|
||||
require.True(t, ok)
|
||||
})
|
||||
t.Run("bad actor, namespace deny", func(t *testing.T) {
|
||||
// Request initiating from the untrusted actor.
|
||||
reqBadActor := newRequest("native::object::put", res, map[string]string{
|
||||
"SourceIP": "10.1.1.13",
|
||||
"Actor": actor2,
|
||||
})
|
||||
status, ok := s.IsAllowed(Ingress, namespace, reqBadActor)
|
||||
require.Equal(t, AccessDenied, status)
|
||||
require.True(t, ok)
|
||||
})
|
||||
t.Run("bad object, container deny", func(t *testing.T) {
|
||||
objGood := newResource("native::object::abc/id1", map[string]string{"Department": "HR"})
|
||||
objBadAttr := newResource("native::object::abc/id2", map[string]string{"Department": "Support"})
|
||||
|
||||
status, ok := s.IsAllowed(Ingress, namespace, newRequest("native::object::get", objGood, map[string]string{
|
||||
"SourceIP": "10.1.1.14",
|
||||
"Actor": actor2,
|
||||
}))
|
||||
require.Equal(t, Allow, status)
|
||||
require.True(t, ok)
|
||||
|
||||
status, ok = s.IsAllowed(Ingress, namespace, newRequest("native::object::get", objBadAttr, map[string]string{
|
||||
"SourceIP": "10.1.1.14",
|
||||
"Actor": actor2,
|
||||
}))
|
||||
require.Equal(t, NoRuleFound, status)
|
||||
require.False(t, ok)
|
||||
})
|
||||
t.Run("bad operation, namespace deny", func(t *testing.T) {
|
||||
// Request with the forbidden operation.
|
||||
reqBadOperation := newRequest("native::object::delete", res, map[string]string{
|
||||
"SourceIP": "10.1.1.12",
|
||||
"Actor": actor1,
|
||||
})
|
||||
status, ok := s.IsAllowed(Ingress, namespace, reqBadOperation)
|
||||
require.Equal(t, AccessDenied, status)
|
||||
require.True(t, ok)
|
||||
})
|
||||
t.Run("good", func(t *testing.T) {
|
||||
status, ok = s.IsAllowed(Ingress, namespace, reqGood)
|
||||
require.Equal(t, NoRuleFound, status)
|
||||
require.False(t, ok)
|
||||
|
||||
t.Run("quota on a different container", func(t *testing.T) {
|
||||
s.AddOverride(Ingress, &Chain{
|
||||
Rules: []Rule{{
|
||||
Status: QuotaLimitReached,
|
||||
Action: []string{"native::object::put"},
|
||||
Resource: []string{"native::object::cba/*"},
|
||||
}},
|
||||
})
|
||||
|
||||
status, ok = s.IsAllowed(Ingress, namespace, reqGood)
|
||||
require.Equal(t, NoRuleFound, status)
|
||||
require.False(t, ok)
|
||||
})
|
||||
t.Run("quota on the request container", func(t *testing.T) {
|
||||
s.AddOverride(Ingress, &Chain{
|
||||
Rules: []Rule{{
|
||||
Status: QuotaLimitReached,
|
||||
Action: []string{"native::object::put"},
|
||||
Resource: []string{"native::object::abc/*"},
|
||||
}},
|
||||
})
|
||||
|
||||
status, ok = s.IsAllowed(Ingress, namespace, reqGood)
|
||||
require.Equal(t, QuotaLimitReached, status)
|
||||
require.True(t, ok)
|
||||
})
|
||||
})
|
||||
}
|
||||
12
interface.go
Normal file
12
interface.go
Normal file
|
|
@ -0,0 +1,12 @@
|
|||
package policyengine
|
||||
|
||||
// CachedChainStorage ...
|
||||
type CachedChainStorage interface {
|
||||
Engine
|
||||
// Adds a policy chain used for all operations with a specific resource.
|
||||
AddResourceChain(name Name, resource string, c *Chain)
|
||||
// Adds a policy chain used for all operations in the namespace.
|
||||
AddNameSpaceChain(name Name, namespace string, c *Chain)
|
||||
// Adds a local policy chain used for all operations with this service.
|
||||
AddOverride(name Name, c *Chain)
|
||||
}
|
||||
|
|
@ -1,333 +0,0 @@
|
|||
package chain
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
"net/netip"
|
||||
"strings"
|
||||
|
||||
"git.frostfs.info/TrueCloudLab/policy-engine/pkg/resource"
|
||||
"git.frostfs.info/TrueCloudLab/policy-engine/util"
|
||||
"github.com/nspcc-dev/neo-go/pkg/encoding/fixedn"
|
||||
"golang.org/x/exp/slices"
|
||||
)
|
||||
|
||||
// ID is the ID of rule chain.
|
||||
type ID []byte
|
||||
|
||||
// MatchType is the match type for chain rules.
|
||||
type MatchType uint8
|
||||
|
||||
const (
|
||||
// MatchTypeDenyPriority rejects the request if any `Deny` is specified.
|
||||
MatchTypeDenyPriority MatchType = 0
|
||||
// MatchTypeFirstMatch returns the first rule action matched to the request.
|
||||
MatchTypeFirstMatch MatchType = 1
|
||||
)
|
||||
|
||||
//easyjson:json
|
||||
type Chain struct {
|
||||
ID ID
|
||||
|
||||
Rules []Rule
|
||||
|
||||
MatchType MatchType
|
||||
}
|
||||
|
||||
func (c *Chain) Bytes() []byte {
|
||||
data, err := c.MarshalBinary()
|
||||
if err != nil {
|
||||
panic(err)
|
||||
}
|
||||
return data
|
||||
}
|
||||
|
||||
func (c *Chain) DecodeBytes(b []byte) error {
|
||||
return c.UnmarshalBinary(b)
|
||||
}
|
||||
|
||||
type Rule struct {
|
||||
Status Status
|
||||
// Actions the operation is applied to.
|
||||
Actions Actions
|
||||
// List of the resources the operation is applied to.
|
||||
Resources Resources
|
||||
// True iff individual conditions must be combined with the logical OR.
|
||||
// By default AND is used, so _each_ condition must pass.
|
||||
Any bool
|
||||
Condition []Condition
|
||||
}
|
||||
|
||||
type Actions struct {
|
||||
Inverted bool
|
||||
Names []string
|
||||
}
|
||||
|
||||
type Resources struct {
|
||||
Inverted bool
|
||||
Names []string
|
||||
}
|
||||
|
||||
type Condition struct {
|
||||
Op ConditionType
|
||||
Kind ConditionKindType
|
||||
Key string
|
||||
Value string
|
||||
}
|
||||
|
||||
type ConditionKindType byte
|
||||
|
||||
const (
|
||||
KindResource ConditionKindType = iota
|
||||
KindRequest
|
||||
)
|
||||
|
||||
type ConditionType byte
|
||||
|
||||
// TODO @fyrchik: reduce the number of conditions.
|
||||
// Everything from here should be expressable, but we do not need them all.
|
||||
// https://docs.aws.amazon.com/IAM/latest/UserGuide/reference_policies_elements_condition_operators.html
|
||||
const (
|
||||
// String condition operators.
|
||||
CondStringEquals ConditionType = iota
|
||||
CondStringNotEquals
|
||||
CondStringEqualsIgnoreCase
|
||||
CondStringNotEqualsIgnoreCase
|
||||
CondStringLike
|
||||
CondStringNotLike
|
||||
CondStringLessThan
|
||||
CondStringLessThanEquals
|
||||
CondStringGreaterThan
|
||||
CondStringGreaterThanEquals
|
||||
|
||||
// Numeric condition operators.
|
||||
CondNumericEquals
|
||||
CondNumericNotEquals
|
||||
CondNumericLessThan
|
||||
CondNumericLessThanEquals
|
||||
CondNumericGreaterThan
|
||||
CondNumericGreaterThanEquals
|
||||
|
||||
CondSliceContains
|
||||
|
||||
CondIPAddress
|
||||
CondNotIPAddress
|
||||
)
|
||||
|
||||
var condToStr = []struct {
|
||||
ct ConditionType
|
||||
str string
|
||||
}{
|
||||
{CondStringEquals, "StringEquals"},
|
||||
{CondStringNotEquals, "StringNotEquals"},
|
||||
{CondStringEqualsIgnoreCase, "StringEqualsIgnoreCase"},
|
||||
{CondStringNotEqualsIgnoreCase, "StringNotEqualsIgnoreCase"},
|
||||
{CondStringLike, "StringLike"},
|
||||
{CondStringNotLike, "StringNotLike"},
|
||||
{CondStringLessThan, "StringLessThan"},
|
||||
{CondStringLessThanEquals, "StringLessThanEquals"},
|
||||
{CondStringGreaterThan, "StringGreaterThan"},
|
||||
{CondStringGreaterThanEquals, "StringGreaterThanEquals"},
|
||||
{CondNumericEquals, "NumericEquals"},
|
||||
{CondNumericNotEquals, "NumericNotEquals"},
|
||||
{CondNumericLessThan, "NumericLessThan"},
|
||||
{CondNumericLessThanEquals, "NumericLessThanEquals"},
|
||||
{CondNumericGreaterThan, "NumericGreaterThan"},
|
||||
{CondNumericGreaterThanEquals, "NumericGreaterThanEquals"},
|
||||
{CondSliceContains, "SliceContains"},
|
||||
{CondIPAddress, "IPAddress"},
|
||||
{CondNotIPAddress, "NotIPAddress"},
|
||||
}
|
||||
|
||||
func (c ConditionType) String() string {
|
||||
for _, v := range condToStr {
|
||||
if v.ct == c {
|
||||
return v.str
|
||||
}
|
||||
}
|
||||
return "unknown condition type"
|
||||
}
|
||||
|
||||
const condSliceContainsDelimiter = "\x00"
|
||||
|
||||
// FormCondSliceContainsValue builds value for ObjectResource or ObjectRequest property
|
||||
// that can be matched by CondSliceContains condition.
|
||||
func FormCondSliceContainsValue(values []string) string {
|
||||
return strings.Join(values, condSliceContainsDelimiter)
|
||||
}
|
||||
|
||||
func (c *Condition) Match(req resource.Request) bool {
|
||||
var val string
|
||||
switch c.Kind {
|
||||
case KindResource:
|
||||
val = req.Resource().Property(c.Key)
|
||||
case KindRequest:
|
||||
val = req.Property(c.Key)
|
||||
default:
|
||||
panic(fmt.Sprintf("unknown condition type: %d", c.Kind))
|
||||
}
|
||||
|
||||
switch c.Op {
|
||||
default:
|
||||
panic(fmt.Sprintf("unimplemented: %d", c.Op))
|
||||
case CondStringEquals:
|
||||
return val == c.Value
|
||||
case CondStringNotEquals:
|
||||
return val != c.Value
|
||||
case CondStringEqualsIgnoreCase:
|
||||
return strings.EqualFold(val, c.Value)
|
||||
case CondStringNotEqualsIgnoreCase:
|
||||
return !strings.EqualFold(val, c.Value)
|
||||
case CondStringLike:
|
||||
return util.GlobMatch(val, c.Value)
|
||||
case CondStringNotLike:
|
||||
return !util.GlobMatch(val, c.Value)
|
||||
case CondStringLessThan:
|
||||
return val < c.Value
|
||||
case CondStringLessThanEquals:
|
||||
return val <= c.Value
|
||||
case CondStringGreaterThan:
|
||||
return val > c.Value
|
||||
case CondStringGreaterThanEquals:
|
||||
return val >= c.Value
|
||||
case CondSliceContains:
|
||||
return slices.Contains(strings.Split(val, condSliceContainsDelimiter), c.Value)
|
||||
case CondNumericEquals, CondNumericNotEquals, CondNumericLessThan, CondNumericLessThanEquals, CondNumericGreaterThan,
|
||||
CondNumericGreaterThanEquals:
|
||||
return c.matchNumeric(val)
|
||||
case CondIPAddress, CondNotIPAddress:
|
||||
return c.matchIP(val)
|
||||
}
|
||||
}
|
||||
|
||||
func (c *Condition) matchNumeric(val string) bool {
|
||||
valDecimal, err := fixedn.Fixed8FromString(val)
|
||||
if err != nil {
|
||||
return c.Op == CondNumericNotEquals
|
||||
}
|
||||
|
||||
condVal, err := fixedn.Fixed8FromString(c.Value)
|
||||
if err != nil {
|
||||
return c.Op == CondNumericNotEquals
|
||||
}
|
||||
|
||||
switch c.Op {
|
||||
default:
|
||||
panic(fmt.Sprintf("unimplemented: %d", c.Op))
|
||||
case CondNumericEquals:
|
||||
return valDecimal.Equal(condVal)
|
||||
case CondNumericNotEquals:
|
||||
return !valDecimal.Equal(condVal)
|
||||
case CondNumericLessThan:
|
||||
return valDecimal.LessThan(condVal)
|
||||
case CondNumericLessThanEquals:
|
||||
return valDecimal.LessThan(condVal) || valDecimal.Equal(condVal)
|
||||
case CondNumericGreaterThan:
|
||||
return valDecimal.GreaterThan(condVal)
|
||||
case CondNumericGreaterThanEquals:
|
||||
return valDecimal.GreaterThan(condVal) || valDecimal.Equal(condVal)
|
||||
}
|
||||
}
|
||||
|
||||
func (c *Condition) matchIP(val string) bool {
|
||||
ipAddr, err := netip.ParseAddr(val)
|
||||
if err != nil {
|
||||
return false
|
||||
}
|
||||
|
||||
prefix, err := netip.ParsePrefix(c.Value)
|
||||
if err != nil {
|
||||
return false
|
||||
}
|
||||
|
||||
switch c.Op {
|
||||
default:
|
||||
panic(fmt.Sprintf("unimplemented: %d", c.Op))
|
||||
case CondIPAddress:
|
||||
return prefix.Contains(ipAddr)
|
||||
case CondNotIPAddress:
|
||||
return !prefix.Contains(ipAddr)
|
||||
}
|
||||
}
|
||||
|
||||
func (r *Rule) Match(req resource.Request) (status Status, matched bool) {
|
||||
found := len(r.Resources.Names) == 0
|
||||
for i := range r.Resources.Names {
|
||||
if util.GlobMatch(req.Resource().Name(), r.Resources.Names[i]) != r.Resources.Inverted {
|
||||
found = true
|
||||
break
|
||||
}
|
||||
}
|
||||
if !found {
|
||||
return NoRuleFound, false
|
||||
}
|
||||
for i := range r.Actions.Names {
|
||||
if util.GlobMatch(req.Operation(), r.Actions.Names[i]) != r.Actions.Inverted {
|
||||
return r.matchCondition(req)
|
||||
}
|
||||
}
|
||||
return NoRuleFound, false
|
||||
}
|
||||
|
||||
func (r *Rule) matchCondition(obj resource.Request) (status Status, matched bool) {
|
||||
if r.Any {
|
||||
return r.matchAny(obj)
|
||||
}
|
||||
return r.matchAll(obj)
|
||||
}
|
||||
|
||||
func (r *Rule) matchAny(obj resource.Request) (status Status, matched bool) {
|
||||
for i := range r.Condition {
|
||||
if r.Condition[i].Match(obj) {
|
||||
return r.Status, true
|
||||
}
|
||||
}
|
||||
return NoRuleFound, false
|
||||
}
|
||||
|
||||
func (r *Rule) matchAll(obj resource.Request) (status Status, matched bool) {
|
||||
for i := range r.Condition {
|
||||
if !r.Condition[i].Match(obj) {
|
||||
return NoRuleFound, false
|
||||
}
|
||||
}
|
||||
return r.Status, true
|
||||
}
|
||||
|
||||
func (c *Chain) Match(req resource.Request) (status Status, matched bool) {
|
||||
switch c.MatchType {
|
||||
case MatchTypeDenyPriority:
|
||||
return c.denyPriority(req)
|
||||
case MatchTypeFirstMatch:
|
||||
return c.firstMatch(req)
|
||||
default:
|
||||
panic(fmt.Sprintf("unknown MatchType %d", c.MatchType))
|
||||
}
|
||||
}
|
||||
|
||||
func (c *Chain) firstMatch(req resource.Request) (status Status, matched bool) {
|
||||
for i := range c.Rules {
|
||||
status, matched := c.Rules[i].Match(req)
|
||||
if matched {
|
||||
return status, true
|
||||
}
|
||||
}
|
||||
return NoRuleFound, false
|
||||
}
|
||||
|
||||
func (c *Chain) denyPriority(req resource.Request) (status Status, matched bool) {
|
||||
var allowFound bool
|
||||
for i := range c.Rules {
|
||||
status, matched := c.Rules[i].Match(req)
|
||||
if !matched {
|
||||
continue
|
||||
}
|
||||
if status != Allow {
|
||||
return status, true
|
||||
}
|
||||
allowFound = true
|
||||
}
|
||||
if allowFound {
|
||||
return Allow, true
|
||||
}
|
||||
return NoRuleFound, false
|
||||
}
|
||||
|
|
@ -1,463 +0,0 @@
|
|||
// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT.
|
||||
|
||||
package chain
|
||||
|
||||
import (
|
||||
json "encoding/json"
|
||||
easyjson "github.com/mailru/easyjson"
|
||||
jlexer "github.com/mailru/easyjson/jlexer"
|
||||
jwriter "github.com/mailru/easyjson/jwriter"
|
||||
)
|
||||
|
||||
// suppress unused package warning
|
||||
var (
|
||||
_ *json.RawMessage
|
||||
_ *jlexer.Lexer
|
||||
_ *jwriter.Writer
|
||||
_ easyjson.Marshaler
|
||||
)
|
||||
|
||||
func easyjsonE2758465DecodeGitFrostfsInfoTrueCloudLabPolicyEnginePkgChain(in *jlexer.Lexer, out *Chain) {
|
||||
isTopLevel := in.IsStart()
|
||||
if in.IsNull() {
|
||||
if isTopLevel {
|
||||
in.Consumed()
|
||||
}
|
||||
in.Skip()
|
||||
return
|
||||
}
|
||||
in.Delim('{')
|
||||
for !in.IsDelim('}') {
|
||||
key := in.UnsafeFieldName(false)
|
||||
in.WantColon()
|
||||
if in.IsNull() {
|
||||
in.Skip()
|
||||
in.WantComma()
|
||||
continue
|
||||
}
|
||||
switch key {
|
||||
case "ID":
|
||||
if in.IsNull() {
|
||||
in.Skip()
|
||||
out.ID = nil
|
||||
} else {
|
||||
out.ID = in.Bytes()
|
||||
}
|
||||
case "Rules":
|
||||
if in.IsNull() {
|
||||
in.Skip()
|
||||
out.Rules = nil
|
||||
} else {
|
||||
in.Delim('[')
|
||||
if out.Rules == nil {
|
||||
if !in.IsDelim(']') {
|
||||
out.Rules = make([]Rule, 0, 0)
|
||||
} else {
|
||||
out.Rules = []Rule{}
|
||||
}
|
||||
} else {
|
||||
out.Rules = (out.Rules)[:0]
|
||||
}
|
||||
for !in.IsDelim(']') {
|
||||
var v2 Rule
|
||||
easyjsonE2758465DecodeGitFrostfsInfoTrueCloudLabPolicyEnginePkgChain1(in, &v2)
|
||||
out.Rules = append(out.Rules, v2)
|
||||
in.WantComma()
|
||||
}
|
||||
in.Delim(']')
|
||||
}
|
||||
case "MatchType":
|
||||
(out.MatchType).UnmarshalEasyJSON(in)
|
||||
default:
|
||||
in.SkipRecursive()
|
||||
}
|
||||
in.WantComma()
|
||||
}
|
||||
in.Delim('}')
|
||||
if isTopLevel {
|
||||
in.Consumed()
|
||||
}
|
||||
}
|
||||
func easyjsonE2758465EncodeGitFrostfsInfoTrueCloudLabPolicyEnginePkgChain(out *jwriter.Writer, in Chain) {
|
||||
out.RawByte('{')
|
||||
first := true
|
||||
_ = first
|
||||
{
|
||||
const prefix string = ",\"ID\":"
|
||||
out.RawString(prefix[1:])
|
||||
out.Base64Bytes(in.ID)
|
||||
}
|
||||
{
|
||||
const prefix string = ",\"Rules\":"
|
||||
out.RawString(prefix)
|
||||
if in.Rules == nil && (out.Flags&jwriter.NilSliceAsEmpty) == 0 {
|
||||
out.RawString("null")
|
||||
} else {
|
||||
out.RawByte('[')
|
||||
for v5, v6 := range in.Rules {
|
||||
if v5 > 0 {
|
||||
out.RawByte(',')
|
||||
}
|
||||
easyjsonE2758465EncodeGitFrostfsInfoTrueCloudLabPolicyEnginePkgChain1(out, v6)
|
||||
}
|
||||
out.RawByte(']')
|
||||
}
|
||||
}
|
||||
{
|
||||
const prefix string = ",\"MatchType\":"
|
||||
out.RawString(prefix)
|
||||
(in.MatchType).MarshalEasyJSON(out)
|
||||
}
|
||||
out.RawByte('}')
|
||||
}
|
||||
|
||||
// MarshalJSON supports json.Marshaler interface
|
||||
func (v Chain) MarshalJSON() ([]byte, error) {
|
||||
w := jwriter.Writer{}
|
||||
easyjsonE2758465EncodeGitFrostfsInfoTrueCloudLabPolicyEnginePkgChain(&w, v)
|
||||
return w.Buffer.BuildBytes(), w.Error
|
||||
}
|
||||
|
||||
// MarshalEasyJSON supports easyjson.Marshaler interface
|
||||
func (v Chain) MarshalEasyJSON(w *jwriter.Writer) {
|
||||
easyjsonE2758465EncodeGitFrostfsInfoTrueCloudLabPolicyEnginePkgChain(w, v)
|
||||
}
|
||||
|
||||
// UnmarshalJSON supports json.Unmarshaler interface
|
||||
func (v *Chain) UnmarshalJSON(data []byte) error {
|
||||
r := jlexer.Lexer{Data: data}
|
||||
easyjsonE2758465DecodeGitFrostfsInfoTrueCloudLabPolicyEnginePkgChain(&r, v)
|
||||
return r.Error()
|
||||
}
|
||||
|
||||
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
|
||||
func (v *Chain) UnmarshalEasyJSON(l *jlexer.Lexer) {
|
||||
easyjsonE2758465DecodeGitFrostfsInfoTrueCloudLabPolicyEnginePkgChain(l, v)
|
||||
}
|
||||
func easyjsonE2758465DecodeGitFrostfsInfoTrueCloudLabPolicyEnginePkgChain1(in *jlexer.Lexer, out *Rule) {
|
||||
isTopLevel := in.IsStart()
|
||||
if in.IsNull() {
|
||||
if isTopLevel {
|
||||
in.Consumed()
|
||||
}
|
||||
in.Skip()
|
||||
return
|
||||
}
|
||||
in.Delim('{')
|
||||
for !in.IsDelim('}') {
|
||||
key := in.UnsafeFieldName(false)
|
||||
in.WantColon()
|
||||
if in.IsNull() {
|
||||
in.Skip()
|
||||
in.WantComma()
|
||||
continue
|
||||
}
|
||||
switch key {
|
||||
case "Status":
|
||||
(out.Status).UnmarshalEasyJSON(in)
|
||||
case "Actions":
|
||||
easyjsonE2758465DecodeGitFrostfsInfoTrueCloudLabPolicyEnginePkgChain2(in, &out.Actions)
|
||||
case "Resources":
|
||||
easyjsonE2758465DecodeGitFrostfsInfoTrueCloudLabPolicyEnginePkgChain3(in, &out.Resources)
|
||||
case "Any":
|
||||
out.Any = bool(in.Bool())
|
||||
case "Condition":
|
||||
if in.IsNull() {
|
||||
in.Skip()
|
||||
out.Condition = nil
|
||||
} else {
|
||||
in.Delim('[')
|
||||
if out.Condition == nil {
|
||||
if !in.IsDelim(']') {
|
||||
out.Condition = make([]Condition, 0, 1)
|
||||
} else {
|
||||
out.Condition = []Condition{}
|
||||
}
|
||||
} else {
|
||||
out.Condition = (out.Condition)[:0]
|
||||
}
|
||||
for !in.IsDelim(']') {
|
||||
var v7 Condition
|
||||
easyjsonE2758465DecodeGitFrostfsInfoTrueCloudLabPolicyEnginePkgChain4(in, &v7)
|
||||
out.Condition = append(out.Condition, v7)
|
||||
in.WantComma()
|
||||
}
|
||||
in.Delim(']')
|
||||
}
|
||||
default:
|
||||
in.SkipRecursive()
|
||||
}
|
||||
in.WantComma()
|
||||
}
|
||||
in.Delim('}')
|
||||
if isTopLevel {
|
||||
in.Consumed()
|
||||
}
|
||||
}
|
||||
func easyjsonE2758465EncodeGitFrostfsInfoTrueCloudLabPolicyEnginePkgChain1(out *jwriter.Writer, in Rule) {
|
||||
out.RawByte('{')
|
||||
first := true
|
||||
_ = first
|
||||
{
|
||||
const prefix string = ",\"Status\":"
|
||||
out.RawString(prefix[1:])
|
||||
(in.Status).MarshalEasyJSON(out)
|
||||
}
|
||||
{
|
||||
const prefix string = ",\"Actions\":"
|
||||
out.RawString(prefix)
|
||||
easyjsonE2758465EncodeGitFrostfsInfoTrueCloudLabPolicyEnginePkgChain2(out, in.Actions)
|
||||
}
|
||||
{
|
||||
const prefix string = ",\"Resources\":"
|
||||
out.RawString(prefix)
|
||||
easyjsonE2758465EncodeGitFrostfsInfoTrueCloudLabPolicyEnginePkgChain3(out, in.Resources)
|
||||
}
|
||||
{
|
||||
const prefix string = ",\"Any\":"
|
||||
out.RawString(prefix)
|
||||
out.Bool(bool(in.Any))
|
||||
}
|
||||
{
|
||||
const prefix string = ",\"Condition\":"
|
||||
out.RawString(prefix)
|
||||
if in.Condition == nil && (out.Flags&jwriter.NilSliceAsEmpty) == 0 {
|
||||
out.RawString("null")
|
||||
} else {
|
||||
out.RawByte('[')
|
||||
for v8, v9 := range in.Condition {
|
||||
if v8 > 0 {
|
||||
out.RawByte(',')
|
||||
}
|
||||
easyjsonE2758465EncodeGitFrostfsInfoTrueCloudLabPolicyEnginePkgChain4(out, v9)
|
||||
}
|
||||
out.RawByte(']')
|
||||
}
|
||||
}
|
||||
out.RawByte('}')
|
||||
}
|
||||
func easyjsonE2758465DecodeGitFrostfsInfoTrueCloudLabPolicyEnginePkgChain4(in *jlexer.Lexer, out *Condition) {
|
||||
isTopLevel := in.IsStart()
|
||||
if in.IsNull() {
|
||||
if isTopLevel {
|
||||
in.Consumed()
|
||||
}
|
||||
in.Skip()
|
||||
return
|
||||
}
|
||||
in.Delim('{')
|
||||
for !in.IsDelim('}') {
|
||||
key := in.UnsafeFieldName(false)
|
||||
in.WantColon()
|
||||
if in.IsNull() {
|
||||
in.Skip()
|
||||
in.WantComma()
|
||||
continue
|
||||
}
|
||||
switch key {
|
||||
case "Op":
|
||||
(out.Op).UnmarshalEasyJSON(in)
|
||||
case "Kind":
|
||||
(out.Kind).UnmarshalEasyJSON(in)
|
||||
case "Key":
|
||||
out.Key = string(in.String())
|
||||
case "Value":
|
||||
out.Value = string(in.String())
|
||||
default:
|
||||
in.SkipRecursive()
|
||||
}
|
||||
in.WantComma()
|
||||
}
|
||||
in.Delim('}')
|
||||
if isTopLevel {
|
||||
in.Consumed()
|
||||
}
|
||||
}
|
||||
func easyjsonE2758465EncodeGitFrostfsInfoTrueCloudLabPolicyEnginePkgChain4(out *jwriter.Writer, in Condition) {
|
||||
out.RawByte('{')
|
||||
first := true
|
||||
_ = first
|
||||
{
|
||||
const prefix string = ",\"Op\":"
|
||||
out.RawString(prefix[1:])
|
||||
(in.Op).MarshalEasyJSON(out)
|
||||
}
|
||||
{
|
||||
const prefix string = ",\"Kind\":"
|
||||
out.RawString(prefix)
|
||||
(in.Kind).MarshalEasyJSON(out)
|
||||
}
|
||||
{
|
||||
const prefix string = ",\"Key\":"
|
||||
out.RawString(prefix)
|
||||
out.String(string(in.Key))
|
||||
}
|
||||
{
|
||||
const prefix string = ",\"Value\":"
|
||||
out.RawString(prefix)
|
||||
out.String(string(in.Value))
|
||||
}
|
||||
out.RawByte('}')
|
||||
}
|
||||
func easyjsonE2758465DecodeGitFrostfsInfoTrueCloudLabPolicyEnginePkgChain3(in *jlexer.Lexer, out *Resources) {
|
||||
isTopLevel := in.IsStart()
|
||||
if in.IsNull() {
|
||||
if isTopLevel {
|
||||
in.Consumed()
|
||||
}
|
||||
in.Skip()
|
||||
return
|
||||
}
|
||||
in.Delim('{')
|
||||
for !in.IsDelim('}') {
|
||||
key := in.UnsafeFieldName(false)
|
||||
in.WantColon()
|
||||
if in.IsNull() {
|
||||
in.Skip()
|
||||
in.WantComma()
|
||||
continue
|
||||
}
|
||||
switch key {
|
||||
case "Inverted":
|
||||
out.Inverted = bool(in.Bool())
|
||||
case "Names":
|
||||
if in.IsNull() {
|
||||
in.Skip()
|
||||
out.Names = nil
|
||||
} else {
|
||||
in.Delim('[')
|
||||
if out.Names == nil {
|
||||
if !in.IsDelim(']') {
|
||||
out.Names = make([]string, 0, 4)
|
||||
} else {
|
||||
out.Names = []string{}
|
||||
}
|
||||
} else {
|
||||
out.Names = (out.Names)[:0]
|
||||
}
|
||||
for !in.IsDelim(']') {
|
||||
var v10 string
|
||||
v10 = string(in.String())
|
||||
out.Names = append(out.Names, v10)
|
||||
in.WantComma()
|
||||
}
|
||||
in.Delim(']')
|
||||
}
|
||||
default:
|
||||
in.SkipRecursive()
|
||||
}
|
||||
in.WantComma()
|
||||
}
|
||||
in.Delim('}')
|
||||
if isTopLevel {
|
||||
in.Consumed()
|
||||
}
|
||||
}
|
||||
func easyjsonE2758465EncodeGitFrostfsInfoTrueCloudLabPolicyEnginePkgChain3(out *jwriter.Writer, in Resources) {
|
||||
out.RawByte('{')
|
||||
first := true
|
||||
_ = first
|
||||
{
|
||||
const prefix string = ",\"Inverted\":"
|
||||
out.RawString(prefix[1:])
|
||||
out.Bool(bool(in.Inverted))
|
||||
}
|
||||
{
|
||||
const prefix string = ",\"Names\":"
|
||||
out.RawString(prefix)
|
||||
if in.Names == nil && (out.Flags&jwriter.NilSliceAsEmpty) == 0 {
|
||||
out.RawString("null")
|
||||
} else {
|
||||
out.RawByte('[')
|
||||
for v11, v12 := range in.Names {
|
||||
if v11 > 0 {
|
||||
out.RawByte(',')
|
||||
}
|
||||
out.String(string(v12))
|
||||
}
|
||||
out.RawByte(']')
|
||||
}
|
||||
}
|
||||
out.RawByte('}')
|
||||
}
|
||||
func easyjsonE2758465DecodeGitFrostfsInfoTrueCloudLabPolicyEnginePkgChain2(in *jlexer.Lexer, out *Actions) {
|
||||
isTopLevel := in.IsStart()
|
||||
if in.IsNull() {
|
||||
if isTopLevel {
|
||||
in.Consumed()
|
||||
}
|
||||
in.Skip()
|
||||
return
|
||||
}
|
||||
in.Delim('{')
|
||||
for !in.IsDelim('}') {
|
||||
key := in.UnsafeFieldName(false)
|
||||
in.WantColon()
|
||||
if in.IsNull() {
|
||||
in.Skip()
|
||||
in.WantComma()
|
||||
continue
|
||||
}
|
||||
switch key {
|
||||
case "Inverted":
|
||||
out.Inverted = bool(in.Bool())
|
||||
case "Names":
|
||||
if in.IsNull() {
|
||||
in.Skip()
|
||||
out.Names = nil
|
||||
} else {
|
||||
in.Delim('[')
|
||||
if out.Names == nil {
|
||||
if !in.IsDelim(']') {
|
||||
out.Names = make([]string, 0, 4)
|
||||
} else {
|
||||
out.Names = []string{}
|
||||
}
|
||||
} else {
|
||||
out.Names = (out.Names)[:0]
|
||||
}
|
||||
for !in.IsDelim(']') {
|
||||
var v13 string
|
||||
v13 = string(in.String())
|
||||
out.Names = append(out.Names, v13)
|
||||
in.WantComma()
|
||||
}
|
||||
in.Delim(']')
|
||||
}
|
||||
default:
|
||||
in.SkipRecursive()
|
||||
}
|
||||
in.WantComma()
|
||||
}
|
||||
in.Delim('}')
|
||||
if isTopLevel {
|
||||
in.Consumed()
|
||||
}
|
||||
}
|
||||
func easyjsonE2758465EncodeGitFrostfsInfoTrueCloudLabPolicyEnginePkgChain2(out *jwriter.Writer, in Actions) {
|
||||
out.RawByte('{')
|
||||
first := true
|
||||
_ = first
|
||||
{
|
||||
const prefix string = ",\"Inverted\":"
|
||||
out.RawString(prefix[1:])
|
||||
out.Bool(bool(in.Inverted))
|
||||
}
|
||||
{
|
||||
const prefix string = ",\"Names\":"
|
||||
out.RawString(prefix)
|
||||
if in.Names == nil && (out.Flags&jwriter.NilSliceAsEmpty) == 0 {
|
||||
out.RawString("null")
|
||||
} else {
|
||||
out.RawByte('[')
|
||||
for v14, v15 := range in.Names {
|
||||
if v14 > 0 {
|
||||
out.RawByte(',')
|
||||
}
|
||||
out.String(string(v15))
|
||||
}
|
||||
out.RawByte(']')
|
||||
}
|
||||
}
|
||||
out.RawByte('}')
|
||||
}
|
||||
File diff suppressed because it is too large
Load diff
|
|
@ -1,257 +0,0 @@
|
|||
package chain
|
||||
|
||||
import (
|
||||
"encoding"
|
||||
"fmt"
|
||||
|
||||
"git.frostfs.info/TrueCloudLab/policy-engine/pkg/marshal"
|
||||
)
|
||||
|
||||
const (
|
||||
ChainMarshalVersion uint8 = 0 // increase if breaking change
|
||||
)
|
||||
|
||||
var (
|
||||
_ encoding.BinaryMarshaler = (*Chain)(nil)
|
||||
_ encoding.BinaryUnmarshaler = (*Chain)(nil)
|
||||
)
|
||||
|
||||
func (c *Chain) MarshalBinary() ([]byte, error) {
|
||||
s := marshal.UInt8Size // Marshaller version
|
||||
s += marshal.UInt8Size // Chain version
|
||||
s += marshal.SliceSize(c.ID, func(byte) int { return marshal.ByteSize })
|
||||
s += marshal.SliceSize(c.Rules, ruleSize)
|
||||
s += marshal.UInt8Size // MatchType
|
||||
|
||||
buf := make([]byte, s)
|
||||
var offset int
|
||||
var err error
|
||||
offset, err = marshal.UInt8Marshal(buf, offset, marshal.Version)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
offset, err = marshal.UInt8Marshal(buf, offset, ChainMarshalVersion)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
offset, err = marshal.SliceMarshal(buf, offset, c.ID, marshal.ByteMarshal)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
offset, err = marshal.SliceMarshal(buf, offset, c.Rules, marshalRule)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
offset, err = marshal.UInt8Marshal(buf, offset, uint8(c.MatchType))
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
if err := marshal.VerifyMarshal(buf, offset); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return buf, nil
|
||||
}
|
||||
|
||||
func (c *Chain) UnmarshalBinary(data []byte) error {
|
||||
var offset int
|
||||
|
||||
marshallerVersion, offset, err := marshal.UInt8Unmarshal(data, offset)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
if marshallerVersion != marshal.Version {
|
||||
return fmt.Errorf("unsupported marshaller version %d", marshallerVersion)
|
||||
}
|
||||
|
||||
chainVersion, offset, err := marshal.UInt8Unmarshal(data, offset)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
if chainVersion != ChainMarshalVersion {
|
||||
return fmt.Errorf("unsupported chain version %d", chainVersion)
|
||||
}
|
||||
|
||||
idBytes, offset, err := marshal.SliceUnmarshal(data, offset, marshal.ByteUnmarshal)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
c.ID = ID(idBytes)
|
||||
|
||||
c.Rules, offset, err = marshal.SliceUnmarshal(data, offset, unmarshalRule)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
matchTypeV, offset, err := marshal.UInt8Unmarshal(data, offset)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
c.MatchType = MatchType(matchTypeV)
|
||||
|
||||
return marshal.VerifyUnmarshal(data, offset)
|
||||
}
|
||||
|
||||
func ruleSize(r Rule) int {
|
||||
s := marshal.ByteSize // Status
|
||||
s += actionsSize(r.Actions)
|
||||
s += resourcesSize(r.Resources)
|
||||
s += marshal.BoolSize // Any
|
||||
s += marshal.SliceSize(r.Condition, conditionSize)
|
||||
return s
|
||||
}
|
||||
|
||||
func marshalRule(buf []byte, offset int, r Rule) (int, error) {
|
||||
offset, err := marshal.ByteMarshal(buf, offset, byte(r.Status))
|
||||
if err != nil {
|
||||
return 0, err
|
||||
}
|
||||
offset, err = marshalActions(buf, offset, r.Actions)
|
||||
if err != nil {
|
||||
return 0, err
|
||||
}
|
||||
offset, err = marshalResources(buf, offset, r.Resources)
|
||||
if err != nil {
|
||||
return 0, err
|
||||
}
|
||||
offset, err = marshal.BoolMarshal(buf, offset, r.Any)
|
||||
if err != nil {
|
||||
return 0, err
|
||||
}
|
||||
return marshal.SliceMarshal(buf, offset, r.Condition, marshalCondition)
|
||||
}
|
||||
|
||||
func unmarshalRule(buf []byte, offset int) (Rule, int, error) {
|
||||
var r Rule
|
||||
statusV, offset, err := marshal.ByteUnmarshal(buf, offset)
|
||||
if err != nil {
|
||||
return Rule{}, 0, err
|
||||
}
|
||||
r.Status = Status(statusV)
|
||||
|
||||
r.Actions, offset, err = unmarshalActions(buf, offset)
|
||||
if err != nil {
|
||||
return Rule{}, 0, err
|
||||
}
|
||||
|
||||
r.Resources, offset, err = unmarshalResources(buf, offset)
|
||||
if err != nil {
|
||||
return Rule{}, 0, err
|
||||
}
|
||||
|
||||
r.Any, offset, err = marshal.BoolUnmarshal(buf, offset)
|
||||
if err != nil {
|
||||
return Rule{}, 0, err
|
||||
}
|
||||
|
||||
r.Condition, offset, err = marshal.SliceUnmarshal(buf, offset, unmarshalCondition)
|
||||
if err != nil {
|
||||
return Rule{}, 0, err
|
||||
}
|
||||
|
||||
return r, offset, nil
|
||||
}
|
||||
|
||||
func actionsSize(a Actions) int {
|
||||
return marshal.BoolSize + // Inverted
|
||||
marshal.SliceSize(a.Names, marshal.StringSize)
|
||||
}
|
||||
|
||||
func marshalActions(buf []byte, offset int, a Actions) (int, error) {
|
||||
offset, err := marshal.BoolMarshal(buf, offset, a.Inverted)
|
||||
if err != nil {
|
||||
return 0, err
|
||||
}
|
||||
return marshal.SliceMarshal(buf, offset, a.Names, marshal.StringMarshal)
|
||||
}
|
||||
|
||||
func unmarshalActions(buf []byte, offset int) (Actions, int, error) {
|
||||
var a Actions
|
||||
var err error
|
||||
a.Inverted, offset, err = marshal.BoolUnmarshal(buf, offset)
|
||||
if err != nil {
|
||||
return Actions{}, 0, err
|
||||
}
|
||||
a.Names, offset, err = marshal.SliceUnmarshal(buf, offset, marshal.StringUnmarshal)
|
||||
if err != nil {
|
||||
return Actions{}, 0, err
|
||||
}
|
||||
return a, offset, nil
|
||||
}
|
||||
|
||||
func resourcesSize(r Resources) int {
|
||||
return marshal.BoolSize + // Inverted
|
||||
marshal.SliceSize(r.Names, marshal.StringSize)
|
||||
}
|
||||
|
||||
func marshalResources(buf []byte, offset int, r Resources) (int, error) {
|
||||
offset, err := marshal.BoolMarshal(buf, offset, r.Inverted)
|
||||
if err != nil {
|
||||
return 0, err
|
||||
}
|
||||
return marshal.SliceMarshal(buf, offset, r.Names, marshal.StringMarshal)
|
||||
}
|
||||
|
||||
func unmarshalResources(buf []byte, offset int) (Resources, int, error) {
|
||||
var r Resources
|
||||
var err error
|
||||
r.Inverted, offset, err = marshal.BoolUnmarshal(buf, offset)
|
||||
if err != nil {
|
||||
return Resources{}, 0, err
|
||||
}
|
||||
r.Names, offset, err = marshal.SliceUnmarshal(buf, offset, marshal.StringUnmarshal)
|
||||
if err != nil {
|
||||
return Resources{}, 0, err
|
||||
}
|
||||
return r, offset, nil
|
||||
}
|
||||
|
||||
func conditionSize(c Condition) int {
|
||||
return marshal.ByteSize + // Op
|
||||
marshal.ByteSize + // Object
|
||||
marshal.StringSize(c.Key) +
|
||||
marshal.StringSize(c.Value)
|
||||
}
|
||||
|
||||
func marshalCondition(buf []byte, offset int, c Condition) (int, error) {
|
||||
offset, err := marshal.ByteMarshal(buf, offset, byte(c.Op))
|
||||
if err != nil {
|
||||
return 0, err
|
||||
}
|
||||
offset, err = marshal.ByteMarshal(buf, offset, byte(c.Kind))
|
||||
if err != nil {
|
||||
return 0, err
|
||||
}
|
||||
offset, err = marshal.StringMarshal(buf, offset, c.Key)
|
||||
if err != nil {
|
||||
return 0, err
|
||||
}
|
||||
return marshal.StringMarshal(buf, offset, c.Value)
|
||||
}
|
||||
|
||||
func unmarshalCondition(buf []byte, offset int) (Condition, int, error) {
|
||||
var c Condition
|
||||
opV, offset, err := marshal.ByteUnmarshal(buf, offset)
|
||||
if err != nil {
|
||||
return Condition{}, 0, err
|
||||
}
|
||||
c.Op = ConditionType(opV)
|
||||
|
||||
obV, offset, err := marshal.ByteUnmarshal(buf, offset)
|
||||
if err != nil {
|
||||
return Condition{}, 0, err
|
||||
}
|
||||
c.Kind = ConditionKindType(obV)
|
||||
|
||||
c.Key, offset, err = marshal.StringUnmarshal(buf, offset)
|
||||
if err != nil {
|
||||
return Condition{}, 0, err
|
||||
}
|
||||
|
||||
c.Value, offset, err = marshal.StringUnmarshal(buf, offset)
|
||||
if err != nil {
|
||||
return Condition{}, 0, err
|
||||
}
|
||||
|
||||
return c, offset, nil
|
||||
}
|
||||
|
|
@ -1,247 +0,0 @@
|
|||
package chain
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
"testing"
|
||||
|
||||
"git.frostfs.info/TrueCloudLab/policy-engine/schema/native"
|
||||
"github.com/google/uuid"
|
||||
"github.com/stretchr/testify/require"
|
||||
)
|
||||
|
||||
func TestChainMarshalling(t *testing.T) {
|
||||
t.Parallel()
|
||||
for _, id := range generateTestIDs() {
|
||||
for _, rules := range generateTestRules() {
|
||||
for _, matchType := range generateTestMatchTypes() {
|
||||
performMarshalTest(t, id, rules, matchType)
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
func TestInvalidChainData(t *testing.T) {
|
||||
var ch Chain
|
||||
require.Error(t, ch.UnmarshalBinary(nil))
|
||||
require.Error(t, ch.UnmarshalBinary([]byte{}))
|
||||
require.Error(t, ch.UnmarshalBinary([]byte{1, 2, 3}))
|
||||
require.Error(t, ch.UnmarshalBinary([]byte("\x00\x00:aws:iam::namespace:group/so\x82\x82\x82\x82\x82\x82u\x82")))
|
||||
}
|
||||
|
||||
func performMarshalTest(t *testing.T, id ID, r []Rule, mt MatchType) {
|
||||
chain := Chain{
|
||||
ID: id,
|
||||
Rules: r,
|
||||
MatchType: mt,
|
||||
}
|
||||
data, err := chain.MarshalBinary()
|
||||
require.NoError(t, err)
|
||||
|
||||
var unmarshalledChain Chain
|
||||
require.NoError(t, unmarshalledChain.UnmarshalBinary(data))
|
||||
|
||||
require.Equal(t, chain, unmarshalledChain)
|
||||
}
|
||||
|
||||
func generateTestIDs() []ID {
|
||||
return []ID{
|
||||
ID(""),
|
||||
ID(uuid.New().String()),
|
||||
ID("*::/"),
|
||||
ID("avada kedavra"),
|
||||
ID("arn:aws:iam::namespace:group/some_group"),
|
||||
ID("$Object:homomorphicHash"),
|
||||
ID("native:container/ns/9LPLUFZpEmfidG4n44vi2cjXKXSqWT492tCvLJiJ8W1J"),
|
||||
}
|
||||
}
|
||||
|
||||
func generateTestRules() [][]Rule {
|
||||
result := [][]Rule{
|
||||
nil,
|
||||
{},
|
||||
{},
|
||||
}
|
||||
|
||||
for _, st := range generateTestStatuses() {
|
||||
for _, act := range generateTestActions() {
|
||||
for _, res := range generateTestResources() {
|
||||
for _, cond := range generateTestConditions() {
|
||||
result[2] = append(result[2], Rule{
|
||||
Status: st,
|
||||
Actions: act,
|
||||
Resources: res,
|
||||
Condition: cond,
|
||||
Any: true,
|
||||
})
|
||||
result[2] = append(result[2], Rule{
|
||||
Status: st,
|
||||
Actions: act,
|
||||
Resources: res,
|
||||
Condition: cond,
|
||||
})
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
return result
|
||||
}
|
||||
|
||||
func generateTestStatuses() []Status {
|
||||
return []Status{
|
||||
Allow,
|
||||
NoRuleFound,
|
||||
AccessDenied,
|
||||
QuotaLimitReached,
|
||||
}
|
||||
}
|
||||
|
||||
func generateTestActions() []Actions {
|
||||
return []Actions{
|
||||
{
|
||||
Inverted: true,
|
||||
Names: nil,
|
||||
},
|
||||
{
|
||||
Names: nil,
|
||||
},
|
||||
{
|
||||
Inverted: true,
|
||||
Names: []string{},
|
||||
},
|
||||
{
|
||||
Names: []string{},
|
||||
},
|
||||
{
|
||||
Inverted: true,
|
||||
Names: []string{native.MethodPutObject},
|
||||
},
|
||||
{
|
||||
Names: []string{native.MethodPutObject},
|
||||
},
|
||||
{
|
||||
Inverted: true,
|
||||
Names: []string{native.MethodPutObject, native.MethodDeleteContainer, native.MethodDeleteObject},
|
||||
},
|
||||
{
|
||||
Names: []string{native.MethodPutObject, native.MethodDeleteContainer, native.MethodDeleteObject},
|
||||
},
|
||||
}
|
||||
}
|
||||
|
||||
func generateTestResources() []Resources {
|
||||
return []Resources{
|
||||
{
|
||||
Inverted: true,
|
||||
Names: nil,
|
||||
},
|
||||
{
|
||||
Names: nil,
|
||||
},
|
||||
{
|
||||
Inverted: true,
|
||||
Names: []string{},
|
||||
},
|
||||
{
|
||||
Names: []string{},
|
||||
},
|
||||
{
|
||||
Inverted: true,
|
||||
Names: []string{native.ResourceFormatAllObjects},
|
||||
},
|
||||
{
|
||||
Names: []string{native.ResourceFormatAllObjects},
|
||||
},
|
||||
{
|
||||
Inverted: true,
|
||||
Names: []string{
|
||||
native.ResourceFormatAllObjects,
|
||||
fmt.Sprintf(native.ResourceFormatRootContainer, "9LPLUFZpEmfidG4n44vi2cjXKXSqWT492tCvLJiJ8W1J"),
|
||||
},
|
||||
},
|
||||
{
|
||||
Names: []string{
|
||||
native.ResourceFormatAllObjects,
|
||||
fmt.Sprintf(native.ResourceFormatRootContainer, "9LPLUFZpEmfidG4n44vi2cjXKXSqWT492tCvLJiJ8W1J"),
|
||||
},
|
||||
},
|
||||
}
|
||||
}
|
||||
|
||||
func generateTestConditions() [][]Condition {
|
||||
result := [][]Condition{
|
||||
nil,
|
||||
{},
|
||||
{},
|
||||
}
|
||||
|
||||
for _, ct := range generateTestConditionTypes() {
|
||||
for _, ot := range generateObjectTypes() {
|
||||
result[2] = append(result[2], Condition{
|
||||
Op: ct,
|
||||
Kind: ot,
|
||||
Key: "",
|
||||
Value: "",
|
||||
})
|
||||
|
||||
result[2] = append(result[2], Condition{
|
||||
Op: ct,
|
||||
Kind: ot,
|
||||
Key: "key",
|
||||
Value: "",
|
||||
})
|
||||
|
||||
result[2] = append(result[2], Condition{
|
||||
Op: ct,
|
||||
Kind: ot,
|
||||
Key: "",
|
||||
Value: "value",
|
||||
})
|
||||
|
||||
result[2] = append(result[2], Condition{
|
||||
Op: ct,
|
||||
Kind: ot,
|
||||
Key: "key",
|
||||
Value: "value",
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
return result
|
||||
}
|
||||
|
||||
func generateTestConditionTypes() []ConditionType {
|
||||
return []ConditionType{
|
||||
CondStringEquals,
|
||||
CondStringNotEquals,
|
||||
CondStringEqualsIgnoreCase,
|
||||
CondStringNotEqualsIgnoreCase,
|
||||
CondStringLike,
|
||||
CondStringNotLike,
|
||||
CondStringLessThan,
|
||||
CondStringLessThanEquals,
|
||||
CondStringGreaterThan,
|
||||
CondStringGreaterThanEquals,
|
||||
CondNumericEquals,
|
||||
CondNumericNotEquals,
|
||||
CondNumericLessThan,
|
||||
CondNumericLessThanEquals,
|
||||
CondNumericGreaterThan,
|
||||
CondNumericGreaterThanEquals,
|
||||
CondSliceContains,
|
||||
}
|
||||
}
|
||||
|
||||
func generateObjectTypes() []ConditionKindType {
|
||||
return []ConditionKindType{
|
||||
KindResource,
|
||||
KindRequest,
|
||||
}
|
||||
}
|
||||
|
||||
func generateTestMatchTypes() []MatchType {
|
||||
return []MatchType{
|
||||
MatchTypeDenyPriority,
|
||||
MatchTypeFirstMatch,
|
||||
}
|
||||
}
|
||||
|
|
@ -1,13 +0,0 @@
|
|||
//go:build gofuzz
|
||||
// +build gofuzz
|
||||
|
||||
package chain
|
||||
|
||||
func DoFuzzChainUnmarshalBinary(data []byte) int {
|
||||
var ch Chain
|
||||
err := ch.UnmarshalBinary(data)
|
||||
if err != nil {
|
||||
return 0
|
||||
}
|
||||
return 1
|
||||
}
|
||||
|
|
@ -1,34 +0,0 @@
|
|||
//go:build gofuzz
|
||||
// +build gofuzz
|
||||
|
||||
package chain
|
||||
|
||||
import (
|
||||
"testing"
|
||||
|
||||
"github.com/stretchr/testify/require"
|
||||
)
|
||||
|
||||
func FuzzUnmarshal(f *testing.F) {
|
||||
for _, id := range generateTestIDs() {
|
||||
for _, rules := range generateTestRules() {
|
||||
for _, matchType := range generateTestMatchTypes() {
|
||||
|
||||
chain := Chain{
|
||||
ID: id,
|
||||
Rules: rules,
|
||||
MatchType: matchType,
|
||||
}
|
||||
data, err := chain.MarshalBinary()
|
||||
require.NoError(f, err)
|
||||
f.Add(data)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
f.Fuzz(func(t *testing.T, data []byte) {
|
||||
require.NotPanics(t, func() {
|
||||
DoFuzzChainUnmarshalBinary(data)
|
||||
})
|
||||
})
|
||||
}
|
||||
|
|
@ -1,145 +0,0 @@
|
|||
package chain
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
"strconv"
|
||||
|
||||
jlexer "github.com/mailru/easyjson/jlexer"
|
||||
jwriter "github.com/mailru/easyjson/jwriter"
|
||||
)
|
||||
|
||||
// Run `make generate`` if types added or changed
|
||||
|
||||
var matchTypeToJSONValue = []struct {
|
||||
mt MatchType
|
||||
str string
|
||||
}{
|
||||
{MatchTypeDenyPriority, "DenyPriority"},
|
||||
{MatchTypeFirstMatch, "FirstMatch"},
|
||||
}
|
||||
|
||||
var statusToJSONValue = []struct {
|
||||
s Status
|
||||
str string
|
||||
}{
|
||||
{Allow, "Allow"},
|
||||
{NoRuleFound, "NoRuleFound"},
|
||||
{AccessDenied, "AccessDenied"},
|
||||
{QuotaLimitReached, "QuotaLimitReached"},
|
||||
}
|
||||
|
||||
var objectTypeToJSONValue = []struct {
|
||||
t ConditionKindType
|
||||
str string
|
||||
}{
|
||||
{KindRequest, "Request"},
|
||||
{KindResource, "Resource"},
|
||||
}
|
||||
|
||||
func (mt MatchType) MarshalEasyJSON(w *jwriter.Writer) {
|
||||
for _, p := range matchTypeToJSONValue {
|
||||
if p.mt == mt {
|
||||
w.String(p.str)
|
||||
return
|
||||
}
|
||||
}
|
||||
w.String(strconv.FormatUint(uint64(mt), 10))
|
||||
}
|
||||
|
||||
func (mt *MatchType) UnmarshalEasyJSON(l *jlexer.Lexer) {
|
||||
str := l.String()
|
||||
for _, p := range matchTypeToJSONValue {
|
||||
if p.str == str {
|
||||
*mt = p.mt
|
||||
return
|
||||
}
|
||||
}
|
||||
|
||||
v, err := strconv.ParseUint(str, 10, 8)
|
||||
if err != nil {
|
||||
l.AddError(fmt.Errorf("failed to parse match type: %w", err))
|
||||
return
|
||||
}
|
||||
*mt = MatchType(v)
|
||||
}
|
||||
|
||||
func (st Status) MarshalEasyJSON(w *jwriter.Writer) {
|
||||
for _, p := range statusToJSONValue {
|
||||
if p.s == st {
|
||||
w.String(p.str)
|
||||
return
|
||||
}
|
||||
}
|
||||
w.String(strconv.FormatUint(uint64(st), 10))
|
||||
}
|
||||
|
||||
func (st *Status) UnmarshalEasyJSON(l *jlexer.Lexer) {
|
||||
str := l.String()
|
||||
for _, p := range statusToJSONValue {
|
||||
if p.str == str {
|
||||
*st = p.s
|
||||
return
|
||||
}
|
||||
}
|
||||
|
||||
v, err := strconv.ParseUint(str, 10, 8)
|
||||
if err != nil {
|
||||
l.AddError(fmt.Errorf("failed to parse status: %w", err))
|
||||
return
|
||||
}
|
||||
*st = Status(v)
|
||||
}
|
||||
|
||||
func (ot ConditionKindType) MarshalEasyJSON(w *jwriter.Writer) {
|
||||
for _, p := range objectTypeToJSONValue {
|
||||
if p.t == ot {
|
||||
w.String(p.str)
|
||||
return
|
||||
}
|
||||
}
|
||||
w.String(strconv.FormatUint(uint64(ot), 10))
|
||||
}
|
||||
|
||||
func (ot *ConditionKindType) UnmarshalEasyJSON(l *jlexer.Lexer) {
|
||||
str := l.String()
|
||||
for _, p := range objectTypeToJSONValue {
|
||||
if p.str == str {
|
||||
*ot = p.t
|
||||
return
|
||||
}
|
||||
}
|
||||
|
||||
v, err := strconv.ParseUint(str, 10, 8)
|
||||
if err != nil {
|
||||
l.AddError(fmt.Errorf("failed to parse object type: %w", err))
|
||||
return
|
||||
}
|
||||
*ot = ConditionKindType(v)
|
||||
}
|
||||
|
||||
func (ct ConditionType) MarshalEasyJSON(w *jwriter.Writer) {
|
||||
for _, p := range condToStr {
|
||||
if p.ct == ct {
|
||||
w.String(p.str)
|
||||
return
|
||||
}
|
||||
}
|
||||
w.String(strconv.FormatUint(uint64(ct), 10))
|
||||
}
|
||||
|
||||
func (ct *ConditionType) UnmarshalEasyJSON(l *jlexer.Lexer) {
|
||||
str := l.String()
|
||||
for _, p := range condToStr {
|
||||
if p.str == str {
|
||||
*ct = p.ct
|
||||
return
|
||||
}
|
||||
}
|
||||
|
||||
v, err := strconv.ParseUint(str, 10, 8)
|
||||
if err != nil {
|
||||
l.AddError(fmt.Errorf("failed to parse condition type: %w", err))
|
||||
return
|
||||
}
|
||||
*ct = ConditionType(v)
|
||||
}
|
||||
|
|
@ -1,121 +0,0 @@
|
|||
package chain
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
"os"
|
||||
"testing"
|
||||
|
||||
"git.frostfs.info/TrueCloudLab/policy-engine/schema/native"
|
||||
"github.com/nspcc-dev/neo-go/pkg/crypto/keys"
|
||||
"github.com/stretchr/testify/require"
|
||||
)
|
||||
|
||||
func TestID(t *testing.T) {
|
||||
key, err := keys.NewPrivateKeyFromWIF("L5eVx6HcHaFpQpvjQ3fy29uKDZ8rQ34bfMVx4XfZMm52EqafpNMg") // s3-gw key
|
||||
require.NoError(t, err)
|
||||
|
||||
chain1 := &Chain{ID: ID(key.PublicKey().GetScriptHash().BytesBE())}
|
||||
data := chain1.Bytes()
|
||||
|
||||
var chain2 Chain
|
||||
require.NoError(t, chain2.DecodeBytes(data))
|
||||
|
||||
require.Equal(t, chain1.ID, chain2.ID)
|
||||
|
||||
data, err = chain1.MarshalJSON()
|
||||
require.NoError(t, err)
|
||||
|
||||
require.NoError(t, chain2.UnmarshalJSON(data))
|
||||
|
||||
require.Equal(t, chain1.ID, chain2.ID)
|
||||
}
|
||||
|
||||
func TestMatchTypeJson(t *testing.T) {
|
||||
for _, mt := range []MatchType{MatchTypeDenyPriority, MatchTypeFirstMatch, MatchType(100)} {
|
||||
var chain Chain
|
||||
chain.MatchType = mt
|
||||
|
||||
data, err := chain.MarshalJSON()
|
||||
require.NoError(t, err)
|
||||
if mt == MatchTypeDenyPriority {
|
||||
require.Equal(t, []byte("{\"ID\":null,\"Rules\":null,\"MatchType\":\"DenyPriority\"}"), data)
|
||||
} else if mt == MatchTypeFirstMatch {
|
||||
require.Equal(t, []byte("{\"ID\":null,\"Rules\":null,\"MatchType\":\"FirstMatch\"}"), data)
|
||||
} else {
|
||||
require.Equal(t, []byte(fmt.Sprintf("{\"ID\":null,\"Rules\":null,\"MatchType\":\"%d\"}", mt)), data)
|
||||
}
|
||||
|
||||
var parsed Chain
|
||||
require.NoError(t, parsed.UnmarshalJSON(data))
|
||||
require.Equal(t, chain, parsed)
|
||||
|
||||
require.Error(t, parsed.UnmarshalJSON([]byte("{\"ID\":\"\",\"Rules\":null,\"MatchType\":\"NotValid\"}")))
|
||||
}
|
||||
}
|
||||
|
||||
func TestJsonEnums(t *testing.T) {
|
||||
chain := Chain{
|
||||
ID: []byte("2cca5ae7-cee8-428d-b45f-567fb1d03f01"), // will be encoded to base64
|
||||
MatchType: MatchTypeFirstMatch,
|
||||
Rules: []Rule{
|
||||
{
|
||||
Status: AccessDenied,
|
||||
Actions: Actions{
|
||||
Names: []string{native.MethodDeleteObject, native.MethodGetContainer},
|
||||
},
|
||||
Resources: Resources{
|
||||
Names: []string{native.ResourceFormatAllObjects},
|
||||
},
|
||||
Condition: []Condition{
|
||||
{
|
||||
Op: CondStringEquals,
|
||||
Kind: KindRequest,
|
||||
Key: native.PropertyKeyActorRole,
|
||||
Value: native.PropertyValueContainerRoleOthers,
|
||||
},
|
||||
},
|
||||
},
|
||||
{
|
||||
Status: QuotaLimitReached,
|
||||
Actions: Actions{
|
||||
Inverted: true,
|
||||
Names: []string{native.MethodPutObject},
|
||||
},
|
||||
Resources: Resources{
|
||||
Names: []string{fmt.Sprintf(native.ResourceFormatRootContainerObjects, "9LPLUFZpEmfidG4n44vi2cjXKXSqWT492tCvLJiJ8W1J")},
|
||||
},
|
||||
Any: true,
|
||||
Condition: []Condition{
|
||||
{
|
||||
Op: CondStringNotLike,
|
||||
Kind: KindResource,
|
||||
Key: native.PropertyKeyObjectType,
|
||||
Value: "regular",
|
||||
},
|
||||
},
|
||||
},
|
||||
{
|
||||
Status: Status(100),
|
||||
Condition: []Condition{
|
||||
{
|
||||
Op: ConditionType(255),
|
||||
Kind: ConditionKindType(128),
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
}
|
||||
|
||||
data, err := chain.MarshalJSON()
|
||||
require.NoError(t, err)
|
||||
|
||||
var parsed Chain
|
||||
require.NoError(t, parsed.UnmarshalJSON(data))
|
||||
require.Equal(t, chain, parsed)
|
||||
|
||||
expected, err := os.ReadFile("./testdata/test_status_json.json")
|
||||
require.NoError(t, err)
|
||||
|
||||
require.NoError(t, parsed.UnmarshalJSON(expected))
|
||||
require.Equal(t, chain, parsed)
|
||||
}
|
||||
75
pkg/chain/testdata/test_status_json.json
vendored
75
pkg/chain/testdata/test_status_json.json
vendored
|
|
@ -1,75 +0,0 @@
|
|||
{
|
||||
"ID": "MmNjYTVhZTctY2VlOC00MjhkLWI0NWYtNTY3ZmIxZDAzZjAx",
|
||||
"Rules": [
|
||||
{
|
||||
"Status": "AccessDenied",
|
||||
"Actions": {
|
||||
"Inverted": false,
|
||||
"Names": [
|
||||
"DeleteObject",
|
||||
"GetContainer"
|
||||
]
|
||||
},
|
||||
"Resources": {
|
||||
"Inverted": false,
|
||||
"Names": [
|
||||
"native:object/*"
|
||||
]
|
||||
},
|
||||
"Any": false,
|
||||
"Condition": [
|
||||
{
|
||||
"Op": "StringEquals",
|
||||
"Kind": "Request",
|
||||
"Key": "$Actor:role",
|
||||
"Value": "others"
|
||||
}
|
||||
]
|
||||
},
|
||||
{
|
||||
"Status": "QuotaLimitReached",
|
||||
"Actions": {
|
||||
"Inverted": true,
|
||||
"Names": [
|
||||
"PutObject"
|
||||
]
|
||||
},
|
||||
"Resources": {
|
||||
"Inverted": false,
|
||||
"Names": [
|
||||
"native:object//9LPLUFZpEmfidG4n44vi2cjXKXSqWT492tCvLJiJ8W1J/*"
|
||||
]
|
||||
},
|
||||
"Any": true,
|
||||
"Condition": [
|
||||
{
|
||||
"Op": "StringNotLike",
|
||||
"Kind": "Resource",
|
||||
"Key": "$Object:objectType",
|
||||
"Value": "regular"
|
||||
}
|
||||
]
|
||||
},
|
||||
{
|
||||
"Status": "100",
|
||||
"Actions": {
|
||||
"Inverted": false,
|
||||
"Names": null
|
||||
},
|
||||
"Resources": {
|
||||
"Inverted": false,
|
||||
"Names": null
|
||||
},
|
||||
"Any": false,
|
||||
"Condition": [
|
||||
{
|
||||
"Op": "255",
|
||||
"Kind": "128",
|
||||
"Key": "",
|
||||
"Value": ""
|
||||
}
|
||||
]
|
||||
}
|
||||
],
|
||||
"MatchType": "FirstMatch"
|
||||
}
|
||||
|
|
@ -1,109 +0,0 @@
|
|||
package engine
|
||||
|
||||
import (
|
||||
"git.frostfs.info/TrueCloudLab/policy-engine/pkg/chain"
|
||||
"git.frostfs.info/TrueCloudLab/policy-engine/pkg/resource"
|
||||
)
|
||||
|
||||
type defaultChainRouter struct {
|
||||
morph MorphRuleChainStorageReader
|
||||
|
||||
local LocalOverrideStorage
|
||||
}
|
||||
|
||||
func NewDefaultChainRouter(morph MorphRuleChainStorageReader) ChainRouter {
|
||||
return &defaultChainRouter{
|
||||
morph: morph,
|
||||
}
|
||||
}
|
||||
|
||||
func NewDefaultChainRouterWithLocalOverrides(morph MorphRuleChainStorageReader, local LocalOverrideStorage) ChainRouter {
|
||||
return &defaultChainRouter{
|
||||
morph: morph,
|
||||
local: local,
|
||||
}
|
||||
}
|
||||
|
||||
func (dr *defaultChainRouter) IsAllowed(name chain.Name, rt RequestTarget, r resource.Request) (status chain.Status, ruleFound bool, err error) {
|
||||
status, ruleFound, err = dr.checkLocal(name, rt, r)
|
||||
if err != nil {
|
||||
return chain.NoRuleFound, false, err
|
||||
} else if ruleFound {
|
||||
// The local overrides have the highest priority and thus
|
||||
// morph rules are not considered if a local one is found.
|
||||
return
|
||||
}
|
||||
|
||||
status, ruleFound, err = dr.checkMorph(name, rt, r)
|
||||
return
|
||||
}
|
||||
|
||||
func (dr *defaultChainRouter) checkLocal(name chain.Name, rt RequestTarget, r resource.Request) (status chain.Status, ruleFound bool, err error) {
|
||||
if dr.local == nil {
|
||||
return
|
||||
}
|
||||
|
||||
var hasAllow bool
|
||||
for _, target := range rt.Targets() {
|
||||
status, ruleFound, err = dr.matchLocalOverrides(name, target, r)
|
||||
if err != nil || ruleFound && status != chain.Allow {
|
||||
return
|
||||
}
|
||||
hasAllow = hasAllow || ruleFound
|
||||
}
|
||||
|
||||
if hasAllow {
|
||||
return chain.Allow, true, nil
|
||||
}
|
||||
return chain.NoRuleFound, false, nil
|
||||
}
|
||||
|
||||
func (dr *defaultChainRouter) checkMorph(name chain.Name, rt RequestTarget, r resource.Request) (status chain.Status, ruleFound bool, err error) {
|
||||
var hasAllow bool
|
||||
for _, target := range rt.Targets() {
|
||||
status, ruleFound, err = dr.matchMorphRuleChains(name, target, r)
|
||||
if err != nil || ruleFound && status != chain.Allow {
|
||||
return
|
||||
}
|
||||
hasAllow = hasAllow || ruleFound
|
||||
}
|
||||
|
||||
if hasAllow {
|
||||
return chain.Allow, true, nil
|
||||
}
|
||||
return chain.NoRuleFound, false, nil
|
||||
}
|
||||
|
||||
func (dr *defaultChainRouter) matchLocalOverrides(name chain.Name, target Target, r resource.Request) (status chain.Status, ruleFound bool, err error) {
|
||||
localOverrides, err := dr.local.ListOverrides(name, target)
|
||||
if err != nil {
|
||||
return
|
||||
}
|
||||
status, ruleFound = dr.getStatusFromChains(localOverrides, r)
|
||||
return
|
||||
}
|
||||
|
||||
func (dr *defaultChainRouter) matchMorphRuleChains(name chain.Name, target Target, r resource.Request) (status chain.Status, ruleFound bool, err error) {
|
||||
namespaceChains, err := dr.morph.ListMorphRuleChains(name, target)
|
||||
if err != nil {
|
||||
return chain.NoRuleFound, false, err
|
||||
}
|
||||
status, ruleFound = dr.getStatusFromChains(namespaceChains, r)
|
||||
return
|
||||
}
|
||||
|
||||
func (dr *defaultChainRouter) getStatusFromChains(chains []*chain.Chain, r resource.Request) (chain.Status, bool) {
|
||||
var allow bool
|
||||
for _, c := range chains {
|
||||
if status, found := c.Match(r); found {
|
||||
if status != chain.Allow {
|
||||
return status, true
|
||||
}
|
||||
allow = true
|
||||
}
|
||||
}
|
||||
if allow {
|
||||
return chain.Allow, true
|
||||
}
|
||||
return chain.NoRuleFound, false
|
||||
}
|
||||
|
|
@ -1,10 +0,0 @@
|
|||
package engine
|
||||
|
||||
import "errors"
|
||||
|
||||
var (
|
||||
ErrUnknownTarget = errors.New("unknown target type")
|
||||
ErrChainNotFound = errors.New("chain not found")
|
||||
ErrChainNameNotFound = errors.New("chain name not found")
|
||||
ErrResourceNotFound = errors.New("resource not found")
|
||||
)
|
||||
|
|
@ -1,48 +0,0 @@
|
|||
package inmemory
|
||||
|
||||
import (
|
||||
"git.frostfs.info/TrueCloudLab/policy-engine/pkg/chain"
|
||||
"git.frostfs.info/TrueCloudLab/policy-engine/pkg/engine"
|
||||
"git.frostfs.info/TrueCloudLab/policy-engine/pkg/resource"
|
||||
)
|
||||
|
||||
type inmemory struct {
|
||||
router engine.ChainRouter
|
||||
|
||||
morph engine.MorphRuleChainStorage
|
||||
|
||||
local engine.LocalOverrideStorage
|
||||
}
|
||||
|
||||
// NewInMemoryLocalOverrides returns new inmemory instance of chain storage with
|
||||
// local overrides manager.
|
||||
func NewInMemoryLocalOverrides() engine.LocalOverrideEngine {
|
||||
morph := NewInmemoryMorphRuleChainStorage()
|
||||
local := NewInmemoryLocalStorage()
|
||||
return &inmemory{
|
||||
router: engine.NewDefaultChainRouterWithLocalOverrides(morph, local),
|
||||
morph: morph,
|
||||
local: local,
|
||||
}
|
||||
}
|
||||
|
||||
// NewInMemory returns new inmemory instance of chain storage.
|
||||
func NewInMemory() engine.Engine {
|
||||
morph := NewInmemoryMorphRuleChainStorage()
|
||||
return &inmemory{
|
||||
router: engine.NewDefaultChainRouter(morph),
|
||||
morph: morph,
|
||||
}
|
||||
}
|
||||
|
||||
func (im *inmemory) LocalStorage() engine.LocalOverrideStorage {
|
||||
return im.local
|
||||
}
|
||||
|
||||
func (im *inmemory) MorphRuleChainStorage() engine.MorphRuleChainStorage {
|
||||
return im.morph
|
||||
}
|
||||
|
||||
func (im *inmemory) IsAllowed(name chain.Name, rt engine.RequestTarget, r resource.Request) (status chain.Status, ruleFound bool, err error) {
|
||||
return im.router.IsAllowed(name, rt, r)
|
||||
}
|
||||
|
|
@ -1,377 +0,0 @@
|
|||
package inmemory
|
||||
|
||||
import (
|
||||
"bytes"
|
||||
"testing"
|
||||
|
||||
"git.frostfs.info/TrueCloudLab/policy-engine/pkg/chain"
|
||||
"git.frostfs.info/TrueCloudLab/policy-engine/pkg/engine"
|
||||
resourcetest "git.frostfs.info/TrueCloudLab/policy-engine/pkg/resource/testutil"
|
||||
"github.com/nspcc-dev/neo-go/pkg/vm/stackitem"
|
||||
"github.com/stretchr/testify/require"
|
||||
)
|
||||
|
||||
func TestAddRootOverrides(t *testing.T) {
|
||||
s := NewInMemoryLocalOverrides()
|
||||
|
||||
target := engine.NamespaceTarget("")
|
||||
|
||||
id, err := s.LocalStorage().AddOverride(chain.S3, target, &chain.Chain{
|
||||
Rules: []chain.Rule{{
|
||||
Status: chain.Allow,
|
||||
Actions: chain.Actions{Names: []string{"s3:PutObject"}},
|
||||
Resources: chain.Resources{Names: []string{"*"}},
|
||||
}},
|
||||
})
|
||||
require.NoError(t, err)
|
||||
|
||||
res, err := s.LocalStorage().ListOverrides(chain.S3, target)
|
||||
require.NoError(t, err)
|
||||
require.Len(t, res, 1)
|
||||
require.Equal(t, string(id), string(res[0].ID))
|
||||
}
|
||||
|
||||
func TestInmemory_MultipleTargets(t *testing.T) {
|
||||
const op = "ape::test::op"
|
||||
|
||||
targets := []engine.Target{
|
||||
engine.NamespaceTarget("ns1"),
|
||||
engine.ContainerTarget("cnr1"),
|
||||
engine.GroupTarget("group1"),
|
||||
engine.UserTarget("user1"),
|
||||
}
|
||||
req := resourcetest.NewRequest(op, resourcetest.NewResource("r", nil), nil)
|
||||
target := engine.NewRequestTargetExtended("ns1", "cnr1", "user1", []string{"group1"})
|
||||
for _, tt := range targets {
|
||||
t.Run("morph", func(t *testing.T) {
|
||||
s := NewInMemoryLocalOverrides()
|
||||
s.MorphRuleChainStorage().AddMorphRuleChain(chain.Ingress, tt, &chain.Chain{
|
||||
Rules: []chain.Rule{{
|
||||
Status: chain.Allow,
|
||||
Actions: chain.Actions{Names: []string{op}},
|
||||
}},
|
||||
})
|
||||
|
||||
status, found, err := s.IsAllowed(chain.Ingress, target, req)
|
||||
require.NoError(t, err)
|
||||
require.True(t, found)
|
||||
require.Equal(t, chain.Allow, status)
|
||||
})
|
||||
t.Run("override", func(t *testing.T) {
|
||||
s := NewInMemoryLocalOverrides()
|
||||
s.LocalStorage().AddOverride(chain.Ingress, tt, &chain.Chain{
|
||||
Rules: []chain.Rule{{
|
||||
Status: chain.Allow,
|
||||
Actions: chain.Actions{Names: []string{op}},
|
||||
}},
|
||||
})
|
||||
|
||||
status, found, err := s.IsAllowed(chain.Ingress, target, req)
|
||||
require.NoError(t, err)
|
||||
require.True(t, found)
|
||||
require.Equal(t, chain.Allow, status)
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
func TestInmemory(t *testing.T) {
|
||||
const (
|
||||
object = "native::object::abc/xyz"
|
||||
container = "native::object::abc/*"
|
||||
namespace = "Tenant1"
|
||||
namespace2 = "Tenant2"
|
||||
actor1 = "owner1"
|
||||
actor2 = "owner2"
|
||||
)
|
||||
|
||||
s := NewInMemoryLocalOverrides()
|
||||
|
||||
// Object which was put via S3.
|
||||
res := resourcetest.NewResource(object, map[string]string{"FromS3": "true"})
|
||||
// Request initiating from the trusted subnet and actor.
|
||||
reqGood := resourcetest.NewRequest("native::object::put", res, map[string]string{
|
||||
"SourceIP": "10.1.1.12",
|
||||
"Actor": actor1,
|
||||
})
|
||||
|
||||
status, ok, _ := s.IsAllowed(chain.Ingress, engine.NewRequestTargetWithNamespace(namespace), reqGood)
|
||||
require.Equal(t, chain.NoRuleFound, status)
|
||||
require.False(t, ok)
|
||||
|
||||
s.MorphRuleChainStorage().AddMorphRuleChain(chain.Ingress, engine.NamespaceTarget(namespace), &chain.Chain{
|
||||
Rules: []chain.Rule{
|
||||
{ // Restrict to remove ANY object from the namespace.
|
||||
Status: chain.AccessDenied,
|
||||
Actions: chain.Actions{Names: []string{"native::object::delete"}},
|
||||
Resources: chain.Resources{Names: []string{"native::object::*"}},
|
||||
},
|
||||
{ // Allow to put object only from the trusted subnet AND trusted actor, deny otherwise.
|
||||
Status: chain.AccessDenied,
|
||||
Actions: chain.Actions{Names: []string{"native::object::put"}},
|
||||
Resources: chain.Resources{Names: []string{"native::object::*"}},
|
||||
Any: true,
|
||||
Condition: []chain.Condition{
|
||||
{
|
||||
Op: chain.CondStringNotLike,
|
||||
Kind: chain.KindRequest,
|
||||
Key: "SourceIP",
|
||||
Value: "10.1.1.*",
|
||||
},
|
||||
{
|
||||
Op: chain.CondStringNotEquals,
|
||||
Kind: chain.KindRequest,
|
||||
Key: "Actor",
|
||||
Value: actor1,
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
})
|
||||
|
||||
_, it, err := s.MorphRuleChainStorage().ListTargetsIterator(engine.Namespace)
|
||||
require.NoError(t, err)
|
||||
itemStacksEqual(t, it.Values, toStackItems(namespace))
|
||||
|
||||
s.MorphRuleChainStorage().AddMorphRuleChain(chain.Ingress, engine.NamespaceTarget(namespace2), &chain.Chain{
|
||||
Rules: []chain.Rule{
|
||||
{ // Deny all expect "native::object::get" for all objects expect "native::object::abc/xyz".
|
||||
Status: chain.AccessDenied,
|
||||
Actions: chain.Actions{Inverted: true, Names: []string{"native::object::get"}},
|
||||
Resources: chain.Resources{Inverted: true, Names: []string{object}},
|
||||
},
|
||||
},
|
||||
})
|
||||
|
||||
_, it, err = s.MorphRuleChainStorage().ListTargetsIterator(engine.Namespace)
|
||||
require.NoError(t, err)
|
||||
itemStacksEqual(t, it.Values, toStackItems(namespace, namespace2))
|
||||
|
||||
s.MorphRuleChainStorage().AddMorphRuleChain(chain.Ingress, engine.ContainerTarget(container), &chain.Chain{
|
||||
Rules: []chain.Rule{
|
||||
{ // Allow to actor2 to get objects from the specific container only if they have `Department=HR` attribute.
|
||||
Status: chain.Allow,
|
||||
Actions: chain.Actions{Names: []string{"native::object::get"}},
|
||||
Resources: chain.Resources{Names: []string{"native::object::abc/*"}},
|
||||
Condition: []chain.Condition{
|
||||
{
|
||||
Op: chain.CondStringEquals,
|
||||
Kind: chain.KindResource,
|
||||
Key: "Department",
|
||||
Value: "HR",
|
||||
},
|
||||
{
|
||||
Op: chain.CondStringEquals,
|
||||
Kind: chain.KindRequest,
|
||||
Key: "Actor",
|
||||
Value: actor2,
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
})
|
||||
|
||||
_, it, err = s.MorphRuleChainStorage().ListTargetsIterator(engine.Namespace)
|
||||
require.NoError(t, err)
|
||||
itemStacksEqual(t, it.Values, toStackItems(namespace, namespace2))
|
||||
|
||||
_, it, err = s.MorphRuleChainStorage().ListTargetsIterator(engine.Container)
|
||||
require.NoError(t, err)
|
||||
itemStacksEqual(t, it.Values, toStackItems(container))
|
||||
|
||||
t.Run("bad subnet, namespace deny", func(t *testing.T) {
|
||||
// Request initiating from the untrusted subnet.
|
||||
reqBadIP := resourcetest.NewRequest("native::object::put", res, map[string]string{
|
||||
"SourceIP": "10.122.1.20",
|
||||
"Actor": actor1,
|
||||
})
|
||||
status, ok, _ := s.IsAllowed(chain.Ingress, engine.NewRequestTarget(namespace, container), reqBadIP)
|
||||
require.Equal(t, chain.AccessDenied, status)
|
||||
require.True(t, ok)
|
||||
})
|
||||
t.Run("bad actor, namespace deny", func(t *testing.T) {
|
||||
// Request initiating from the untrusted actor.
|
||||
reqBadActor := resourcetest.NewRequest("native::object::put", res, map[string]string{
|
||||
"SourceIP": "10.1.1.13",
|
||||
"Actor": actor2,
|
||||
})
|
||||
status, ok, _ := s.IsAllowed(chain.Ingress, engine.NewRequestTarget(namespace, container), reqBadActor)
|
||||
require.Equal(t, chain.AccessDenied, status)
|
||||
require.True(t, ok)
|
||||
})
|
||||
t.Run("bad object, container deny", func(t *testing.T) {
|
||||
objGood := resourcetest.NewResource("native::object::abc/id1", map[string]string{"Department": "HR"})
|
||||
objBadAttr := resourcetest.NewResource("native::object::abc/id2", map[string]string{"Department": "Support"})
|
||||
|
||||
status, ok, _ := s.IsAllowed(chain.Ingress, engine.NewRequestTarget(namespace, container), resourcetest.NewRequest("native::object::get", objGood, map[string]string{
|
||||
"SourceIP": "10.1.1.14",
|
||||
"Actor": actor2,
|
||||
}))
|
||||
require.Equal(t, chain.Allow, status)
|
||||
require.True(t, ok)
|
||||
|
||||
status, ok, _ = s.IsAllowed(chain.Ingress, engine.NewRequestTarget(namespace, container), resourcetest.NewRequest("native::object::get", objBadAttr, map[string]string{
|
||||
"SourceIP": "10.1.1.14",
|
||||
"Actor": actor2,
|
||||
}))
|
||||
require.Equal(t, chain.NoRuleFound, status)
|
||||
require.False(t, ok)
|
||||
})
|
||||
t.Run("bad operation, namespace deny", func(t *testing.T) {
|
||||
// Request with the forbidden operation.
|
||||
reqBadOperation := resourcetest.NewRequest("native::object::delete", res, map[string]string{
|
||||
"SourceIP": "10.1.1.12",
|
||||
"Actor": actor1,
|
||||
})
|
||||
status, ok, _ := s.IsAllowed(chain.Ingress, engine.NewRequestTarget(namespace, container), reqBadOperation)
|
||||
require.Equal(t, chain.AccessDenied, status)
|
||||
require.True(t, ok)
|
||||
})
|
||||
t.Run("inverted rules", func(t *testing.T) {
|
||||
req := resourcetest.NewRequest("native::object::put", resourcetest.NewResource(object, nil), nil)
|
||||
status, ok, _ = s.IsAllowed(chain.Ingress, engine.NewRequestTarget(namespace2, container), req)
|
||||
require.Equal(t, chain.NoRuleFound, status)
|
||||
require.False(t, ok)
|
||||
|
||||
req = resourcetest.NewRequest("native::object::put", resourcetest.NewResource("native::object::cba/def", nil), nil)
|
||||
status, ok, _ = s.IsAllowed(chain.Ingress, engine.NewRequestTarget(namespace2, container), req)
|
||||
require.Equal(t, chain.AccessDenied, status)
|
||||
require.True(t, ok)
|
||||
|
||||
req = resourcetest.NewRequest("native::object::get", resourcetest.NewResource("native::object::cba/def", nil), nil)
|
||||
status, ok, _ = s.IsAllowed(chain.Ingress, engine.NewRequestTarget(namespace2, container), req)
|
||||
require.Equal(t, chain.NoRuleFound, status)
|
||||
require.False(t, ok)
|
||||
})
|
||||
t.Run("good", func(t *testing.T) {
|
||||
status, ok, _ = s.IsAllowed(chain.Ingress, engine.NewRequestTarget(namespace, container), reqGood)
|
||||
require.Equal(t, chain.NoRuleFound, status)
|
||||
require.False(t, ok)
|
||||
|
||||
t.Run("quota on a different container", func(t *testing.T) {
|
||||
s.LocalStorage().AddOverride(chain.Ingress, engine.ContainerTarget(container), &chain.Chain{
|
||||
Rules: []chain.Rule{{
|
||||
Status: chain.QuotaLimitReached,
|
||||
Actions: chain.Actions{Names: []string{"native::object::put"}},
|
||||
Resources: chain.Resources{Names: []string{"native::object::cba/*"}},
|
||||
}},
|
||||
})
|
||||
|
||||
_, it, err = s.MorphRuleChainStorage().ListTargetsIterator(engine.Namespace)
|
||||
require.NoError(t, err)
|
||||
itemStacksEqual(t, it.Values, toStackItems(namespace, namespace2))
|
||||
|
||||
_, it, err = s.MorphRuleChainStorage().ListTargetsIterator(engine.Container)
|
||||
require.NoError(t, err)
|
||||
itemStacksEqual(t, it.Values, toStackItems(container))
|
||||
|
||||
status, ok, _ = s.IsAllowed(chain.Ingress, engine.NewRequestTarget(namespace, container), reqGood)
|
||||
require.Equal(t, chain.NoRuleFound, status)
|
||||
require.False(t, ok)
|
||||
})
|
||||
|
||||
var quotaRuleChainID chain.ID
|
||||
t.Run("quota on the request container", func(t *testing.T) {
|
||||
quotaRuleChainID, _ = s.LocalStorage().AddOverride(chain.Ingress, engine.ContainerTarget(container), &chain.Chain{
|
||||
Rules: []chain.Rule{{
|
||||
Status: chain.QuotaLimitReached,
|
||||
Actions: chain.Actions{Names: []string{"native::object::put"}},
|
||||
Resources: chain.Resources{Names: []string{"native::object::abc/*"}},
|
||||
}},
|
||||
})
|
||||
|
||||
_, it, err = s.MorphRuleChainStorage().ListTargetsIterator(engine.Namespace)
|
||||
require.NoError(t, err)
|
||||
itemStacksEqual(t, it.Values, toStackItems(namespace, namespace2))
|
||||
|
||||
_, it, err = s.MorphRuleChainStorage().ListTargetsIterator(engine.Container)
|
||||
require.NoError(t, err)
|
||||
itemStacksEqual(t, it.Values, toStackItems(container))
|
||||
|
||||
status, ok, _ = s.IsAllowed(chain.Ingress, engine.NewRequestTarget(namespace, container), reqGood)
|
||||
require.Equal(t, chain.QuotaLimitReached, status)
|
||||
require.True(t, ok)
|
||||
})
|
||||
t.Run("removed quota on the request container", func(t *testing.T) {
|
||||
err := s.LocalStorage().RemoveOverride(chain.Ingress, engine.ContainerTarget(container), quotaRuleChainID)
|
||||
require.NoError(t, err)
|
||||
|
||||
_, it, err = s.MorphRuleChainStorage().ListTargetsIterator(engine.Namespace)
|
||||
require.NoError(t, err)
|
||||
itemStacksEqual(t, it.Values, toStackItems(namespace, namespace2))
|
||||
|
||||
_, it, err = s.MorphRuleChainStorage().ListTargetsIterator(engine.Container)
|
||||
require.NoError(t, err)
|
||||
itemStacksEqual(t, it.Values, toStackItems(container))
|
||||
|
||||
status, ok, _ = s.IsAllowed(chain.Ingress, engine.NewRequestTarget(namespace, container), reqGood)
|
||||
require.Equal(t, chain.NoRuleFound, status)
|
||||
require.False(t, ok)
|
||||
})
|
||||
})
|
||||
|
||||
t.Run("remove all", func(t *testing.T) {
|
||||
s := NewInMemoryLocalOverrides()
|
||||
_, _, err := s.MorphRuleChainStorage().AddMorphRuleChain(chain.Ingress, engine.NamespaceTarget(namespace), &chain.Chain{
|
||||
Rules: []chain.Rule{
|
||||
{
|
||||
Status: chain.AccessDenied,
|
||||
Actions: chain.Actions{Inverted: true, Names: []string{"native::object::get"}},
|
||||
Resources: chain.Resources{Inverted: true, Names: []string{object}},
|
||||
},
|
||||
},
|
||||
})
|
||||
require.NoError(t, err)
|
||||
_, _, err = s.MorphRuleChainStorage().AddMorphRuleChain(chain.Ingress, engine.NamespaceTarget(namespace2), &chain.Chain{
|
||||
Rules: []chain.Rule{
|
||||
{
|
||||
Status: chain.Allow,
|
||||
Actions: chain.Actions{Inverted: true, Names: []string{"native::object::get"}},
|
||||
Resources: chain.Resources{Inverted: true, Names: []string{object}},
|
||||
},
|
||||
},
|
||||
})
|
||||
require.NoError(t, err)
|
||||
_, _, err = s.MorphRuleChainStorage().AddMorphRuleChain(chain.Ingress, engine.NamespaceTarget(namespace2), &chain.Chain{
|
||||
Rules: []chain.Rule{
|
||||
{
|
||||
Status: chain.AccessDenied,
|
||||
Actions: chain.Actions{Inverted: true, Names: []string{"native::object::get"}},
|
||||
Resources: chain.Resources{Inverted: true, Names: []string{object}},
|
||||
},
|
||||
},
|
||||
})
|
||||
require.NoError(t, err)
|
||||
_, _, err = s.MorphRuleChainStorage().RemoveMorphRuleChainsByTarget(chain.Ingress, engine.NamespaceTarget(namespace2))
|
||||
require.NoError(t, err)
|
||||
chains, err := s.MorphRuleChainStorage().ListMorphRuleChains(chain.Ingress, engine.NamespaceTarget(namespace2))
|
||||
require.NoError(t, err)
|
||||
require.Equal(t, 0, len(chains))
|
||||
chains, err = s.MorphRuleChainStorage().ListMorphRuleChains(chain.Ingress, engine.NamespaceTarget(namespace))
|
||||
require.NoError(t, err)
|
||||
require.Equal(t, 1, len(chains))
|
||||
})
|
||||
}
|
||||
|
||||
func itemStacksEqual(t *testing.T, got []stackitem.Item, expected []stackitem.Item) {
|
||||
next:
|
||||
for _, exp := range expected {
|
||||
expBytes, err := exp.TryBytes()
|
||||
require.NoError(t, err)
|
||||
for _, v := range got {
|
||||
vBytes, err := v.TryBytes()
|
||||
require.NoError(t, err)
|
||||
if bytes.Equal(vBytes, expBytes) {
|
||||
continue next
|
||||
}
|
||||
}
|
||||
t.Fatalf("not found %s", exp)
|
||||
}
|
||||
}
|
||||
|
||||
func toStackItems(names ...string) []stackitem.Item {
|
||||
var items []stackitem.Item
|
||||
for _, name := range names {
|
||||
items = append(items, stackitem.NewByteArray([]byte(name)))
|
||||
}
|
||||
return items
|
||||
}
|
||||
|
|
@ -1,180 +0,0 @@
|
|||
package inmemory
|
||||
|
||||
import (
|
||||
"bytes"
|
||||
"fmt"
|
||||
"math/rand"
|
||||
"strings"
|
||||
"sync"
|
||||
|
||||
"git.frostfs.info/TrueCloudLab/policy-engine/pkg/chain"
|
||||
"git.frostfs.info/TrueCloudLab/policy-engine/pkg/engine"
|
||||
"git.frostfs.info/TrueCloudLab/policy-engine/util"
|
||||
)
|
||||
|
||||
type targetToChain map[engine.Target][]*chain.Chain
|
||||
|
||||
type inmemoryLocalStorage struct {
|
||||
usedChainID map[string]struct{}
|
||||
nameToResourceChains map[chain.Name]targetToChain
|
||||
guard *sync.RWMutex
|
||||
}
|
||||
|
||||
func NewInmemoryLocalStorage() engine.LocalOverrideStorage {
|
||||
return &inmemoryLocalStorage{
|
||||
usedChainID: map[string]struct{}{},
|
||||
nameToResourceChains: make(map[chain.Name]targetToChain),
|
||||
guard: &sync.RWMutex{},
|
||||
}
|
||||
}
|
||||
|
||||
func (s *inmemoryLocalStorage) generateChainID(name chain.Name, target engine.Target) chain.ID {
|
||||
var id chain.ID
|
||||
for {
|
||||
suffix := rand.Uint32() % 100
|
||||
sid := fmt.Sprintf("%s:%s/%d", name, target.Name, suffix)
|
||||
sid = strings.ReplaceAll(sid, "*", "")
|
||||
sid = strings.ReplaceAll(sid, "/", ":")
|
||||
sid = strings.ReplaceAll(sid, "::", ":")
|
||||
_, ok := s.usedChainID[sid]
|
||||
if ok {
|
||||
continue
|
||||
}
|
||||
s.usedChainID[sid] = struct{}{}
|
||||
|
||||
id = chain.ID(sid)
|
||||
break
|
||||
}
|
||||
return id
|
||||
}
|
||||
|
||||
func (s *inmemoryLocalStorage) AddOverride(name chain.Name, target engine.Target, c *chain.Chain) (chain.ID, error) {
|
||||
s.guard.Lock()
|
||||
defer s.guard.Unlock()
|
||||
|
||||
if target.Name == "" {
|
||||
target.Name = "root"
|
||||
}
|
||||
|
||||
// AddOverride assigns generated chain ID if it has not been assigned.
|
||||
if len(c.ID) == 0 {
|
||||
c.ID = s.generateChainID(name, target)
|
||||
}
|
||||
if s.nameToResourceChains[name] == nil {
|
||||
s.nameToResourceChains[name] = make(targetToChain)
|
||||
}
|
||||
rc := s.nameToResourceChains[name]
|
||||
for i := range rc[target] {
|
||||
if bytes.Equal(rc[target][i].ID, c.ID) {
|
||||
rc[target][i] = c
|
||||
return c.ID, nil
|
||||
}
|
||||
}
|
||||
rc[target] = append(rc[target], c)
|
||||
return c.ID, nil
|
||||
}
|
||||
|
||||
func (s *inmemoryLocalStorage) GetOverride(name chain.Name, target engine.Target, chainID chain.ID) (*chain.Chain, error) {
|
||||
s.guard.RLock()
|
||||
defer s.guard.RUnlock()
|
||||
|
||||
if _, ok := s.nameToResourceChains[name]; !ok {
|
||||
return nil, engine.ErrChainNameNotFound
|
||||
}
|
||||
if target.Name == "" {
|
||||
target.Name = "root"
|
||||
}
|
||||
chains, ok := s.nameToResourceChains[name][target]
|
||||
if !ok {
|
||||
return nil, engine.ErrResourceNotFound
|
||||
}
|
||||
for _, c := range chains {
|
||||
if bytes.Equal(c.ID, chainID) {
|
||||
return c, nil
|
||||
}
|
||||
}
|
||||
return nil, engine.ErrChainNotFound
|
||||
}
|
||||
|
||||
func (s *inmemoryLocalStorage) RemoveOverride(name chain.Name, target engine.Target, chainID chain.ID) error {
|
||||
s.guard.Lock()
|
||||
defer s.guard.Unlock()
|
||||
|
||||
if _, ok := s.nameToResourceChains[name]; !ok {
|
||||
return engine.ErrChainNameNotFound
|
||||
}
|
||||
if target.Name == "" {
|
||||
target.Name = "root"
|
||||
}
|
||||
chains, ok := s.nameToResourceChains[name][target]
|
||||
if !ok {
|
||||
return engine.ErrResourceNotFound
|
||||
}
|
||||
for i, c := range chains {
|
||||
if bytes.Equal(c.ID, chainID) {
|
||||
s.nameToResourceChains[name][target] = append(chains[:i], chains[i+1:]...)
|
||||
return nil
|
||||
}
|
||||
}
|
||||
return engine.ErrChainNotFound
|
||||
}
|
||||
|
||||
func (s *inmemoryLocalStorage) RemoveOverridesByTarget(name chain.Name, target engine.Target) error {
|
||||
s.guard.Lock()
|
||||
defer s.guard.Unlock()
|
||||
|
||||
if _, ok := s.nameToResourceChains[name]; !ok {
|
||||
return engine.ErrChainNameNotFound
|
||||
}
|
||||
if target.Name == "" {
|
||||
target.Name = "root"
|
||||
}
|
||||
_, ok := s.nameToResourceChains[name][target]
|
||||
if ok {
|
||||
delete(s.nameToResourceChains[name], target)
|
||||
return nil
|
||||
}
|
||||
return engine.ErrResourceNotFound
|
||||
}
|
||||
|
||||
func (s *inmemoryLocalStorage) ListOverrides(name chain.Name, target engine.Target) ([]*chain.Chain, error) {
|
||||
s.guard.RLock()
|
||||
defer s.guard.RUnlock()
|
||||
|
||||
rcs, ok := s.nameToResourceChains[name]
|
||||
if !ok {
|
||||
return []*chain.Chain{}, nil
|
||||
}
|
||||
if target.Name == "" {
|
||||
target.Name = "root"
|
||||
}
|
||||
for t, chains := range rcs {
|
||||
if t.Type != target.Type {
|
||||
continue
|
||||
}
|
||||
if !util.GlobMatch(target.Name, t.Name) {
|
||||
continue
|
||||
}
|
||||
return chains, nil
|
||||
}
|
||||
return []*chain.Chain{}, nil
|
||||
}
|
||||
|
||||
func (s *inmemoryLocalStorage) DropAllOverrides(name chain.Name) error {
|
||||
s.guard.Lock()
|
||||
defer s.guard.Unlock()
|
||||
|
||||
s.nameToResourceChains[name] = make(targetToChain)
|
||||
return nil
|
||||
}
|
||||
|
||||
func (s *inmemoryLocalStorage) ListOverrideDefinedTargets(name chain.Name) ([]engine.Target, error) {
|
||||
s.guard.RLock()
|
||||
defer s.guard.RUnlock()
|
||||
ttc := s.nameToResourceChains[name]
|
||||
var keys []engine.Target
|
||||
for k := range ttc {
|
||||
keys = append(keys, k)
|
||||
}
|
||||
return keys, nil
|
||||
}
|
||||
|
|
@ -1,268 +0,0 @@
|
|||
package inmemory
|
||||
|
||||
import (
|
||||
"testing"
|
||||
|
||||
"git.frostfs.info/TrueCloudLab/policy-engine/pkg/chain"
|
||||
"git.frostfs.info/TrueCloudLab/policy-engine/pkg/engine"
|
||||
"github.com/stretchr/testify/require"
|
||||
)
|
||||
|
||||
const (
|
||||
container = "native:::object/ExYw/*"
|
||||
chainID = "ingress:ExYw"
|
||||
nonExistChainId = "ingress:LxGyWyL"
|
||||
)
|
||||
|
||||
var resrc = engine.ContainerTarget(container)
|
||||
|
||||
func testInmemLocalStorage() *inmemoryLocalStorage {
|
||||
return NewInmemoryLocalStorage().(*inmemoryLocalStorage)
|
||||
}
|
||||
|
||||
func TestAddOverride(t *testing.T) {
|
||||
inmem := testInmemLocalStorage()
|
||||
|
||||
inmem.AddOverride(chain.Ingress, resrc, &chain.Chain{
|
||||
Rules: []chain.Rule{
|
||||
{
|
||||
Status: chain.AccessDenied,
|
||||
Actions: chain.Actions{Names: []string{"native::object::delete"}},
|
||||
Resources: chain.Resources{Names: []string{"native::object::*"}},
|
||||
},
|
||||
},
|
||||
})
|
||||
|
||||
ingressChains, ok := inmem.nameToResourceChains[chain.Ingress]
|
||||
require.True(t, ok)
|
||||
resourceChains, ok := ingressChains[resrc]
|
||||
require.True(t, ok)
|
||||
require.Len(t, resourceChains, 1)
|
||||
require.Len(t, resourceChains[0].Rules, 1)
|
||||
|
||||
inmem.AddOverride(chain.Ingress, resrc, &chain.Chain{
|
||||
Rules: []chain.Rule{
|
||||
{
|
||||
Status: chain.QuotaLimitReached,
|
||||
Actions: chain.Actions{Names: []string{"native::object::put"}},
|
||||
Resources: chain.Resources{Names: []string{"native::object::*"}},
|
||||
},
|
||||
{
|
||||
Status: chain.AccessDenied,
|
||||
Actions: chain.Actions{Names: []string{"native::object::get"}},
|
||||
Resources: chain.Resources{Names: []string{"native::object::*"}},
|
||||
},
|
||||
},
|
||||
})
|
||||
|
||||
ingressChains, ok = inmem.nameToResourceChains[chain.Ingress]
|
||||
require.True(t, ok)
|
||||
resourceChains, ok = ingressChains[resrc]
|
||||
require.True(t, ok)
|
||||
require.Len(t, resourceChains, 2)
|
||||
require.Len(t, resourceChains[1].Rules, 2)
|
||||
}
|
||||
|
||||
func TestRemoveOverride(t *testing.T) {
|
||||
t.Run("remove from empty storage", func(t *testing.T) {
|
||||
inmem := testInmemLocalStorage()
|
||||
err := inmem.RemoveOverride(chain.Ingress, resrc, chain.ID(chainID))
|
||||
require.ErrorIs(t, err, engine.ErrChainNameNotFound)
|
||||
})
|
||||
|
||||
t.Run("remove not added chain id", func(t *testing.T) {
|
||||
inmem := testInmemLocalStorage()
|
||||
inmem.AddOverride(chain.Ingress, resrc, &chain.Chain{
|
||||
ID: chain.ID(chainID),
|
||||
Rules: []chain.Rule{
|
||||
{ // Restrict to remove ANY object from the namespace.
|
||||
Status: chain.AccessDenied,
|
||||
Actions: chain.Actions{Names: []string{"native::object::delete"}},
|
||||
Resources: chain.Resources{Names: []string{"native::object::*"}},
|
||||
},
|
||||
},
|
||||
})
|
||||
|
||||
err := inmem.RemoveOverride(chain.Ingress, resrc, chain.ID(nonExistChainId))
|
||||
require.ErrorIs(t, err, engine.ErrChainNotFound)
|
||||
})
|
||||
|
||||
t.Run("remove existing chain id", func(t *testing.T) {
|
||||
inmem := testInmemLocalStorage()
|
||||
inmem.AddOverride(chain.Ingress, resrc, &chain.Chain{
|
||||
ID: chain.ID(chainID),
|
||||
Rules: []chain.Rule{
|
||||
{ // Restrict to remove ANY object from the namespace.
|
||||
Status: chain.AccessDenied,
|
||||
Actions: chain.Actions{Names: []string{"native::object::delete"}},
|
||||
Resources: chain.Resources{Names: []string{"native::object::*"}},
|
||||
},
|
||||
},
|
||||
})
|
||||
|
||||
err := inmem.RemoveOverride(chain.Ingress, resrc, chain.ID(chainID))
|
||||
require.NoError(t, err)
|
||||
|
||||
ingressChains, ok := inmem.nameToResourceChains[chain.Ingress]
|
||||
require.True(t, ok)
|
||||
require.Len(t, ingressChains, 1)
|
||||
resourceChains, ok := ingressChains[resrc]
|
||||
require.True(t, ok)
|
||||
require.Len(t, resourceChains, 0)
|
||||
})
|
||||
|
||||
t.Run("remove by target", func(t *testing.T) {
|
||||
inmem := testInmemLocalStorage()
|
||||
t0 := engine.ContainerTarget("name0")
|
||||
t1 := engine.ContainerTarget("name1")
|
||||
inmem.AddOverride(chain.Ingress, t0, &chain.Chain{
|
||||
ID: chain.ID(chainID),
|
||||
Rules: []chain.Rule{
|
||||
{
|
||||
Status: chain.AccessDenied,
|
||||
Actions: chain.Actions{Names: []string{"native::object::delete"}},
|
||||
Resources: chain.Resources{Names: []string{"native::object::*"}},
|
||||
},
|
||||
},
|
||||
})
|
||||
inmem.AddOverride(chain.Ingress, t0, &chain.Chain{
|
||||
ID: chain.ID(chainID),
|
||||
Rules: []chain.Rule{
|
||||
{
|
||||
Status: chain.Allow,
|
||||
Actions: chain.Actions{Names: []string{"native::object::delete"}},
|
||||
Resources: chain.Resources{Names: []string{"native::object::*"}},
|
||||
},
|
||||
},
|
||||
})
|
||||
inmem.AddOverride(chain.Ingress, t1, &chain.Chain{
|
||||
ID: chain.ID(chainID),
|
||||
Rules: []chain.Rule{
|
||||
{
|
||||
Status: chain.Allow,
|
||||
Actions: chain.Actions{Names: []string{"native::object::delete"}},
|
||||
Resources: chain.Resources{Names: []string{"native::object::*"}},
|
||||
},
|
||||
},
|
||||
})
|
||||
|
||||
err := inmem.RemoveOverridesByTarget(chain.Ingress, t0)
|
||||
require.NoError(t, err)
|
||||
|
||||
ingressChains, ok := inmem.nameToResourceChains[chain.Ingress]
|
||||
require.True(t, ok)
|
||||
require.Len(t, ingressChains, 1)
|
||||
resourceChains, ok := ingressChains[t1]
|
||||
require.True(t, ok)
|
||||
require.Len(t, resourceChains, 1)
|
||||
})
|
||||
}
|
||||
|
||||
func TestGetOverride(t *testing.T) {
|
||||
addChain := &chain.Chain{
|
||||
ID: chain.ID(chainID),
|
||||
Rules: []chain.Rule{
|
||||
{ // Restrict to remove ANY object from the namespace.
|
||||
Status: chain.AccessDenied,
|
||||
Actions: chain.Actions{Names: []string{"native::object::delete"}},
|
||||
Resources: chain.Resources{Names: []string{"native::object::*"}},
|
||||
},
|
||||
},
|
||||
}
|
||||
|
||||
t.Run("get from empty storage", func(t *testing.T) {
|
||||
inmem := testInmemLocalStorage()
|
||||
_, err := inmem.GetOverride(chain.Ingress, resrc, chain.ID(chainID))
|
||||
require.ErrorIs(t, err, engine.ErrChainNameNotFound)
|
||||
})
|
||||
|
||||
t.Run("get not added chain id", func(t *testing.T) {
|
||||
inmem := testInmemLocalStorage()
|
||||
inmem.AddOverride(chain.Ingress, resrc, addChain)
|
||||
|
||||
const nonExistingChainID = "ingress:LxGyWyL"
|
||||
|
||||
_, err := inmem.GetOverride(chain.Ingress, resrc, chain.ID(nonExistingChainID))
|
||||
require.ErrorIs(t, err, engine.ErrChainNotFound)
|
||||
})
|
||||
|
||||
t.Run("get existing chain id", func(t *testing.T) {
|
||||
inmem := testInmemLocalStorage()
|
||||
inmem.AddOverride(chain.Ingress, resrc, addChain)
|
||||
|
||||
c, err := inmem.GetOverride(chain.Ingress, resrc, chain.ID(chainID))
|
||||
require.NoError(t, err)
|
||||
require.EqualValues(t, *addChain, *c)
|
||||
})
|
||||
|
||||
t.Run("get removed chain id", func(t *testing.T) {
|
||||
inmem := testInmemLocalStorage()
|
||||
inmem.AddOverride(chain.Ingress, resrc, addChain)
|
||||
|
||||
err := inmem.RemoveOverride(chain.Ingress, resrc, chain.ID(chainID))
|
||||
require.NoError(t, err)
|
||||
|
||||
_, err = inmem.GetOverride(chain.Ingress, resrc, chain.ID(chainID))
|
||||
require.ErrorIs(t, err, engine.ErrChainNotFound)
|
||||
})
|
||||
}
|
||||
|
||||
func TestListOverrides(t *testing.T) {
|
||||
addChain := &chain.Chain{
|
||||
ID: chain.ID(chainID),
|
||||
Rules: []chain.Rule{
|
||||
{ // Restrict to remove ANY object from the namespace.
|
||||
Status: chain.AccessDenied,
|
||||
Actions: chain.Actions{Names: []string{"native::object::delete"}},
|
||||
Resources: chain.Resources{Names: []string{"native::object::*"}},
|
||||
},
|
||||
},
|
||||
}
|
||||
|
||||
t.Run("list empty storage", func(t *testing.T) {
|
||||
inmem := testInmemLocalStorage()
|
||||
l, _ := inmem.ListOverrides(chain.Ingress, resrc)
|
||||
require.Len(t, l, 0)
|
||||
})
|
||||
|
||||
t.Run("list with one added resource", func(t *testing.T) {
|
||||
inmem := testInmemLocalStorage()
|
||||
inmem.AddOverride(chain.Ingress, resrc, addChain)
|
||||
l, _ := inmem.ListOverrides(chain.Ingress, resrc)
|
||||
require.Len(t, l, 1)
|
||||
targets, err := inmem.ListOverrideDefinedTargets(chain.Ingress)
|
||||
require.NoError(t, err)
|
||||
require.Equal(t, []engine.Target{resrc}, targets)
|
||||
})
|
||||
|
||||
t.Run("list after drop", func(t *testing.T) {
|
||||
inmem := testInmemLocalStorage()
|
||||
inmem.AddOverride(chain.Ingress, resrc, addChain)
|
||||
l, _ := inmem.ListOverrides(chain.Ingress, resrc)
|
||||
require.Len(t, l, 1)
|
||||
|
||||
_ = inmem.DropAllOverrides(chain.Ingress)
|
||||
l, _ = inmem.ListOverrides(chain.Ingress, resrc)
|
||||
require.Len(t, l, 0)
|
||||
})
|
||||
}
|
||||
|
||||
func TestGenerateID(t *testing.T) {
|
||||
inmem := testInmemLocalStorage()
|
||||
ids := make([]chain.ID, 0, 100)
|
||||
for i := 0; i < 100; i++ {
|
||||
ids = append(ids, inmem.generateChainID(chain.Ingress, resrc))
|
||||
}
|
||||
require.False(t, hasDuplicates(ids))
|
||||
}
|
||||
|
||||
func hasDuplicates(ids []chain.ID) bool {
|
||||
seen := make(map[string]bool)
|
||||
for _, id := range ids {
|
||||
if seen[string(id)] {
|
||||
return true
|
||||
}
|
||||
seen[string(id)] = true
|
||||
}
|
||||
return false
|
||||
}
|
||||
|
|
@ -1,112 +0,0 @@
|
|||
package inmemory
|
||||
|
||||
import (
|
||||
"git.frostfs.info/TrueCloudLab/policy-engine/pkg/chain"
|
||||
"git.frostfs.info/TrueCloudLab/policy-engine/pkg/engine"
|
||||
"github.com/google/uuid"
|
||||
"github.com/nspcc-dev/neo-go/pkg/neorpc/result"
|
||||
"github.com/nspcc-dev/neo-go/pkg/util"
|
||||
"github.com/nspcc-dev/neo-go/pkg/vm/stackitem"
|
||||
)
|
||||
|
||||
type inmemoryMorphRuleChainStorage struct {
|
||||
storage engine.LocalOverrideStorage
|
||||
}
|
||||
|
||||
func NewInmemoryMorphRuleChainStorage() engine.MorphRuleChainStorage {
|
||||
return &inmemoryMorphRuleChainStorage{
|
||||
storage: NewInmemoryLocalStorage(),
|
||||
}
|
||||
}
|
||||
|
||||
func (s *inmemoryMorphRuleChainStorage) AddMorphRuleChain(name chain.Name, target engine.Target, c *chain.Chain) (_ util.Uint256, _ uint32, err error) {
|
||||
switch target.Type {
|
||||
case engine.Namespace, engine.Container, engine.User, engine.Group:
|
||||
_, err = s.storage.AddOverride(name, target, c)
|
||||
default:
|
||||
err = engine.ErrUnknownTarget
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func (s *inmemoryMorphRuleChainStorage) RemoveMorphRuleChain(name chain.Name, target engine.Target, chainID chain.ID) (_ util.Uint256, _ uint32, err error) {
|
||||
switch target.Type {
|
||||
case engine.Namespace, engine.Container, engine.User, engine.Group:
|
||||
err = s.storage.RemoveOverride(name, target, chainID)
|
||||
default:
|
||||
err = engine.ErrUnknownTarget
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func (s *inmemoryMorphRuleChainStorage) RemoveMorphRuleChainsByTarget(name chain.Name, target engine.Target) (_ util.Uint256, _ uint32, err error) {
|
||||
switch target.Type {
|
||||
case engine.Namespace, engine.Container, engine.User, engine.Group:
|
||||
err = s.storage.RemoveOverridesByTarget(name, target)
|
||||
default:
|
||||
err = engine.ErrUnknownTarget
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func (s *inmemoryMorphRuleChainStorage) ListMorphRuleChains(name chain.Name, target engine.Target) ([]*chain.Chain, error) {
|
||||
switch target.Type {
|
||||
case engine.Namespace, engine.Container, engine.User, engine.Group:
|
||||
return s.storage.ListOverrides(name, target)
|
||||
default:
|
||||
}
|
||||
return nil, engine.ErrUnknownTarget
|
||||
}
|
||||
|
||||
func (s *inmemoryMorphRuleChainStorage) GetAdmin() (util.Uint160, error) {
|
||||
panic("not implemented")
|
||||
}
|
||||
|
||||
func (s *inmemoryMorphRuleChainStorage) SetAdmin(_ util.Uint160) (util.Uint256, uint32, error) {
|
||||
panic("not implemented")
|
||||
}
|
||||
|
||||
func (s *inmemoryMorphRuleChainStorage) ListTargetsIterator(targetType engine.TargetType) (uuid uuid.UUID, it result.Iterator, err error) {
|
||||
it.Values = make([]stackitem.Item, 0)
|
||||
|
||||
switch targetType {
|
||||
case engine.Namespace:
|
||||
// Listing targets may look bizarre, because inmemory rule chain storage use inmemory local overrides where
|
||||
// targets are listed by chain names.
|
||||
var targets []engine.Target
|
||||
targets, err = s.storage.ListOverrideDefinedTargets(chain.Ingress)
|
||||
if err != nil {
|
||||
return
|
||||
}
|
||||
for _, t := range targets {
|
||||
it.Values = append(it.Values, stackitem.NewByteArray([]byte(t.Name)))
|
||||
}
|
||||
|
||||
targets, err = s.storage.ListOverrideDefinedTargets(chain.S3)
|
||||
if err != nil {
|
||||
return
|
||||
}
|
||||
for _, t := range targets {
|
||||
it.Values = append(it.Values, stackitem.NewByteArray([]byte(t.Name)))
|
||||
}
|
||||
case engine.Container:
|
||||
var targets []engine.Target
|
||||
targets, err = s.storage.ListOverrideDefinedTargets(chain.Ingress)
|
||||
if err != nil {
|
||||
return
|
||||
}
|
||||
for _, t := range targets {
|
||||
it.Values = append(it.Values, stackitem.NewByteArray([]byte(t.Name)))
|
||||
}
|
||||
|
||||
targets, err = s.storage.ListOverrideDefinedTargets(chain.S3)
|
||||
if err != nil {
|
||||
return
|
||||
}
|
||||
for _, t := range targets {
|
||||
it.Values = append(it.Values, stackitem.NewByteArray([]byte(t.Name)))
|
||||
}
|
||||
default:
|
||||
}
|
||||
return
|
||||
}
|
||||
|
|
@ -1,185 +0,0 @@
|
|||
package engine
|
||||
|
||||
import (
|
||||
"git.frostfs.info/TrueCloudLab/policy-engine/pkg/chain"
|
||||
"git.frostfs.info/TrueCloudLab/policy-engine/pkg/resource"
|
||||
"github.com/google/uuid"
|
||||
"github.com/nspcc-dev/neo-go/pkg/neorpc/result"
|
||||
"github.com/nspcc-dev/neo-go/pkg/util"
|
||||
)
|
||||
|
||||
type ChainRouter interface {
|
||||
// IsAllowed returns status for the operation after all checks.
|
||||
// The second return value signifies whether a matching rule was found.
|
||||
IsAllowed(name chain.Name, reqTarget RequestTarget, r resource.Request) (status chain.Status, found bool, err error)
|
||||
}
|
||||
|
||||
// LocalOverrideStorage is the interface to manage local overrides defined
|
||||
// for a node. Local overrides have a higher priority than chains got from morph storage.
|
||||
type LocalOverrideStorage interface {
|
||||
AddOverride(name chain.Name, target Target, c *chain.Chain) (chain.ID, error)
|
||||
|
||||
GetOverride(name chain.Name, target Target, chainID chain.ID) (*chain.Chain, error)
|
||||
|
||||
RemoveOverride(name chain.Name, target Target, chainID chain.ID) error
|
||||
|
||||
RemoveOverridesByTarget(name chain.Name, target Target) error
|
||||
|
||||
ListOverrides(name chain.Name, target Target) ([]*chain.Chain, error)
|
||||
|
||||
DropAllOverrides(name chain.Name) error
|
||||
|
||||
ListOverrideDefinedTargets(name chain.Name) ([]Target, error)
|
||||
}
|
||||
|
||||
type TargetType rune
|
||||
|
||||
const (
|
||||
Namespace TargetType = 'n'
|
||||
Container TargetType = 'c'
|
||||
User TargetType = 'u'
|
||||
Group TargetType = 'g'
|
||||
)
|
||||
|
||||
type Target struct {
|
||||
Type TargetType
|
||||
Name string
|
||||
}
|
||||
|
||||
// RequestTarget combines several targets on which the request is performed.
|
||||
type RequestTarget struct {
|
||||
Namespace *Target
|
||||
Container *Target
|
||||
User *Target
|
||||
Groups []Target
|
||||
}
|
||||
|
||||
func NewRequestTargetWithNamespace(namespace string) RequestTarget {
|
||||
nt := NamespaceTarget(namespace)
|
||||
return RequestTarget{
|
||||
Namespace: &nt,
|
||||
}
|
||||
}
|
||||
|
||||
func NewRequestTargetWithContainer(container string) RequestTarget {
|
||||
ct := ContainerTarget(container)
|
||||
return RequestTarget{
|
||||
Container: &ct,
|
||||
}
|
||||
}
|
||||
|
||||
func NewRequestTarget(namespace, container string) RequestTarget {
|
||||
nt := NamespaceTarget(namespace)
|
||||
ct := ContainerTarget(container)
|
||||
return RequestTarget{
|
||||
Namespace: &nt,
|
||||
Container: &ct,
|
||||
}
|
||||
}
|
||||
|
||||
func NewRequestTargetExtended(namespace, container, user string, groups []string) RequestTarget {
|
||||
nt := NamespaceTarget(namespace)
|
||||
ct := ContainerTarget(container)
|
||||
u := UserTarget(user)
|
||||
rt := RequestTarget{
|
||||
Namespace: &nt,
|
||||
Container: &ct,
|
||||
User: &u,
|
||||
}
|
||||
if len(groups) != 0 {
|
||||
rt.Groups = make([]Target, len(groups))
|
||||
for i := range groups {
|
||||
rt.Groups[i] = GroupTarget(groups[i])
|
||||
}
|
||||
}
|
||||
return rt
|
||||
}
|
||||
|
||||
func (rt *RequestTarget) Targets() (targets []Target) {
|
||||
if rt.Namespace != nil {
|
||||
targets = append(targets, *rt.Namespace)
|
||||
}
|
||||
if rt.Container != nil {
|
||||
targets = append(targets, *rt.Container)
|
||||
}
|
||||
if rt.User != nil {
|
||||
targets = append(targets, *rt.User)
|
||||
}
|
||||
if len(rt.Groups) != 0 {
|
||||
targets = append(targets, rt.Groups...)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func NamespaceTarget(namespace string) Target {
|
||||
return Target{
|
||||
Type: Namespace,
|
||||
Name: namespace,
|
||||
}
|
||||
}
|
||||
|
||||
func ContainerTarget(container string) Target {
|
||||
return Target{
|
||||
Type: Container,
|
||||
Name: container,
|
||||
}
|
||||
}
|
||||
|
||||
func UserTarget(user string) Target {
|
||||
return Target{
|
||||
Type: User,
|
||||
Name: user,
|
||||
}
|
||||
}
|
||||
|
||||
func GroupTarget(group string) Target {
|
||||
return Target{
|
||||
Type: Group,
|
||||
Name: group,
|
||||
}
|
||||
}
|
||||
|
||||
// MorphRuleChainStorageReader is the interface that provides read-only methods to receive
|
||||
// data like chains, target or admin from a chain storage.
|
||||
type MorphRuleChainStorageReader interface {
|
||||
// ListMorphRuleChains just lists deserialized chains.
|
||||
ListMorphRuleChains(name chain.Name, target Target) ([]*chain.Chain, error)
|
||||
|
||||
GetAdmin() (util.Uint160, error)
|
||||
|
||||
// ListTargetsIterator provides an iterator to list targets for which rules are defined.
|
||||
ListTargetsIterator(targetType TargetType) (uuid.UUID, result.Iterator, error)
|
||||
}
|
||||
|
||||
// MorphRuleChainStorage is the interface to read and manage data within a chain storage.
|
||||
// Basically, this implies that the storage manages rules stored in policy contract.
|
||||
type MorphRuleChainStorage interface {
|
||||
MorphRuleChainStorageReader
|
||||
|
||||
// AddMorphRuleChain adds a chain rule to the policy contract and returns transaction hash, VUB and error.
|
||||
AddMorphRuleChain(name chain.Name, target Target, c *chain.Chain) (util.Uint256, uint32, error)
|
||||
|
||||
// RemoveMorphRuleChain removes a chain rule to the policy contract and returns transaction hash, VUB and error.
|
||||
RemoveMorphRuleChain(name chain.Name, target Target, chainID chain.ID) (util.Uint256, uint32, error)
|
||||
|
||||
// RemoveMorphRuleChainsByTarget removes all chains by target and returns transaction hash, VUB and error.
|
||||
RemoveMorphRuleChainsByTarget(name chain.Name, target Target) (util.Uint256, uint32, error)
|
||||
|
||||
SetAdmin(addr util.Uint160) (util.Uint256, uint32, error)
|
||||
}
|
||||
|
||||
// Engine is the interface that provides methods to check request permissions checking
|
||||
// chain rules from morph client - this implies using the policy contract.
|
||||
type Engine interface {
|
||||
ChainRouter
|
||||
|
||||
MorphRuleChainStorage() MorphRuleChainStorage
|
||||
}
|
||||
|
||||
// LocalOverrideEngine is extended Engine that also provides methods to manage a local
|
||||
// chain rule storage. Local overrides must have the highest priority during request checking.
|
||||
type LocalOverrideEngine interface {
|
||||
Engine
|
||||
|
||||
LocalStorage() LocalOverrideStorage
|
||||
}
|
||||
|
|
@ -1,267 +0,0 @@
|
|||
package marshal
|
||||
|
||||
import (
|
||||
"encoding/binary"
|
||||
"fmt"
|
||||
)
|
||||
|
||||
const (
|
||||
Version byte = 0 // increase if breaking change
|
||||
|
||||
ByteSize int = 1
|
||||
UInt8Size int = ByteSize
|
||||
BoolSize int = ByteSize
|
||||
|
||||
nilSlice int64 = -1
|
||||
nilSliceSize int = 1
|
||||
|
||||
byteTrue uint8 = 1
|
||||
byteFalse uint8 = 0
|
||||
|
||||
// maxSliceLen taken from https://github.com/neo-project/neo/blob/38218bbee5bbe8b33cd8f9453465a19381c9a547/src/Neo/IO/Helper.cs#L77
|
||||
maxSliceLen = 0x1000000
|
||||
)
|
||||
|
||||
type MarshallerError struct {
|
||||
errMsg string
|
||||
offset int
|
||||
}
|
||||
|
||||
func (e *MarshallerError) Error() string {
|
||||
if e == nil {
|
||||
return ""
|
||||
}
|
||||
if e.offset < 0 {
|
||||
return e.errMsg
|
||||
}
|
||||
return fmt.Sprintf("%s (offset: %d)", e.errMsg, e.offset)
|
||||
}
|
||||
|
||||
func errBufTooSmall(t string, marshal bool, offset int) error {
|
||||
action := "unmarshal"
|
||||
if marshal {
|
||||
action = "marshal"
|
||||
}
|
||||
return &MarshallerError{
|
||||
errMsg: fmt.Sprintf("not enough bytes left to %s value of type '%s'", action, t),
|
||||
offset: offset,
|
||||
}
|
||||
}
|
||||
|
||||
func VerifyMarshal(buf []byte, lastOffset int) error {
|
||||
if len(buf) != lastOffset {
|
||||
return &MarshallerError{
|
||||
errMsg: "actual data size differs from expected",
|
||||
offset: -1,
|
||||
}
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func VerifyUnmarshal(buf []byte, lastOffset int) error {
|
||||
if len(buf) != lastOffset {
|
||||
return &MarshallerError{
|
||||
errMsg: "unmarshalled bytes left",
|
||||
}
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func SliceSize[T any](slice []T, sizeOf func(T) int) int {
|
||||
if slice == nil {
|
||||
return nilSliceSize
|
||||
}
|
||||
s := Int64Size(int64(len(slice)))
|
||||
for _, v := range slice {
|
||||
s += sizeOf(v)
|
||||
}
|
||||
return s
|
||||
}
|
||||
|
||||
func SliceMarshal[T any](buf []byte, offset int, slice []T, marshalT func([]byte, int, T) (int, error)) (int, error) {
|
||||
if slice == nil {
|
||||
return Int64Marshal(buf, offset, nilSlice)
|
||||
}
|
||||
if len(slice) > maxSliceLen {
|
||||
return 0, &MarshallerError{
|
||||
errMsg: fmt.Sprintf("slice size if too big: '%d'", len(slice)),
|
||||
offset: offset,
|
||||
}
|
||||
}
|
||||
offset, err := Int64Marshal(buf, offset, int64(len(slice)))
|
||||
if err != nil {
|
||||
return 0, err
|
||||
}
|
||||
for _, v := range slice {
|
||||
offset, err = marshalT(buf, offset, v)
|
||||
if err != nil {
|
||||
return 0, err
|
||||
}
|
||||
}
|
||||
return offset, nil
|
||||
}
|
||||
|
||||
func SliceUnmarshal[T any](buf []byte, offset int, unmarshalT func(buf []byte, offset int) (T, int, error)) ([]T, int, error) {
|
||||
size, offset, err := Int64Unmarshal(buf, offset)
|
||||
if err != nil {
|
||||
return nil, 0, err
|
||||
}
|
||||
if size == nilSlice {
|
||||
return nil, offset, nil
|
||||
}
|
||||
if size > maxSliceLen {
|
||||
return nil, 0, &MarshallerError{
|
||||
errMsg: fmt.Sprintf("slice size if too big: '%d'", size),
|
||||
offset: offset,
|
||||
}
|
||||
}
|
||||
if size < 0 {
|
||||
return nil, 0, &MarshallerError{
|
||||
errMsg: fmt.Sprintf("invalid slice size: '%d'", size),
|
||||
offset: offset,
|
||||
}
|
||||
}
|
||||
result := make([]T, size)
|
||||
for idx := 0; idx < len(result); idx++ {
|
||||
result[idx], offset, err = unmarshalT(buf, offset)
|
||||
if err != nil {
|
||||
return nil, 0, err
|
||||
}
|
||||
}
|
||||
return result, offset, nil
|
||||
}
|
||||
|
||||
func Int64Size(v int64) int {
|
||||
// https://cs.opensource.google/go/go/+/master:src/encoding/binary/varint.go;l=92;drc=dac9b9ddbd5160c5f4552410f5f8281bd5eed38c
|
||||
// and
|
||||
// https://cs.opensource.google/go/go/+/master:src/encoding/binary/varint.go;l=41;drc=dac9b9ddbd5160c5f4552410f5f8281bd5eed38c
|
||||
ux := uint64(v) << 1
|
||||
if v < 0 {
|
||||
ux = ^ux
|
||||
}
|
||||
s := 0
|
||||
for ux >= 0x80 {
|
||||
s++
|
||||
ux >>= 7
|
||||
}
|
||||
return s + 1
|
||||
}
|
||||
|
||||
func Int64Marshal(buf []byte, offset int, v int64) (int, error) {
|
||||
if len(buf)-offset < Int64Size(v) {
|
||||
return 0, errBufTooSmall("int64", true, offset)
|
||||
}
|
||||
return offset + binary.PutVarint(buf[offset:], v), nil
|
||||
}
|
||||
|
||||
func Int64Unmarshal(buf []byte, offset int) (int64, int, error) {
|
||||
v, read := binary.Varint(buf[offset:])
|
||||
if read == 0 {
|
||||
return 0, 0, errBufTooSmall("int64", false, offset)
|
||||
}
|
||||
if read < 0 {
|
||||
return 0, 0, &MarshallerError{
|
||||
errMsg: "int64 unmarshal overflow",
|
||||
offset: offset,
|
||||
}
|
||||
}
|
||||
return v, offset + read, nil
|
||||
}
|
||||
|
||||
func StringSize(s string) int {
|
||||
return Int64Size(int64(len(s))) + len(s)
|
||||
}
|
||||
|
||||
func StringMarshal(buf []byte, offset int, s string) (int, error) {
|
||||
if len(s) > maxSliceLen {
|
||||
return 0, &MarshallerError{
|
||||
errMsg: fmt.Sprintf("string is too long: '%d'", len(s)),
|
||||
offset: offset,
|
||||
}
|
||||
}
|
||||
if len(buf)-offset < Int64Size(int64(len(s)))+len(s) {
|
||||
return 0, errBufTooSmall("string", true, offset)
|
||||
}
|
||||
|
||||
offset, err := Int64Marshal(buf, offset, int64(len(s)))
|
||||
if err != nil {
|
||||
return 0, err
|
||||
}
|
||||
if s == "" {
|
||||
return offset, nil
|
||||
}
|
||||
return offset + copy(buf[offset:], s), nil
|
||||
}
|
||||
|
||||
func StringUnmarshal(buf []byte, offset int) (string, int, error) {
|
||||
size, offset, err := Int64Unmarshal(buf, offset)
|
||||
if err != nil {
|
||||
return "", 0, err
|
||||
}
|
||||
if size == 0 {
|
||||
return "", offset, nil
|
||||
}
|
||||
if size > maxSliceLen {
|
||||
return "", 0, &MarshallerError{
|
||||
errMsg: fmt.Sprintf("string is too long: '%d'", size),
|
||||
offset: offset,
|
||||
}
|
||||
}
|
||||
if size < 0 {
|
||||
return "", 0, &MarshallerError{
|
||||
errMsg: fmt.Sprintf("invalid string size: '%d'", size),
|
||||
offset: offset,
|
||||
}
|
||||
}
|
||||
if len(buf)-offset < int(size) {
|
||||
return "", 0, errBufTooSmall("string", false, offset)
|
||||
}
|
||||
return string(buf[offset : offset+int(size)]), offset + int(size), nil
|
||||
}
|
||||
|
||||
func UInt8Marshal(buf []byte, offset int, value uint8) (int, error) {
|
||||
if len(buf)-offset < 1 {
|
||||
return 0, errBufTooSmall("uint8", true, offset)
|
||||
}
|
||||
buf[offset] = value
|
||||
return offset + 1, nil
|
||||
}
|
||||
|
||||
func UInt8Unmarshal(buf []byte, offset int) (uint8, int, error) {
|
||||
if len(buf)-offset < 1 {
|
||||
return 0, 0, errBufTooSmall("uint8", false, offset)
|
||||
}
|
||||
return buf[offset], offset + 1, nil
|
||||
}
|
||||
|
||||
func ByteMarshal(buf []byte, offset int, value byte) (int, error) {
|
||||
return UInt8Marshal(buf, offset, value)
|
||||
}
|
||||
|
||||
func ByteUnmarshal(buf []byte, offset int) (byte, int, error) {
|
||||
return UInt8Unmarshal(buf, offset)
|
||||
}
|
||||
|
||||
func BoolMarshal(buf []byte, offset int, value bool) (int, error) {
|
||||
if value {
|
||||
return UInt8Marshal(buf, offset, byteTrue)
|
||||
}
|
||||
return UInt8Marshal(buf, offset, byteFalse)
|
||||
}
|
||||
|
||||
func BoolUnmarshal(buf []byte, offset int) (bool, int, error) {
|
||||
v, offset, err := UInt8Unmarshal(buf, offset)
|
||||
if err != nil {
|
||||
return false, 0, err
|
||||
}
|
||||
if v == byteTrue {
|
||||
return true, offset, nil
|
||||
}
|
||||
if v == byteFalse {
|
||||
return false, offset, nil
|
||||
}
|
||||
return false, 0, &MarshallerError{
|
||||
errMsg: fmt.Sprintf("invalid marshalled value for bool: %d", v),
|
||||
offset: offset - BoolSize,
|
||||
}
|
||||
}
|
||||
|
|
@ -1,313 +0,0 @@
|
|||
package marshal
|
||||
|
||||
import (
|
||||
"encoding/binary"
|
||||
"math"
|
||||
"testing"
|
||||
|
||||
"github.com/stretchr/testify/require"
|
||||
)
|
||||
|
||||
func TestMarshalling(t *testing.T) {
|
||||
t.Parallel()
|
||||
t.Run("slice", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
t.Run("nil slice", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
var int64s []int64
|
||||
expectedSize := SliceSize(int64s, Int64Size)
|
||||
require.Equal(t, 1, expectedSize)
|
||||
buf := make([]byte, expectedSize)
|
||||
offset, err := SliceMarshal(buf, 0, int64s, Int64Marshal)
|
||||
require.NoError(t, err)
|
||||
require.NoError(t, VerifyMarshal(buf, offset))
|
||||
|
||||
result, offset, err := SliceUnmarshal(buf, 0, Int64Unmarshal)
|
||||
require.NoError(t, err)
|
||||
require.NoError(t, VerifyUnmarshal(buf, offset))
|
||||
require.Nil(t, result)
|
||||
})
|
||||
|
||||
t.Run("empty slice", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
int64s := make([]int64, 0)
|
||||
expectedSize := SliceSize(int64s, Int64Size)
|
||||
require.Equal(t, 1, expectedSize)
|
||||
buf := make([]byte, expectedSize)
|
||||
offset, err := SliceMarshal(buf, 0, int64s, Int64Marshal)
|
||||
require.NoError(t, err)
|
||||
require.NoError(t, VerifyMarshal(buf, offset))
|
||||
|
||||
result, offset, err := SliceUnmarshal(buf, 0, Int64Unmarshal)
|
||||
require.NoError(t, err)
|
||||
require.NoError(t, VerifyUnmarshal(buf, offset))
|
||||
require.NotNil(t, result)
|
||||
require.Len(t, result, 0)
|
||||
})
|
||||
|
||||
t.Run("non empty slice", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
int64s := make([]int64, 100)
|
||||
for i := range int64s {
|
||||
int64s[i] = int64(i)
|
||||
}
|
||||
expectedSize := SliceSize(int64s, Int64Size)
|
||||
buf := make([]byte, expectedSize)
|
||||
offset, err := SliceMarshal(buf, 0, int64s, Int64Marshal)
|
||||
require.NoError(t, err)
|
||||
require.NoError(t, VerifyMarshal(buf, offset))
|
||||
|
||||
result, offset, err := SliceUnmarshal(buf, 0, Int64Unmarshal)
|
||||
require.NoError(t, err)
|
||||
require.NoError(t, VerifyUnmarshal(buf, offset))
|
||||
require.Equal(t, int64s, result)
|
||||
})
|
||||
|
||||
t.Run("corrupted slice size", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
int64s := make([]int64, 100)
|
||||
for i := range int64s {
|
||||
int64s[i] = int64(i)
|
||||
}
|
||||
expectedSize := SliceSize(int64s, Int64Size)
|
||||
buf := make([]byte, expectedSize)
|
||||
offset, err := SliceMarshal(buf, 0, int64s, Int64Marshal)
|
||||
require.NoError(t, err)
|
||||
require.NoError(t, VerifyMarshal(buf, offset))
|
||||
|
||||
for i := 0; i < binary.MaxVarintLen64; i++ {
|
||||
buf[i] = 129
|
||||
}
|
||||
|
||||
_, _, err = SliceUnmarshal(buf, 0, Int64Unmarshal)
|
||||
var mErr *MarshallerError
|
||||
require.ErrorAs(t, err, &mErr)
|
||||
|
||||
for i := 0; i < binary.MaxVarintLen64; i++ {
|
||||
buf[i] = 127
|
||||
}
|
||||
_, _, err = SliceUnmarshal(buf, 0, Int64Unmarshal)
|
||||
require.ErrorAs(t, err, &mErr)
|
||||
})
|
||||
|
||||
t.Run("corrupted slice item", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
int64s := make([]int64, 100)
|
||||
for i := range int64s {
|
||||
int64s[i] = int64(i)
|
||||
}
|
||||
expectedSize := SliceSize(int64s, Int64Size)
|
||||
buf := make([]byte, expectedSize)
|
||||
offset, err := SliceMarshal(buf, 0, int64s, Int64Marshal)
|
||||
require.NoError(t, err)
|
||||
require.NoError(t, VerifyMarshal(buf, offset))
|
||||
|
||||
for i := 2; i < binary.MaxVarintLen64+2; i++ {
|
||||
buf[i] = 129
|
||||
}
|
||||
|
||||
_, _, err = SliceUnmarshal(buf, 0, Int64Unmarshal)
|
||||
var mErr *MarshallerError
|
||||
require.ErrorAs(t, err, &mErr)
|
||||
})
|
||||
|
||||
t.Run("small buffer", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
int64s := make([]int64, 100)
|
||||
for i := range int64s {
|
||||
int64s[i] = int64(i)
|
||||
}
|
||||
buf := make([]byte, 1)
|
||||
_, err := SliceMarshal(buf, 0, int64s, Int64Marshal)
|
||||
var mErr *MarshallerError
|
||||
require.ErrorAs(t, err, &mErr)
|
||||
|
||||
buf = make([]byte, 10)
|
||||
_, err = SliceMarshal(buf, 0, int64s, Int64Marshal)
|
||||
require.ErrorAs(t, err, &mErr)
|
||||
})
|
||||
})
|
||||
|
||||
t.Run("int64", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
t.Run("success", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
require.Equal(t, 1, Int64Size(0))
|
||||
require.Equal(t, binary.MaxVarintLen64, Int64Size(math.MaxInt64))
|
||||
require.Equal(t, binary.MaxVarintLen64, Int64Size(math.MinInt64))
|
||||
|
||||
for _, v := range []int64{0, math.MinInt64, math.MaxInt64} {
|
||||
size := Int64Size(v)
|
||||
buf := make([]byte, size)
|
||||
offset, err := Int64Marshal(buf, 0, v)
|
||||
require.NoError(t, err)
|
||||
require.NoError(t, VerifyMarshal(buf, offset))
|
||||
|
||||
uv, offset, err := Int64Unmarshal(buf, 0)
|
||||
require.NoError(t, err)
|
||||
require.NoError(t, VerifyUnmarshal(buf, offset))
|
||||
require.Equal(t, v, uv)
|
||||
}
|
||||
})
|
||||
|
||||
t.Run("invalid buffer", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
var mErr *MarshallerError
|
||||
|
||||
_, err := Int64Marshal([]byte{}, 0, 100500)
|
||||
require.ErrorAs(t, err, &mErr)
|
||||
|
||||
_, _, err = Int64Unmarshal(nil, 0)
|
||||
require.ErrorAs(t, err, &mErr)
|
||||
})
|
||||
|
||||
t.Run("overflow", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
var mErr *MarshallerError
|
||||
|
||||
var v int64 = math.MaxInt64
|
||||
buf := make([]byte, Int64Size(v))
|
||||
_, err := Int64Marshal(buf, 0, v)
|
||||
require.NoError(t, err)
|
||||
|
||||
buf[9] = 2
|
||||
|
||||
_, _, err = Int64Unmarshal(buf, 0)
|
||||
require.ErrorAs(t, err, &mErr)
|
||||
})
|
||||
})
|
||||
|
||||
t.Run("string", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
t.Run("success", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
for _, v := range []string{
|
||||
"", "arn:aws:iam::namespace:group/some_group", "$Object:homomorphicHash",
|
||||
"native:container/ns/9LPLUFZpEmfidG4n44vi2cjXKXSqWT492tCvLJiJ8W1J",
|
||||
} {
|
||||
size := StringSize(v)
|
||||
buf := make([]byte, size)
|
||||
offset, err := StringMarshal(buf, 0, v)
|
||||
require.NoError(t, err)
|
||||
require.NoError(t, VerifyMarshal(buf, offset))
|
||||
|
||||
uv, offset, err := StringUnmarshal(buf, 0)
|
||||
require.NoError(t, err)
|
||||
require.NoError(t, VerifyUnmarshal(buf, offset))
|
||||
require.Equal(t, v, uv)
|
||||
}
|
||||
})
|
||||
|
||||
t.Run("invalid buffer", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
str := "avada kedavra"
|
||||
|
||||
var mErr *MarshallerError
|
||||
_, err := StringMarshal(nil, 0, str)
|
||||
require.ErrorAs(t, err, &mErr)
|
||||
|
||||
_, _, err = StringUnmarshal(nil, 0)
|
||||
require.ErrorAs(t, err, &mErr)
|
||||
|
||||
buf := make([]byte, StringSize(str))
|
||||
offset, err := StringMarshal(buf, 0, str)
|
||||
require.NoError(t, err)
|
||||
require.NoError(t, VerifyMarshal(buf, offset))
|
||||
buf = buf[:len(buf)-1]
|
||||
_, _, err = StringUnmarshal(buf, 0)
|
||||
require.ErrorAs(t, err, &mErr)
|
||||
})
|
||||
})
|
||||
|
||||
t.Run("uint8, byte", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
for _, v := range []byte{0, 8, 16, 32, 64, 128, 255} {
|
||||
buf := make([]byte, ByteSize)
|
||||
offset, err := ByteMarshal(buf, 0, v)
|
||||
require.NoError(t, err)
|
||||
require.NoError(t, VerifyMarshal(buf, offset))
|
||||
|
||||
ub, offset, err := ByteUnmarshal(buf, 0)
|
||||
require.NoError(t, err)
|
||||
require.NoError(t, VerifyUnmarshal(buf, offset))
|
||||
require.Equal(t, v, ub)
|
||||
|
||||
buf = make([]byte, UInt8Size)
|
||||
offset, err = UInt8Marshal(buf, 0, v)
|
||||
require.NoError(t, err)
|
||||
require.NoError(t, VerifyMarshal(buf, offset))
|
||||
|
||||
uu, offset, err := UInt8Unmarshal(buf, 0)
|
||||
require.NoError(t, err)
|
||||
require.NoError(t, VerifyUnmarshal(buf, offset))
|
||||
require.Equal(t, v, uu)
|
||||
}
|
||||
})
|
||||
|
||||
t.Run("bool", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
|
||||
t.Run("success", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
for _, v := range []bool{false, true} {
|
||||
buf := make([]byte, BoolSize)
|
||||
offset, err := BoolMarshal(buf, 0, v)
|
||||
require.NoError(t, err)
|
||||
require.NoError(t, VerifyMarshal(buf, offset))
|
||||
|
||||
ub, offset, err := BoolUnmarshal(buf, 0)
|
||||
require.NoError(t, err)
|
||||
require.NoError(t, VerifyUnmarshal(buf, offset))
|
||||
require.Equal(t, v, ub)
|
||||
}
|
||||
})
|
||||
|
||||
t.Run("invalid value", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
buf := make([]byte, BoolSize)
|
||||
offset, err := BoolMarshal(buf, 0, true)
|
||||
require.NoError(t, err)
|
||||
require.NoError(t, VerifyMarshal(buf, offset))
|
||||
|
||||
buf[0] = 2
|
||||
|
||||
_, _, err = BoolUnmarshal(buf, 0)
|
||||
var mErr *MarshallerError
|
||||
require.ErrorAs(t, err, &mErr)
|
||||
})
|
||||
|
||||
t.Run("invalid buffer", func(t *testing.T) {
|
||||
t.Parallel()
|
||||
var mErr *MarshallerError
|
||||
|
||||
_, err := BoolMarshal(nil, 0, true)
|
||||
require.ErrorAs(t, err, &mErr)
|
||||
|
||||
buf := append(make([]byte, BoolSize), 100)
|
||||
offset, err := BoolMarshal(buf, 0, true)
|
||||
require.NoError(t, err)
|
||||
require.ErrorAs(t, VerifyMarshal(buf, offset), &mErr)
|
||||
|
||||
v, offset, err := BoolUnmarshal(buf, 0)
|
||||
require.NoError(t, err)
|
||||
require.True(t, v)
|
||||
require.ErrorAs(t, VerifyUnmarshal(buf, offset), &mErr)
|
||||
|
||||
_, _, err = BoolUnmarshal(nil, 0)
|
||||
require.ErrorAs(t, err, &mErr)
|
||||
})
|
||||
})
|
||||
}
|
||||
|
|
@ -1,248 +0,0 @@
|
|||
package policy
|
||||
|
||||
import (
|
||||
"errors"
|
||||
"fmt"
|
||||
"math/big"
|
||||
"strings"
|
||||
|
||||
"git.frostfs.info/TrueCloudLab/frostfs-contract/commonclient"
|
||||
"git.frostfs.info/TrueCloudLab/frostfs-contract/policy"
|
||||
client "git.frostfs.info/TrueCloudLab/frostfs-contract/rpcclient/policy"
|
||||
"git.frostfs.info/TrueCloudLab/policy-engine/pkg/chain"
|
||||
"git.frostfs.info/TrueCloudLab/policy-engine/pkg/engine"
|
||||
"github.com/google/uuid"
|
||||
"github.com/nspcc-dev/neo-go/pkg/neorpc/result"
|
||||
"github.com/nspcc-dev/neo-go/pkg/rpcclient/actor"
|
||||
neoinvoker "github.com/nspcc-dev/neo-go/pkg/rpcclient/invoker"
|
||||
"github.com/nspcc-dev/neo-go/pkg/util"
|
||||
"github.com/nspcc-dev/neo-go/pkg/vm/stackitem"
|
||||
"github.com/nspcc-dev/neo-go/pkg/wallet"
|
||||
)
|
||||
|
||||
var (
|
||||
ErrEmptyChainID = errors.New("chain id is not set")
|
||||
|
||||
ErrEngineTargetTypeUnsupported = errors.New("this target type is not supported yet")
|
||||
)
|
||||
|
||||
// ContractStorage is the interface to manage chain rules within Policy contract.
|
||||
type ContractStorage struct {
|
||||
hash util.Uint160
|
||||
|
||||
actor ContractStorageActor
|
||||
|
||||
contractInterface *client.Contract
|
||||
}
|
||||
|
||||
var _ engine.MorphRuleChainStorage = (*ContractStorage)(nil)
|
||||
|
||||
// ContractStorageReader is the interface to read data from Policy contract.
|
||||
type ContractStorageReader struct {
|
||||
hash util.Uint160
|
||||
|
||||
invoker ContractStorageInvoker
|
||||
|
||||
contractReaderInterface *client.ContractReader
|
||||
}
|
||||
|
||||
type ContractStorageActor interface {
|
||||
client.Actor
|
||||
GetRPCInvoker() neoinvoker.RPCInvoke
|
||||
}
|
||||
|
||||
var _ engine.MorphRuleChainStorageReader = (*ContractStorageReader)(nil)
|
||||
|
||||
func NewContractStorage(actor ContractStorageActor, contract util.Uint160) *ContractStorage {
|
||||
return &ContractStorage{
|
||||
hash: contract,
|
||||
actor: actor,
|
||||
contractInterface: client.New(actor, contract),
|
||||
}
|
||||
}
|
||||
|
||||
type contractStorageActorImpl struct {
|
||||
client.Actor
|
||||
rpcActor actor.RPCActor
|
||||
}
|
||||
|
||||
var _ ContractStorageActor = &contractStorageActorImpl{}
|
||||
|
||||
func (c *contractStorageActorImpl) GetRPCInvoker() neoinvoker.RPCInvoke {
|
||||
return c.rpcActor
|
||||
}
|
||||
|
||||
// NewContractStorageWithSimpleActor constructs core actor from `rpcActor`.
|
||||
//
|
||||
// Note: NewContractStorageWithSimpleActor is appropriate only for call-only-once cases (for example, in CLIs). Otherwise, it is unsafe,
|
||||
// because core actor may use invalidated `rpcActor` if some connection errors occurred.
|
||||
func NewContractStorageWithSimpleActor(rpcActor actor.RPCActor, acc *wallet.Account, contract util.Uint160) (*ContractStorage, error) {
|
||||
act, err := actor.NewSimple(rpcActor, acc)
|
||||
if err != nil {
|
||||
return nil, fmt.Errorf("failed to create simple actor: %w", err)
|
||||
}
|
||||
return NewContractStorage(&contractStorageActorImpl{Actor: act, rpcActor: rpcActor}, contract), nil
|
||||
}
|
||||
|
||||
func (s *ContractStorage) AddMorphRuleChain(name chain.Name, target engine.Target, c *chain.Chain) (txHash util.Uint256, vub uint32, err error) {
|
||||
if len(c.ID) == 0 {
|
||||
err = ErrEmptyChainID
|
||||
return
|
||||
}
|
||||
|
||||
var kind policy.Kind
|
||||
kind, err = policyKind(target.Type)
|
||||
if err != nil {
|
||||
return
|
||||
}
|
||||
fullName := prefixedChainName(name, c.ID)
|
||||
|
||||
txHash, vub, err = s.contractInterface.AddChain(big.NewInt(int64(kind)), target.Name, fullName, c.Bytes())
|
||||
return
|
||||
}
|
||||
|
||||
func (s *ContractStorage) RemoveMorphRuleChain(name chain.Name, target engine.Target, chainID chain.ID) (txHash util.Uint256, vub uint32, err error) {
|
||||
if len(chainID) == 0 {
|
||||
err = ErrEmptyChainID
|
||||
return
|
||||
}
|
||||
|
||||
var kind policy.Kind
|
||||
kind, err = policyKind(target.Type)
|
||||
if err != nil {
|
||||
return
|
||||
}
|
||||
fullName := prefixedChainName(name, chainID)
|
||||
|
||||
txHash, vub, err = s.contractInterface.RemoveChain(big.NewInt(int64(kind)), target.Name, fullName)
|
||||
return
|
||||
}
|
||||
|
||||
func (s *ContractStorage) RemoveMorphRuleChainsByTarget(name chain.Name, target engine.Target) (txHash util.Uint256, vub uint32, err error) {
|
||||
var kind policy.Kind
|
||||
kind, err = policyKind(target.Type)
|
||||
if err != nil {
|
||||
return
|
||||
}
|
||||
fullName := prefixedChainName(name, nil)
|
||||
|
||||
txHash, vub, err = s.contractInterface.RemoveChainsByPrefix(big.NewInt(int64(kind)), target.Name, fullName)
|
||||
return
|
||||
}
|
||||
|
||||
func listChains(name chain.Name, target engine.Target, rpcInvoker neoinvoker.RPCInvoke, hash util.Uint160) ([]*chain.Chain, error) {
|
||||
kind, err := policyKind(target.Type)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
const (
|
||||
method = "iteratorChainsByPrefix"
|
||||
batchSize = neoinvoker.DefaultIteratorResultItems
|
||||
)
|
||||
|
||||
inv := neoinvoker.New(rpcInvoker, nil)
|
||||
params := []any{
|
||||
big.NewInt(int64(kind)), target.Name, []byte(name),
|
||||
}
|
||||
|
||||
items, err := commonclient.ReadIteratorItems(inv, batchSize, hash, method, params...)
|
||||
if err != nil {
|
||||
return nil, fmt.Errorf("read items error: %w", err)
|
||||
}
|
||||
var chains []*chain.Chain
|
||||
for _, item := range items {
|
||||
serialized, err := bytesFromStackItem(item)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
c := new(chain.Chain)
|
||||
if err := c.DecodeBytes(serialized); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
chains = append(chains, c)
|
||||
}
|
||||
return chains, nil
|
||||
}
|
||||
|
||||
func (s *ContractStorage) ListMorphRuleChains(name chain.Name, target engine.Target) ([]*chain.Chain, error) {
|
||||
return listChains(name, target, s.actor.GetRPCInvoker(), s.hash)
|
||||
}
|
||||
|
||||
func (s *ContractStorage) ListTargetsIterator(targetType engine.TargetType) (uuid.UUID, result.Iterator, error) {
|
||||
kind, err := policyKind(targetType)
|
||||
if err != nil {
|
||||
return uuid.UUID{}, result.Iterator{}, err
|
||||
}
|
||||
return s.contractInterface.ListTargets(big.NewInt(int64(kind)))
|
||||
}
|
||||
|
||||
func (s *ContractStorage) GetAdmin() (util.Uint160, error) {
|
||||
return s.contractInterface.GetAdmin()
|
||||
}
|
||||
|
||||
func (s *ContractStorage) SetAdmin(addr util.Uint160) (util.Uint256, uint32, error) {
|
||||
return s.contractInterface.SetAdmin(addr)
|
||||
}
|
||||
|
||||
type ContractStorageInvoker interface {
|
||||
client.Invoker
|
||||
GetRPCInvoker() neoinvoker.RPCInvoke
|
||||
}
|
||||
|
||||
func NewContractStorageReader(inv ContractStorageInvoker, contract util.Uint160) *ContractStorageReader {
|
||||
return &ContractStorageReader{
|
||||
hash: contract,
|
||||
invoker: inv,
|
||||
contractReaderInterface: client.NewReader(inv, contract),
|
||||
}
|
||||
}
|
||||
|
||||
func (s *ContractStorageReader) ListMorphRuleChains(name chain.Name, target engine.Target) ([]*chain.Chain, error) {
|
||||
return listChains(name, target, s.invoker.GetRPCInvoker(), s.hash)
|
||||
}
|
||||
|
||||
func (s *ContractStorageReader) GetAdmin() (util.Uint160, error) {
|
||||
return s.contractReaderInterface.GetAdmin()
|
||||
}
|
||||
|
||||
func (s *ContractStorageReader) ListTargetsIterator(targetType engine.TargetType) (uuid.UUID, result.Iterator, error) {
|
||||
kind, err := policyKind(targetType)
|
||||
if err != nil {
|
||||
return uuid.UUID{}, result.Iterator{}, err
|
||||
}
|
||||
return s.contractReaderInterface.ListTargets(big.NewInt(int64(kind)))
|
||||
}
|
||||
|
||||
func bytesFromStackItem(param stackitem.Item) ([]byte, error) {
|
||||
switch param.Type() {
|
||||
case stackitem.BufferT, stackitem.ByteArrayT, stackitem.IntegerT:
|
||||
return param.TryBytes()
|
||||
case stackitem.AnyT:
|
||||
if param.Value() == nil {
|
||||
return nil, nil
|
||||
}
|
||||
fallthrough
|
||||
default:
|
||||
return nil, fmt.Errorf("chain/client: %s is not a byte array type", param.Type())
|
||||
}
|
||||
}
|
||||
|
||||
func prefixedChainName(name chain.Name, chainID chain.ID) []byte {
|
||||
return []byte(strings.ToLower(fmt.Sprintf("%s:%s", name, chainID)))
|
||||
}
|
||||
|
||||
func policyKind(typ engine.TargetType) (policy.Kind, error) {
|
||||
switch typ {
|
||||
case engine.Namespace:
|
||||
return policy.Namespace, nil
|
||||
case engine.Container:
|
||||
return policy.Container, nil
|
||||
case engine.User:
|
||||
return policy.Kind(engine.User), nil
|
||||
case engine.Group:
|
||||
return policy.Kind(engine.Group), nil
|
||||
default:
|
||||
return policy.Kind(0), ErrEngineTargetTypeUnsupported
|
||||
}
|
||||
}
|
||||
|
|
@ -1,53 +0,0 @@
|
|||
package testutil
|
||||
|
||||
import (
|
||||
resourcepkg "git.frostfs.info/TrueCloudLab/policy-engine/pkg/resource"
|
||||
)
|
||||
|
||||
type Resource struct {
|
||||
name string
|
||||
properties map[string]string
|
||||
}
|
||||
|
||||
func (r *Resource) Name() string {
|
||||
return r.name
|
||||
}
|
||||
|
||||
func (r *Resource) Property(name string) string {
|
||||
return r.properties[name]
|
||||
}
|
||||
|
||||
func NewResource(name string, properties map[string]string) *Resource {
|
||||
if properties == nil {
|
||||
properties = make(map[string]string)
|
||||
}
|
||||
return &Resource{name: name, properties: properties}
|
||||
}
|
||||
|
||||
type Request struct {
|
||||
operation string
|
||||
properties map[string]string
|
||||
resource *Resource
|
||||
}
|
||||
|
||||
var _ resourcepkg.Request = (*Request)(nil)
|
||||
|
||||
func (r *Request) Operation() string {
|
||||
return r.operation
|
||||
}
|
||||
|
||||
func (r *Request) Resource() resourcepkg.Resource {
|
||||
return r.resource
|
||||
}
|
||||
|
||||
func (r *Request) Property(name string) string {
|
||||
return r.properties[name]
|
||||
}
|
||||
|
||||
func NewRequest(op string, r *Resource, properties map[string]string) *Request {
|
||||
return &Request{
|
||||
operation: op,
|
||||
properties: properties,
|
||||
resource: r,
|
||||
}
|
||||
}
|
||||
30
policy.go
Normal file
30
policy.go
Normal file
|
|
@ -0,0 +1,30 @@
|
|||
package policyengine
|
||||
|
||||
//{
|
||||
// "Version": "xyz",
|
||||
// "Policy": [
|
||||
// {
|
||||
// "Effect": "Allow",
|
||||
// "Action": [
|
||||
// "native:*",
|
||||
// "s3:PutObject",
|
||||
// "s3:GetObject"
|
||||
// ],
|
||||
// "Resource": ["*"],
|
||||
// "Principal": ["did:frostfs:039e3ee771a223361fe7862f532e9511b57baaae3c3e2622682e99d0e660f7671"],
|
||||
// "Condition": [ {"StringEquals": {"native::object::attribute", "iamuser-admin"}]
|
||||
// }
|
||||
// ]
|
||||
//}
|
||||
|
||||
// type Policy struct {
|
||||
// Rules []Rule `json:"Policy"`
|
||||
// }
|
||||
|
||||
// type AWSRule struct {
|
||||
// Effect string `json:"Effect"`
|
||||
// Action []string `json:"Action"`
|
||||
// Resource []string `json:"Resource"`
|
||||
// Principal []string `json:"Principal"`
|
||||
// Condition []Condition `json:"Condition"`
|
||||
// }
|
||||
|
|
@ -1,4 +1,4 @@
|
|||
package resource
|
||||
package policyengine
|
||||
|
||||
// Request represents generic named resource (bucket, container etc.).
|
||||
// Name is resource depenent but should be globally unique for any given
|
||||
49
resource_test.go
Normal file
49
resource_test.go
Normal file
|
|
@ -0,0 +1,49 @@
|
|||
package policyengine
|
||||
|
||||
type resource struct {
|
||||
name string
|
||||
properties map[string]string
|
||||
}
|
||||
|
||||
func (r *resource) Name() string {
|
||||
return r.name
|
||||
}
|
||||
|
||||
func (r *resource) Property(name string) string {
|
||||
return r.properties[name]
|
||||
}
|
||||
|
||||
func newResource(name string, properties map[string]string) *resource {
|
||||
if properties == nil {
|
||||
properties = make(map[string]string)
|
||||
}
|
||||
return &resource{name: name, properties: properties}
|
||||
}
|
||||
|
||||
type request struct {
|
||||
operation string
|
||||
properties map[string]string
|
||||
resource *resource
|
||||
}
|
||||
|
||||
var _ Request = (*request)(nil)
|
||||
|
||||
func (r *request) Operation() string {
|
||||
return r.operation
|
||||
}
|
||||
|
||||
func (r *request) Resource() Resource {
|
||||
return r.resource
|
||||
}
|
||||
|
||||
func (r *request) Property(name string) string {
|
||||
return r.properties[name]
|
||||
}
|
||||
|
||||
func newRequest(op string, r *resource, properties map[string]string) *request {
|
||||
return &request{
|
||||
operation: op,
|
||||
properties: properties,
|
||||
resource: r,
|
||||
}
|
||||
}
|
||||
|
|
@ -1,11 +0,0 @@
|
|||
package common
|
||||
|
||||
const (
|
||||
PropertyKeyFrostFSIDGroupID = "frostfsid:groupID"
|
||||
|
||||
PropertyKeyFrostFSSourceIP = "frostfs:sourceIP"
|
||||
|
||||
PropertyKeyFormatFrostFSIDUserClaim = "frostfsid:userClaim/%s"
|
||||
|
||||
PropertyKeyFrostFSXHeader = "frostfs:xheader/%s"
|
||||
)
|
||||
|
|
@ -1,60 +0,0 @@
|
|||
package native
|
||||
|
||||
const (
|
||||
MethodGetObject = "GetObject"
|
||||
MethodPutObject = "PutObject"
|
||||
MethodHeadObject = "HeadObject"
|
||||
MethodDeleteObject = "DeleteObject"
|
||||
MethodSearchObject = "SearchObject"
|
||||
MethodRangeObject = "RangeObject"
|
||||
MethodHashObject = "HashObject"
|
||||
MethodPatchObject = "PatchObject"
|
||||
|
||||
MethodPutContainer = "PutContainer"
|
||||
MethodDeleteContainer = "DeleteContainer"
|
||||
MethodGetContainer = "GetContainer"
|
||||
MethodListContainers = "ListContainers"
|
||||
MethodSetContainerEACL = "SetContainerEACL"
|
||||
MethodGetContainerEACL = "GetContainerEACL"
|
||||
|
||||
ObjectPrefix = "native:object"
|
||||
ContainerPrefix = "native:container"
|
||||
|
||||
ResourceFormatNamespaceObjects = "native:object/%s/*"
|
||||
ResourceFormatNamespaceContainerObjects = "native:object/%s/%s/*"
|
||||
ResourceFormatNamespaceContainerObject = "native:object/%s/%s/%s"
|
||||
|
||||
ResourceFormatRootObjects = "native:object//*"
|
||||
ResourceFormatRootContainerObjects = "native:object//%s/*"
|
||||
ResourceFormatRootContainerObject = "native:object//%s/%s"
|
||||
|
||||
ResourceFormatAllObjects = "native:object/*"
|
||||
|
||||
ResourceFormatNamespaceContainer = "native:container/%s/%s"
|
||||
ResourceFormatNamespaceContainers = "native:container/%s/*"
|
||||
|
||||
ResourceFormatRootContainer = "native:container//%s"
|
||||
ResourceFormatRootContainers = "native:container//*"
|
||||
|
||||
ResourceFormatAllContainers = "native:container/*"
|
||||
|
||||
PropertyKeyActorPublicKey = "$Actor:publicKey"
|
||||
PropertyKeyActorRole = "$Actor:role"
|
||||
|
||||
PropertyKeyObjectVersion = "$Object:version"
|
||||
PropertyKeyObjectID = "$Object:objectID"
|
||||
PropertyKeyObjectContainerID = "$Object:containerID"
|
||||
PropertyKeyObjectOwnerID = "$Object:ownerID"
|
||||
PropertyKeyObjectCreationEpoch = "$Object:creationEpoch"
|
||||
PropertyKeyObjectPayloadLength = "$Object:payloadLength"
|
||||
PropertyKeyObjectPayloadHash = "$Object:payloadHash"
|
||||
PropertyKeyObjectType = "$Object:objectType"
|
||||
PropertyKeyObjectHomomorphicHash = "$Object:homomorphicHash"
|
||||
|
||||
PropertyKeyContainerOwnerID = "$Container:ownerID"
|
||||
|
||||
PropertyValueContainerRoleOwner = "owner"
|
||||
PropertyValueContainerRoleIR = "ir"
|
||||
PropertyValueContainerRoleContainer = "container"
|
||||
PropertyValueContainerRoleOthers = "others"
|
||||
)
|
||||
|
|
@ -1,45 +0,0 @@
|
|||
package util
|
||||
|
||||
import (
|
||||
"strings"
|
||||
|
||||
"git.frostfs.info/TrueCloudLab/policy-engine/schema/native"
|
||||
)
|
||||
|
||||
var nativePatterns = []string{
|
||||
native.ResourceFormatNamespaceObjects, native.ResourceFormatNamespaceContainerObjects,
|
||||
native.ResourceFormatNamespaceContainerObject, native.ResourceFormatRootObjects,
|
||||
native.ResourceFormatRootContainerObjects, native.ResourceFormatRootContainerObject,
|
||||
native.ResourceFormatAllObjects, native.ResourceFormatNamespaceContainer,
|
||||
native.ResourceFormatNamespaceContainers, native.ResourceFormatRootContainer,
|
||||
native.ResourceFormatRootContainers, native.ResourceFormatAllContainers,
|
||||
}
|
||||
|
||||
func match(resource, pattern string) bool {
|
||||
rTokens := strings.Split(resource, "/")
|
||||
pToken := strings.Split(pattern, "/")
|
||||
|
||||
if len(rTokens) != len(pToken) {
|
||||
return false
|
||||
}
|
||||
|
||||
for i := range rTokens {
|
||||
if pToken[i] == "%s" {
|
||||
continue
|
||||
}
|
||||
if pToken[i] != rTokens[i] {
|
||||
return false
|
||||
}
|
||||
}
|
||||
|
||||
return true
|
||||
}
|
||||
|
||||
func IsNativeResourceNameValid(resource string) bool {
|
||||
for _, pattern := range nativePatterns {
|
||||
if match(resource, pattern) {
|
||||
return true
|
||||
}
|
||||
}
|
||||
return false
|
||||
}
|
||||
|
|
@ -1,97 +0,0 @@
|
|||
package util
|
||||
|
||||
import (
|
||||
"testing"
|
||||
|
||||
"github.com/stretchr/testify/require"
|
||||
)
|
||||
|
||||
var tests = []struct {
|
||||
name string
|
||||
expected bool
|
||||
resource string
|
||||
}{
|
||||
{
|
||||
name: "ResourceFormatNamespaceObjects",
|
||||
expected: true,
|
||||
resource: "native:object/RootNamespace/*",
|
||||
},
|
||||
{
|
||||
name: "ResourceFormatNamespaceContainerObjects",
|
||||
expected: true,
|
||||
resource: "native:object/RootNamespace/BzQw5HH3feoxFDD5tCT87Y1726qzgLfxEE7wgtoRzB3R/*",
|
||||
},
|
||||
{
|
||||
name: "ResourceFormatNamespaceContainerObject",
|
||||
expected: true,
|
||||
resource: "native:object/RootNamespace/BzQw5HH3feoxFDD5tCT87Y1726qzgLfxEE7wgtoRzB3R/AeZa5HH3feoxFDD5tCT87Y1726qzgLfxEE7wgtoRzB4E",
|
||||
},
|
||||
{
|
||||
name: "ResourceFormatRootObjects",
|
||||
expected: true,
|
||||
resource: "native:object//*",
|
||||
},
|
||||
{
|
||||
name: "ResourceFormatRootContainerObjects",
|
||||
expected: true,
|
||||
resource: "native:object//BzQw5HH3feoxFDD5tCT87Y1726qzgLfxEE7wgtoRzB3R/*",
|
||||
},
|
||||
{
|
||||
name: "ResourceFormatRootContainerObject",
|
||||
expected: true,
|
||||
resource: "native:object//BzQw5HH3feoxFDD5tCT87Y1726qzgLfxEE7wgtoRzB3R/AeZa5HH3feoxFDD5tCT87Y1726qzgLfxEE7wgtoRzB4E",
|
||||
},
|
||||
{
|
||||
name: "ResourceFormatAllObjects",
|
||||
expected: true,
|
||||
resource: "native:object/*",
|
||||
},
|
||||
{
|
||||
name: "ResourceFormatNamespaceContainer",
|
||||
expected: true,
|
||||
resource: "native:container/RootNamespace/BzQw5HH3feoxFDD5tCT87Y1726qzgLfxEE7wgtoRzB3R",
|
||||
},
|
||||
{
|
||||
name: "ResourceFormatNamespaceContainers",
|
||||
expected: true,
|
||||
resource: "native:container/RootNamespace/*",
|
||||
},
|
||||
{
|
||||
name: "ResourceFormatRootContainers",
|
||||
expected: true,
|
||||
resource: "native:container//*",
|
||||
},
|
||||
{
|
||||
name: "ResourceFormatAllContainers",
|
||||
expected: true,
|
||||
resource: "native:container/*",
|
||||
},
|
||||
{
|
||||
name: "Invalid resource 1",
|
||||
expected: false,
|
||||
resource: "native:::container/*",
|
||||
},
|
||||
{
|
||||
name: "Invalid resource 2",
|
||||
expected: false,
|
||||
resource: "native:container/RootNamespace/w5HH3feoxFDD5tCTtoRzB3R/Bz726qzgLfxEE7wgtoRzB3R/RootNamespace",
|
||||
},
|
||||
}
|
||||
|
||||
func TestIsNativeResourceNameValid(t *testing.T) {
|
||||
for _, test := range tests {
|
||||
t.Run(test.name, func(t *testing.T) {
|
||||
require.Equal(t, test.expected, IsNativeResourceNameValid(test.resource))
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
func BenchmarkIsNativeResourceNameValid(b *testing.B) {
|
||||
for _, test := range tests {
|
||||
b.Run(test.name, func(b *testing.B) {
|
||||
for i := 0; i < b.N; i++ {
|
||||
_ = IsNativeResourceNameValid(test.resource)
|
||||
}
|
||||
})
|
||||
}
|
||||
}
|
||||
|
|
@ -1,24 +0,0 @@
|
|||
package s3
|
||||
|
||||
const (
|
||||
PropertyKeyOwner = "Owner"
|
||||
|
||||
PropertyKeyDelimiter = "s3:delimiter"
|
||||
PropertyKeyPrefix = "s3:prefix"
|
||||
PropertyKeyVersionID = "s3:VersionId"
|
||||
PropertyKeyMaxKeys = "s3:max-keys"
|
||||
|
||||
PropertyKeyFormatResourceTag = "aws:ResourceTag/%s"
|
||||
PropertyKeyFormatRequestTag = "aws:RequestTag/%s"
|
||||
|
||||
PropertyKeyAccessBoxAttrMFA = "AccessBox-Attribute/IAM-MFA"
|
||||
PropertyKeyFormatAccessBoxAttr = "AccessBox-Attribute/%s"
|
||||
|
||||
ResourceFormatS3All = "arn:aws:s3:::*"
|
||||
ResourceFormatS3Bucket = "arn:aws:s3:::%s"
|
||||
ResourceFormatS3BucketObjects = "arn:aws:s3:::%s/*"
|
||||
ResourceFormatS3BucketObject = "arn:aws:s3:::%s/%s"
|
||||
|
||||
ResourceFormatIAMNamespaceUser = "arn:aws:iam::%s:user/%s"
|
||||
ResourceFormatIAMNamespaceGroup = "arn:aws:iam::%s:group/%s"
|
||||
)
|
||||
Loading…
Reference in a new issue