[#87] iam: Support s3:PatchObject action

Signed-off-by: Marina Biryukova <m.biryukova@yadro.com>

.forgejo/workflows/dco.yml

@@ -0,0 +1,21 @@
+name: DCO action
+on: [pull_request]
+
+jobs:
+  dco:
+    name: DCO
+    runs-on: ubuntu-latest
+    steps:
+      - uses: actions/checkout@v3
+        with:
+          fetch-depth: 0
+
+      - name: Setup Go
+        uses: actions/setup-go@v3
+        with:
+          go-version: '1.23'
+
+      - name: Run commit format checker
+        uses: https://git.frostfs.info/TrueCloudLab/dco-go@v3
+        with:
+          from: 'origin/${{ github.event.pull_request.base.ref }}'

.forgejo/workflows/tests.yml

@@ -0,0 +1,73 @@
+name: Tests and linters
+on: [pull_request]
+
+jobs:
+  lint:
+    name: Lint
+    runs-on: ubuntu-latest
+    steps:
+      - uses: actions/checkout@v3
+
+      - name: Set up Go
+        uses: actions/setup-go@v3
+        with:
+          go-version: '1.23'
+          cache: true
+
+      - name: Install linters
+        run: make lint-install
+
+      - name: Run linters
+        run: make lint
+
+  tests:
+    name: Tests
+    runs-on: ubuntu-latest
+    strategy:
+      matrix:
+        go_versions: [ '1.22', '1.23' ]
+      fail-fast: false
+    steps:
+      - uses: actions/checkout@v3
+
+      - name: Set up Go
+        uses: actions/setup-go@v3
+        with:
+          go-version: '${{ matrix.go_versions }}'
+          cache: true
+
+      - name: Run tests
+        run: make test
+
+  tests-race:
+    name: Tests with -race
+    runs-on: ubuntu-latest
+    steps:
+      - uses: actions/checkout@v3
+
+      - name: Set up Go
+        uses: actions/setup-go@v3
+        with:
+          go-version: '1.23'
+          cache: true
+
+      - name: Run tests
+        run: go test ./... -count=1 -race
+
+  staticcheck:
+    name: Staticcheck
+    runs-on: ubuntu-latest
+    steps:
+      - uses: actions/checkout@v3
+
+      - name: Set up Go
+        uses: actions/setup-go@v3
+        with:
+          go-version: '1.23'
+          cache: true
+
+      - name: Install staticcheck
+        run: make staticcheck-install
+
+      - name: Run staticcheck
+        run: make staticcheck-run

.gitattributes

@@ -1,2 +1,4 @@
 /**/*.pb.go -diff -merge
 /**/*.pb.go linguist-generated=true
+/**/*_easyjson.go -diff -merge
+/**/*_easyjson.go linguist-generated=true

.golangci.yml

@@ -12,7 +12,8 @@ run:
 # output configuration options
 output:
   # colored-line-number|line-number|json|tab|checkstyle|code-climate, default is "colored-line-number"
-  format: tab
+  formats:
+    - format: tab
 
 # all available settings of specific linters
 linters-settings:
@@ -47,7 +48,7 @@ linters:
     - durationcheck
     - exhaustive
     - exportloopref
-    - gofmt
+    - gofumpt
     - goimports
     - misspell
     - whitespace

.pre-commit-config.yaml

@@ -2,13 +2,6 @@ ci:
   autofix_prs: false
 
 repos:
-  - repo: https://github.com/jorisroovers/gitlint
-    rev:  v0.19.1
-    hooks:
-      - id: gitlint
-        stages: [commit-msg]
-      - id: gitlint-ci
-
   - repo: https://github.com/pre-commit/pre-commit-hooks
     rev: v4.4.0
     hooks:
@@ -26,20 +19,29 @@ repos:
       exclude: ".key$"
 
   - repo: https://github.com/shellcheck-py/shellcheck-py
-    rev: v0.9.0.2
+    rev: v0.9.0.6
     hooks:
       - id: shellcheck
 
-  - repo: https://github.com/golangci/golangci-lint
-    rev: v1.51.2
+  - repo: local
     hooks:
-      - id: golangci-lint
+      - id: make-lint
+        name: Run Make Lint
+        entry: make lint
+        language: system
+        pass_filenames: false
 
   - repo: local
     hooks:
        - id: go-unit-tests
          name: go unit tests
-         entry: make test
+         entry: make test GOFLAGS=''
          pass_filenames: false
          types: [go]
          language: system
+
+  - repo: https://github.com/TekWizely/pre-commit-golang
+    rev: v1.0.0-rc.1
+    hooks:
+       - id: go-staticcheck-repo-mod
+       - id: go-mod-tidy

Makefile

@@ -0,0 +1,77 @@
+#!/usr/bin/make -f
+
+TRUECLOUDLAB_LINT_VERSION ?= 0.0.6
+TMP_DIR := .cache
+OUTPUT_LINT_DIR ?= $(shell pwd)/bin
+LINT_VERSION ?= 1.60.1
+LINT_DIR = $(OUTPUT_LINT_DIR)/golangci-lint-$(LINT_VERSION)-v$(TRUECLOUDLAB_LINT_VERSION)
+EASYJSON_VERSION ?= $(shell go list -f '{{.Version}}' -m github.com/mailru/easyjson)
+EASYJSON_DIR ?= $(shell pwd)/bin/easyjson-$(EASYJSON_VERSION)
+
+# Run all code formatters
+fmts: fmt imports
+
+# Reformat code
+fmt:
+	@echo "⇒ Processing gofmt check"
+	@gofumpt -s -w .
+
+# Reformat imports
+imports:
+	@echo "⇒ Processing goimports check"
+	@goimports -w .
+
+# Run Unit Test with go test
+test: GOFLAGS ?= "-count=1"
+test:
+	@echo "⇒ Running go test"
+	@GOFLAGS="$(GOFLAGS)" go test ./...
+
+# Activate pre-commit hooks
+pre-commit:
+	pre-commit install -t pre-commit -t commit-msg
+
+# Deactivate pre-commit hooks
+unpre-commit:
+	pre-commit uninstall -t pre-commit -t commit-msg
+
+pre-commit-run:
+	@pre-commit run -a --hook-stage manual
+
+# Install linters
+lint-install:
+	@mkdir -p $(TMP_DIR)
+	@rm -rf $(TMP_DIR)/linters
+	@git -c advice.detachedHead=false clone --branch v$(TRUECLOUDLAB_LINT_VERSION) https://git.frostfs.info/TrueCloudLab/linters.git $(TMP_DIR)/linters
+	@make -C $(TMP_DIR)/linters lib CGO_ENABLED=1 OUT_DIR=$(OUTPUT_LINT_DIR)
+	@rm -rf $(TMP_DIR)/linters
+	@rmdir $(TMP_DIR) 2>/dev/null || true
+	@CGO_ENABLED=1 GOBIN=$(LINT_DIR) go install github.com/golangci/golangci-lint/cmd/golangci-lint@v$(LINT_VERSION)
+
+# Run linters
+lint:
+	@if [ ! -d "$(LINT_DIR)" ]; then \
+		echo "Run make lint-install"; \
+		exit 1; \
+	fi
+	@$(LINT_DIR)/golangci-lint run
+
+# Install staticcheck
+staticcheck-install:
+	@go install honnef.co/go/tools/cmd/staticcheck@latest
+
+# Run staticcheck
+staticcheck-run:
+	@staticcheck ./...
+
+easyjson-install:
+	@rm -rf $(EASYJSON_DIR)
+	@mkdir -p $(EASYJSON_DIR)
+	@GOBIN=$(EASYJSON_DIR) go install github.com/mailru/easyjson/...@$(EASYJSON_VERSION)
+
+generate:
+	@if [ ! -d "$(EASYJSON_DIR)" ]; then \
+		make easyjson-install; \
+	fi
+	find ./ -name "_easyjson.go" -exec rm -rf {} \;
+	$(EASYJSON_DIR)/easyjson ./pkg/chain/chain.go

chain.go

@@ -1,179 +0,0 @@
-package policyengine
-
-import (
-	"encoding/json"
-	"fmt"
-	"strings"
-)
-
-// Engine ...
-type Engine interface {
-	// IsAllowed returns status for the operation after all checks.
-	// The second return value signifies whether a matching rule was found.
-	IsAllowed(name Name, namespace string, r Request) (Status, bool)
-}
-
-// ChainID is the ID of rule chain.
-type ChainID string
-
-type Chain struct {
-	ID ChainID
-
-	Rules []Rule
-}
-
-func (c *Chain) Bytes() []byte {
-	data, err := json.Marshal(c)
-	if err != nil {
-		panic(err)
-	}
-	return data
-}
-
-func (c *Chain) DecodeBytes(b []byte) error {
-	return json.Unmarshal(b, c)
-}
-
-type Rule struct {
-	Status Status
-	// Actions the operation is applied to.
-	Action []string
-	// List of the resources the operation is applied to.
-	Resource []string
-	// True iff individual conditions must be combined with the logical OR.
-	// By default AND is used, so _each_ condition must pass.
-	Any       bool
-	Condition []Condition
-}
-
-type Condition struct {
-	Op     ConditionType
-	Object ObjectType
-	Key    string
-	Value  string
-}
-
-type ObjectType byte
-
-const (
-	ObjectResource ObjectType = iota
-	ObjectRequest
-	ObjectActor
-)
-
-type ConditionType byte
-
-// TODO @fyrchik: reduce the number of conditions.
-// Everything from here should be expressable, but we do not need them all.
-// https://docs.aws.amazon.com/IAM/latest/UserGuide/reference_policies_elements_condition_operators.html
-const (
-	// String condition operators.
-	CondStringEquals ConditionType = iota
-	CondStringNotEquals
-	CondStringEqualsIgnoreCase
-	CondStringNotEqualsIgnoreCase
-	CondStringLike
-	CondStringNotLike
-	CondStringLessThan
-	CondStringLessThanEquals
-	CondStringGreaterThan
-	CondStringGreaterThanEquals
-
-	// Numeric condition operators.
-	CondNumericEquals
-	CondNumericNotEquals
-	CondNumericLessThan
-	CondNumericLessThanEquals
-	CondNumericGreaterThan
-	CondNumericGreaterThanEquals
-)
-
-func (c *Condition) Match(req Request) bool {
-	var val string
-	switch c.Object {
-	case ObjectResource:
-		val = req.Resource().Property(c.Key)
-	case ObjectRequest:
-		val = req.Property(c.Key)
-	default:
-		panic(fmt.Sprintf("unknown condition type: %d", c.Object))
-	}
-
-	switch c.Op {
-	default:
-		panic(fmt.Sprintf("unimplemented: %s", c.Op))
-	case CondStringEquals:
-		return val == c.Value
-	case CondStringNotEquals:
-		return val != c.Value
-	case CondStringEqualsIgnoreCase:
-		return strings.EqualFold(val, c.Value)
-	case CondStringNotEqualsIgnoreCase:
-		return !strings.EqualFold(val, c.Value)
-	case CondStringLike:
-		return globMatch(val, c.Value)
-	case CondStringNotLike:
-		return !globMatch(val, c.Value)
-	case CondStringLessThan:
-		return val < c.Value
-	case CondStringLessThanEquals:
-		return val <= c.Value
-	case CondStringGreaterThan:
-		return val > c.Value
-	case CondStringGreaterThanEquals:
-		return val >= c.Value
-	}
-}
-
-func (r *Rule) Match(req Request) (status Status, matched bool) {
-	found := len(r.Resource) == 0
-	for i := range r.Resource {
-		if globMatch(req.Resource().Name(), r.Resource[i]) {
-			found = true
-			break
-		}
-	}
-	if !found {
-		return NoRuleFound, false
-	}
-	for i := range r.Action {
-		if globMatch(req.Operation(), r.Action[i]) {
-			return r.matchCondition(req)
-		}
-	}
-	return NoRuleFound, false
-}
-
-func (r *Rule) matchCondition(obj Request) (status Status, matched bool) {
-	if r.Any {
-		return r.matchAny(obj)
-	}
-	return r.matchAll(obj)
-}
-func (r *Rule) matchAny(obj Request) (status Status, matched bool) {
-	for i := range r.Condition {
-		if r.Condition[i].Match(obj) {
-
-			return r.Status, true
-		}
-	}
-	return NoRuleFound, false
-}
-func (r *Rule) matchAll(obj Request) (status Status, matched bool) {
-	for i := range r.Condition {
-		if !r.Condition[i].Match(obj) {
-			return NoRuleFound, false
-		}
-	}
-	return r.Status, true
-}
-
-func (c *Chain) Match(req Request) (status Status, matched bool) {
-	for i := range c.Rules {
-		status, matched := c.Rules[i].Match(req)
-		if matched {
-			return status, true
-		}
-	}
-	return NoRuleFound, false
-}

chain_test.go

@@ -1,33 +0,0 @@
-package policyengine
-
-import (
-	"testing"
-
-	"github.com/stretchr/testify/require"
-)
-
-func TestEncodeDecode(t *testing.T) {
-	expected := Chain{
-		Rules: []Rule{
-			{
-				Status: Allow,
-				Action: []string{
-					"native::PutObject",
-				},
-				Resource: []string{"*"},
-				Condition: []Condition{
-					{
-						Op:    CondStringEquals,
-						Key:   "Name",
-						Value: "NNS",
-					},
-				},
-			},
-		},
-	}
-	data := expected.Bytes()
-
-	var actual Chain
-	require.NoError(t, actual.DecodeBytes(data))
-	require.Equal(t, expected, actual)
-}

docs/ape.md

@@ -0,0 +1,85 @@
+# Access policy engine
+
+## General overview
+
+### Purpose
+
+Access policy engine (APE) is aimed at checking if a request can be performed over a resource by looking up the set chains of rules.
+
+#### Terms
+
+| Term           | Description                                                    | Structure overview     |
+| -------------- | -------------------------------------------------------------- | -------------- |
+| `Request`      | The action that is being performed on the `Resource`.                          | <ul><li>`Operation` - `GetObject`,`PutObject` etc.;</li><li>`Properties` - actor's public key, actor's attributes;</li><li>`Resource`.</li></ul> |
+| `Resource`     | The object that the request is being performed on. Check also [resource.md](./resource.md).   |  <ul><li>`Name` - strictly formatted string value;</li><li>`Properties`.</li></ul> |
+| `Chain`        | A chain of `Rule`-s defined for a specific target. Chains are strictly distinguished by `Name`-s , i.e. chains with name `ingress` are not intersected with chains with name `s3`. Chains are stored in serialized format.       | <ul><li>Base64-encoded `ID`;</li><li>List of `Rule`-s;</li><li>`MatchType` - defines rule status selection priority.</li></ul> |
+| `Rule`         | `Rule` defines which status is returned if `Request` matches all conditions.                                                         | <ul><li>`Status`: `Allow`, `AccessDenied`, `QuotaLimitReached`, `NoRuleFound`;</li><li>`Actions` - operation defined by a schema (`GetObject`, `PutContainer` etc.);</li><li>`Resources`;</li><li>`Any` - if `true` then `Reqeust` matches `Rule` if any `Condition` is `true`;</li><li>`Conditions`.</li></ul> |
+| `Name`   | `Name` of a chain (do not confuse with chain ID). `Name` defines a layer of `Chain`'s usage, so chains are distinguished by `Name`-s. Basically, `Name` refers to a protocol.                                                       | String value (`ingress`, `s3`, `iam`).      |
+| `Target`       | A scope of request. `Target` can be either simple (only namespace; only container; only user; only groups) or compound (namespace + container). | <ul><li>`Namespace`;</li><li>`Container`;</li><li>`User`;</li><li>`Groups`.</li></ul> |
+| `Engine`       | `Engine` checks a request in a scope defined by `Target`. First, it is trying to match a request with rules defined in `LocalOverrideStorage` and, then, in `MorphRuleChainStorage`.                                                          | <ul><li>`LocalOverrideStorage` - chains stored in the local override storage have the highest priority</li><li>`MorphRuleChainStorage` - basically, chains stored in `Policy` contract;</li><li>`ChainRouter` - looks up chains and try to match them with `Request`.</li></ul> |
+
+#### Details
+
+Here some entities are overviewed in more detail.
+
+##### Resource
+
+`Resource`'s name is strictly formatted, the format is defined by a schema (`native`, `aws` etc.). Examples:
+
+```bash
+# The resource is the particular object with the address within Root namespace
+native:object//HRwWbb1bJjRms33kkA21hy4JdPfARaH3fW9NfuNN6Fgj/EbxzAdz5LB4uqxuz6crWKAumBNtZyK2rKsqQP7TdZvwr
+# The resource is all objects within the container within Root namespace
+native:object//HRwWbb1bJjRms33kkA21hy4JdPfARaH3fW9NfuNN6Fgj/*
+# The resource is the particular container within the namespace
+native:container/namespace1/HRwWbb1bJjRms33kkA21hy4JdPfARaH3fW9NfuNN6Fgj
+# The resource is all containers within the namespace
+native:container/namespace1/*
+```
+
+##### Rule
+
+`Rule` works out if:
+
+ 1. a requests's operation matches the rule's `Actions`;
+ 2. resource name matches the rule's `Resources`;
+ 3. if all (or at least one if `Any=true`) conditions in `Condition` is met. Each condition defines how to retrieve
+and compare the retrieved value. If `Condition`'s `Object` is set to `Resource` then the value is retrieved from the
+resource's properties (example: container zone attribute). If `Object` is set to `Request`, the it's retrieved from the request's properties (example: actor's public key).
+
+###### Name matching
+
+`Resource`'s name in `Rule` may contain wildcard '*' that can be considered as a regular expression:
+
+```bash
+# The resource is all objects within the container within Root namespace
+native:object//HRwWbb1bJjRms33kkA21hy4JdPfARaH3fW9NfuNN6Fgj/*
+```
+
+If an incoming request has such a resource name, then names are matched:
+
+```bash
+# The resource is all objects within the container within Root namespace
+native:object//HRwWbb1bJjRms33kkA21hy4JdPfARaH3fW9NfuNN6Fgj/EbxzAdz5LB4uqxuz6crWKAumBNtZyK2rKsqQP7TdZvwr
+```
+
+If the incoming request has such a resource name that specifies a container's object within namespace, for instance, `namespicy`,
+then matching does not work out:
+
+```bash
+# The resource is all objects within the container within `namespicy` namespace:
+native:object/namespicy/HRwWbb1bJjRms33kkA21hy4JdPfARaH3fW9NfuNN6Fgj/EbxzAdz5LB4uqxuz6crWKAumBNtZyK2rKsqQP7TdZvwr
+```
+
+##### Engine
+
+`Engine` is trying to match the request against **the target** looking up chain rules, firstly, in `LocalOverrideStorage` (these rules are also known as *local overrides*) and then in `MorphRuleChainStorage` (contract `Policy`). Both storages iterate chain rules according to the specified priority of the targets: `namespace` -> `container` -> `user` -> `groups`.
+
+#### Diagrams
+
+The diagram demonstrates a scenario in Storage node. The request `A` cannot be performed as APE matched
+the request and returned `Access Denied` status. The request `B` is allowed and the client gets `OK` status.  
+![Storage node](images/ape/storage_node_ape.svg)
+
+The diagram demonstrates a complex scenario with S3, IAM and Storage node.
+![S3 and IAM](images/ape/s3_ape.svg)

docs/images/ape/s3_ape.puml

@@ -0,0 +1,61 @@
+@startuml s3 ape
+
+participant "Client" as client
+
+participant "IAM" as iam
+participant "IAM -> APE converter" as converter
+
+box "S3" #HotPink
+  participant "S3 gateway" as s3
+end box
+
+box "Access Policy Engine (as s3 middleware)" #LightPink
+  participant "Local override storage" as s3localOverrides
+  participant "Chain router" as s3chainRouter
+end box
+
+box "Policy contract (shared)" 
+  participant "Morph rule storage" as morphRuleStorage
+end box
+
+box "Access Policy Engine (as storage middleware)" #LightGreen
+  participant "Chain Router" as storageChainRouter
+  participant "Local override storage" as storageLocalOverrides
+end box
+
+box "Storage node" #Green
+  participant "Object service" as obj
+  participant "Control service" as control
+end box
+
+group Request IAM to set a policy
+  client -> iam : Set IAM policy
+  iam -> converter : Convert IAM policy
+  converter -> iam : Return APE chain
+  iam -> morphRuleStorage : Store IAM policy and APE chain
+  iam -> s3localOverrides : Set S3 local overrides
+  iam -> client : OK
+end
+
+group Request S3 to set a policy
+  client -> s3 : Set bucket policy
+  s3 -> converter : Convert IAM policy
+  converter -> s3 : Return APE chain
+  s3 -> morphRuleStorage : Store bucket policy and APE chain
+  s3 -> client : OK
+end
+
+group Get object
+  client -> s3: GetObject
+  s3 -> s3chainRouter: Check if APE allows request for S3
+  note over s3chainRouter: matching the request with overrides and rules
+  s3chainRouter -> s3: Status: ALLOW
+  s3 -> obj: Get object
+  obj -> storageChainRouter: Check if APE allows the request
+  note over storageChainRouter : matching the request with overrides and rules
+  storageChainRouter -> obj: Status: ALLOW
+  obj -> s3: Response: OK, Object
+  s3 -> client: Response: OK, Object
+end
+
+@enduml

docs/images/ape/storage_node_ape.puml

@@ -0,0 +1,46 @@
+@startuml storage node ape
+!pragma teoz true
+
+participant "Administrator" as administrator
+participant "Client" as client
+
+box "Storage node" #Green
+  participant "Object service" as obj
+  participant "Control service" as control
+end box
+
+box "Access Policy Engine" #LightGreen
+  participant "Local override storage" as localOverrides
+  participant "Chain Router" as chainRouter
+  participant "Morph rule storage" as morphRuleStorage
+end box
+
+group Set local override
+  client -> control: Add local override
+  control -> localOverrides: Save override in DB
+  localOverrides -> control: OK
+  control -> client: OK
+end
+
+group Update state in Policy contract
+  administrator -> morphRuleStorage: Add chain
+  morphRuleStorage -> administrator: OK
+end
+
+group Perform a request A
+  client -> obj : Sending a request
+  obj -> chainRouter: Check if APE allows the request
+  note over chainRouter : Fetches local overrides and rules defined for a target/targets and looks for a match
+  chainRouter -> obj: APE returns status: "ACCESS DENIED"
+  obj -> client: Response: "the request is denied"
+end
+
+group Perform a request B
+  client -> obj : Sending a request
+  obj -> chainRouter: Check if APE allows the request
+  note over chainRouter : Fetches local overrides and rules defined for a target/targets and looks for a match
+  chainRouter -> obj: APE returns status: "ALLOW"
+  obj -> client: Response: "OK"
+end
+
+@enduml

docs/policy_converters.md

@@ -0,0 +1,439 @@
+# Policy converters
+
+This repository contains converters that provide opportunities to
+transform [AWS IAM policies](https://docs.aws.amazon.com/IAM/latest/UserGuide/reference_policies.html) to inner
+FrostFS policy format. This document describes such transformations.
+
+## FrostFS
+
+As it was mentioned there are converters that transform AWS IAM policies to FrostFS.
+Here common examples of AWS:
+
+```json
+{
+  "Version": "2012-10-17",
+  "Statement": [
+    {
+      "Effect": "Allow",
+      "Action": [
+        "s3:*"
+      ],
+      "Resource": "*"
+    }
+  ]
+}
+```
+
+and FrostFS:
+
+```json
+{
+  "ID": "c29tZS1pZA==",
+  "Rules": [
+    {
+      "Status": "Allow",
+      "Actions": {
+        "Inverted": false,
+        "Names": [
+          "s3:*"
+        ]
+      },
+      "Resources": {
+        "Inverted": false,
+        "Names": [
+          "*"
+        ]
+      },
+      "Any": false,
+      "Condition": null
+    }
+  ],
+  "MatchType": "DenyPriority"
+}
+```
+
+policies.
+
+Despite there is only one FrostFS format, we have two converters (`s3` and `native`). The reason is S3 gateway and
+Storage node have different actions and resource naming:
+
+* S3 has [a lot of methods](https://docs.aws.amazon.com/AmazonS3/latest/API/API_Operations.html) and operates with
+  bucket/object
+* Storage node has only 6 container and 7 object methods and operates container/object (that has different format)
+
+The following sections describe each transformation more precisely ([common](#common) sections contains shared concepts)
+
+### Common
+
+#### Fields
+
+Rough json main fields mapping:
+
+| AWS policy field | FrostFS policy field | Comment                                                          |
+|------------------|----------------------|------------------------------------------------------------------|
+| `Version`        | -                    | Not applicable                                                   |
+| `Statement`      | `Rules`              |                                                                  |
+| `Effect`         | `Status`             |                                                                  |
+| `Action`         | `Actions.Names`      | `Actions.Inverted` = false                                       |
+| `NotAction`      | `Actions.Names`      | `Actions.Inverted` = true                                        |
+| `Resource`       | `Resources.Names`    | `Resources.Inverted` = false                                     |
+| `NotResource`    | `Resources.Names`    | `Resources.Inverted` = true                                      |
+| `Condition`      | `Condition`          | `Any` = false, that means the conditions must be hold altogether |
+| `Principal`      | -                    | Expressed via conditions (depends on s3/native converters)       |
+
+### Conditions
+
+Each condition in FrostFS policy can add requirements to some request/resource properties
+and consists of the following fields:
+
+| Field    | Description                                                                               |
+|----------|-------------------------------------------------------------------------------------------|
+| `Op`     | Condition type operation (`StringEqual`, `NumericEqual` etc)                              |                                                                   
+| `Object` | Property type to which condition can be applied (`Request` property, `Resource` property) |                                                                   
+| `Key`    | Property key                                                                              |                                                                   
+| `Value`  | Property value                                                                            |                                                                   
+
+Conditions operators:
+
+| AWS conditions operator     | FrostFS condition operator  | Comment                                                           |
+|-----------------------------|-----------------------------|-------------------------------------------------------------------|
+| `StringEquals`              | `StringEquals`              |                                                                   |
+| `StringNotEquals`           | `StringNotEquals`           |                                                                   |
+| `StringEqualsIgnoreCase`    | `StringEqualsIgnoreCase`    |                                                                   |
+| `StringNotEqualsIgnoreCase` | `StringNotEqualsIgnoreCase` |                                                                   |
+| `StringLike`                | `StringLike`                |                                                                   |
+| `StringNotLike`             | `StringNotLike`             |                                                                   |
+| `NumericEquals`             | `NumericEquals`             |                                                                   |
+| `NumericNotEquals`          | `NumericNotEquals`          |                                                                   |
+| `NumericLessThan`           | `NumericLessThan`           |                                                                   |
+| `NumericLessThanEquals`     | `NumericLessThanEquals`     |                                                                   |
+| `NumericGreaterThan`        | `NumericGreaterThan`        |                                                                   |
+| `NumericGreaterThanEquals`  | `NumericGreaterThanEquals`  |                                                                   |
+| `DateEquals`                | `StringEquals`              | Date transforms to unix timestamp to be compared as string        |
+| `DateNotEquals`             | `StringNotEquals`           | Date transforms to unix timestamp to be compared as string        |
+| `DateLessThan`              | `StringEqualsIgnoreCase`    | Date transforms to unix timestamp to be compared as string        |
+| `DateLessThanEquals`        | `StringNotEqualsIgnoreCase` | Date transforms to unix timestamp to be compared as string        |
+| `DateGreaterThan`           | `StringLike`                | Date transforms to unix timestamp to be compared as string        |
+| `DateGreaterThanEquals`     | `StringNotLike`             | Date transforms to unix timestamp to be compared as string        |
+| `Bool`                      | `StringEqualsIgnoreCase`    |                                                                   |
+| `IpAddress`                 | `IPAddress`                 |                                                                   |
+| `NotIpAddress`              | `NotIPAddress`              |                                                                   |
+| `ArnEquals`                 | `StringEquals`              |                                                                   |
+| `ArnLike`                   | `StringLike`                |                                                                   |
+| `ArnNotEquals`              | `StringNotEquals`           |                                                                   |
+| `ArnNotLike`                | `StringNotLike`             |                                                                   |
+| `SliceContains`             | `SliceContains`             | AWS spec doesn't contain such operator. This is FrostFS extension |
+
+For example, AWS conditions:
+
+```json
+{
+  "Condition": {
+    "ArnEquals": {"key16": ["val16"]},
+    "ArnNotEquals": {"key18": ["val18"]},
+    "ArnNotLike": {"key19": ["val19"]},
+    "Bool": {"key13": ["True"]},
+    "DateEquals": {"key7": ["2006-01-02T15:04:05+07:00"]},
+    "DateGreaterThan": {"key11": ["2006-01-02T15:04:05-01:00"]},
+    "DateGreaterThanEquals": {"key12": ["2006-01-02T15:04:05-03:00"]},
+    "DateLessThan": {"key9": ["2006-01-02T15:04:05+06:00"]},
+    "DateLessThanEquals": {"key10": ["2006-01-02T15:04:05+03:00"]},
+    "DateNotEquals": {"key8": ["2006-01-02T15:04:05Z"]},
+    "NumericEquals": {"key20": ["-20"]},
+    "NumericGreaterThan": {"key24": ["-24.24"]},
+    "NumericGreaterThanEquals": {"key25": ["+25.25"]},
+    "NumericLessThan": {"key22": ["0"]},
+    "NumericLessThanEquals": {"key23": ["23.23"]},
+    "NumericNotEquals": {"key21": ["+21"]},
+    "StringEquals": {"key1": ["val0"]},
+    "StringEqualsIgnoreCase": {"key3": ["val3"]},
+    "StringLike": {"key5": ["val5"]},
+    "StringNotEquals": {"key2": ["val2"]},
+    "StringNotEqualsIgnoreCase": {"key4": ["val4"]},
+    "StringNotLike": {"key6": ["val6"]}
+  }
+}
+```
+
+transforms to FrostFS conditions:
+
+```json
+{
+  "Condition": [
+    {"Op": "StringLike", "Object": "Request", "Key": "key5", "Value": "val5"},
+    {"Op": "StringNotEquals", "Object": "Request", "Key": "key2", "Value": "val2"},
+    {"Op": "StringGreaterThan", "Object": "Request", "Key": "key11", "Value": "1136217845"},
+    {"Op": "StringGreaterThanEquals", "Object": "Request", "Key": "key12", "Value": "1136225045"},
+    {"Op": "StringLessThan", "Object": "Request", "Key": "key9", "Value": "1136192645"},
+    {"Op": "StringEqualsIgnoreCase", "Object": "Request", "Key": "key3", "Value": "val3"},
+    {"Op": "StringEquals", "Object": "Request", "Key": "key16", "Value": "val16"},
+    {"Op": "NumericLessThanEquals", "Object": "Request", "Key": "key23", "Value": "23.23"},
+    {"Op": "StringNotEqualsIgnoreCase", "Object": "Request", "Key": "key4", "Value": "val4"},
+    {"Op": "StringEquals", "Object": "Request", "Key": "key1", "Value": "val0"},
+    {"Op": "StringLessThanEquals", "Object": "Request", "Key": "key10", "Value": "1136203445"},
+    {"Op": "NumericGreaterThan", "Object": "Request", "Key": "key24", "Value": "-24.24"},
+    {"Op": "NumericGreaterThanEquals", "Object": "Request", "Key": "key25", "Value": "+25.25"},
+    {"Op": "NumericLessThan", "Object": "Request", "Key": "key22", "Value": "0"},
+    {"Op": "StringNotEquals", "Object": "Request", "Key": "key8", "Value": "1136214245"},
+    {"Op": "NumericEquals", "Object": "Request", "Key": "key20", "Value": "-20"},
+    {"Op": "NumericNotEquals", "Object": "Request", "Key": "key21", "Value": "+21"},
+    {"Op": "StringNotLike", "Object": "Request", "Key": "key6", "Value": "val6"},
+    {"Op": "StringNotEquals", "Object": "Request", "Key": "key18", "Value": "val18"},
+    {"Op": "StringNotLike", "Object": "Request", "Key": "key19", "Value": "val19"},
+    {"Op": "StringEqualsIgnoreCase", "Object": "Request", "Key": "key13", "Value": "True"},
+    {"Op": "StringEquals", "Object": "Request", "Key": "key7", "Value": "1136189045"}
+  ]
+}
+```
+
+### S3
+
+#### Actions
+
+Each action allows some s3-gw methods, so we must transform action to specific method names
+(you can see exact mapping in table in [this file](../iam/converter_s3.go)).
+
+For example the following actions:
+
+```json
+{
+  "Action": [
+    "s3:DeleteObject",
+    "iam:CreateUser"
+  ]
+}
+```
+
+transforms to
+
+```json
+{
+  "Actions": {
+    "Inverted": false,
+    "Names": [
+      "s3:DeleteObject",
+      "s3:DeleteMultipleObjects",
+      "iam:CreateUser"
+    ]
+  }
+}
+```
+
+As we can see any `iam:*` action transformed as it is. But `s3:*` actions transforms according to
+[spec rules](https://docs.aws.amazon.com/service-authorization/latest/reference/list_amazons3.html) and s3-gw
+[method names](https://git.frostfs.info/TrueCloudLab/frostfs-s3-gw/src/commit/2ab655b909c40db6f7a4e41e07d8b99167f791bd/api/middleware/constants.go#L3-L76).
+
+#### Resources
+
+Resource is transformed as it is:
+
+```json
+{
+  "Resource": [
+    "arn:aws:s3:::bucket/object"
+  ]
+}
+```
+
+```json
+{
+  "Resources": {
+    "Inverted": false,
+    "Names": [
+      "arn:aws:s3:::bucket/object"
+    ]
+  }
+}
+```
+
+#### Principals
+
+To check user s3-gw uses special condition request property (`Owner`), so when AWS policy contains principal field
+it transforms to rule with appropriate condition. To get correct `Owner` property value special user resolver
+(`S3Resolver` interface in [converter_s3 file](../iam/converter_s3.go)) must be provided into convert function.
+
+For example such AWS json statement:
+
+```json
+{
+  "Effect": "Allow",
+  "Action": "*",
+  "Resource": "*",
+  "Principal": {
+    "AWS": "arn:aws:iam::111122223333:user/JohnDoe"
+  }
+}
+```
+
+transforms to the following FrostFS rule:
+
+```json
+{
+  "Status": "Allow",
+  "Actions": {
+    "Inverted": false,
+    "Names": [
+      "*"
+    ]
+  },
+  "Resources": {
+    "Inverted": false,
+    "Names": [
+      "*"
+    ]
+  },
+  "Any": false,
+  "Condition": [
+    {
+      "Op": "StringEquals",
+      "Object": "Request",
+      "Key": "Owner",
+      "Value": "NbUgTSFvPmsRxmGeWpuuGeJUoRoi6PErcM"
+    }
+  ]
+}
+```
+
+### Native
+
+#### Actions
+
+Each action allows some frostfs methods, so we must transform action to specific method names
+(you can see exact mapping in table in [this file](../iam/converter_native.go)).
+
+For example the following actions:
+
+```json
+{
+  "Action": [
+    "s3:DeleteObject",
+    "iam:CreateUser"
+  ]
+}
+```
+
+transforms to
+
+```json
+{
+  "Actions": {
+    "Inverted": false,
+    "Names": [
+      "PutObject",
+      "HeadObject",
+      "GetObject",
+      "RangeObject",
+      "GetContainer",
+      "DeleteObject"
+    ]
+  }
+}
+```
+
+> **Note:** Only subset of s3:* actions can be transformed (exact value you can see in mapping table mentioned before).
+> If all provided actions is not applicable converter function returns appropriate error.
+
+Native methods (to which original actions are transformed) depend on which methods are invoked by appropriate s3-gw
+[method](https://git.frostfs.info/TrueCloudLab/frostfs-s3-gw/src/commit/2ab655b909c40db6f7a4e41e07d8b99167f791bd/api/middleware/constants.go#L3-L76).
+
+So in example above s3-gw during performing DeleteObject methods invokes the following methods:
+`["PutObject","HeadObject","GetObject","RangeObject","GetContainer","DeleteObject"]`
+
+#### Resources
+
+To transform resources the following is being performed:
+
+* Bucket name is resoled to container id (by providing `NativeResolver` interface implementation to converter)
+* Object name is transformed to condition with special `FilePath` attribute
+  (that present on every object that was uploaded via s3-gw)
+
+For example, the following AWS policy statement:
+
+```json
+{
+  "Principal": "*",
+  "Effect": "Allow",
+  "Action": "*",
+  "Resource": "arn:aws:s3:::bucket/object"
+}
+```
+
+transforms to FrostFS native policy rule:
+
+```json
+{
+  "Status": "Allow",
+  "Actions": {
+    "Inverted": false,
+    "Names": [
+      "*"
+    ]
+  },
+  "Resources": {
+    "Inverted": false,
+    "Names": [
+      "native:object//bucket/HFq67qbfhFEiEL7qDXqayo3F78yAvxXSXzwSa2hKM9bH/*",
+      "native:container//bucket/HFq67qbfhFEiEL7qDXqayo3F78yAvxXSXzwSa2hKM9bH"
+    ]
+  },
+  "Any": false,
+  "Condition": [
+    {
+      "Op": "StringLike",
+      "Object": "Resource",
+      "Key": "FilePath",
+      "Value": "object"
+    }
+  ]
+}
+```
+
+#### Principals
+
+To check user s3-gw uses special condition request property (`$Actor:publicKey`), so when AWS policy contains principal
+field it transforms to rule with appropriate condition. To get correct `$Actor:publicKey` property value
+special user resolver (`NativeResolver` interface in [converter_native file](../iam/converter_native.go)) must be
+provided into convert function.
+
+For example such AWS json statement:
+
+```json
+{
+  "Effect": "Allow",
+  "Action": "*",
+  "Resource": "*",
+  "Principal": {
+    "AWS": "arn:aws:iam::111122223333:user/JohnDoe"
+  }
+}
+```
+
+transforms to the following FrostFS rule:
+
+```json
+{
+  "Status": "Allow",
+  "Actions": {
+    "Inverted": false,
+    "Names": [
+      "*"
+    ]
+  },
+  "Resources": {
+    "Inverted": false,
+    "Names": [
+      "native:object/*",
+      "native:container/*"
+    ]
+  },
+  "Any": false,
+  "Condition": [
+    {
+      "Op": "StringEquals",
+      "Object": "Request",
+      "Key": "$Actor:publicKey",
+      "Value": "031a6c6fbbdf02ca351745fa86b9ba5a9452d785ac4f7fc2b7548ca2a46c4fcf4a"
+    }
+  ]
+}
+```

docs/resource.md

@@ -0,0 +1,20 @@
+# Resource
+
+From the point of the access policy engine, a resource is an object to which a request is being performed.
+This can be an object in a container within a namespace, or all objects in a container,
+or all containers within the root namespace etc.
+
+A resource can be viewed from two sides:
+ - As part of a [request](../pkg/resource/resource.go). In this case a resource has a name and properties.
+ - As part of rule [chain](../pkg/chain/chain.go): a resource has just a name.
+
+## Resource name
+
+A resource name must have a such format that can be processed by a chain router that matches a request
+either with local overrides or with rules within policy contract to get if this request is allowed to be performed.
+The main idea of this format is for the chain router to match by full name (`native:object//cnrID/objID`) or
+wildcard (`native:object//cnrID/*`).
+
+Check out formats that are defined in the schema: [native formats](../schema/native/consts.go), [s3 formats](../schema/s3/consts.go).
+You should validate a resource name using [util](../schema/native/util/validation.go) before instantiating a request or
+before putting it to either to local override storage or the policy contract storage.

go.mod

@@ -1,11 +1,35 @@
 module git.frostfs.info/TrueCloudLab/policy-engine
 
-go 1.20
+go 1.22
 
-require github.com/stretchr/testify v1.8.1
+require (
+	git.frostfs.info/TrueCloudLab/frostfs-contract v0.19.3-0.20240409111539-e7a05a49ff45
+	github.com/google/uuid v1.3.1
+	github.com/mailru/easyjson v0.7.7
+	github.com/nspcc-dev/neo-go v0.105.0
+	github.com/stretchr/testify v1.8.4
+	golang.org/x/exp v0.0.0-20230817173708-d852ddb80c63
+)
 
 require (
 	github.com/davecgh/go-spew v1.1.1 // indirect
+	github.com/decred/dcrd/dcrec/secp256k1/v4 v4.0.1 // indirect
+	github.com/golang/snappy v0.0.1 // indirect
+	github.com/hashicorp/golang-lru v0.6.0 // indirect
+	github.com/josharian/intern v1.0.0 // indirect
+	github.com/mr-tron/base58 v1.2.0 // indirect
+	github.com/nspcc-dev/go-ordered-json v0.0.0-20231123160306-3374ff1e7a3c // indirect
+	github.com/nspcc-dev/neo-go/pkg/interop v0.0.0-20231127165613-b35f351f0ba0 // indirect
+	github.com/nspcc-dev/rfc6979 v0.2.0 // indirect
 	github.com/pmezard/go-difflib v1.0.0 // indirect
+	github.com/syndtr/goleveldb v1.0.1-0.20210305035536-64b5b1c73954 // indirect
+	github.com/twmb/murmur3 v1.1.5 // indirect
+	go.etcd.io/bbolt v1.3.8 // indirect
+	go.uber.org/multierr v1.10.0 // indirect
+	go.uber.org/zap v1.26.0 // indirect
+	golang.org/x/crypto v0.17.0 // indirect
+	golang.org/x/sync v0.3.0 // indirect
+	golang.org/x/sys v0.15.0 // indirect
+	golang.org/x/text v0.14.0 // indirect
 	gopkg.in/yaml.v3 v3.0.1 // indirect
 )

go.sum

@@ -1,17 +1,166 @@
-github.com/davecgh/go-spew v1.1.0/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
+git.frostfs.info/TrueCloudLab/frostfs-contract v0.19.3-0.20240409111539-e7a05a49ff45 h1:Tp4I+XOLp3VCJORfxSamQtj3RZNISbaLM4WD5iIzXxg=
+git.frostfs.info/TrueCloudLab/frostfs-contract v0.19.3-0.20240409111539-e7a05a49ff45/go.mod h1:F/fe1OoIDKr5Bz99q4sriuHDuf3aZefZy9ZsCqEtgxc=
+github.com/beorn7/perks v1.0.1 h1:VlbKKnNfV8bJzeqoa4cOKqO6bYr3WgKZxO8Z16+hsOM=
+github.com/beorn7/perks v1.0.1/go.mod h1:G2ZrVWU2WbWT9wwq4/hrbKbnv/1ERSJQ0ibhJ6rlkpw=
+github.com/bits-and-blooms/bitset v1.8.0 h1:FD+XqgOZDUxxZ8hzoBFuV9+cGWY9CslN6d5MS5JVb4c=
+github.com/bits-and-blooms/bitset v1.8.0/go.mod h1:7hO7Gc7Pp1vODcmWvKMRA9BNmbv6a/7QIWpPxHddWR8=
+github.com/cespare/xxhash/v2 v2.2.0 h1:DC2CZ1Ep5Y4k3ZQ899DldepgrayRUGE6BBZ/cd9Cj44=
+github.com/cespare/xxhash/v2 v2.2.0/go.mod h1:VGX0DQ3Q6kWi7AoAeZDth3/j3BFtOZR5XLFGgcrjCOs=
+github.com/consensys/bavard v0.1.13 h1:oLhMLOFGTLdlda/kma4VOJazblc7IM5y5QPd2A/YjhQ=
+github.com/consensys/bavard v0.1.13/go.mod h1:9ItSMtA/dXMAiL7BG6bqW2m3NdSEObYWoH223nGHukI=
+github.com/consensys/gnark-crypto v0.12.2-0.20231013160410-1f65e75b6dfb h1:f0BMgIjhZy4lSRHCXFbQst85f5agZAjtDMixQqBWNpc=
+github.com/consensys/gnark-crypto v0.12.2-0.20231013160410-1f65e75b6dfb/go.mod h1:v2Gy7L/4ZRosZ7Ivs+9SfUDr0f5UlG+EM5t7MPHiLuY=
+github.com/cpuguy83/go-md2man/v2 v2.0.0-20190314233015-f79a8a8ca69d h1:U+s90UTSYgptZMwQh2aRr3LuazLJIa+Pg3Kc1ylSYVY=
+github.com/cpuguy83/go-md2man/v2 v2.0.0-20190314233015-f79a8a8ca69d/go.mod h1:maD7wRr/U5Z6m/iR4s+kqSMx2CaBsrgA7czyZG/E6dU=
 github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c=
 github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
+github.com/decred/dcrd/crypto/blake256 v1.0.0/go.mod h1:sQl2p6Y26YV+ZOcSTP6thNdn47hh8kt6rqSlvmrXFAc=
+github.com/decred/dcrd/dcrec/secp256k1/v4 v4.0.1 h1:YLtO71vCjJRCBcrPMtQ9nqBsqpA1m5sE92cU+pd5Mcc=
+github.com/decred/dcrd/dcrec/secp256k1/v4 v4.0.1/go.mod h1:hyedUtir6IdtD/7lIxGeCxkaw7y45JueMRL4DIyJDKs=
+github.com/fsnotify/fsnotify v1.4.7/go.mod h1:jwhsz4b93w/PPRr/qN1Yymfu8t87LnFCMoQvtojpjFo=
+github.com/fsnotify/fsnotify v1.4.9 h1:hsms1Qyu0jgnwNXIxa+/V/PDsU6CfLf6CNO8H7IWoS4=
+github.com/fsnotify/fsnotify v1.4.9/go.mod h1:znqG4EE+3YCdAaPaxE2ZRY/06pZUdp0tY4IgpuI1SZQ=
+github.com/golang/protobuf v1.2.0/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U=
+github.com/golang/protobuf v1.4.0-rc.1/go.mod h1:ceaxUfeHdC40wWswd/P6IGgMaK3YpKi5j83Wpe3EHw8=
+github.com/golang/protobuf v1.4.0-rc.1.0.20200221234624-67d41d38c208/go.mod h1:xKAWHe0F5eneWXFV3EuXVDTCmh+JuBKY0li0aMyXATA=
+github.com/golang/protobuf v1.4.0-rc.2/go.mod h1:LlEzMj4AhA7rCAGe4KMBDvJI+AwstrUpVNzEA03Pprs=
+github.com/golang/protobuf v1.4.0-rc.4.0.20200313231945-b860323f09d0/go.mod h1:WU3c8KckQ9AFe+yFwt9sWVRKCVIyN9cPHBJSNnbL67w=
+github.com/golang/protobuf v1.4.0/go.mod h1:jodUvKwWbYaEsadDk5Fwe5c77LiNKVO9IDvqG2KuDX0=
+github.com/golang/protobuf v1.4.2/go.mod h1:oDoupMAO8OvCJWAcko0GGGIgR6R6ocIYbsSw735rRwI=
+github.com/golang/protobuf v1.5.3 h1:KhyjKVUg7Usr/dYsdSqoFveMYd5ko72D+zANwlG1mmg=
+github.com/golang/protobuf v1.5.3/go.mod h1:XVQd3VNwM+JqD3oG2Ue2ip4fOMUkwXdXDdiuN0vRsmY=
+github.com/golang/snappy v0.0.1 h1:Qgr9rKW7uDUkrbSmQeiDsGa8SjGyCOGtuasMWwvp2P4=
+github.com/golang/snappy v0.0.1/go.mod h1:/XxbfmMg8lxefKM7IXC3fBNl/7bRcc72aCRzEWrmP2Q=
+github.com/google/go-cmp v0.3.0/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU=
+github.com/google/go-cmp v0.3.1/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU=
+github.com/google/go-cmp v0.4.0/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE=
+github.com/google/uuid v1.3.1 h1:KjJaJ9iWZ3jOFZIf1Lqf4laDRCasjl0BCmnEGxkdLb4=
+github.com/google/uuid v1.3.1/go.mod h1:TIyPZe4MgqvfeYDBFedMoGGpEw/LqOeaOT+nhxU+yHo=
+github.com/gorilla/websocket v1.4.2 h1:+/TMaTYc4QFitKJxsQ7Yye35DkWvkdLcvGKqM+x0Ufc=
+github.com/gorilla/websocket v1.4.2/go.mod h1:YR8l580nyteQvAITg2hZ9XVh4b55+EU/adAjf1fMHhE=
+github.com/hashicorp/golang-lru v0.6.0 h1:uL2shRDx7RTrOrTCUZEGP/wJUFiUI8QT6E7z5o8jga4=
+github.com/hashicorp/golang-lru v0.6.0/go.mod h1:iADmTwqILo4mZ8BN3D2Q6+9jd8WM5uGBxy+E8yxSoD4=
+github.com/holiman/uint256 v1.2.0 h1:gpSYcPLWGv4sG43I2mVLiDZCNDh/EpGjSk8tmtxitHM=
+github.com/holiman/uint256 v1.2.0/go.mod h1:y4ga/t+u+Xwd7CpDgZESaRcWy0I7XMlTMA25ApIH5Jw=
+github.com/hpcloud/tail v1.0.0/go.mod h1:ab1qPbhIpdTxEkNHXyeSf5vhxWSCs/tWer42PpOxQnU=
+github.com/josharian/intern v1.0.0 h1:vlS4z54oSdjm0bgjRigI+G1HpF+tI+9rE5LLzOg8HmY=
+github.com/josharian/intern v1.0.0/go.mod h1:5DoeVV0s6jJacbCEi61lwdGj/aVlrQvzHFFd8Hwg//Y=
+github.com/mailru/easyjson v0.7.7 h1:UGYAvKxe3sBsEDzO8ZeWOSlIQfWFlxbzLZe7hwFURr0=
+github.com/mailru/easyjson v0.7.7/go.mod h1:xzfreul335JAWq5oZzymOObrkdz5UnU4kGfJJLY9Nlc=
+github.com/matttproud/golang_protobuf_extensions v1.0.1 h1:4hp9jkHxhMHkqkrB3Ix0jegS5sx/RkqARlsWZ6pIwiU=
+github.com/matttproud/golang_protobuf_extensions v1.0.1/go.mod h1:D8He9yQNgCq6Z5Ld7szi9bcBfOoFv/3dc6xSMkL2PC0=
+github.com/mmcloughlin/addchain v0.4.0 h1:SobOdjm2xLj1KkXN5/n0xTIWyZA2+s99UCY1iPfkHRY=
+github.com/mmcloughlin/addchain v0.4.0/go.mod h1:A86O+tHqZLMNO4w6ZZ4FlVQEadcoqkyU72HC5wJ4RlU=
+github.com/mr-tron/base58 v1.2.0 h1:T/HDJBh4ZCPbU39/+c3rRvE0uKBQlU27+QI8LJ4t64o=
+github.com/mr-tron/base58 v1.2.0/go.mod h1:BinMc/sQntlIE1frQmRFPUoPA1Zkr8VRgBdjWI2mNwc=
+github.com/nspcc-dev/go-ordered-json v0.0.0-20231123160306-3374ff1e7a3c h1:OOQeE613BH93ICPq3eke5N78gWNeMjcBWkmD2NKyXVg=
+github.com/nspcc-dev/go-ordered-json v0.0.0-20231123160306-3374ff1e7a3c/go.mod h1:79bEUDEviBHJMFV6Iq6in57FEOCMcRhfQnfaf0ETA5U=
+github.com/nspcc-dev/neo-go v0.105.0 h1:vtNZYFEFySK8zRDhLzQYha849VzWrcKezlnq/oNQg/w=
+github.com/nspcc-dev/neo-go v0.105.0/go.mod h1:6pchIHg5okeZO955RxpTh5q0sUI0vtpgPM6Q+no1rlI=
+github.com/nspcc-dev/neo-go/pkg/interop v0.0.0-20231127165613-b35f351f0ba0 h1:N+dMIBmteXjJpkH6UZ7HmNftuFxkqszfGLbhsEctnv0=
+github.com/nspcc-dev/neo-go/pkg/interop v0.0.0-20231127165613-b35f351f0ba0/go.mod h1:J/Mk6+nKeKSW4wygkZQFLQ6SkLOSGX5Ga0RuuuktEag=
+github.com/nspcc-dev/rfc6979 v0.2.0 h1:3e1WNxrN60/6N0DW7+UYisLeZJyfqZTNOjeV/toYvOE=
+github.com/nspcc-dev/rfc6979 v0.2.0/go.mod h1:exhIh1PdpDC5vQmyEsGvc4YDM/lyQp/452QxGq/UEso=
+github.com/nxadm/tail v1.4.4 h1:DQuhQpB1tVlglWS2hLQ5OV6B5r8aGxSrPc5Qo6uTN78=
+github.com/nxadm/tail v1.4.4/go.mod h1:kenIhsEOeOJmVchQTgglprH7qJGnHDVpk1VPCcaMI8A=
+github.com/onsi/ginkgo v1.6.0/go.mod h1:lLunBs/Ym6LB5Z9jYTR76FiuTmxDTDusOGeTQH+WWjE=
+github.com/onsi/ginkgo v1.12.1/go.mod h1:zj2OWP4+oCPe1qIXoGWkgMRwljMUYCdkwsT2108oapk=
+github.com/onsi/ginkgo v1.14.0 h1:2mOpI4JVVPBN+WQRa0WKH2eXR+Ey+uK4n7Zj0aYpIQA=
+github.com/onsi/ginkgo v1.14.0/go.mod h1:iSB4RoI2tjJc9BBv4NKIKWKya62Rps+oPG/Lv9klQyY=
+github.com/onsi/gomega v1.7.1/go.mod h1:XdKZgCCFLUoM/7CFJVPcG8C1xQ1AJ0vpAezJrB7JYyY=
+github.com/onsi/gomega v1.10.1 h1:o0+MgICZLuZ7xjH7Vx6zS/zcu93/BEp1VwkIW1mEXCE=
+github.com/onsi/gomega v1.10.1/go.mod h1:iN09h71vgCQne3DLsj+A5owkum+a2tYe+TOCB1ybHNo=
 github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM=
 github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4=
-github.com/stretchr/objx v0.1.0/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME=
-github.com/stretchr/objx v0.4.0/go.mod h1:YvHI0jy2hoMjB+UWwv71VJQ9isScKT/TqJzVSSt89Yw=
-github.com/stretchr/objx v0.5.0/go.mod h1:Yh+to48EsGEfYuaHDzXPcE3xhTkx73EhmCGUpEOglKo=
-github.com/stretchr/testify v1.7.1/go.mod h1:6Fq8oRcR53rry900zMqJjRRixrwX3KX962/h/Wwjteg=
-github.com/stretchr/testify v1.8.0/go.mod h1:yNjHg4UonilssWZ8iaSj1OCr/vHnekPRkoO+kdMU+MU=
-github.com/stretchr/testify v1.8.1 h1:w7B6lhMri9wdJUVmEZPGGhZzrYTPvgJArz7wNPgYKsk=
-github.com/stretchr/testify v1.8.1/go.mod h1:w2LPCIKwWwSfY2zedu0+kehJoqGctiVI29o6fzry7u4=
+github.com/prometheus/client_golang v1.13.0 h1:b71QUfeo5M8gq2+evJdTPfZhYMAU0uKPkyPJ7TPsloU=
+github.com/prometheus/client_golang v1.13.0/go.mod h1:vTeo+zgvILHsnnj/39Ou/1fPN5nJFOEMgftOUOmlvYQ=
+github.com/prometheus/client_model v0.2.0 h1:uq5h0d+GuxiXLJLNABMgp2qUWDPiLvgCzz2dUR+/W/M=
+github.com/prometheus/client_model v0.2.0/go.mod h1:xMI15A0UPsDsEKsMN9yxemIoYk6Tm2C1GtYGdfGttqA=
+github.com/prometheus/common v0.37.0 h1:ccBbHCgIiT9uSoFY0vX8H3zsNR5eLt17/RQLUvn8pXE=
+github.com/prometheus/common v0.37.0/go.mod h1:phzohg0JFMnBEFGxTDbfu3QyL5GI8gTQJFhYO5B3mfA=
+github.com/prometheus/procfs v0.8.0 h1:ODq8ZFEaYeCaZOJlZZdJA2AbQR98dSHSM1KW/You5mo=
+github.com/prometheus/procfs v0.8.0/go.mod h1:z7EfXMXOkbkqb9IINtpCn86r/to3BnA0uaxHdg830/4=
+github.com/russross/blackfriday/v2 v2.0.1 h1:lPqVAte+HuHNfhJ/0LC98ESWRz8afy9tM/0RK8m9o+Q=
+github.com/russross/blackfriday/v2 v2.0.1/go.mod h1:+Rmxgy9KzJVeS9/2gXHxylqXiyQDYRxCVz55jmeOWTM=
+github.com/shurcooL/sanitized_anchor_name v1.0.0 h1:PdmoCO6wvbs+7yrJyMORt4/BmY5IYyJwS/kOiWx8mHo=
+github.com/shurcooL/sanitized_anchor_name v1.0.0/go.mod h1:1NzhyTcUVG4SuEtjjoZeVRXNmyL/1OwPU0+IJeTBvfc=
+github.com/stretchr/testify v1.8.4 h1:CcVxjf3Q8PM0mHUKJCdn+eZZtm5yQwehR5yeSVQQcUk=
+github.com/stretchr/testify v1.8.4/go.mod h1:sz/lmYIOXD/1dqDmKjjqLyZ2RngseejIcXlSw2iwfAo=
+github.com/syndtr/goleveldb v1.0.1-0.20210305035536-64b5b1c73954 h1:xQdMZ1WLrgkkvOZ/LDQxjVxMLdby7osSh4ZEVa5sIjs=
+github.com/syndtr/goleveldb v1.0.1-0.20210305035536-64b5b1c73954/go.mod h1:u2MKkTVTVJWe5D1rCvame8WqhBd88EuIwODJZ1VHCPM=
+github.com/twmb/murmur3 v1.1.5 h1:i9OLS9fkuLzBXjt6dptlAEyk58fJsSTXbRg3SgVyqgk=
+github.com/twmb/murmur3 v1.1.5/go.mod h1:Qq/R7NUyOfr65zD+6Q5IHKsJLwP7exErjN6lyyq3OSQ=
+github.com/urfave/cli v1.22.5 h1:lNq9sAHXK2qfdI8W+GRItjCEkI+2oR4d+MEHy1CKXoU=
+github.com/urfave/cli v1.22.5/go.mod h1:Gos4lmkARVdJ6EkW0WaNv/tZAAMe9V7XWyB60NtXRu0=
+github.com/virtuald/go-ordered-json v0.0.0-20170621173500-b18e6e673d74 h1:JwtAtbp7r/7QSyGz8mKUbYJBg2+6Cd7OjM8o/GNOcVo=
+github.com/virtuald/go-ordered-json v0.0.0-20170621173500-b18e6e673d74/go.mod h1:RmMWU37GKR2s6pgrIEB4ixgpVCt/cf7dnJv3fuH1J1c=
+go.etcd.io/bbolt v1.3.8 h1:xs88BrvEv273UsB79e0hcVrlUWmS0a8upikMFhSyAtA=
+go.etcd.io/bbolt v1.3.8/go.mod h1:N9Mkw9X8x5fupy0IKsmuqVtoGDyxsaDlbk4Rd05IAQw=
+go.uber.org/goleak v1.2.0 h1:xqgm/S+aQvhWFTtR0XK3Jvg7z8kGV8P4X14IzwN3Eqk=
+go.uber.org/goleak v1.2.0/go.mod h1:XJYK+MuIchqpmGmUSAzotztawfKvYLUIgg7guXrwVUo=
+go.uber.org/multierr v1.10.0 h1:S0h4aNzvfcFsC3dRF1jLoaov7oRaKqRGC/pUEJ2yvPQ=
+go.uber.org/multierr v1.10.0/go.mod h1:20+QtiLqy0Nd6FdQB9TLXag12DsQkrbs3htMFfDN80Y=
+go.uber.org/zap v1.26.0 h1:sI7k6L95XOKS281NhVKOFCUNIvv9e0w4BF8N3u+tCRo=
+go.uber.org/zap v1.26.0/go.mod h1:dtElttAiwGvoJ/vj4IwHBS/gXsEu/pZ50mUIRWuG0so=
+golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACkg1iLfiJU5Ep61QUkGW8qpdssI0+w=
+golang.org/x/crypto v0.0.0-20200622213623-75b288015ac9/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto=
+golang.org/x/crypto v0.17.0 h1:r8bRNjWL3GshPW3gkd+RpvzWrZAwPS49OmTGZ/uhM4k=
+golang.org/x/crypto v0.17.0/go.mod h1:gCAAfMLgwOJRpTjQ2zCCt2OcSfYMTeZVSRtQlPC7Nq4=
+golang.org/x/exp v0.0.0-20230817173708-d852ddb80c63 h1:m64FZMko/V45gv0bNmrNYoDEq8U5YUhetc9cBWKS1TQ=
+golang.org/x/exp v0.0.0-20230817173708-d852ddb80c63/go.mod h1:0v4NqG35kSWCMzLaMeX+IQrlSnVE/bqGSyC2cz/9Le8=
+golang.org/x/mod v0.12.0 h1:rmsUpXtvNzj340zd98LZ4KntptpfRHwpFOHG188oHXc=
+golang.org/x/mod v0.12.0/go.mod h1:iBbtSCu2XBx23ZKBPSOrRkjjQPZFPuis4dIYUhu/chs=
+golang.org/x/net v0.0.0-20180906233101-161cd47e91fd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
+golang.org/x/net v0.0.0-20190404232315-eb5bcb51f2a3/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg=
+golang.org/x/net v0.0.0-20200520004742-59133d7f0dd7/go.mod h1:qpuaurCH72eLCgpAm/N6yyVIVM9cpaDIP3A8BGJEC5A=
+golang.org/x/net v0.0.0-20200813134508-3edf25e44fcc/go.mod h1:/O7V0waA8r7cgGh81Ro3o1hOxt32SMVPicZroKQ2sZA=
+golang.org/x/net v0.17.0 h1:pVaXccu2ozPjCXewfr1S7xza/zcXTity9cCdXQYSjIM=
+golang.org/x/net v0.17.0/go.mod h1:NxSsAGuq816PNPmqtQdLE42eU2Fs7NoRIZrHJAlaCOE=
+golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
+golang.org/x/sync v0.0.0-20210220032951-036812b2e83c/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
+golang.org/x/sync v0.3.0 h1:ftCYgMx6zT/asHUrPw8BLLscYtGznsLAnjq5RH9P66E=
+golang.org/x/sync v0.3.0/go.mod h1:FU7BRWz2tNW+3quACPkgCx/L+uEAv1htQ0V83Z9Rj+Y=
+golang.org/x/sys v0.0.0-20180909124046-d0be0721c37e/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
+golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
+golang.org/x/sys v0.0.0-20190412213103-97732733099d/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20190904154756-749cb33beabd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20191005200804-aed5e4c7ecf9/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20191120155948-bd437916bb0e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20200323222414-85ca7c5b95cd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20200519105757-fe76b779f299/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20200814200057-3d37ad5750ed/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.15.0 h1:h48lPFYpsTvQJZF4EKyI4aLHaev3CxivZmv7yZig9pc=
+golang.org/x/sys v0.15.0/go.mod h1:/VUhepiaJMQUp4+oa/7Zr1D23ma6VTLIYjOOTFZPUcA=
+golang.org/x/term v0.15.0 h1:y/Oo/a/q3IXu26lQgl04j/gjuBDOBlx7X6Om1j2CPW4=
+golang.org/x/term v0.15.0/go.mod h1:BDl952bC7+uMoWR75FIrCDx79TPU9oHkTZ9yRbYOrX0=
+golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ=
+golang.org/x/text v0.3.2/go.mod h1:bEr9sfX3Q8Zfm5fL9x+3itogRgK3+ptLWKqgva+5dAk=
+golang.org/x/text v0.3.3/go.mod h1:5Zoc/QRtKVWzQhOtBMvqHzDpF6irO9z98xDceosuGiQ=
+golang.org/x/text v0.14.0 h1:ScX5w1eTa3QqT8oi6+ziP7dTV1S2+ALU0bI+0zXKWiQ=
+golang.org/x/text v0.14.0/go.mod h1:18ZOQIKpY8NJVqYksKHtTdi31H5itFRjB5/qKTNYzSU=
+golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ=
+golang.org/x/tools v0.12.1-0.20230815132531-74c255bcf846 h1:Vve/L0v7CXXuxUmaMGIEK/dEeq7uiqb5qBgQrZzIE7E=
+golang.org/x/tools v0.12.1-0.20230815132531-74c255bcf846/go.mod h1:Sc0INKfu04TlqNoRA1hgpFZbhYXHPr4V5DzpSBTPqQM=
+golang.org/x/xerrors v0.0.0-20191204190536-9bdfabe68543/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0=
+golang.org/x/xerrors v0.0.0-20200804184101-5ec99f83aff1 h1:go1bK/D/BFZV2I8cIQd1NKEZ+0owSTG1fDTci4IqFcE=
+golang.org/x/xerrors v0.0.0-20200804184101-5ec99f83aff1/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0=
+google.golang.org/protobuf v0.0.0-20200109180630-ec00e32a8dfd/go.mod h1:DFci5gLYBciE7Vtevhsrf46CRTquxDuWsQurQQe4oz8=
+google.golang.org/protobuf v0.0.0-20200221191635-4d8936d0db64/go.mod h1:kwYJMbMJ01Woi6D6+Kah6886xMZcty6N08ah7+eCXa0=
+google.golang.org/protobuf v0.0.0-20200228230310-ab0ca4ff8a60/go.mod h1:cfTl7dwQJ+fmap5saPgwCLgHXTUD7jkjRqWcaiX5VyM=
+google.golang.org/protobuf v1.20.1-0.20200309200217-e05f789c0967/go.mod h1:A+miEFZTKqfCUM6K7xSMQL9OKL/b6hQv+e19PK+JZNE=
+google.golang.org/protobuf v1.21.0/go.mod h1:47Nbq4nVaFHyn7ilMalzfO3qCViNmqZ2kzikPIcrTAo=
+google.golang.org/protobuf v1.23.0/go.mod h1:EGpADcykh3NcUnDUJcl1+ZksZNG86OlYog2l/sGQquU=
+google.golang.org/protobuf v1.31.0 h1:g0LDEJHgrBl9N9r17Ru3sqWhkIx2NB67okBHPwC7hs8=
+google.golang.org/protobuf v1.31.0/go.mod h1:HV8QOd/L58Z+nl8r43ehVNZIU/HEI6OcFqwMG9pJV4I=
 gopkg.in/check.v1 v0.0.0-20161208181325-20d25e280405 h1:yhCVgyC4o1eVCa2tZl7eS0r+SDo693bJlVdllGtEeKM=
 gopkg.in/check.v1 v0.0.0-20161208181325-20d25e280405/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0=
-gopkg.in/yaml.v3 v3.0.0-20200313102051-9f266ea9e77c/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM=
+gopkg.in/fsnotify.v1 v1.4.7/go.mod h1:Tz8NjZHkW78fSQdbUxIjBTcgA1z1m8ZHf0WmKUhAMys=
+gopkg.in/tomb.v1 v1.0.0-20141024135613-dd632973f1e7 h1:uRGJdciOHaEIrze2W8Q3AKkepLTh2hOroT7a+7czfdQ=
+gopkg.in/tomb.v1 v1.0.0-20141024135613-dd632973f1e7/go.mod h1:dt/ZhP58zS4L8KSrWDmTeBkI65Dw0HsyUHuEVlX15mw=
+gopkg.in/yaml.v2 v2.2.4/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
+gopkg.in/yaml.v2 v2.3.0 h1:clyUAQHOM3G0M3f5vQj7LuJrETvjVot3Z5el9nffUtU=
+gopkg.in/yaml.v2 v2.3.0/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
 gopkg.in/yaml.v3 v3.0.1 h1:fxVm/GzAzEWqLHuvctI91KS9hhNmmWOoWu0XTYJS7CA=
 gopkg.in/yaml.v3 v3.0.1/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM=
+rsc.io/tmplfunc v0.0.3 h1:53XFQh69AfOa8Tw0Jm7t+GV7KZhOi6jzsCzTtKbMvzU=
+rsc.io/tmplfunc v0.0.3/go.mod h1:AG3sTPzElb1Io3Yg4voV9AGZJuleGAwaVRxL9M49PhA=

iam/converter.go

@@ -3,17 +3,76 @@ package iam
 import (
 	"errors"
 	"fmt"
+	"net/netip"
 	"strconv"
 	"strings"
 	"time"
+	"unicode/utf8"
 
-	policyengine "git.frostfs.info/TrueCloudLab/policy-engine"
+	"git.frostfs.info/TrueCloudLab/policy-engine/pkg/chain"
+	"git.frostfs.info/TrueCloudLab/policy-engine/schema/common"
+	"github.com/nspcc-dev/neo-go/pkg/encoding/fixedn"
 )
 
 const (
-	FrostFSPrincipal = "FrostFS"
+	s3ActionAbortMultipartUpload             = "s3:AbortMultipartUpload"
+	s3ActionCreateBucket                     = "s3:CreateBucket"
+	s3ActionDeleteBucket                     = "s3:DeleteBucket"
+	s3ActionDeleteBucketPolicy               = "s3:DeleteBucketPolicy"
+	s3ActionDeleteObject                     = "s3:DeleteObject"
+	s3ActionDeleteObjectTagging              = "s3:DeleteObjectTagging"
+	s3ActionDeleteObjectVersion              = "s3:DeleteObjectVersion"
+	s3ActionDeleteObjectVersionTagging       = "s3:DeleteObjectVersionTagging"
+	s3ActionGetBucketACL                     = "s3:GetBucketAcl"
+	s3ActionGetBucketCORS                    = "s3:GetBucketCORS"
+	s3ActionGetBucketLocation                = "s3:GetBucketLocation"
+	s3ActionGetBucketNotification            = "s3:GetBucketNotification"
+	s3ActionGetBucketObjectLockConfiguration = "s3:GetBucketObjectLockConfiguration"
+	s3ActionGetBucketPolicy                  = "s3:GetBucketPolicy"
+	s3ActionGetBucketPolicyStatus            = "s3:GetBucketPolicyStatus"
+	s3ActionGetBucketTagging                 = "s3:GetBucketTagging"
+	s3ActionGetBucketVersioning              = "s3:GetBucketVersioning"
+	s3ActionGetLifecycleConfiguration        = "s3:GetLifecycleConfiguration"
+	s3ActionGetObject                        = "s3:GetObject"
+	s3ActionGetObjectACL                     = "s3:GetObjectAcl"
+	s3ActionGetObjectAttributes              = "s3:GetObjectAttributes"
+	s3ActionGetObjectLegalHold               = "s3:GetObjectLegalHold"
+	s3ActionGetObjectRetention               = "s3:GetObjectRetention"
+	s3ActionGetObjectTagging                 = "s3:GetObjectTagging"
+	s3ActionGetObjectVersion                 = "s3:GetObjectVersion"
+	s3ActionGetObjectVersionACL              = "s3:GetObjectVersionAcl"
+	s3ActionGetObjectVersionAttributes       = "s3:GetObjectVersionAttributes"
+	s3ActionGetObjectVersionTagging          = "s3:GetObjectVersionTagging"
+	s3ActionListAllMyBuckets                 = "s3:ListAllMyBuckets"
+	s3ActionListBucket                       = "s3:ListBucket"
+	s3ActionListBucketMultipartUploads       = "s3:ListBucketMultipartUploads"
+	s3ActionListBucketVersions               = "s3:ListBucketVersions"
+	s3ActionListMultipartUploadParts         = "s3:ListMultipartUploadParts"
+	s3ActionPutBucketACL                     = "s3:PutBucketAcl"
+	s3ActionPutBucketCORS                    = "s3:PutBucketCORS"
+	s3ActionPutBucketNotification            = "s3:PutBucketNotification"
+	s3ActionPutBucketObjectLockConfiguration = "s3:PutBucketObjectLockConfiguration"
+	s3ActionPutBucketPolicy                  = "s3:PutBucketPolicy"
+	s3ActionPutBucketTagging                 = "s3:PutBucketTagging"
+	s3ActionPutBucketVersioning              = "s3:PutBucketVersioning"
+	s3ActionPutLifecycleConfiguration        = "s3:PutLifecycleConfiguration"
+	s3ActionPutObject                        = "s3:PutObject"
+	s3ActionPutObjectACL                     = "s3:PutObjectAcl"
+	s3ActionPutObjectLegalHold               = "s3:PutObjectLegalHold"
+	s3ActionPutObjectRetention               = "s3:PutObjectRetention"
+	s3ActionPutObjectTagging                 = "s3:PutObjectTagging"
+	s3ActionPutObjectVersionACL              = "s3:PutObjectVersionAcl"
+	s3ActionPutObjectVersionTagging          = "s3:PutObjectVersionTagging"
+	s3ActionPatchObject                      = "s3:PatchObject"
+)
 
-	RequestOwnerProperty = "Owner"
+const (
+	condKeyAWSPrincipalARN       = "aws:PrincipalArn"
+	condKeyAWSSourceIP           = "aws:SourceIp"
+	condKeyAWSPrincipalTagPrefix = "aws:PrincipalTag/"
+	condKeyAWSRequestTagPrefix   = "aws:RequestTag/"
+	condKeyAWSResourceTagPrefix  = "aws:ResourceTag/"
+	userClaimTagPrefix           = "tag-"
 )
 
 const (
@@ -53,166 +112,213 @@ const (
 	CondArnLike      string = "ArnLike"
 	CondArnNotEquals string = "ArnNotEquals"
 	CondArnNotLike   string = "ArnNotLike"
+
+	// Custom condition operators.
+	CondSliceContains string = "SliceContains"
 )
 
-func (p Policy) ToChain() (*policyengine.Chain, error) {
-	var chain policyengine.Chain
+const (
+	arnIAMPrefix     = "arn:aws:iam::"
+	s3ResourcePrefix = "arn:aws:s3:::"
+	s3ActionPrefix   = "s3:"
+	iamActionPrefix  = "iam:"
+)
 
-	for _, statement := range p.Statement {
-		status := policyengine.AccessDenied
-		if statement.Effect == AllowEffect {
-			status = policyengine.Allow
-		}
+var (
+	// ErrInvalidPrincipalFormat occurs when principal has unknown/unsupported format.
+	ErrInvalidPrincipalFormat = errors.New("invalid principal format")
 
-		if len(statement.Principal) != 1 {
-			return nil, errors.New("currently supported exactly one principal type")
-		}
+	// ErrInvalidResourceFormat occurs when resource has unknown/unsupported format.
+	ErrInvalidResourceFormat = errors.New("invalid resource format")
 
-		var principals []string
-		var op policyengine.ConditionType
-		if _, ok := statement.Principal[Wildcard]; ok {
-			principals = []string{Wildcard}
-			op = policyengine.CondStringLike
-		} else if frostfsPrincipals, ok := statement.Principal[FrostFSPrincipal]; ok {
-			principals = frostfsPrincipals
-			op = policyengine.CondStringEquals
-		} else {
-			return nil, errors.New("currently supported only FrostFS or all (wildcard) principals")
-		}
+	// ErrInvalidActionFormat occurs when action has unknown/unsupported format.
+	ErrInvalidActionFormat = errors.New("invalid action format")
 
-		var conditions []policyengine.Condition
-		for _, principal := range principals {
-			conditions = append(conditions, policyengine.Condition{
-				Op:     op,
-				Object: policyengine.ObjectRequest,
-				Key:    RequestOwnerProperty,
-				Value:  principal,
-			})
-		}
+	// ErrActionsNotApplicable occurs when failed to convert any actions.
+	ErrActionsNotApplicable = errors.New("actions not applicable")
+)
 
-		conds, err := statement.Conditions.ToChainCondition()
-		if err != nil {
-			return nil, err
-		}
-		conditions = append(conditions, conds...)
+type formPrincipalConditionFunc func(string) chain.Condition
 
-		r := policyengine.Rule{
-			Status:    status,
-			Action:    statement.Action,
-			Resource:  statement.Resource,
-			Any:       true,
-			Condition: conditions,
-		}
-		chain.Rules = append(chain.Rules, r)
-	}
+type transformConditionFunc func(gr GroupedConditions) (GroupedConditions, error)
 
-	return &chain, nil
-}
-
-func (c Conditions) ToChainCondition() ([]policyengine.Condition, error) {
-	var conditions []policyengine.Condition
-
-	var convertValue convertFunction
-
-	for op, KVs := range c {
-		var condType policyengine.ConditionType
-
-		switch {
-		case strings.HasPrefix(op, "String"):
-			convertValue = noConvertFunction
-			switch op {
-			case CondStringEquals:
-				condType = policyengine.CondStringEquals
-			case CondStringNotEquals:
-				condType = policyengine.CondStringNotEquals
-			case CondStringEqualsIgnoreCase:
-				condType = policyengine.CondStringEqualsIgnoreCase
-			case CondStringNotEqualsIgnoreCase:
-				condType = policyengine.CondStringNotEqualsIgnoreCase
-			case CondStringLike:
-				condType = policyengine.CondStringLike
-			case CondStringNotLike:
-				condType = policyengine.CondStringNotLike
-			default:
-				return nil, fmt.Errorf("unsupported condition operator: '%s'", op)
-			}
-		case strings.HasPrefix(op, "Arn"):
-			convertValue = noConvertFunction
-			switch op {
-			case CondArnEquals:
-				condType = policyengine.CondStringEquals
-			case CondArnNotEquals:
-				condType = policyengine.CondStringNotEquals
-			case CondArnLike:
-				condType = policyengine.CondStringLike
-			case CondArnNotLike:
-				condType = policyengine.CondStringNotLike
-			default:
-				return nil, fmt.Errorf("unsupported condition operator: '%s'", op)
-			}
-		case strings.HasPrefix(op, "Numeric"):
-			// TODO
-		case strings.HasPrefix(op, "Date"):
-			convertValue = dateConvertFunction
-			switch op {
-			case CondDateEquals:
-				condType = policyengine.CondStringEquals
-			case CondDateNotEquals:
-				condType = policyengine.CondStringNotEquals
-			case CondDateLessThan:
-				condType = policyengine.CondStringLessThan
-			case CondDateLessThanEquals:
-				condType = policyengine.CondStringLessThanEquals
-			case CondDateGreaterThan:
-				condType = policyengine.CondStringGreaterThan
-			case CondDateGreaterThanEquals:
-				condType = policyengine.CondStringGreaterThanEquals
-			default:
-				return nil, fmt.Errorf("unsupported condition operator: '%s'", op)
-			}
-		case op == CondBool:
-			convertValue = noConvertFunction
-			condType = policyengine.CondStringEqualsIgnoreCase
-		case op == CondIPAddress:
-			// todo consider using converters
-			//  "203.0.113.0/24" -> "203.0.113.*",
-			//  "2001:DB8:1234:5678::/64" -> "2001:DB8:1234:5678:*"
-			//  or having specific condition type for IP
-			convertValue = noConvertFunction
-			condType = policyengine.CondStringLike
-		case op == CondNotIPAddress:
-			convertValue = noConvertFunction
-			condType = policyengine.CondStringNotLike
-		default:
-			return nil, fmt.Errorf("unsupported condition operator: '%s'", op)
-		}
-
-		for key, values := range KVs {
-			for _, val := range values {
-				converted, err := convertValue(val)
+func convertToChainConditions(c Conditions, transformer transformConditionFunc) ([]GroupedConditions, error) {
+	conditions, err := convertToChainCondition(c)
 	if err != nil {
 		return nil, err
 	}
 
-				conditions = append(conditions, policyengine.Condition{
-					Op:     condType,
-					Object: policyengine.ObjectRequest,
-					Key:    key,
-					Value:  converted,
-				})
-			}
+	for i := range conditions {
+		if conditions[i], err = transformer(conditions[i]); err != nil {
+			return nil, fmt.Errorf("transform condition: %w", err)
 		}
 	}
 
 	return conditions, nil
 }
 
+type GroupedConditions struct {
+	Conditions []chain.Condition
+	Any        bool
+}
+
+func convertToChainCondition(c Conditions) ([]GroupedConditions, error) {
+	var grouped []GroupedConditions
+
+	for op, KVs := range c {
+		condType, convertValue, err := getConditionTypeAndConverter(op)
+		if err != nil {
+			return nil, err
+		}
+
+		for key, values := range KVs {
+			group := GroupedConditions{
+				Conditions: make([]chain.Condition, len(values)),
+				Any:        len(values) > 1,
+			}
+
+			for i, val := range values {
+				converted, err := convertValue(val)
+				if err != nil {
+					return nil, err
+				}
+
+				group.Conditions[i] = chain.Condition{
+					Op:    condType,
+					Kind:  chain.KindRequest,
+					Key:   transformKey(key),
+					Value: converted,
+				}
+			}
+			grouped = append(grouped, group)
+		}
+	}
+
+	return grouped, nil
+}
+
+func transformKey(key string) string {
+	tagName, isTag := strings.CutPrefix(key, condKeyAWSPrincipalTagPrefix)
+	if isTag {
+		return fmt.Sprintf(common.PropertyKeyFormatFrostFSIDUserClaim, userClaimTagPrefix+tagName)
+	}
+
+	switch key {
+	case condKeyAWSSourceIP:
+		return common.PropertyKeyFrostFSSourceIP
+	}
+
+	return key
+}
+
+func getConditionTypeAndConverter(op string) (chain.ConditionType, convertFunction, error) {
+	switch {
+	case strings.HasPrefix(op, "String"):
+		switch op {
+		case CondStringEquals:
+			return chain.CondStringEquals, noConvertFunction, nil
+		case CondStringNotEquals:
+			return chain.CondStringNotEquals, noConvertFunction, nil
+		case CondStringEqualsIgnoreCase:
+			return chain.CondStringEqualsIgnoreCase, noConvertFunction, nil
+		case CondStringNotEqualsIgnoreCase:
+			return chain.CondStringNotEqualsIgnoreCase, noConvertFunction, nil
+		case CondStringLike:
+			return chain.CondStringLike, noConvertFunction, nil
+		case CondStringNotLike:
+			return chain.CondStringNotLike, noConvertFunction, nil
+		default:
+			return 0, nil, fmt.Errorf("unsupported condition operator: '%s'", op)
+		}
+	case strings.HasPrefix(op, "Arn"):
+		switch op {
+		case CondArnEquals:
+			return chain.CondStringEquals, noConvertFunction, nil
+		case CondArnNotEquals:
+			return chain.CondStringNotEquals, noConvertFunction, nil
+		case CondArnLike:
+			return chain.CondStringLike, noConvertFunction, nil
+		case CondArnNotLike:
+			return chain.CondStringNotLike, noConvertFunction, nil
+		default:
+			return 0, nil, fmt.Errorf("unsupported condition operator: '%s'", op)
+		}
+	case strings.HasPrefix(op, "Numeric"):
+		return numericConditionTypeAndConverter(op)
+	case strings.HasPrefix(op, "Date"):
+		switch op {
+		case CondDateEquals:
+			return chain.CondStringEquals, dateConvertFunction, nil
+		case CondDateNotEquals:
+			return chain.CondStringNotEquals, dateConvertFunction, nil
+		case CondDateLessThan:
+			return chain.CondStringLessThan, dateConvertFunction, nil
+		case CondDateLessThanEquals:
+			return chain.CondStringLessThanEquals, dateConvertFunction, nil
+		case CondDateGreaterThan:
+			return chain.CondStringGreaterThan, dateConvertFunction, nil
+		case CondDateGreaterThanEquals:
+			return chain.CondStringGreaterThanEquals, dateConvertFunction, nil
+		default:
+			return 0, nil, fmt.Errorf("unsupported condition operator: '%s'", op)
+		}
+	case op == CondBool:
+		return chain.CondStringEqualsIgnoreCase, noConvertFunction, nil
+	case op == CondIPAddress:
+		return chain.CondIPAddress, ipConvertFunction, nil
+	case op == CondNotIPAddress:
+		return chain.CondNotIPAddress, ipConvertFunction, nil
+	case op == CondSliceContains:
+		return chain.CondSliceContains, noConvertFunction, nil
+	default:
+		return 0, nil, fmt.Errorf("unsupported condition operator: '%s'", op)
+	}
+}
+
+func numericConditionTypeAndConverter(op string) (chain.ConditionType, convertFunction, error) {
+	switch op {
+	case CondNumericEquals:
+		return chain.CondNumericEquals, numericConvertFunction, nil
+	case CondNumericNotEquals:
+		return chain.CondNumericNotEquals, numericConvertFunction, nil
+	case CondNumericLessThan:
+		return chain.CondNumericLessThan, numericConvertFunction, nil
+	case CondNumericLessThanEquals:
+		return chain.CondNumericLessThanEquals, numericConvertFunction, nil
+	case CondNumericGreaterThan:
+		return chain.CondNumericGreaterThan, numericConvertFunction, nil
+	case CondNumericGreaterThanEquals:
+		return chain.CondNumericGreaterThanEquals, numericConvertFunction, nil
+	default:
+		return 0, nil, fmt.Errorf("unsupported condition operator: '%s'", op)
+	}
+}
+
 type convertFunction func(string) (string, error)
 
 func noConvertFunction(val string) (string, error) {
 	return val, nil
 }
 
+func numericConvertFunction(val string) (string, error) {
+	if _, err := fixedn.Fixed8FromString(val); err == nil {
+		return val, nil
+	}
+
+	return "", fmt.Errorf("invalid numeric value: '%s'", val)
+}
+
+func ipConvertFunction(val string) (string, error) {
+	if _, err := netip.ParsePrefix(val); err != nil {
+		if _, err = netip.ParseAddr(val); err != nil {
+			return "", err
+		}
+		val += "/32"
+	}
+
+	return val, nil
+}
+
 func dateConvertFunction(val string) (string, error) {
 	if _, err := strconv.ParseInt(val, 10, 64); err == nil {
 		return val, nil
@@ -225,3 +331,95 @@ func dateConvertFunction(val string) (string, error) {
 
 	return strconv.FormatInt(parsed.UTC().Unix(), 10), nil
 }
+
+func parsePrincipalAsIAMUser(principal string) (account string, user string, err error) {
+	if !strings.HasPrefix(principal, arnIAMPrefix) {
+		return "", "", ErrInvalidPrincipalFormat
+	}
+
+	// iam arn format arn:aws:iam::<account>:user/<user-name-with-path>
+	iamResource := strings.TrimPrefix(principal, arnIAMPrefix)
+	sepIndex := strings.Index(iamResource, ":user/")
+	if sepIndex < 0 {
+		return "", "", ErrInvalidPrincipalFormat
+	}
+
+	account = iamResource[:sepIndex]
+	user = iamResource[sepIndex+6:]
+	if len(user) == 0 {
+		return "", "", ErrInvalidPrincipalFormat
+	}
+
+	userNameIndex := strings.LastIndexByte(user, '/')
+	if userNameIndex > -1 {
+		user = user[userNameIndex+1:]
+		if len(user) == 0 {
+			return "", "", ErrInvalidPrincipalFormat
+		}
+	}
+
+	return account, user, nil
+}
+
+func validateResource(resource string) error {
+	if resource == Wildcard {
+		return nil
+	}
+
+	if !strings.HasPrefix(resource, s3ResourcePrefix) && !strings.HasPrefix(resource, arnIAMPrefix) {
+		return ErrInvalidResourceFormat
+	}
+
+	index := strings.IndexByte(resource, Wildcard[0])
+	if index != -1 && index != utf8.RuneCountInString(resource)-1 {
+		return ErrInvalidResourceFormat
+	}
+
+	return nil
+}
+
+func validateAction(action string) (bool, error) {
+	isIAM := strings.HasPrefix(action, iamActionPrefix)
+	if !strings.HasPrefix(action, s3ActionPrefix) && !isIAM {
+		return false, ErrInvalidActionFormat
+	}
+
+	index := strings.IndexByte(action, Wildcard[0])
+	if index != -1 && index != utf8.RuneCountInString(action)-1 {
+		return false, ErrInvalidActionFormat
+	}
+
+	return isIAM, nil
+}
+
+func splitGroupedConditions(groupedConditions []GroupedConditions) [][]chain.Condition {
+	var orConditions []chain.Condition
+	commonConditions := make([]chain.Condition, 0, len(groupedConditions))
+	for _, grouped := range groupedConditions {
+		if grouped.Any {
+			orConditions = append(orConditions, grouped.Conditions...)
+		} else {
+			commonConditions = append(commonConditions, grouped.Conditions...)
+		}
+	}
+
+	if len(orConditions) == 0 {
+		return [][]chain.Condition{commonConditions}
+	}
+
+	res := make([][]chain.Condition, len(orConditions))
+	for i, condition := range orConditions {
+		res[i] = append([]chain.Condition{condition}, commonConditions...)
+	}
+
+	return res
+}
+
+func formStatus(statement Statement) chain.Status {
+	status := chain.AccessDenied
+	if statement.Effect == AllowEffect {
+		status = chain.Allow
+	}
+
+	return status
+}

iam/converter_native.go

@@ -0,0 +1,427 @@
+package iam
+
+import (
+	"errors"
+	"fmt"
+	"strings"
+
+	"git.frostfs.info/TrueCloudLab/policy-engine/pkg/chain"
+	"git.frostfs.info/TrueCloudLab/policy-engine/schema/native"
+)
+
+const PropertyKeyFilePath = "FilePath"
+
+var actionToNativeOpMap = map[string][]string{
+	s3ActionAbortMultipartUpload:             {native.MethodGetContainer, native.MethodDeleteObject, native.MethodHeadObject, native.MethodGetObject, native.MethodPutObject},
+	s3ActionCreateBucket:                     {native.MethodGetContainer, native.MethodPutContainer, native.MethodSetContainerEACL, native.MethodGetObject, native.MethodPutObject},
+	s3ActionDeleteBucket:                     {native.MethodGetContainer, native.MethodDeleteContainer, native.MethodSearchObject, native.MethodHeadObject, native.MethodGetObject},
+	s3ActionDeleteBucketPolicy:               {native.MethodGetContainer},
+	s3ActionDeleteObject:                     {native.MethodGetContainer, native.MethodDeleteObject, native.MethodPutObject, native.MethodHeadObject, native.MethodGetObject, native.MethodRangeObject},
+	s3ActionDeleteObjectTagging:              {native.MethodGetContainer, native.MethodHeadObject, native.MethodGetObject, native.MethodPutObject},
+	s3ActionDeleteObjectVersion:              {native.MethodGetContainer, native.MethodDeleteObject, native.MethodPutObject, native.MethodHeadObject, native.MethodGetObject, native.MethodRangeObject},
+	s3ActionDeleteObjectVersionTagging:       {native.MethodGetContainer, native.MethodHeadObject, native.MethodGetObject, native.MethodPutObject},
+	s3ActionGetBucketACL:                     {native.MethodGetContainer, native.MethodGetContainerEACL, native.MethodGetObject},
+	s3ActionGetBucketCORS:                    {native.MethodGetContainer, native.MethodGetObject, native.MethodHeadObject},
+	s3ActionGetBucketLocation:                {native.MethodGetContainer},
+	s3ActionGetBucketNotification:            {native.MethodGetContainer, native.MethodGetObject, native.MethodHeadObject},
+	s3ActionGetBucketObjectLockConfiguration: {native.MethodGetContainer, native.MethodGetObject},
+	s3ActionGetBucketPolicy:                  {native.MethodGetContainer},
+	s3ActionGetBucketPolicyStatus:            {native.MethodGetContainer},
+	s3ActionGetBucketTagging:                 {native.MethodGetContainer, native.MethodGetObject},
+	s3ActionGetBucketVersioning:              {native.MethodGetContainer, native.MethodGetObject},
+	s3ActionGetLifecycleConfiguration:        {native.MethodGetContainer, native.MethodGetObject, native.MethodHeadObject},
+	s3ActionGetObject:                        {native.MethodGetContainer, native.MethodGetObject, native.MethodHeadObject, native.MethodSearchObject, native.MethodRangeObject, native.MethodHashObject},
+	s3ActionGetObjectACL:                     {native.MethodGetContainer, native.MethodGetContainerEACL, native.MethodGetObject, native.MethodHeadObject},
+	s3ActionGetObjectAttributes:              {native.MethodGetContainer, native.MethodGetObject, native.MethodHeadObject},
+	s3ActionGetObjectLegalHold:               {native.MethodGetContainer, native.MethodHeadObject, native.MethodGetObject},
+	s3ActionGetObjectRetention:               {native.MethodGetContainer, native.MethodHeadObject, native.MethodGetObject},
+	s3ActionGetObjectTagging:                 {native.MethodGetContainer, native.MethodHeadObject, native.MethodGetObject},
+	s3ActionGetObjectVersion:                 {native.MethodGetContainer, native.MethodGetObject, native.MethodHeadObject, native.MethodSearchObject, native.MethodRangeObject, native.MethodHashObject},
+	s3ActionGetObjectVersionACL:              {native.MethodGetContainer, native.MethodGetContainerEACL, native.MethodGetObject, native.MethodHeadObject},
+	s3ActionGetObjectVersionAttributes:       {native.MethodGetContainer, native.MethodGetObject, native.MethodHeadObject},
+	s3ActionGetObjectVersionTagging:          {native.MethodGetContainer, native.MethodHeadObject, native.MethodGetObject},
+	s3ActionListAllMyBuckets:                 {native.MethodListContainers, native.MethodGetContainer},
+	s3ActionListBucket:                       {native.MethodGetContainer, native.MethodGetObject, native.MethodHeadObject, native.MethodSearchObject, native.MethodRangeObject, native.MethodHashObject},
+	s3ActionListBucketMultipartUploads:       {native.MethodGetContainer, native.MethodGetObject},
+	s3ActionListBucketVersions:               {native.MethodGetContainer, native.MethodGetObject, native.MethodHeadObject, native.MethodSearchObject, native.MethodRangeObject, native.MethodHashObject},
+	s3ActionListMultipartUploadParts:         {native.MethodGetContainer, native.MethodGetObject},
+	s3ActionPutBucketACL:                     {native.MethodGetContainer, native.MethodSetContainerEACL, native.MethodGetObject, native.MethodPutObject},
+	s3ActionPutBucketCORS:                    {native.MethodGetContainer, native.MethodGetObject, native.MethodPutObject},
+	s3ActionPutBucketNotification:            {native.MethodGetContainer, native.MethodHeadObject, native.MethodDeleteObject, native.MethodGetObject, native.MethodPutObject},
+	s3ActionPutBucketObjectLockConfiguration: {native.MethodGetContainer, native.MethodGetObject, native.MethodPutObject},
+	s3ActionPutBucketPolicy:                  {native.MethodGetContainer},
+	s3ActionPutBucketTagging:                 {native.MethodGetContainer, native.MethodGetObject, native.MethodPutObject},
+	s3ActionPutBucketVersioning:              {native.MethodGetContainer, native.MethodGetObject, native.MethodPutObject},
+	s3ActionPutLifecycleConfiguration:        {native.MethodGetContainer, native.MethodGetObject, native.MethodHeadObject, native.MethodPutObject, native.MethodDeleteObject},
+	s3ActionPutObject:                        {native.MethodGetContainer, native.MethodPutObject, native.MethodGetObject, native.MethodHeadObject, native.MethodRangeObject},
+	s3ActionPutObjectACL:                     {native.MethodGetContainer, native.MethodGetContainerEACL, native.MethodSetContainerEACL, native.MethodGetObject, native.MethodHeadObject},
+	s3ActionPutObjectLegalHold:               {native.MethodGetContainer, native.MethodHeadObject, native.MethodGetObject, native.MethodPutObject},
+	s3ActionPutObjectRetention:               {native.MethodGetContainer, native.MethodHeadObject, native.MethodGetObject, native.MethodPutObject},
+	s3ActionPutObjectTagging:                 {native.MethodGetContainer, native.MethodHeadObject, native.MethodGetObject, native.MethodPutObject},
+	s3ActionPutObjectVersionACL:              {native.MethodGetContainer, native.MethodGetContainerEACL, native.MethodSetContainerEACL, native.MethodGetObject, native.MethodHeadObject},
+	s3ActionPutObjectVersionTagging:          {native.MethodGetContainer, native.MethodHeadObject, native.MethodGetObject, native.MethodPutObject},
+	s3ActionPatchObject:                      {native.MethodGetContainer, native.MethodGetObject, native.MethodHeadObject, native.MethodPatchObject, native.MethodPutObject, native.MethodRangeObject},
+}
+
+var containerNativeOperations = map[string]struct{}{
+	native.MethodPutContainer:     {},
+	native.MethodDeleteContainer:  {},
+	native.MethodGetContainer:     {},
+	native.MethodListContainers:   {},
+	native.MethodSetContainerEACL: {},
+	native.MethodGetContainerEACL: {},
+}
+
+var objectNativeOperations = map[string]struct{}{
+	native.MethodGetObject:    {},
+	native.MethodPutObject:    {},
+	native.MethodHeadObject:   {},
+	native.MethodDeleteObject: {},
+	native.MethodSearchObject: {},
+	native.MethodRangeObject:  {},
+	native.MethodHashObject:   {},
+}
+
+var errConditionKeyNotApplicable = errors.New("condition key is not applicable")
+
+type NativeResolver interface {
+	GetUserKey(account, name string) (string, error)
+	GetBucketInfo(bucket string) (*BucketInfo, error)
+}
+
+type BucketInfo struct {
+	Namespace string
+	Container string
+}
+
+func ConvertToNativeChain(p Policy, resolver NativeResolver) (*chain.Chain, error) {
+	if err := p.Validate(ResourceBasedPolicyType); err != nil {
+		return nil, err
+	}
+
+	var engineChain chain.Chain
+
+	for _, statement := range p.Statement {
+		status := formStatus(statement)
+		if status != chain.Allow {
+			// Most s3 methods share the same native operations. Deny rules must not affect shared native operations,
+			// therefore this code skips all deny rules for native protocol. Deny is applied for s3 protocol only, in this case.
+			continue
+		}
+
+		action, actionInverted := statement.action()
+		nativeActions, err := formNativeActionNames(action)
+		if err != nil {
+			return nil, err
+		}
+		ruleAction := chain.Actions{Inverted: actionInverted, Names: nativeActions}
+		if len(ruleAction.Names) == 0 {
+			continue
+		}
+
+		resource, resourceInverted := statement.resource()
+		groupedResources, err := formNativeResourceNamesAndConditions(resource, resolver, getActionTypes(nativeActions))
+		if err != nil {
+			return nil, err
+		}
+
+		groupedConditions, err := convertToNativeChainCondition(statement.Conditions, resolver)
+		if err != nil {
+			if errors.Is(err, errConditionKeyNotApplicable) {
+				continue
+			}
+			return nil, err
+		}
+		splitConditions := splitGroupedConditions(groupedConditions)
+
+		principals, principalCondFn, err := getNativePrincipalsAndConditionFunc(statement, resolver)
+		if err != nil {
+			return nil, err
+		}
+
+		for _, groupedResource := range groupedResources {
+			for _, principal := range principals {
+				for _, conditions := range splitConditions {
+					var principalCondition []chain.Condition
+					if principal != Wildcard {
+						principalCondition = []chain.Condition{principalCondFn(principal)}
+					}
+
+					ruleConditions := append(principalCondition, groupedResource.Conditions...)
+
+					r := chain.Rule{
+						Status:  status,
+						Actions: ruleAction,
+						Resources: chain.Resources{
+							Inverted: resourceInverted,
+							Names:    groupedResource.Names,
+						},
+						Condition: append(ruleConditions, conditions...),
+					}
+					engineChain.Rules = append(engineChain.Rules, r)
+				}
+			}
+		}
+	}
+
+	if len(engineChain.Rules) == 0 {
+		return nil, ErrActionsNotApplicable
+	}
+
+	return &engineChain, nil
+}
+
+func getActionTypes(nativeActions []string) ActionTypes {
+	var res ActionTypes
+	for _, action := range nativeActions {
+		if res.Object && res.Container {
+			break
+		}
+
+		_, isObj := objectNativeOperations[action]
+		_, isCnr := containerNativeOperations[action]
+
+		res.Object = res.Object || isObj || action == Wildcard
+		res.Container = res.Container || isCnr || action == Wildcard
+	}
+
+	return res
+}
+
+func getNativePrincipalsAndConditionFunc(statement Statement, resolver NativeResolver) ([]string, formPrincipalConditionFunc, error) {
+	var principals []string
+	var op chain.ConditionType
+	statementPrincipal, inverted := statement.principal()
+	if _, ok := statementPrincipal[Wildcard]; ok { // this can be true only if 'inverted' false
+		principals = []string{Wildcard}
+		op = chain.CondStringLike
+	} else {
+		for principalType, principal := range statementPrincipal {
+			if principalType != AWSPrincipalType {
+				return nil, nil, fmt.Errorf("unsupported principal type '%s'", principalType)
+			}
+			parsedPrincipal, err := formNativePrincipal(principal, resolver)
+			if err != nil {
+				return nil, nil, fmt.Errorf("parse principal: %w", err)
+			}
+			principals = append(principals, parsedPrincipal...)
+		}
+
+		op = chain.CondStringEquals
+		if inverted {
+			op = chain.CondStringNotEquals
+		}
+	}
+
+	return principals, func(principal string) chain.Condition {
+		return chain.Condition{
+			Op:    op,
+			Kind:  chain.KindRequest,
+			Key:   native.PropertyKeyActorPublicKey,
+			Value: principal,
+		}
+	}, nil
+}
+
+func convertToNativeChainCondition(c Conditions, resolver NativeResolver) ([]GroupedConditions, error) {
+	return convertToChainConditions(c, func(gr GroupedConditions) (GroupedConditions, error) {
+		res := GroupedConditions{
+			Conditions: make([]chain.Condition, 0, len(gr.Conditions)),
+			Any:        gr.Any,
+		}
+
+		for i := range gr.Conditions {
+			switch {
+			case gr.Conditions[i].Key == condKeyAWSMFAPresent:
+				return GroupedConditions{}, errConditionKeyNotApplicable
+			case gr.Conditions[i].Key == condKeyAWSPrincipalARN:
+				gr.Conditions[i].Key = native.PropertyKeyActorPublicKey
+				val, err := formPrincipalKey(gr.Conditions[i].Value, resolver)
+				if err != nil {
+					return GroupedConditions{}, err
+				}
+				gr.Conditions[i].Value = val
+				res.Conditions = append(res.Conditions, gr.Conditions[i])
+			case strings.HasPrefix(gr.Conditions[i].Key, condKeyAWSRequestTagPrefix) ||
+				strings.HasPrefix(gr.Conditions[i].Key, condKeyAWSResourceTagPrefix):
+				// Tags exist only in S3 requests, so native protocol should not process such conditions.
+				continue
+			default:
+				res.Conditions = append(res.Conditions, gr.Conditions[i])
+			}
+		}
+
+		return res, nil
+	})
+}
+
+type GroupedResources struct {
+	Names      []string
+	Conditions []chain.Condition
+}
+
+type ActionTypes struct {
+	Object    bool
+	Container bool
+}
+
+func formNativeResourceNamesAndConditions(names []string, resolver NativeResolver, actionTypes ActionTypes) ([]GroupedResources, error) {
+	if !actionTypes.Object && !actionTypes.Container {
+		return nil, ErrActionsNotApplicable
+	}
+
+	res := make([]GroupedResources, 0, len(names))
+
+	combined := make(map[string]struct{})
+
+	for _, resource := range names {
+		if err := validateResource(resource); err != nil {
+			return nil, err
+		}
+
+		if resource == Wildcard {
+			res = res[:0]
+			return append(res, formWildcardNativeResource(actionTypes)), nil
+		}
+
+		if !strings.HasPrefix(resource, s3ResourcePrefix) {
+			continue
+		}
+
+		var bkt, obj string
+		s3Resource := strings.TrimPrefix(resource, s3ResourcePrefix)
+		if s3Resource == Wildcard {
+			res = res[:0]
+			return append(res, formWildcardNativeResource(actionTypes)), nil
+		}
+
+		if sepIndex := strings.Index(s3Resource, "/"); sepIndex < 0 {
+			bkt = s3Resource
+		} else {
+			bkt = s3Resource[:sepIndex]
+			obj = s3Resource[sepIndex+1:]
+			if len(obj) == 0 {
+				obj = Wildcard
+			}
+		}
+
+		bktInfo, err := resolver.GetBucketInfo(bkt)
+		if err != nil {
+			return nil, err
+		}
+
+		if obj == Wildcard && actionTypes.Object { // this corresponds to arn:aws:s3:::BUCKET/ or arn:aws:s3:::BUCKET/*
+			combined[fmt.Sprintf(native.ResourceFormatNamespaceContainerObjects, bktInfo.Namespace, bktInfo.Container)] = struct{}{}
+			combined[fmt.Sprintf(native.ResourceFormatNamespaceContainer, bktInfo.Namespace, bktInfo.Container)] = struct{}{}
+			continue
+		}
+		if obj == "" && actionTypes.Container { // this corresponds to arn:aws:s3:::BUCKET
+			combined[fmt.Sprintf(native.ResourceFormatNamespaceContainer, bktInfo.Namespace, bktInfo.Container)] = struct{}{}
+			continue
+		}
+
+		res = append(res, GroupedResources{
+			Names: []string{
+				fmt.Sprintf(native.ResourceFormatNamespaceContainerObjects, bktInfo.Namespace, bktInfo.Container),
+				fmt.Sprintf(native.ResourceFormatNamespaceContainer, bktInfo.Namespace, bktInfo.Container),
+			},
+			Conditions: []chain.Condition{
+				{
+					Op:    chain.CondStringLike,
+					Kind:  chain.KindResource,
+					Key:   PropertyKeyFilePath,
+					Value: obj,
+				},
+			},
+		})
+	}
+
+	if len(combined) != 0 {
+		gr := GroupedResources{Names: make([]string, 0, len(combined))}
+		for key := range combined {
+			gr.Names = append(gr.Names, key)
+		}
+
+		res = append(res, gr)
+	}
+
+	return res, nil
+}
+
+func formWildcardNativeResource(actionTypes ActionTypes) GroupedResources {
+	groupedNames := make([]string, 0, 2)
+	if actionTypes.Object {
+		groupedNames = append(groupedNames, native.ResourceFormatAllObjects)
+	}
+	if actionTypes.Container {
+		groupedNames = append(groupedNames, native.ResourceFormatAllContainers)
+	}
+
+	return GroupedResources{Names: groupedNames}
+}
+
+func formNativePrincipal(principal []string, resolver NativeResolver) ([]string, error) {
+	res := make([]string, len(principal))
+
+	var err error
+	for i := range principal {
+		if res[i], err = formPrincipalKey(principal[i], resolver); err != nil {
+			return nil, err
+		}
+	}
+
+	return res, nil
+}
+
+func formPrincipalKey(principal string, resolver NativeResolver) (string, error) {
+	account, user, err := parsePrincipalAsIAMUser(principal)
+	if err != nil {
+		return "", err
+	}
+
+	key, err := resolver.GetUserKey(account, user)
+	if err != nil {
+		return "", fmt.Errorf("get user key: %w", err)
+	}
+
+	return key, nil
+}
+
+func formNativeActionNames(names []string) ([]string, error) {
+	uniqueActions := make(map[string]struct{}, len(names))
+
+	for _, action := range names {
+		if action == Wildcard {
+			return []string{Wildcard}, nil
+		}
+
+		isIAM, err := validateAction(action)
+		if err != nil {
+			return nil, err
+		}
+
+		if isIAM {
+			continue
+		}
+
+		if action[len(s3ActionPrefix):] == Wildcard {
+			return []string{Wildcard}, nil
+		}
+
+		nativeActions := actionToNativeOpMap[action]
+		if len(nativeActions) == 0 {
+			return nil, ErrActionsNotApplicable
+		}
+
+		for _, nativeAction := range nativeActions {
+			uniqueActions[nativeAction] = struct{}{}
+		}
+	}
+
+	res := make([]string, 0, len(uniqueActions))
+	for key := range uniqueActions {
+		res = append(res, key)
+	}
+
+	return res, nil
+}

iam/converter_s3.go

@@ -0,0 +1,270 @@
+package iam
+
+import (
+	"fmt"
+	"strings"
+
+	"git.frostfs.info/TrueCloudLab/policy-engine/pkg/chain"
+	"git.frostfs.info/TrueCloudLab/policy-engine/schema/s3"
+)
+
+const condKeyAWSMFAPresent = "aws:MultiFactorAuthPresent"
+
+var actionToS3OpMap = map[string][]string{
+	s3ActionAbortMultipartUpload:  {s3ActionAbortMultipartUpload},
+	s3ActionCreateBucket:          {s3ActionCreateBucket},
+	s3ActionDeleteBucket:          {s3ActionDeleteBucket},
+	s3ActionDeleteBucketPolicy:    {s3ActionDeleteBucketPolicy},
+	s3ActionDeleteObjectTagging:   {s3ActionDeleteObjectTagging},
+	s3ActionGetBucketLocation:     {s3ActionGetBucketLocation},
+	s3ActionGetBucketNotification: {s3ActionGetBucketNotification},
+	s3ActionGetBucketPolicy:       {s3ActionGetBucketPolicy},
+	s3ActionGetBucketPolicyStatus: {s3ActionGetBucketPolicyStatus},
+	s3ActionGetBucketTagging:      {s3ActionGetBucketTagging},
+	s3ActionGetBucketVersioning:   {s3ActionGetBucketVersioning},
+	s3ActionGetObjectAttributes:   {s3ActionGetObjectAttributes},
+	s3ActionGetObjectLegalHold:    {s3ActionGetObjectLegalHold},
+	s3ActionGetObjectRetention:    {s3ActionGetObjectRetention},
+	s3ActionGetObjectTagging:      {s3ActionGetObjectTagging},
+	s3ActionPutBucketNotification: {s3ActionPutBucketNotification},
+	s3ActionPutBucketPolicy:       {s3ActionPutBucketPolicy},
+	s3ActionPutBucketVersioning:   {s3ActionPutBucketVersioning},
+	s3ActionPutObjectLegalHold:    {s3ActionPutObjectLegalHold},
+	s3ActionPutObjectRetention:    {s3ActionPutObjectRetention},
+	s3ActionPutObjectTagging:      {s3ActionPutObjectTagging},
+	s3ActionPatchObject:           {s3ActionPatchObject},
+
+	s3ActionListAllMyBuckets:                 {"s3:ListBuckets"},
+	s3ActionListBucket:                       {"s3:HeadBucket", "s3:GetBucketLocation", "s3:ListObjectsV1", "s3:ListObjectsV2"},
+	s3ActionListBucketVersions:               {"s3:ListBucketObjectVersions"},
+	s3ActionListBucketMultipartUploads:       {"s3:ListMultipartUploads"},
+	s3ActionGetBucketObjectLockConfiguration: {"s3:GetBucketObjectLockConfig"},
+	s3ActionGetLifecycleConfiguration:        {"s3:GetBucketLifecycle"},
+	s3ActionGetBucketACL:                     {"s3:GetBucketACL"},
+	s3ActionGetBucketCORS:                    {"s3:GetBucketCors"},
+	s3ActionPutBucketTagging:                 {"s3:PutBucketTagging", "s3:DeleteBucketTagging"},
+	s3ActionPutBucketObjectLockConfiguration: {"s3:PutBucketObjectLockConfig"},
+	s3ActionPutLifecycleConfiguration:        {"s3:PutBucketLifecycle", "s3:DeleteBucketLifecycle"},
+	s3ActionPutBucketACL:                     {"s3:PutBucketACL"},
+	s3ActionPutBucketCORS:                    {"s3:PutBucketCors", "s3:DeleteBucketCors"},
+
+	s3ActionListMultipartUploadParts:   {"s3:ListParts"},
+	s3ActionGetObjectACL:               {"s3:GetObjectACL"},
+	s3ActionGetObject:                  {"s3:GetObject", "s3:HeadObject"},
+	s3ActionGetObjectVersion:           {"s3:GetObject", "s3:HeadObject"},
+	s3ActionGetObjectVersionACL:        {"s3:GetObjectACL"},
+	s3ActionGetObjectVersionAttributes: {"s3:GetObjectAttributes"},
+	s3ActionGetObjectVersionTagging:    {"s3:GetObjectTagging"},
+	s3ActionPutObjectACL:               {"s3:PutObjectACL"},
+	s3ActionPutObjectVersionACL:        {"s3:PutObjectACL"},
+	s3ActionPutObjectVersionTagging:    {"s3:PutObjectTagging"},
+	s3ActionPutObject: {
+		"s3:PutObject", "s3:PostObject", "s3:CopyObject",
+		"s3:UploadPart", "s3:UploadPartCopy", "s3:CreateMultipartUpload", "s3:CompleteMultipartUpload",
+	},
+	s3ActionDeleteObjectVersionTagging: {"s3:DeleteObjectTagging"},
+	s3ActionDeleteObject:               {"s3:DeleteObject", "s3:DeleteMultipleObjects"},
+	s3ActionDeleteObjectVersion:        {"s3:DeleteObject", "s3:DeleteMultipleObjects"},
+}
+
+type S3Resolver interface {
+	GetUserAddress(account, user string) (string, error)
+}
+
+func ConvertToS3Chain(p Policy, resolver S3Resolver) (*chain.Chain, error) {
+	if err := p.Validate(ResourceBasedPolicyType); err != nil {
+		return nil, err
+	}
+
+	var engineChain chain.Chain
+
+	for _, statement := range p.Statement {
+		status := formStatus(statement)
+
+		actions, actionInverted := statement.action()
+		s3Actions, err := formS3ActionNames(actions)
+		if err != nil {
+			return nil, err
+		}
+		ruleAction := chain.Actions{Inverted: actionInverted, Names: s3Actions}
+		if len(ruleAction.Names) == 0 {
+			continue
+		}
+
+		resources, resourceInverted := statement.resource()
+		if err := validateS3ResourceNames(resources); err != nil {
+			return nil, err
+		}
+		ruleResource := chain.Resources{Inverted: resourceInverted, Names: resources}
+
+		groupedConditions, err := convertToS3ChainCondition(statement.Conditions, resolver)
+		if err != nil {
+			return nil, err
+		}
+		splitConditions := splitGroupedConditions(groupedConditions)
+
+		principals, principalCondFn, err := getS3PrincipalsAndConditionFunc(statement, resolver)
+		if err != nil {
+			return nil, err
+		}
+
+		for _, principal := range principals {
+			for _, conditions := range splitConditions {
+				var principalCondition []chain.Condition
+				if principal != Wildcard {
+					principalCondition = []chain.Condition{principalCondFn(principal)}
+				}
+
+				r := chain.Rule{
+					Status:    status,
+					Actions:   ruleAction,
+					Resources: ruleResource,
+					Condition: append(principalCondition, conditions...),
+				}
+				engineChain.Rules = append(engineChain.Rules, r)
+			}
+		}
+	}
+
+	if len(engineChain.Rules) == 0 {
+		return nil, ErrActionsNotApplicable
+	}
+
+	return &engineChain, nil
+}
+
+func getS3PrincipalsAndConditionFunc(statement Statement, resolver S3Resolver) ([]string, formPrincipalConditionFunc, error) {
+	var principals []string
+	var op chain.ConditionType
+	statementPrincipal, inverted := statement.principal()
+	if _, ok := statementPrincipal[Wildcard]; ok { // this can be true only if 'inverted' false
+		principals = []string{Wildcard}
+		op = chain.CondStringLike
+	} else {
+		for principalType, principal := range statementPrincipal {
+			if principalType != AWSPrincipalType {
+				return nil, nil, fmt.Errorf("unsupported principal type '%s'", principalType)
+			}
+			parsedPrincipal, err := formS3Principal(principal, resolver)
+			if err != nil {
+				return nil, nil, fmt.Errorf("parse principal: %w", err)
+			}
+			principals = append(principals, parsedPrincipal...)
+		}
+
+		op = chain.CondStringEquals
+		if inverted {
+			op = chain.CondStringNotEquals
+		}
+	}
+
+	return principals, func(principal string) chain.Condition {
+		return chain.Condition{
+			Op:    op,
+			Kind:  chain.KindRequest,
+			Key:   s3.PropertyKeyOwner,
+			Value: principal,
+		}
+	}, nil
+}
+
+func convertToS3ChainCondition(c Conditions, resolver S3Resolver) ([]GroupedConditions, error) {
+	return convertToChainConditions(c, func(gr GroupedConditions) (GroupedConditions, error) {
+		for i := range gr.Conditions {
+			switch {
+			case gr.Conditions[i].Key == condKeyAWSPrincipalARN:
+				gr.Conditions[i].Key = s3.PropertyKeyOwner
+				val, err := formPrincipalOwner(gr.Conditions[i].Value, resolver)
+				if err != nil {
+					return GroupedConditions{}, err
+				}
+				gr.Conditions[i].Value = val
+
+			case gr.Conditions[i].Key == condKeyAWSMFAPresent:
+				gr.Conditions[i].Key = s3.PropertyKeyAccessBoxAttrMFA
+			case strings.HasPrefix(gr.Conditions[i].Key, condKeyAWSResourceTagPrefix):
+				gr.Conditions[i].Kind = chain.KindResource
+			}
+		}
+
+		return gr, nil
+	})
+}
+
+func formS3Principal(principal []string, resolver S3Resolver) ([]string, error) {
+	res := make([]string, len(principal))
+
+	var err error
+	for i := range principal {
+		if res[i], err = formPrincipalOwner(principal[i], resolver); err != nil {
+			return nil, err
+		}
+	}
+
+	return res, nil
+}
+
+func formPrincipalOwner(principal string, resolver S3Resolver) (string, error) {
+	account, user, err := parsePrincipalAsIAMUser(principal)
+	if err != nil {
+		return "", err
+	}
+
+	address, err := resolver.GetUserAddress(account, user)
+	if err != nil {
+		return "", fmt.Errorf("get user address: %w", err)
+	}
+
+	return address, nil
+}
+
+func validateS3ResourceNames(names []string) error {
+	for i := range names {
+		if err := validateResource(names[i]); err != nil {
+			return err
+		}
+	}
+
+	return nil
+}
+
+func formS3ActionNames(names []string) ([]string, error) {
+	uniqueActions := make(map[string]struct{}, len(names))
+
+	for _, action := range names {
+		if action == Wildcard {
+			return []string{Wildcard}, nil
+		}
+
+		isIAM, err := validateAction(action)
+		if err != nil {
+			return nil, err
+		}
+
+		if isIAM {
+			uniqueActions[action] = struct{}{}
+			continue
+		}
+
+		if action[len(s3ActionPrefix):] == Wildcard {
+			uniqueActions[action] = struct{}{}
+			continue
+		}
+
+		s3Actions := actionToS3OpMap[action]
+		if len(s3Actions) == 0 {
+			return nil, ErrActionsNotApplicable
+		}
+
+		for _, s3Action := range s3Actions {
+			uniqueActions[s3Action] = struct{}{}
+		}
+	}
+
+	res := make([]string, 0, len(uniqueActions))
+	for key := range uniqueActions {
+		res = append(res, key)
+	}
+
+	return res, nil
+}

iam/policy.go

@@ -3,11 +3,11 @@ package iam
 import (
 	"encoding/json"
 	"errors"
+	"fmt"
 )
 
 type (
 	// Policy grammar https://docs.aws.amazon.com/IAM/latest/UserGuide/reference_policies_grammar.html
-	// Currently 'NotPrincipal', 'NotAction' and 'NotResource' are not supported (so cannot be unmarshalled).
 	Policy struct {
 		Version   string     `json:"Version,omitempty"`
 		ID        string     `json:"Id,omitempty"`
@@ -17,15 +17,19 @@ type (
 	Statements []Statement
 
 	Statement struct {
+		ID           string     `json:"Id,omitempty"`
 		SID          string     `json:"Sid,omitempty"`
 		Principal    Principal  `json:"Principal,omitempty"`
+		NotPrincipal Principal  `json:"NotPrincipal,omitempty"`
 		Effect       Effect     `json:"Effect"`
-		Action     Action     `json:"Action"`
-		Resource   Resource   `json:"Resource"`
+		Action       Action     `json:"Action,omitempty"`
+		NotAction    Action     `json:"NotAction,omitempty"`
+		Resource     Resource   `json:"Resource,omitempty"`
+		NotResource  Resource   `json:"NotResource,omitempty"`
 		Conditions   Conditions `json:"Condition,omitempty"`
 	}
 
-	Principal map[string][]string
+	Principal map[PrincipalType][]string
 
 	Effect string
 
@@ -36,6 +40,18 @@ type (
 	Conditions map[string]Condition
 
 	Condition map[string][]string
+
+	PolicyType int
+
+	PrincipalType string
+)
+
+const policyVersion = "2012-10-17"
+
+const (
+	GeneralPolicyType PolicyType = iota
+	IdentityBasedPolicyType
+	ResourceBasedPolicyType
 )
 
 const Wildcard = "*"
@@ -45,6 +61,22 @@ const (
 	DenyEffect  Effect = "Deny"
 )
 
+func (e Effect) IsValid() bool {
+	return e == AllowEffect || e == DenyEffect
+}
+
+const (
+	AWSPrincipalType           PrincipalType = "AWS"
+	FederatedPrincipalType     PrincipalType = "Federated"
+	ServicePrincipalType       PrincipalType = "Service"
+	CanonicalUserPrincipalType PrincipalType = "CanonicalUser"
+)
+
+func (p PrincipalType) IsValid() bool {
+	return p == AWSPrincipalType || p == FederatedPrincipalType ||
+		p == ServicePrincipalType || p == CanonicalUserPrincipalType
+}
+
 func (s *Statements) UnmarshalJSON(data []byte) error {
 	var list []Statement
 	if err := json.Unmarshal(data, &list); err == nil {
@@ -75,7 +107,7 @@ func (p *Principal) UnmarshalJSON(data []byte) error {
 		return nil
 	}
 
-	m := make(map[string]interface{})
+	m := make(map[PrincipalType]any)
 	if err := json.Unmarshal(data, &m); err != nil {
 		return err
 	}
@@ -87,7 +119,7 @@ func (p *Principal) UnmarshalJSON(data []byte) error {
 			continue
 		}
 
-		list, ok := val.([]interface{})
+		list, ok := val.([]any)
 		if !ok {
 			return errors.New("invalid principal format")
 		}
@@ -144,7 +176,7 @@ func (r *Resource) UnmarshalJSON(data []byte) error {
 func (c *Condition) UnmarshalJSON(data []byte) error {
 	*c = make(Condition)
 
-	m := make(map[string]interface{})
+	m := make(map[string]any)
 	if err := json.Unmarshal(data, &m); err != nil {
 		return err
 	}
@@ -156,7 +188,7 @@ func (c *Condition) UnmarshalJSON(data []byte) error {
 			continue
 		}
 
-		list, ok := val.([]interface{})
+		list, ok := val.([]any)
 		if !ok {
 			return errors.New("invalid principal format")
 		}
@@ -175,3 +207,123 @@ func (c *Condition) UnmarshalJSON(data []byte) error {
 
 	return nil
 }
+
+func (p Policy) Validate(typ PolicyType) error {
+	if err := p.validate(); err != nil {
+		return err
+	}
+
+	switch typ {
+	case IdentityBasedPolicyType:
+		return p.validateIdentityBased()
+	case ResourceBasedPolicyType:
+		return p.validateResourceBased()
+	default:
+		return nil
+	}
+}
+
+func (p Policy) validate() error {
+	if p.Version != policyVersion {
+		return fmt.Errorf("invalid policy version, expected '%s', actual: '%s'", policyVersion, p.Version)
+	}
+
+	if len(p.Statement) == 0 {
+		return errors.New("'Statement' is missing")
+	}
+
+	sids := make(map[string]struct{}, len(p.Statement))
+	for _, statement := range p.Statement {
+		if _, ok := sids[statement.SID]; ok && statement.SID != "" {
+			return fmt.Errorf("duplicate 'SID': %s", statement.SID)
+		}
+		sids[statement.SID] = struct{}{}
+		if !statement.Effect.IsValid() {
+			return fmt.Errorf("unknown effect: '%s'", statement.Effect)
+		}
+		if len(statement.Action) != 0 && len(statement.NotAction) != 0 {
+			return errors.New("'Actions' and 'NotAction' are mutually exclusive")
+		}
+		if statement.Resource != nil && statement.NotResource != nil {
+			return errors.New("'Resources' and 'NotResource' are mutually exclusive")
+		}
+		if len(statement.Resource) == 0 && len(statement.NotResource) == 0 {
+			return errors.New("one of 'Resources'/'NotResource' must be provided")
+		}
+		if len(statement.Principal) != 0 && len(statement.NotPrincipal) != 0 {
+			return errors.New("'Principal' and 'NotPrincipal' are mutually exclusive")
+		}
+		if len(statement.NotPrincipal) != 0 && statement.Effect != DenyEffect {
+			return errors.New("using 'NotPrincipal' with effect 'Allow' is not supported")
+		}
+
+		principal, _ := statement.principal()
+		if err := principal.validate(); err != nil {
+			return err
+		}
+	}
+
+	return nil
+}
+
+func (p Policy) validateIdentityBased() error {
+	if len(p.ID) != 0 {
+		return errors.New("'Id' is not allowed for identity-based policy")
+	}
+
+	for _, statement := range p.Statement {
+		if len(statement.Principal) != 0 || len(statement.NotPrincipal) != 0 {
+			return errors.New("'Principal' and 'NotPrincipal' are not allowed for identity-based policy")
+		}
+	}
+
+	return nil
+}
+
+func (p Policy) validateResourceBased() error {
+	for _, statement := range p.Statement {
+		if len(statement.Principal) == 0 && len(statement.NotPrincipal) == 0 {
+			return errors.New("'Principal' or 'NotPrincipal' must be provided for resource-based policy")
+		}
+	}
+
+	return nil
+}
+
+func (s Statement) principal() (Principal, bool) {
+	if len(s.NotPrincipal) != 0 {
+		return s.NotPrincipal, true
+	}
+
+	return s.Principal, false
+}
+
+func (s Statement) action() (Action, bool) {
+	if len(s.NotAction) != 0 {
+		return s.NotAction, true
+	}
+
+	return s.Action, false
+}
+
+func (s Statement) resource() (Resource, bool) {
+	if len(s.NotResource) != 0 {
+		return s.NotResource, true
+	}
+
+	return s.Resource, false
+}
+
+func (p Principal) validate() error {
+	if _, ok := p[Wildcard]; ok && len(p) == 1 {
+		return nil
+	}
+
+	for key := range p {
+		if !key.IsValid() {
+			return fmt.Errorf("unknown principal type: '%s'", key)
+		}
+	}
+
+	return nil
+}

iam/policy_test.go

@@ -4,6 +4,11 @@ import (
 	"encoding/json"
 	"testing"
 
+	"git.frostfs.info/TrueCloudLab/policy-engine/pkg/chain"
+	"git.frostfs.info/TrueCloudLab/policy-engine/pkg/engine"
+	"git.frostfs.info/TrueCloudLab/policy-engine/pkg/engine/inmemory"
+	"git.frostfs.info/TrueCloudLab/policy-engine/pkg/resource/testutil"
+	"git.frostfs.info/TrueCloudLab/policy-engine/schema/s3"
 	"github.com/stretchr/testify/require"
 )
 
@@ -31,7 +36,7 @@ func TestUnmarshalIAMPolicy(t *testing.T) {
 			ID:      "PutObjPolicy",
 			Statement: []Statement{{
 				SID: "DenyObjectsThatAreNotSSEKMS",
-				Principal: map[string][]string{
+				Principal: map[PrincipalType][]string{
 					"*": nil,
 				},
 				Effect:   DenyEffect,
@@ -78,8 +83,8 @@ func TestUnmarshalIAMPolicy(t *testing.T) {
 		expected := Policy{
 			Version: "2012-10-17",
 			Statement: []Statement{{
-				Principal: map[string][]string{
-					"AWS": {"arn:aws:iam::111122223333:user/JohnDoe"},
+				Principal: map[PrincipalType][]string{
+					AWSPrincipalType: {"arn:aws:iam::111122223333:user/JohnDoe"},
 				},
 				Effect:   AllowEffect,
 				Action:   []string{"s3:PutObject"},
@@ -113,8 +118,8 @@ func TestUnmarshalIAMPolicy(t *testing.T) {
 
 		expected := Policy{
 			Statement: []Statement{{
-				Principal: map[string][]string{
-					"AWS": {"arn:aws:iam::111122223333:user/JohnDoe"},
+				Principal: map[PrincipalType][]string{
+					AWSPrincipalType: {"arn:aws:iam::111122223333:user/JohnDoe"},
 				},
 			}},
 		}
@@ -170,4 +175,377 @@ func TestUnmarshalIAMPolicy(t *testing.T) {
 		require.NoError(t, err)
 		require.Equal(t, expected, p)
 	})
+
+	t.Run("'Not*' fields", func(t *testing.T) {
+		policy := `
+{
+	"Id": "PutObjPolicy",
+	"Statement": [{
+			"NotPrincipal": {"AWS":["arn:aws:iam::111122223333:user/Alice"]},
+			"Effect": "Deny",
+			"NotAction": "s3:PutObject",
+			"NotResource": "arn:aws:s3:::DOC-EXAMPLE-BUCKET/*"
+	}]
+}`
+
+		expected := Policy{
+			ID: "PutObjPolicy",
+			Statement: []Statement{{
+				NotPrincipal: map[PrincipalType][]string{
+					AWSPrincipalType: {"arn:aws:iam::111122223333:user/Alice"},
+				},
+				Effect:      DenyEffect,
+				NotAction:   []string{"s3:PutObject"},
+				NotResource: []string{"arn:aws:s3:::DOC-EXAMPLE-BUCKET/*"},
+			}},
+		}
+
+		var p Policy
+		err := json.Unmarshal([]byte(policy), &p)
+		require.NoError(t, err)
+		require.Equal(t, expected, p)
+	})
+}
+
+func TestValidatePolicies(t *testing.T) {
+	for _, tc := range []struct {
+		name    string
+		policy  Policy
+		typ     PolicyType
+		isValid bool
+	}{
+		{
+			name: "valid permission boundaries",
+			policy: Policy{
+				Version: policyVersion,
+				Statement: []Statement{{
+					Effect:   AllowEffect,
+					Action:   []string{"s3:*", "cloudwatch:*", "ec2:*"},
+					Resource: []string{Wildcard},
+				}},
+			},
+			typ:     GeneralPolicyType,
+			isValid: true,
+		},
+		{
+			name: "general invalid effect",
+			policy: Policy{
+				Version: policyVersion,
+				Statement: []Statement{{
+					Effect:   "dummy",
+					Action:   []string{"s3:*", "cloudwatch:*", "ec2:*"},
+					Resource: []string{Wildcard},
+				}},
+			},
+			typ:     GeneralPolicyType,
+			isValid: false,
+		},
+		{
+			name: "general invalid principal block",
+			policy: Policy{
+				Version: policyVersion,
+				Statement: []Statement{{
+					Effect:       AllowEffect,
+					Action:       []string{"s3:*", "cloudwatch:*", "ec2:*"},
+					Resource:     []string{Wildcard},
+					Principal:    map[PrincipalType][]string{Wildcard: nil},
+					NotPrincipal: map[PrincipalType][]string{Wildcard: nil},
+				}},
+			},
+			typ:     GeneralPolicyType,
+			isValid: false,
+		},
+		{
+			name: "general invalid not principal",
+			policy: Policy{
+				Version: policyVersion,
+				Statement: []Statement{{
+					Effect:       AllowEffect,
+					Action:       []string{"s3:*", "cloudwatch:*", "ec2:*"},
+					Resource:     []string{Wildcard},
+					NotPrincipal: map[PrincipalType][]string{AWSPrincipalType: {"arn:aws:iam::111122223333:user/Alice"}},
+				}},
+			},
+			typ:     GeneralPolicyType,
+			isValid: false,
+		},
+		{
+			name: "general invalid principal type",
+			policy: Policy{
+				Version: policyVersion,
+				Statement: []Statement{{
+					Effect:       AllowEffect,
+					Action:       []string{"s3:*", "cloudwatch:*", "ec2:*"},
+					Resource:     []string{Wildcard},
+					NotPrincipal: map[PrincipalType][]string{"dummy": {"arn:aws:iam::111122223333:user/Alice"}},
+				}},
+			},
+			typ:     GeneralPolicyType,
+			isValid: false,
+		},
+		{
+			name: "general invalid action block",
+			policy: Policy{
+				Version: policyVersion,
+				Statement: []Statement{{
+					Effect:    AllowEffect,
+					Action:    []string{"s3:*", "cloudwatch:*", "ec2:*"},
+					NotAction: []string{"iam:*"},
+					Resource:  []string{Wildcard},
+				}},
+			},
+			typ:     GeneralPolicyType,
+			isValid: false,
+		},
+		{
+			name: "general invalid resource block",
+			policy: Policy{
+				Version: policyVersion,
+				Statement: []Statement{{
+					Effect:      AllowEffect,
+					Resource:    []string{Wildcard},
+					NotResource: []string{"arn:aws:s3:::DOC-EXAMPLE-BUCKET/*"},
+				}},
+			},
+			typ:     GeneralPolicyType,
+			isValid: false,
+		},
+		{
+			name: "invalid resource block",
+			policy: Policy{
+				Version: policyVersion,
+				Statement: []Statement{{
+					Effect:      AllowEffect,
+					Resource:    []string{},
+					NotResource: []string{"arn:aws:s3:::DOC-EXAMPLE-BUCKET/*"},
+				}},
+			},
+			typ:     GeneralPolicyType,
+			isValid: false,
+		},
+		{
+			name: "missing resource block",
+			policy: Policy{
+				Version: policyVersion,
+				Statement: []Statement{{
+					Effect: AllowEffect,
+				}},
+			},
+			typ:     GeneralPolicyType,
+			isValid: false,
+		},
+		{
+			name:    "missing statement block",
+			policy:  Policy{},
+			typ:     GeneralPolicyType,
+			isValid: false,
+		},
+		{
+			name: "duplicate sid",
+			policy: Policy{
+				Version: policyVersion,
+				Statement: []Statement{
+					{
+						SID:      "sid",
+						Effect:   AllowEffect,
+						Action:   []string{"s3:*"},
+						Resource: []string{Wildcard},
+					},
+					{
+						SID:      "sid",
+						Effect:   AllowEffect,
+						Action:   []string{"cloudwatch:*"},
+						Resource: []string{Wildcard},
+					}},
+			},
+			typ:     GeneralPolicyType,
+			isValid: false,
+		},
+		{
+			name: "missing version",
+			policy: Policy{
+				Statement: []Statement{{
+					Effect:   AllowEffect,
+					Action:   []string{"s3:*"},
+					Resource: []string{Wildcard},
+				}},
+			},
+			typ:     GeneralPolicyType,
+			isValid: false,
+		},
+		{
+			name: "identity based valid",
+			policy: Policy{
+				Version: policyVersion,
+				Statement: []Statement{{
+					Effect:   AllowEffect,
+					Action:   []string{"s3:PutObject"},
+					Resource: []string{Wildcard},
+				}},
+			},
+			typ:     IdentityBasedPolicyType,
+			isValid: true,
+		},
+		{
+			name: "identity based invalid because of id presence",
+			policy: Policy{
+				ID:      "some-id",
+				Version: policyVersion,
+				Statement: []Statement{{
+					Effect:   AllowEffect,
+					Action:   []string{"s3:PutObject"},
+					Resource: []string{Wildcard},
+				}},
+			},
+			typ:     IdentityBasedPolicyType,
+			isValid: false,
+		},
+		{
+			name: "identity based invalid because of principal presence",
+			policy: Policy{
+				Version: policyVersion,
+				Statement: []Statement{{
+					Effect:    AllowEffect,
+					Action:    []string{"s3:PutObject"},
+					Resource:  []string{Wildcard},
+					Principal: map[PrincipalType][]string{AWSPrincipalType: {"arn:aws:iam::111122223333:user/Alice"}},
+				}},
+			},
+			typ:     IdentityBasedPolicyType,
+			isValid: false,
+		},
+		{
+			name: "identity based invalid because of not principal presence",
+			policy: Policy{
+				Version: policyVersion,
+				Statement: []Statement{{
+					Effect:       AllowEffect,
+					Action:       []string{"s3:PutObject"},
+					Resource:     []string{Wildcard},
+					NotPrincipal: map[PrincipalType][]string{AWSPrincipalType: {"arn:aws:iam::111122223333:user/Alice"}},
+				}},
+			},
+			typ:     IdentityBasedPolicyType,
+			isValid: false,
+		},
+		{
+			name: "resource based valid principal",
+			policy: Policy{
+				Version: policyVersion,
+				Statement: []Statement{{
+					Effect:    DenyEffect,
+					Action:    []string{"s3:PutObject"},
+					Resource:  []string{Wildcard},
+					Principal: map[PrincipalType][]string{AWSPrincipalType: {"arn:aws:iam::111122223333:user/Alice"}},
+				}},
+			},
+			typ:     ResourceBasedPolicyType,
+			isValid: true,
+		},
+		{
+			name: "resource based valid not principal",
+			policy: Policy{
+				ID:      "some-id",
+				Version: policyVersion,
+				Statement: []Statement{{
+					Effect:       DenyEffect,
+					Action:       []string{"s3:PutObject"},
+					Resource:     []string{Wildcard},
+					NotPrincipal: map[PrincipalType][]string{AWSPrincipalType: {"arn:aws:iam::111122223333:user/Alice"}},
+				}},
+			},
+			typ:     ResourceBasedPolicyType,
+			isValid: true,
+		},
+		{
+			name: "resource based invalid missing principal",
+			policy: Policy{
+				ID:      "some-id",
+				Version: policyVersion,
+				Statement: []Statement{{
+					Effect:   AllowEffect,
+					Action:   []string{"s3:PutObject"},
+					Resource: []string{Wildcard},
+				}},
+			},
+			typ:     ResourceBasedPolicyType,
+			isValid: false,
+		},
+	} {
+		t.Run(tc.name, func(t *testing.T) {
+			err := tc.policy.Validate(tc.typ)
+			if tc.isValid {
+				require.NoError(t, err)
+			} else {
+				require.Error(t, err)
+			}
+		})
+	}
+}
+
+func TestProcessDenyFirst(t *testing.T) {
+	identityBasedPolicyStr := `
+{
+    "Version": "2012-10-17",
+    "Statement": [
+        {
+            "Effect": "Allow",
+			"Principal": {
+				"AWS": [ "arn:aws:iam::root:user/user-name" ]
+			},
+            "Action": ["s3:PutObject" ],
+            "Resource": "arn:aws:s3:::*"
+        }
+    ]
+}
+`
+
+	resourceBasedPolicyStr := `
+{
+    "Version": "2012-10-17",
+    "Statement": [
+        {
+            "Effect": "Deny",
+            "Principal": "*",
+            "Action": "s3:*",
+            "Resource": [ "arn:aws:s3:::test-bucket/*" ]
+        }
+    ]
+}
+`
+
+	var identityPolicy Policy
+	err := json.Unmarshal([]byte(identityBasedPolicyStr), &identityPolicy)
+	require.NoError(t, err)
+
+	var resourcePolicy Policy
+	err = json.Unmarshal([]byte(resourceBasedPolicyStr), &resourcePolicy)
+	require.NoError(t, err)
+
+	mockResolver := newMockUserResolver([]string{"root/user-name"}, []string{"test-bucket"}, "")
+
+	identityNativePolicy, err := ConvertToS3Chain(identityPolicy, mockResolver)
+	require.NoError(t, err)
+	identityNativePolicy.MatchType = chain.MatchTypeFirstMatch
+
+	resourceNativePolicy, err := ConvertToS3Chain(resourcePolicy, mockResolver)
+	require.NoError(t, err)
+
+	s := inmemory.NewInMemory()
+
+	target := engine.NamespaceTarget("ns")
+
+	_, _, err = s.MorphRuleChainStorage().AddMorphRuleChain(chain.S3, target, identityNativePolicy)
+	require.NoError(t, err)
+
+	_, _, err = s.MorphRuleChainStorage().AddMorphRuleChain(chain.S3, target, resourceNativePolicy)
+	require.NoError(t, err)
+
+	resource := testutil.NewResource("arn:aws:s3:::test-bucket/object", nil)
+	request := testutil.NewRequest("s3:PutObject", resource, map[string]string{s3.PropertyKeyOwner: mockResolver.users["root/user-name"]})
+
+	status, found, err := s.IsAllowed(chain.S3, engine.NewRequestTarget("ns", ""), request)
+	require.NoError(t, err)
+	require.True(t, found)
+	require.Equal(t, chain.AccessDenied, status)
 }

inmemory.go

@@ -1,107 +0,0 @@
-package policyengine
-
-type inmemory struct {
-	namespace map[Name][]chain
-	resource  map[Name][]chain
-	local     map[Name][]*Chain
-}
-
-type chain struct {
-	object string
-	chain  *Chain
-}
-
-// NewInMemory returns new inmemory instance of chain storage.
-func NewInMemory() CachedChainStorage {
-	return &inmemory{
-		namespace: make(map[Name][]chain),
-		resource:  make(map[Name][]chain),
-		local:     make(map[Name][]*Chain),
-	}
-}
-
-// TODO параметры для actor (IP)
-// TODO
-func (s *inmemory) IsAllowed(name Name, namespace string, r Request) (Status, bool) {
-	var ruleFound bool
-	if local, ok := s.local[name]; ok {
-		for _, c := range local {
-			if status, matched := c.Match(r); matched && status != Allow {
-				return status, true
-			}
-		}
-	}
-	if cs, ok := s.namespace[name]; ok {
-		status, ok := matchArray(cs, namespace, r)
-		if ok && status != Allow {
-			return status, true
-		}
-		ruleFound = ruleFound || ok
-	}
-	if cs, ok := s.resource[name]; ok {
-		status, ok := matchArray(cs, r.Resource().Name(), r)
-		if ok {
-			return status, true
-		}
-		ruleFound = ruleFound || ok
-	}
-	if ruleFound {
-		return Allow, true
-	}
-	return NoRuleFound, false
-}
-
-func matchArray(cs []chain, object string, r Request) (Status, bool) {
-	for _, c := range cs {
-		if !globMatch(object, c.object) {
-			continue
-		}
-		if status, matched := c.chain.Match(r); matched {
-			return status, true
-		}
-	}
-	return NoRuleFound, false
-}
-
-func (s *inmemory) AddResourceChain(name Name, resource string, c *Chain) {
-	s.resource[name] = append(s.resource[name], chain{resource, c})
-}
-
-func (s *inmemory) AddNameSpaceChain(name Name, namespace string, c *Chain) {
-	s.namespace[name] = append(s.namespace[name], chain{namespace, c})
-}
-
-func (s *inmemory) AddOverride(name Name, c *Chain) {
-	s.local[name] = append(s.local[name], c)
-}
-
-func (s *inmemory) GetOverride(name Name, chainID ChainID) (chain *Chain, found bool) {
-	chains := s.local[name]
-
-	for _, chain = range chains {
-		if chain.ID == chainID {
-			found = true
-			return
-		}
-	}
-
-	return
-}
-
-func (s *inmemory) RemoveOverride(name Name, chainID ChainID) (found bool) {
-	chains := s.local[name]
-
-	for i, chain := range chains {
-		if chain.ID == chainID {
-			s.local[name] = append(chains[:i], chains[i+1:]...)
-			found = true
-			return
-		}
-	}
-
-	return
-}
-
-func (s *inmemory) ListOverrides(name Name) []*Chain {
-	return s.local[name]
-}

inmemory_test.go

@@ -1,166 +0,0 @@
-package policyengine
-
-import (
-	"testing"
-
-	"github.com/stretchr/testify/require"
-)
-
-func TestInmemory(t *testing.T) {
-	const (
-		object    = "native::object::abc/xyz"
-		container = "native::object::abc/*"
-		namespace = "Tenant1"
-		actor1    = "owner1"
-		actor2    = "owner2"
-	)
-
-	s := NewInMemory()
-
-	// Object which was put via S3.
-	res := newResource(object, map[string]string{"FromS3": "true"})
-	// Request initiating from the trusted subnet and actor.
-	reqGood := newRequest("native::object::put", res, map[string]string{
-		"SourceIP": "10.1.1.12",
-		"Actor":    actor1,
-	})
-
-	status, ok := s.IsAllowed(Ingress, namespace, reqGood)
-	require.Equal(t, NoRuleFound, status)
-	require.False(t, ok)
-
-	s.AddNameSpaceChain(Ingress, namespace, &Chain{
-		Rules: []Rule{
-			{ // Restrict to remove ANY object from the namespace.
-				Status:   AccessDenied,
-				Action:   []string{"native::object::delete"},
-				Resource: []string{"native::object::*"},
-			},
-			{ // Allow to put object only from the trusted subnet AND trusted actor, deny otherwise.
-				Status:   AccessDenied,
-				Action:   []string{"native::object::put"},
-				Resource: []string{"native::object::*"},
-				Any:      true,
-				Condition: []Condition{
-					{
-						Op:     CondStringNotLike,
-						Object: ObjectRequest,
-						Key:    "SourceIP",
-						Value:  "10.1.1.*",
-					},
-					{
-						Op:     CondStringNotEquals,
-						Object: ObjectRequest,
-						Key:    "Actor",
-						Value:  actor1,
-					},
-				},
-			},
-		},
-	})
-
-	s.AddResourceChain(Ingress, container, &Chain{
-		Rules: []Rule{
-			{ // Allow to actor2 to get objects from the specific container only if they have `Department=HR` attribute.
-				Status:   Allow,
-				Action:   []string{"native::object::get"},
-				Resource: []string{"native::object::abc/*"},
-				Condition: []Condition{
-					{
-						Op:     CondStringEquals,
-						Object: ObjectResource,
-						Key:    "Department",
-						Value:  "HR",
-					},
-					{
-						Op:     CondStringEquals,
-						Object: ObjectRequest,
-						Key:    "Actor",
-						Value:  actor2,
-					},
-				},
-			},
-		},
-	})
-
-	t.Run("bad subnet, namespace deny", func(t *testing.T) {
-		// Request initiating from the untrusted subnet.
-		reqBadIP := newRequest("native::object::put", res, map[string]string{
-			"SourceIP": "10.122.1.20",
-			"Actor":    actor1,
-		})
-		status, ok := s.IsAllowed(Ingress, namespace, reqBadIP)
-		require.Equal(t, AccessDenied, status)
-		require.True(t, ok)
-	})
-	t.Run("bad actor, namespace deny", func(t *testing.T) {
-		// Request initiating from the untrusted actor.
-		reqBadActor := newRequest("native::object::put", res, map[string]string{
-			"SourceIP": "10.1.1.13",
-			"Actor":    actor2,
-		})
-		status, ok := s.IsAllowed(Ingress, namespace, reqBadActor)
-		require.Equal(t, AccessDenied, status)
-		require.True(t, ok)
-	})
-	t.Run("bad object, container deny", func(t *testing.T) {
-		objGood := newResource("native::object::abc/id1", map[string]string{"Department": "HR"})
-		objBadAttr := newResource("native::object::abc/id2", map[string]string{"Department": "Support"})
-
-		status, ok := s.IsAllowed(Ingress, namespace, newRequest("native::object::get", objGood, map[string]string{
-			"SourceIP": "10.1.1.14",
-			"Actor":    actor2,
-		}))
-		require.Equal(t, Allow, status)
-		require.True(t, ok)
-
-		status, ok = s.IsAllowed(Ingress, namespace, newRequest("native::object::get", objBadAttr, map[string]string{
-			"SourceIP": "10.1.1.14",
-			"Actor":    actor2,
-		}))
-		require.Equal(t, NoRuleFound, status)
-		require.False(t, ok)
-	})
-	t.Run("bad operation, namespace deny", func(t *testing.T) {
-		// Request with the forbidden operation.
-		reqBadOperation := newRequest("native::object::delete", res, map[string]string{
-			"SourceIP": "10.1.1.12",
-			"Actor":    actor1,
-		})
-		status, ok := s.IsAllowed(Ingress, namespace, reqBadOperation)
-		require.Equal(t, AccessDenied, status)
-		require.True(t, ok)
-	})
-	t.Run("good", func(t *testing.T) {
-		status, ok = s.IsAllowed(Ingress, namespace, reqGood)
-		require.Equal(t, NoRuleFound, status)
-		require.False(t, ok)
-
-		t.Run("quota on a different container", func(t *testing.T) {
-			s.AddOverride(Ingress, &Chain{
-				Rules: []Rule{{
-					Status:   QuotaLimitReached,
-					Action:   []string{"native::object::put"},
-					Resource: []string{"native::object::cba/*"},
-				}},
-			})
-
-			status, ok = s.IsAllowed(Ingress, namespace, reqGood)
-			require.Equal(t, NoRuleFound, status)
-			require.False(t, ok)
-		})
-		t.Run("quota on the request container", func(t *testing.T) {
-			s.AddOverride(Ingress, &Chain{
-				Rules: []Rule{{
-					Status:   QuotaLimitReached,
-					Action:   []string{"native::object::put"},
-					Resource: []string{"native::object::abc/*"},
-				}},
-			})
-
-			status, ok = s.IsAllowed(Ingress, namespace, reqGood)
-			require.Equal(t, QuotaLimitReached, status)
-			require.True(t, ok)
-		})
-	})
-}

interface.go

@@ -1,18 +0,0 @@
-package policyengine
-
-// CachedChainStorage ...
-type CachedChainStorage interface {
-	Engine
-	// Adds a policy chain used for all operations with a specific resource.
-	AddResourceChain(name Name, resource string, c *Chain)
-	// Adds a policy chain used for all operations in the namespace.
-	AddNameSpaceChain(name Name, namespace string, c *Chain)
-	// Adds a local policy chain used for all operations with this service.
-	AddOverride(name Name, c *Chain)
-	// Gets the local override with given chain id.
-	GetOverride(name Name, chainID ChainID) (chain *Chain, found bool)
-	// Remove the local override with given chain id.
-	RemoveOverride(name Name, chainID ChainID) (removed bool)
-	// ListOverrides returns the list of local overrides.
-	ListOverrides(name Name) []*Chain
-}

pkg/chain/chain.go

@@ -0,0 +1,333 @@
+package chain
+
+import (
+	"fmt"
+	"net/netip"
+	"strings"
+
+	"git.frostfs.info/TrueCloudLab/policy-engine/pkg/resource"
+	"git.frostfs.info/TrueCloudLab/policy-engine/util"
+	"github.com/nspcc-dev/neo-go/pkg/encoding/fixedn"
+	"golang.org/x/exp/slices"
+)
+
+// ID is the ID of rule chain.
+type ID []byte
+
+// MatchType is the match type for chain rules.
+type MatchType uint8
+
+const (
+	// MatchTypeDenyPriority rejects the request if any `Deny` is specified.
+	MatchTypeDenyPriority MatchType = 0
+	// MatchTypeFirstMatch returns the first rule action matched to the request.
+	MatchTypeFirstMatch MatchType = 1
+)
+
+//easyjson:json
+type Chain struct {
+	ID ID
+
+	Rules []Rule
+
+	MatchType MatchType
+}
+
+func (c *Chain) Bytes() []byte {
+	data, err := c.MarshalBinary()
+	if err != nil {
+		panic(err)
+	}
+	return data
+}
+
+func (c *Chain) DecodeBytes(b []byte) error {
+	return c.UnmarshalBinary(b)
+}
+
+type Rule struct {
+	Status Status
+	// Actions the operation is applied to.
+	Actions Actions
+	// List of the resources the operation is applied to.
+	Resources Resources
+	// True iff individual conditions must be combined with the logical OR.
+	// By default AND is used, so _each_ condition must pass.
+	Any       bool
+	Condition []Condition
+}
+
+type Actions struct {
+	Inverted bool
+	Names    []string
+}
+
+type Resources struct {
+	Inverted bool
+	Names    []string
+}
+
+type Condition struct {
+	Op    ConditionType
+	Kind  ConditionKindType
+	Key   string
+	Value string
+}
+
+type ConditionKindType byte
+
+const (
+	KindResource ConditionKindType = iota
+	KindRequest
+)
+
+type ConditionType byte
+
+// TODO @fyrchik: reduce the number of conditions.
+// Everything from here should be expressable, but we do not need them all.
+// https://docs.aws.amazon.com/IAM/latest/UserGuide/reference_policies_elements_condition_operators.html
+const (
+	// String condition operators.
+	CondStringEquals ConditionType = iota
+	CondStringNotEquals
+	CondStringEqualsIgnoreCase
+	CondStringNotEqualsIgnoreCase
+	CondStringLike
+	CondStringNotLike
+	CondStringLessThan
+	CondStringLessThanEquals
+	CondStringGreaterThan
+	CondStringGreaterThanEquals
+
+	// Numeric condition operators.
+	CondNumericEquals
+	CondNumericNotEquals
+	CondNumericLessThan
+	CondNumericLessThanEquals
+	CondNumericGreaterThan
+	CondNumericGreaterThanEquals
+
+	CondSliceContains
+
+	CondIPAddress
+	CondNotIPAddress
+)
+
+var condToStr = []struct {
+	ct  ConditionType
+	str string
+}{
+	{CondStringEquals, "StringEquals"},
+	{CondStringNotEquals, "StringNotEquals"},
+	{CondStringEqualsIgnoreCase, "StringEqualsIgnoreCase"},
+	{CondStringNotEqualsIgnoreCase, "StringNotEqualsIgnoreCase"},
+	{CondStringLike, "StringLike"},
+	{CondStringNotLike, "StringNotLike"},
+	{CondStringLessThan, "StringLessThan"},
+	{CondStringLessThanEquals, "StringLessThanEquals"},
+	{CondStringGreaterThan, "StringGreaterThan"},
+	{CondStringGreaterThanEquals, "StringGreaterThanEquals"},
+	{CondNumericEquals, "NumericEquals"},
+	{CondNumericNotEquals, "NumericNotEquals"},
+	{CondNumericLessThan, "NumericLessThan"},
+	{CondNumericLessThanEquals, "NumericLessThanEquals"},
+	{CondNumericGreaterThan, "NumericGreaterThan"},
+	{CondNumericGreaterThanEquals, "NumericGreaterThanEquals"},
+	{CondSliceContains, "SliceContains"},
+	{CondIPAddress, "IPAddress"},
+	{CondNotIPAddress, "NotIPAddress"},
+}
+
+func (c ConditionType) String() string {
+	for _, v := range condToStr {
+		if v.ct == c {
+			return v.str
+		}
+	}
+	return "unknown condition type"
+}
+
+const condSliceContainsDelimiter = "\x00"
+
+// FormCondSliceContainsValue builds value for ObjectResource or ObjectRequest property
+// that can be matched by CondSliceContains condition.
+func FormCondSliceContainsValue(values []string) string {
+	return strings.Join(values, condSliceContainsDelimiter)
+}
+
+func (c *Condition) Match(req resource.Request) bool {
+	var val string
+	switch c.Kind {
+	case KindResource:
+		val = req.Resource().Property(c.Key)
+	case KindRequest:
+		val = req.Property(c.Key)
+	default:
+		panic(fmt.Sprintf("unknown condition type: %d", c.Kind))
+	}
+
+	switch c.Op {
+	default:
+		panic(fmt.Sprintf("unimplemented: %d", c.Op))
+	case CondStringEquals:
+		return val == c.Value
+	case CondStringNotEquals:
+		return val != c.Value
+	case CondStringEqualsIgnoreCase:
+		return strings.EqualFold(val, c.Value)
+	case CondStringNotEqualsIgnoreCase:
+		return !strings.EqualFold(val, c.Value)
+	case CondStringLike:
+		return util.GlobMatch(val, c.Value)
+	case CondStringNotLike:
+		return !util.GlobMatch(val, c.Value)
+	case CondStringLessThan:
+		return val < c.Value
+	case CondStringLessThanEquals:
+		return val <= c.Value
+	case CondStringGreaterThan:
+		return val > c.Value
+	case CondStringGreaterThanEquals:
+		return val >= c.Value
+	case CondSliceContains:
+		return slices.Contains(strings.Split(val, condSliceContainsDelimiter), c.Value)
+	case CondNumericEquals, CondNumericNotEquals, CondNumericLessThan, CondNumericLessThanEquals, CondNumericGreaterThan,
+		CondNumericGreaterThanEquals:
+		return c.matchNumeric(val)
+	case CondIPAddress, CondNotIPAddress:
+		return c.matchIP(val)
+	}
+}
+
+func (c *Condition) matchNumeric(val string) bool {
+	valDecimal, err := fixedn.Fixed8FromString(val)
+	if err != nil {
+		return c.Op == CondNumericNotEquals
+	}
+
+	condVal, err := fixedn.Fixed8FromString(c.Value)
+	if err != nil {
+		return c.Op == CondNumericNotEquals
+	}
+
+	switch c.Op {
+	default:
+		panic(fmt.Sprintf("unimplemented: %d", c.Op))
+	case CondNumericEquals:
+		return valDecimal.Equal(condVal)
+	case CondNumericNotEquals:
+		return !valDecimal.Equal(condVal)
+	case CondNumericLessThan:
+		return valDecimal.LessThan(condVal)
+	case CondNumericLessThanEquals:
+		return valDecimal.LessThan(condVal) || valDecimal.Equal(condVal)
+	case CondNumericGreaterThan:
+		return valDecimal.GreaterThan(condVal)
+	case CondNumericGreaterThanEquals:
+		return valDecimal.GreaterThan(condVal) || valDecimal.Equal(condVal)
+	}
+}
+
+func (c *Condition) matchIP(val string) bool {
+	ipAddr, err := netip.ParseAddr(val)
+	if err != nil {
+		return false
+	}
+
+	prefix, err := netip.ParsePrefix(c.Value)
+	if err != nil {
+		return false
+	}
+
+	switch c.Op {
+	default:
+		panic(fmt.Sprintf("unimplemented: %d", c.Op))
+	case CondIPAddress:
+		return prefix.Contains(ipAddr)
+	case CondNotIPAddress:
+		return !prefix.Contains(ipAddr)
+	}
+}
+
+func (r *Rule) Match(req resource.Request) (status Status, matched bool) {
+	found := len(r.Resources.Names) == 0
+	for i := range r.Resources.Names {
+		if util.GlobMatch(req.Resource().Name(), r.Resources.Names[i]) != r.Resources.Inverted {
+			found = true
+			break
+		}
+	}
+	if !found {
+		return NoRuleFound, false
+	}
+	for i := range r.Actions.Names {
+		if util.GlobMatch(req.Operation(), r.Actions.Names[i]) != r.Actions.Inverted {
+			return r.matchCondition(req)
+		}
+	}
+	return NoRuleFound, false
+}
+
+func (r *Rule) matchCondition(obj resource.Request) (status Status, matched bool) {
+	if r.Any {
+		return r.matchAny(obj)
+	}
+	return r.matchAll(obj)
+}
+
+func (r *Rule) matchAny(obj resource.Request) (status Status, matched bool) {
+	for i := range r.Condition {
+		if r.Condition[i].Match(obj) {
+			return r.Status, true
+		}
+	}
+	return NoRuleFound, false
+}
+
+func (r *Rule) matchAll(obj resource.Request) (status Status, matched bool) {
+	for i := range r.Condition {
+		if !r.Condition[i].Match(obj) {
+			return NoRuleFound, false
+		}
+	}
+	return r.Status, true
+}
+
+func (c *Chain) Match(req resource.Request) (status Status, matched bool) {
+	switch c.MatchType {
+	case MatchTypeDenyPriority:
+		return c.denyPriority(req)
+	case MatchTypeFirstMatch:
+		return c.firstMatch(req)
+	default:
+		panic(fmt.Sprintf("unknown MatchType %d", c.MatchType))
+	}
+}
+
+func (c *Chain) firstMatch(req resource.Request) (status Status, matched bool) {
+	for i := range c.Rules {
+		status, matched := c.Rules[i].Match(req)
+		if matched {
+			return status, true
+		}
+	}
+	return NoRuleFound, false
+}
+
+func (c *Chain) denyPriority(req resource.Request) (status Status, matched bool) {
+	var allowFound bool
+	for i := range c.Rules {
+		status, matched := c.Rules[i].Match(req)
+		if !matched {
+			continue
+		}
+		if status != Allow {
+			return status, true
+		}
+		allowFound = true
+	}
+	if allowFound {
+		return Allow, true
+	}
+	return NoRuleFound, false
+}

pkg/chain/chain_names.go

@@ -1,4 +1,4 @@
-package policyengine
+package chain
 
 // Name represents the place in the request lifecycle where policy is applied.
 type Name string
@@ -7,4 +7,7 @@ const (
 	// Ingress represents chains applied when crossing user/storage network boundary.
 	// It is not applied when talking between nodes.
 	Ingress Name = "ingress"
+
+	// S3 represents chains applied when crossing user/s3 network boundary.
+	S3 Name = "s3"
 )

pkg/chain/error.go

@@ -1,8 +1,8 @@
-package policyengine
+package chain
 
 import "fmt"
 
-// Status is the status for policy application
+// Status is the status for policy application.
 type Status byte
 
 const (

pkg/chain/marshal_binary.go

@@ -0,0 +1,257 @@
+package chain
+
+import (
+	"encoding"
+	"fmt"
+
+	"git.frostfs.info/TrueCloudLab/policy-engine/pkg/marshal"
+)
+
+const (
+	ChainMarshalVersion uint8 = 0 // increase if breaking change
+)
+
+var (
+	_ encoding.BinaryMarshaler   = (*Chain)(nil)
+	_ encoding.BinaryUnmarshaler = (*Chain)(nil)
+)
+
+func (c *Chain) MarshalBinary() ([]byte, error) {
+	s := marshal.UInt8Size // Marshaller version
+	s += marshal.UInt8Size // Chain version
+	s += marshal.SliceSize(c.ID, func(byte) int { return marshal.ByteSize })
+	s += marshal.SliceSize(c.Rules, ruleSize)
+	s += marshal.UInt8Size // MatchType
+
+	buf := make([]byte, s)
+	var offset int
+	var err error
+	offset, err = marshal.UInt8Marshal(buf, offset, marshal.Version)
+	if err != nil {
+		return nil, err
+	}
+	offset, err = marshal.UInt8Marshal(buf, offset, ChainMarshalVersion)
+	if err != nil {
+		return nil, err
+	}
+	offset, err = marshal.SliceMarshal(buf, offset, c.ID, marshal.ByteMarshal)
+	if err != nil {
+		return nil, err
+	}
+	offset, err = marshal.SliceMarshal(buf, offset, c.Rules, marshalRule)
+	if err != nil {
+		return nil, err
+	}
+	offset, err = marshal.UInt8Marshal(buf, offset, uint8(c.MatchType))
+	if err != nil {
+		return nil, err
+	}
+
+	if err := marshal.VerifyMarshal(buf, offset); err != nil {
+		return nil, err
+	}
+	return buf, nil
+}
+
+func (c *Chain) UnmarshalBinary(data []byte) error {
+	var offset int
+
+	marshallerVersion, offset, err := marshal.UInt8Unmarshal(data, offset)
+	if err != nil {
+		return err
+	}
+	if marshallerVersion != marshal.Version {
+		return fmt.Errorf("unsupported marshaller version %d", marshallerVersion)
+	}
+
+	chainVersion, offset, err := marshal.UInt8Unmarshal(data, offset)
+	if err != nil {
+		return err
+	}
+	if chainVersion != ChainMarshalVersion {
+		return fmt.Errorf("unsupported chain version %d", chainVersion)
+	}
+
+	idBytes, offset, err := marshal.SliceUnmarshal(data, offset, marshal.ByteUnmarshal)
+	if err != nil {
+		return err
+	}
+	c.ID = ID(idBytes)
+
+	c.Rules, offset, err = marshal.SliceUnmarshal(data, offset, unmarshalRule)
+	if err != nil {
+		return err
+	}
+
+	matchTypeV, offset, err := marshal.UInt8Unmarshal(data, offset)
+	if err != nil {
+		return err
+	}
+	c.MatchType = MatchType(matchTypeV)
+
+	return marshal.VerifyUnmarshal(data, offset)
+}
+
+func ruleSize(r Rule) int {
+	s := marshal.ByteSize // Status
+	s += actionsSize(r.Actions)
+	s += resourcesSize(r.Resources)
+	s += marshal.BoolSize // Any
+	s += marshal.SliceSize(r.Condition, conditionSize)
+	return s
+}
+
+func marshalRule(buf []byte, offset int, r Rule) (int, error) {
+	offset, err := marshal.ByteMarshal(buf, offset, byte(r.Status))
+	if err != nil {
+		return 0, err
+	}
+	offset, err = marshalActions(buf, offset, r.Actions)
+	if err != nil {
+		return 0, err
+	}
+	offset, err = marshalResources(buf, offset, r.Resources)
+	if err != nil {
+		return 0, err
+	}
+	offset, err = marshal.BoolMarshal(buf, offset, r.Any)
+	if err != nil {
+		return 0, err
+	}
+	return marshal.SliceMarshal(buf, offset, r.Condition, marshalCondition)
+}
+
+func unmarshalRule(buf []byte, offset int) (Rule, int, error) {
+	var r Rule
+	statusV, offset, err := marshal.ByteUnmarshal(buf, offset)
+	if err != nil {
+		return Rule{}, 0, err
+	}
+	r.Status = Status(statusV)
+
+	r.Actions, offset, err = unmarshalActions(buf, offset)
+	if err != nil {
+		return Rule{}, 0, err
+	}
+
+	r.Resources, offset, err = unmarshalResources(buf, offset)
+	if err != nil {
+		return Rule{}, 0, err
+	}
+
+	r.Any, offset, err = marshal.BoolUnmarshal(buf, offset)
+	if err != nil {
+		return Rule{}, 0, err
+	}
+
+	r.Condition, offset, err = marshal.SliceUnmarshal(buf, offset, unmarshalCondition)
+	if err != nil {
+		return Rule{}, 0, err
+	}
+
+	return r, offset, nil
+}
+
+func actionsSize(a Actions) int {
+	return marshal.BoolSize + // Inverted
+		marshal.SliceSize(a.Names, marshal.StringSize)
+}
+
+func marshalActions(buf []byte, offset int, a Actions) (int, error) {
+	offset, err := marshal.BoolMarshal(buf, offset, a.Inverted)
+	if err != nil {
+		return 0, err
+	}
+	return marshal.SliceMarshal(buf, offset, a.Names, marshal.StringMarshal)
+}
+
+func unmarshalActions(buf []byte, offset int) (Actions, int, error) {
+	var a Actions
+	var err error
+	a.Inverted, offset, err = marshal.BoolUnmarshal(buf, offset)
+	if err != nil {
+		return Actions{}, 0, err
+	}
+	a.Names, offset, err = marshal.SliceUnmarshal(buf, offset, marshal.StringUnmarshal)
+	if err != nil {
+		return Actions{}, 0, err
+	}
+	return a, offset, nil
+}
+
+func resourcesSize(r Resources) int {
+	return marshal.BoolSize + // Inverted
+		marshal.SliceSize(r.Names, marshal.StringSize)
+}
+
+func marshalResources(buf []byte, offset int, r Resources) (int, error) {
+	offset, err := marshal.BoolMarshal(buf, offset, r.Inverted)
+	if err != nil {
+		return 0, err
+	}
+	return marshal.SliceMarshal(buf, offset, r.Names, marshal.StringMarshal)
+}
+
+func unmarshalResources(buf []byte, offset int) (Resources, int, error) {
+	var r Resources
+	var err error
+	r.Inverted, offset, err = marshal.BoolUnmarshal(buf, offset)
+	if err != nil {
+		return Resources{}, 0, err
+	}
+	r.Names, offset, err = marshal.SliceUnmarshal(buf, offset, marshal.StringUnmarshal)
+	if err != nil {
+		return Resources{}, 0, err
+	}
+	return r, offset, nil
+}
+
+func conditionSize(c Condition) int {
+	return marshal.ByteSize + // Op
+		marshal.ByteSize + // Object
+		marshal.StringSize(c.Key) +
+		marshal.StringSize(c.Value)
+}
+
+func marshalCondition(buf []byte, offset int, c Condition) (int, error) {
+	offset, err := marshal.ByteMarshal(buf, offset, byte(c.Op))
+	if err != nil {
+		return 0, err
+	}
+	offset, err = marshal.ByteMarshal(buf, offset, byte(c.Kind))
+	if err != nil {
+		return 0, err
+	}
+	offset, err = marshal.StringMarshal(buf, offset, c.Key)
+	if err != nil {
+		return 0, err
+	}
+	return marshal.StringMarshal(buf, offset, c.Value)
+}
+
+func unmarshalCondition(buf []byte, offset int) (Condition, int, error) {
+	var c Condition
+	opV, offset, err := marshal.ByteUnmarshal(buf, offset)
+	if err != nil {
+		return Condition{}, 0, err
+	}
+	c.Op = ConditionType(opV)
+
+	obV, offset, err := marshal.ByteUnmarshal(buf, offset)
+	if err != nil {
+		return Condition{}, 0, err
+	}
+	c.Kind = ConditionKindType(obV)
+
+	c.Key, offset, err = marshal.StringUnmarshal(buf, offset)
+	if err != nil {
+		return Condition{}, 0, err
+	}
+
+	c.Value, offset, err = marshal.StringUnmarshal(buf, offset)
+	if err != nil {
+		return Condition{}, 0, err
+	}
+
+	return c, offset, nil
+}

pkg/chain/marshal_binary_test.go

@@ -0,0 +1,247 @@
+package chain
+
+import (
+	"fmt"
+	"testing"
+
+	"git.frostfs.info/TrueCloudLab/policy-engine/schema/native"
+	"github.com/google/uuid"
+	"github.com/stretchr/testify/require"
+)
+
+func TestChainMarshalling(t *testing.T) {
+	t.Parallel()
+	for _, id := range generateTestIDs() {
+		for _, rules := range generateTestRules() {
+			for _, matchType := range generateTestMatchTypes() {
+				performMarshalTest(t, id, rules, matchType)
+			}
+		}
+	}
+}
+
+func TestInvalidChainData(t *testing.T) {
+	var ch Chain
+	require.Error(t, ch.UnmarshalBinary(nil))
+	require.Error(t, ch.UnmarshalBinary([]byte{}))
+	require.Error(t, ch.UnmarshalBinary([]byte{1, 2, 3}))
+	require.Error(t, ch.UnmarshalBinary([]byte("\x00\x00:aws:iam::namespace:group/so\x82\x82\x82\x82\x82\x82u\x82")))
+}
+
+func performMarshalTest(t *testing.T, id ID, r []Rule, mt MatchType) {
+	chain := Chain{
+		ID:        id,
+		Rules:     r,
+		MatchType: mt,
+	}
+	data, err := chain.MarshalBinary()
+	require.NoError(t, err)
+
+	var unmarshalledChain Chain
+	require.NoError(t, unmarshalledChain.UnmarshalBinary(data))
+
+	require.Equal(t, chain, unmarshalledChain)
+}
+
+func generateTestIDs() []ID {
+	return []ID{
+		ID(""),
+		ID(uuid.New().String()),
+		ID("*::/"),
+		ID("avada kedavra"),
+		ID("arn:aws:iam::namespace:group/some_group"),
+		ID("$Object:homomorphicHash"),
+		ID("native:container/ns/9LPLUFZpEmfidG4n44vi2cjXKXSqWT492tCvLJiJ8W1J"),
+	}
+}
+
+func generateTestRules() [][]Rule {
+	result := [][]Rule{
+		nil,
+		{},
+		{},
+	}
+
+	for _, st := range generateTestStatuses() {
+		for _, act := range generateTestActions() {
+			for _, res := range generateTestResources() {
+				for _, cond := range generateTestConditions() {
+					result[2] = append(result[2], Rule{
+						Status:    st,
+						Actions:   act,
+						Resources: res,
+						Condition: cond,
+						Any:       true,
+					})
+					result[2] = append(result[2], Rule{
+						Status:    st,
+						Actions:   act,
+						Resources: res,
+						Condition: cond,
+					})
+				}
+			}
+		}
+	}
+
+	return result
+}
+
+func generateTestStatuses() []Status {
+	return []Status{
+		Allow,
+		NoRuleFound,
+		AccessDenied,
+		QuotaLimitReached,
+	}
+}
+
+func generateTestActions() []Actions {
+	return []Actions{
+		{
+			Inverted: true,
+			Names:    nil,
+		},
+		{
+			Names: nil,
+		},
+		{
+			Inverted: true,
+			Names:    []string{},
+		},
+		{
+			Names: []string{},
+		},
+		{
+			Inverted: true,
+			Names:    []string{native.MethodPutObject},
+		},
+		{
+			Names: []string{native.MethodPutObject},
+		},
+		{
+			Inverted: true,
+			Names:    []string{native.MethodPutObject, native.MethodDeleteContainer, native.MethodDeleteObject},
+		},
+		{
+			Names: []string{native.MethodPutObject, native.MethodDeleteContainer, native.MethodDeleteObject},
+		},
+	}
+}
+
+func generateTestResources() []Resources {
+	return []Resources{
+		{
+			Inverted: true,
+			Names:    nil,
+		},
+		{
+			Names: nil,
+		},
+		{
+			Inverted: true,
+			Names:    []string{},
+		},
+		{
+			Names: []string{},
+		},
+		{
+			Inverted: true,
+			Names:    []string{native.ResourceFormatAllObjects},
+		},
+		{
+			Names: []string{native.ResourceFormatAllObjects},
+		},
+		{
+			Inverted: true,
+			Names: []string{
+				native.ResourceFormatAllObjects,
+				fmt.Sprintf(native.ResourceFormatRootContainer, "9LPLUFZpEmfidG4n44vi2cjXKXSqWT492tCvLJiJ8W1J"),
+			},
+		},
+		{
+			Names: []string{
+				native.ResourceFormatAllObjects,
+				fmt.Sprintf(native.ResourceFormatRootContainer, "9LPLUFZpEmfidG4n44vi2cjXKXSqWT492tCvLJiJ8W1J"),
+			},
+		},
+	}
+}
+
+func generateTestConditions() [][]Condition {
+	result := [][]Condition{
+		nil,
+		{},
+		{},
+	}
+
+	for _, ct := range generateTestConditionTypes() {
+		for _, ot := range generateObjectTypes() {
+			result[2] = append(result[2], Condition{
+				Op:    ct,
+				Kind:  ot,
+				Key:   "",
+				Value: "",
+			})
+
+			result[2] = append(result[2], Condition{
+				Op:    ct,
+				Kind:  ot,
+				Key:   "key",
+				Value: "",
+			})
+
+			result[2] = append(result[2], Condition{
+				Op:    ct,
+				Kind:  ot,
+				Key:   "",
+				Value: "value",
+			})
+
+			result[2] = append(result[2], Condition{
+				Op:    ct,
+				Kind:  ot,
+				Key:   "key",
+				Value: "value",
+			})
+		}
+	}
+
+	return result
+}
+
+func generateTestConditionTypes() []ConditionType {
+	return []ConditionType{
+		CondStringEquals,
+		CondStringNotEquals,
+		CondStringEqualsIgnoreCase,
+		CondStringNotEqualsIgnoreCase,
+		CondStringLike,
+		CondStringNotLike,
+		CondStringLessThan,
+		CondStringLessThanEquals,
+		CondStringGreaterThan,
+		CondStringGreaterThanEquals,
+		CondNumericEquals,
+		CondNumericNotEquals,
+		CondNumericLessThan,
+		CondNumericLessThanEquals,
+		CondNumericGreaterThan,
+		CondNumericGreaterThanEquals,
+		CondSliceContains,
+	}
+}
+
+func generateObjectTypes() []ConditionKindType {
+	return []ConditionKindType{
+		KindResource,
+		KindRequest,
+	}
+}
+
+func generateTestMatchTypes() []MatchType {
+	return []MatchType{
+		MatchTypeDenyPriority,
+		MatchTypeFirstMatch,
+	}
+}

pkg/chain/marshal_fuzz.go

@@ -0,0 +1,13 @@
+//go:build gofuzz
+// +build gofuzz
+
+package chain
+
+func DoFuzzChainUnmarshalBinary(data []byte) int {
+	var ch Chain
+	err := ch.UnmarshalBinary(data)
+	if err != nil {
+		return 0
+	}
+	return 1
+}

pkg/chain/marshal_fuzz_test.go

@@ -0,0 +1,34 @@
+//go:build gofuzz
+// +build gofuzz
+
+package chain
+
+import (
+	"testing"
+
+	"github.com/stretchr/testify/require"
+)
+
+func FuzzUnmarshal(f *testing.F) {
+	for _, id := range generateTestIDs() {
+		for _, rules := range generateTestRules() {
+			for _, matchType := range generateTestMatchTypes() {
+
+				chain := Chain{
+					ID:        id,
+					Rules:     rules,
+					MatchType: matchType,
+				}
+				data, err := chain.MarshalBinary()
+				require.NoError(f, err)
+				f.Add(data)
+			}
+		}
+	}
+
+	f.Fuzz(func(t *testing.T, data []byte) {
+		require.NotPanics(t, func() {
+			DoFuzzChainUnmarshalBinary(data)
+		})
+	})
+}

pkg/chain/marshal_json.go

@@ -0,0 +1,145 @@
+package chain
+
+import (
+	"fmt"
+	"strconv"
+
+	jlexer "github.com/mailru/easyjson/jlexer"
+	jwriter "github.com/mailru/easyjson/jwriter"
+)
+
+// Run `make generate`` if types added or changed
+
+var matchTypeToJSONValue = []struct {
+	mt  MatchType
+	str string
+}{
+	{MatchTypeDenyPriority, "DenyPriority"},
+	{MatchTypeFirstMatch, "FirstMatch"},
+}
+
+var statusToJSONValue = []struct {
+	s   Status
+	str string
+}{
+	{Allow, "Allow"},
+	{NoRuleFound, "NoRuleFound"},
+	{AccessDenied, "AccessDenied"},
+	{QuotaLimitReached, "QuotaLimitReached"},
+}
+
+var objectTypeToJSONValue = []struct {
+	t   ConditionKindType
+	str string
+}{
+	{KindRequest, "Request"},
+	{KindResource, "Resource"},
+}
+
+func (mt MatchType) MarshalEasyJSON(w *jwriter.Writer) {
+	for _, p := range matchTypeToJSONValue {
+		if p.mt == mt {
+			w.String(p.str)
+			return
+		}
+	}
+	w.String(strconv.FormatUint(uint64(mt), 10))
+}
+
+func (mt *MatchType) UnmarshalEasyJSON(l *jlexer.Lexer) {
+	str := l.String()
+	for _, p := range matchTypeToJSONValue {
+		if p.str == str {
+			*mt = p.mt
+			return
+		}
+	}
+
+	v, err := strconv.ParseUint(str, 10, 8)
+	if err != nil {
+		l.AddError(fmt.Errorf("failed to parse match type: %w", err))
+		return
+	}
+	*mt = MatchType(v)
+}
+
+func (st Status) MarshalEasyJSON(w *jwriter.Writer) {
+	for _, p := range statusToJSONValue {
+		if p.s == st {
+			w.String(p.str)
+			return
+		}
+	}
+	w.String(strconv.FormatUint(uint64(st), 10))
+}
+
+func (st *Status) UnmarshalEasyJSON(l *jlexer.Lexer) {
+	str := l.String()
+	for _, p := range statusToJSONValue {
+		if p.str == str {
+			*st = p.s
+			return
+		}
+	}
+
+	v, err := strconv.ParseUint(str, 10, 8)
+	if err != nil {
+		l.AddError(fmt.Errorf("failed to parse status: %w", err))
+		return
+	}
+	*st = Status(v)
+}
+
+func (ot ConditionKindType) MarshalEasyJSON(w *jwriter.Writer) {
+	for _, p := range objectTypeToJSONValue {
+		if p.t == ot {
+			w.String(p.str)
+			return
+		}
+	}
+	w.String(strconv.FormatUint(uint64(ot), 10))
+}
+
+func (ot *ConditionKindType) UnmarshalEasyJSON(l *jlexer.Lexer) {
+	str := l.String()
+	for _, p := range objectTypeToJSONValue {
+		if p.str == str {
+			*ot = p.t
+			return
+		}
+	}
+
+	v, err := strconv.ParseUint(str, 10, 8)
+	if err != nil {
+		l.AddError(fmt.Errorf("failed to parse object type: %w", err))
+		return
+	}
+	*ot = ConditionKindType(v)
+}
+
+func (ct ConditionType) MarshalEasyJSON(w *jwriter.Writer) {
+	for _, p := range condToStr {
+		if p.ct == ct {
+			w.String(p.str)
+			return
+		}
+	}
+	w.String(strconv.FormatUint(uint64(ct), 10))
+}
+
+func (ct *ConditionType) UnmarshalEasyJSON(l *jlexer.Lexer) {
+	str := l.String()
+	for _, p := range condToStr {
+		if p.str == str {
+			*ct = p.ct
+			return
+		}
+	}
+
+	v, err := strconv.ParseUint(str, 10, 8)
+	if err != nil {
+		l.AddError(fmt.Errorf("failed to parse condition type: %w", err))
+		return
+	}
+	*ct = ConditionType(v)
+}

pkg/chain/marshal_json_test.go

@@ -0,0 +1,121 @@
+package chain
+
+import (
+	"fmt"
+	"os"
+	"testing"
+
+	"git.frostfs.info/TrueCloudLab/policy-engine/schema/native"
+	"github.com/nspcc-dev/neo-go/pkg/crypto/keys"
+	"github.com/stretchr/testify/require"
+)
+
+func TestID(t *testing.T) {
+	key, err := keys.NewPrivateKeyFromWIF("L5eVx6HcHaFpQpvjQ3fy29uKDZ8rQ34bfMVx4XfZMm52EqafpNMg") // s3-gw key
+	require.NoError(t, err)
+
+	chain1 := &Chain{ID: ID(key.PublicKey().GetScriptHash().BytesBE())}
+	data := chain1.Bytes()
+
+	var chain2 Chain
+	require.NoError(t, chain2.DecodeBytes(data))
+
+	require.Equal(t, chain1.ID, chain2.ID)
+
+	data, err = chain1.MarshalJSON()
+	require.NoError(t, err)
+
+	require.NoError(t, chain2.UnmarshalJSON(data))
+
+	require.Equal(t, chain1.ID, chain2.ID)
+}
+
+func TestMatchTypeJson(t *testing.T) {
+	for _, mt := range []MatchType{MatchTypeDenyPriority, MatchTypeFirstMatch, MatchType(100)} {
+		var chain Chain
+		chain.MatchType = mt
+
+		data, err := chain.MarshalJSON()
+		require.NoError(t, err)
+		if mt == MatchTypeDenyPriority {
+			require.Equal(t, []byte("{\"ID\":null,\"Rules\":null,\"MatchType\":\"DenyPriority\"}"), data)
+		} else if mt == MatchTypeFirstMatch {
+			require.Equal(t, []byte("{\"ID\":null,\"Rules\":null,\"MatchType\":\"FirstMatch\"}"), data)
+		} else {
+			require.Equal(t, []byte(fmt.Sprintf("{\"ID\":null,\"Rules\":null,\"MatchType\":\"%d\"}", mt)), data)
+		}
+
+		var parsed Chain
+		require.NoError(t, parsed.UnmarshalJSON(data))
+		require.Equal(t, chain, parsed)
+
+		require.Error(t, parsed.UnmarshalJSON([]byte("{\"ID\":\"\",\"Rules\":null,\"MatchType\":\"NotValid\"}")))
+	}
+}
+
+func TestJsonEnums(t *testing.T) {
+	chain := Chain{
+		ID:        []byte("2cca5ae7-cee8-428d-b45f-567fb1d03f01"), // will be encoded to base64
+		MatchType: MatchTypeFirstMatch,
+		Rules: []Rule{
+			{
+				Status: AccessDenied,
+				Actions: Actions{
+					Names: []string{native.MethodDeleteObject, native.MethodGetContainer},
+				},
+				Resources: Resources{
+					Names: []string{native.ResourceFormatAllObjects},
+				},
+				Condition: []Condition{
+					{
+						Op:    CondStringEquals,
+						Kind:  KindRequest,
+						Key:   native.PropertyKeyActorRole,
+						Value: native.PropertyValueContainerRoleOthers,
+					},
+				},
+			},
+			{
+				Status: QuotaLimitReached,
+				Actions: Actions{
+					Inverted: true,
+					Names:    []string{native.MethodPutObject},
+				},
+				Resources: Resources{
+					Names: []string{fmt.Sprintf(native.ResourceFormatRootContainerObjects, "9LPLUFZpEmfidG4n44vi2cjXKXSqWT492tCvLJiJ8W1J")},
+				},
+				Any: true,
+				Condition: []Condition{
+					{
+						Op:    CondStringNotLike,
+						Kind:  KindResource,
+						Key:   native.PropertyKeyObjectType,
+						Value: "regular",
+					},
+				},
+			},
+			{
+				Status: Status(100),
+				Condition: []Condition{
+					{
+						Op:   ConditionType(255),
+						Kind: ConditionKindType(128),
+					},
+				},
+			},
+		},
+	}
+
+	data, err := chain.MarshalJSON()
+	require.NoError(t, err)
+
+	var parsed Chain
+	require.NoError(t, parsed.UnmarshalJSON(data))
+	require.Equal(t, chain, parsed)
+
+	expected, err := os.ReadFile("./testdata/test_status_json.json")
+	require.NoError(t, err)
+
+	require.NoError(t, parsed.UnmarshalJSON(expected))
+	require.Equal(t, chain, parsed)
+}

pkg/chain/testdata/test_status_json.json

@@ -0,0 +1,75 @@
+{
+    "ID": "MmNjYTVhZTctY2VlOC00MjhkLWI0NWYtNTY3ZmIxZDAzZjAx",
+    "Rules": [
+        {
+            "Status": "AccessDenied",
+            "Actions": {
+                "Inverted": false,
+                "Names": [
+                    "DeleteObject",
+                    "GetContainer"
+                ]
+            },
+            "Resources": {
+                "Inverted": false,
+                "Names": [
+                    "native:object/*"
+                ]
+            },
+            "Any": false,
+            "Condition": [
+                {
+                    "Op": "StringEquals",
+                    "Kind": "Request",
+                    "Key": "$Actor:role",
+                    "Value": "others"
+                }
+            ]
+        },
+        {
+            "Status": "QuotaLimitReached",
+            "Actions": {
+                "Inverted": true,
+                "Names": [
+                    "PutObject"
+                ]
+            },
+            "Resources": {
+                "Inverted": false,
+                "Names": [
+                    "native:object//9LPLUFZpEmfidG4n44vi2cjXKXSqWT492tCvLJiJ8W1J/*"
+                ]
+            },
+            "Any": true,
+            "Condition": [
+                {
+                    "Op": "StringNotLike",
+                    "Kind": "Resource",
+                    "Key": "$Object:objectType",
+                    "Value": "regular"
+                }
+            ]
+        },
+        {
+            "Status": "100",
+            "Actions": {
+                "Inverted": false,
+                "Names": null
+            },
+            "Resources": {
+                "Inverted": false,
+                "Names": null
+            },
+            "Any": false,
+            "Condition": [
+                {
+                    "Op": "255",
+                    "Kind": "128",
+                    "Key": "",
+                    "Value": ""
+                }
+            ]
+        }
+    ],
+    "MatchType": "FirstMatch"
+}

pkg/engine/chain_router.go

@@ -0,0 +1,109 @@
+package engine
+
+import (
+	"git.frostfs.info/TrueCloudLab/policy-engine/pkg/chain"
+	"git.frostfs.info/TrueCloudLab/policy-engine/pkg/resource"
+)
+
+type defaultChainRouter struct {
+	morph MorphRuleChainStorageReader
+
+	local LocalOverrideStorage
+}
+
+func NewDefaultChainRouter(morph MorphRuleChainStorageReader) ChainRouter {
+	return &defaultChainRouter{
+		morph: morph,
+	}
+}
+
+func NewDefaultChainRouterWithLocalOverrides(morph MorphRuleChainStorageReader, local LocalOverrideStorage) ChainRouter {
+	return &defaultChainRouter{
+		morph: morph,
+		local: local,
+	}
+}
+
+func (dr *defaultChainRouter) IsAllowed(name chain.Name, rt RequestTarget, r resource.Request) (status chain.Status, ruleFound bool, err error) {
+	status, ruleFound, err = dr.checkLocal(name, rt, r)
+	if err != nil {
+		return chain.NoRuleFound, false, err
+	} else if ruleFound {
+		// The local overrides have the highest priority and thus
+		// morph rules are not considered if a local one is found.
+		return
+	}
+
+	status, ruleFound, err = dr.checkMorph(name, rt, r)
+	return
+}
+
+func (dr *defaultChainRouter) checkLocal(name chain.Name, rt RequestTarget, r resource.Request) (status chain.Status, ruleFound bool, err error) {
+	if dr.local == nil {
+		return
+	}
+
+	var hasAllow bool
+	for _, target := range rt.Targets() {
+		status, ruleFound, err = dr.matchLocalOverrides(name, target, r)
+		if err != nil || ruleFound && status != chain.Allow {
+			return
+		}
+		hasAllow = hasAllow || ruleFound
+	}
+
+	if hasAllow {
+		return chain.Allow, true, nil
+	}
+	return chain.NoRuleFound, false, nil
+}
+
+func (dr *defaultChainRouter) checkMorph(name chain.Name, rt RequestTarget, r resource.Request) (status chain.Status, ruleFound bool, err error) {
+	var hasAllow bool
+	for _, target := range rt.Targets() {
+		status, ruleFound, err = dr.matchMorphRuleChains(name, target, r)
+		if err != nil || ruleFound && status != chain.Allow {
+			return
+		}
+		hasAllow = hasAllow || ruleFound
+	}
+
+	if hasAllow {
+		return chain.Allow, true, nil
+	}
+	return chain.NoRuleFound, false, nil
+}
+
+func (dr *defaultChainRouter) matchLocalOverrides(name chain.Name, target Target, r resource.Request) (status chain.Status, ruleFound bool, err error) {
+	localOverrides, err := dr.local.ListOverrides(name, target)
+	if err != nil {
+		return
+	}
+	status, ruleFound = dr.getStatusFromChains(localOverrides, r)
+	return
+}
+
+func (dr *defaultChainRouter) matchMorphRuleChains(name chain.Name, target Target, r resource.Request) (status chain.Status, ruleFound bool, err error) {
+	namespaceChains, err := dr.morph.ListMorphRuleChains(name, target)
+	if err != nil {
+		return chain.NoRuleFound, false, err
+	}
+	status, ruleFound = dr.getStatusFromChains(namespaceChains, r)
+	return
+}
+
+func (dr *defaultChainRouter) getStatusFromChains(chains []*chain.Chain, r resource.Request) (chain.Status, bool) {
+	var allow bool
+	for _, c := range chains {
+		if status, found := c.Match(r); found {
+			if status != chain.Allow {
+				return status, true
+			}
+			allow = true
+		}
+	}
+	if allow {
+		return chain.Allow, true
+	}
+	return chain.NoRuleFound, false
+}

pkg/engine/errors.go

@@ -0,0 +1,10 @@
+package engine
+
+import "errors"
+
+var (
+	ErrUnknownTarget     = errors.New("unknown target type")
+	ErrChainNotFound     = errors.New("chain not found")
+	ErrChainNameNotFound = errors.New("chain name not found")
+	ErrResourceNotFound  = errors.New("resource not found")
+)

pkg/engine/inmemory/inmemory.go

@@ -0,0 +1,48 @@
+package inmemory
+
+import (
+	"git.frostfs.info/TrueCloudLab/policy-engine/pkg/chain"
+	"git.frostfs.info/TrueCloudLab/policy-engine/pkg/engine"
+	"git.frostfs.info/TrueCloudLab/policy-engine/pkg/resource"
+)
+
+type inmemory struct {
+	router engine.ChainRouter
+
+	morph engine.MorphRuleChainStorage
+
+	local engine.LocalOverrideStorage
+}
+
+// NewInMemoryLocalOverrides returns new inmemory instance of chain storage with
+// local overrides manager.
+func NewInMemoryLocalOverrides() engine.LocalOverrideEngine {
+	morph := NewInmemoryMorphRuleChainStorage()
+	local := NewInmemoryLocalStorage()
+	return &inmemory{
+		router: engine.NewDefaultChainRouterWithLocalOverrides(morph, local),
+		morph:  morph,
+		local:  local,
+	}
+}
+
+// NewInMemory returns new inmemory instance of chain storage.
+func NewInMemory() engine.Engine {
+	morph := NewInmemoryMorphRuleChainStorage()
+	return &inmemory{
+		router: engine.NewDefaultChainRouter(morph),
+		morph:  morph,
+	}
+}
+
+func (im *inmemory) LocalStorage() engine.LocalOverrideStorage {
+	return im.local
+}
+
+func (im *inmemory) MorphRuleChainStorage() engine.MorphRuleChainStorage {
+	return im.morph
+}
+
+func (im *inmemory) IsAllowed(name chain.Name, rt engine.RequestTarget, r resource.Request) (status chain.Status, ruleFound bool, err error) {
+	return im.router.IsAllowed(name, rt, r)
+}

pkg/engine/inmemory/inmemory_test.go

@@ -0,0 +1,377 @@
+package inmemory
+
+import (
+	"bytes"
+	"testing"
+
+	"git.frostfs.info/TrueCloudLab/policy-engine/pkg/chain"
+	"git.frostfs.info/TrueCloudLab/policy-engine/pkg/engine"
+	resourcetest "git.frostfs.info/TrueCloudLab/policy-engine/pkg/resource/testutil"
+	"github.com/nspcc-dev/neo-go/pkg/vm/stackitem"
+	"github.com/stretchr/testify/require"
+)
+
+func TestAddRootOverrides(t *testing.T) {
+	s := NewInMemoryLocalOverrides()
+
+	target := engine.NamespaceTarget("")
+
+	id, err := s.LocalStorage().AddOverride(chain.S3, target, &chain.Chain{
+		Rules: []chain.Rule{{
+			Status:    chain.Allow,
+			Actions:   chain.Actions{Names: []string{"s3:PutObject"}},
+			Resources: chain.Resources{Names: []string{"*"}},
+		}},
+	})
+	require.NoError(t, err)
+
+	res, err := s.LocalStorage().ListOverrides(chain.S3, target)
+	require.NoError(t, err)
+	require.Len(t, res, 1)
+	require.Equal(t, string(id), string(res[0].ID))
+}
+
+func TestInmemory_MultipleTargets(t *testing.T) {
+	const op = "ape::test::op"
+
+	targets := []engine.Target{
+		engine.NamespaceTarget("ns1"),
+		engine.ContainerTarget("cnr1"),
+		engine.GroupTarget("group1"),
+		engine.UserTarget("user1"),
+	}
+	req := resourcetest.NewRequest(op, resourcetest.NewResource("r", nil), nil)
+	target := engine.NewRequestTargetExtended("ns1", "cnr1", "user1", []string{"group1"})
+	for _, tt := range targets {
+		t.Run("morph", func(t *testing.T) {
+			s := NewInMemoryLocalOverrides()
+			s.MorphRuleChainStorage().AddMorphRuleChain(chain.Ingress, tt, &chain.Chain{
+				Rules: []chain.Rule{{
+					Status:  chain.Allow,
+					Actions: chain.Actions{Names: []string{op}},
+				}},
+			})
+
+			status, found, err := s.IsAllowed(chain.Ingress, target, req)
+			require.NoError(t, err)
+			require.True(t, found)
+			require.Equal(t, chain.Allow, status)
+		})
+		t.Run("override", func(t *testing.T) {
+			s := NewInMemoryLocalOverrides()
+			s.LocalStorage().AddOverride(chain.Ingress, tt, &chain.Chain{
+				Rules: []chain.Rule{{
+					Status:  chain.Allow,
+					Actions: chain.Actions{Names: []string{op}},
+				}},
+			})
+
+			status, found, err := s.IsAllowed(chain.Ingress, target, req)
+			require.NoError(t, err)
+			require.True(t, found)
+			require.Equal(t, chain.Allow, status)
+		})
+	}
+}
+
+func TestInmemory(t *testing.T) {
+	const (
+		object     = "native::object::abc/xyz"
+		container  = "native::object::abc/*"
+		namespace  = "Tenant1"
+		namespace2 = "Tenant2"
+		actor1     = "owner1"
+		actor2     = "owner2"
+	)
+
+	s := NewInMemoryLocalOverrides()
+
+	// Object which was put via S3.
+	res := resourcetest.NewResource(object, map[string]string{"FromS3": "true"})
+	// Request initiating from the trusted subnet and actor.
+	reqGood := resourcetest.NewRequest("native::object::put", res, map[string]string{
+		"SourceIP": "10.1.1.12",
+		"Actor":    actor1,
+	})
+
+	status, ok, _ := s.IsAllowed(chain.Ingress, engine.NewRequestTargetWithNamespace(namespace), reqGood)
+	require.Equal(t, chain.NoRuleFound, status)
+	require.False(t, ok)
+
+	s.MorphRuleChainStorage().AddMorphRuleChain(chain.Ingress, engine.NamespaceTarget(namespace), &chain.Chain{
+		Rules: []chain.Rule{
+			{ // Restrict to remove ANY object from the namespace.
+				Status:    chain.AccessDenied,
+				Actions:   chain.Actions{Names: []string{"native::object::delete"}},
+				Resources: chain.Resources{Names: []string{"native::object::*"}},
+			},
+			{ // Allow to put object only from the trusted subnet AND trusted actor, deny otherwise.
+				Status:    chain.AccessDenied,
+				Actions:   chain.Actions{Names: []string{"native::object::put"}},
+				Resources: chain.Resources{Names: []string{"native::object::*"}},
+				Any:       true,
+				Condition: []chain.Condition{
+					{
+						Op:    chain.CondStringNotLike,
+						Kind:  chain.KindRequest,
+						Key:   "SourceIP",
+						Value: "10.1.1.*",
+					},
+					{
+						Op:    chain.CondStringNotEquals,
+						Kind:  chain.KindRequest,
+						Key:   "Actor",
+						Value: actor1,
+					},
+				},
+			},
+		},
+	})
+
+	_, it, err := s.MorphRuleChainStorage().ListTargetsIterator(engine.Namespace)
+	require.NoError(t, err)
+	itemStacksEqual(t, it.Values, toStackItems(namespace))
+
+	s.MorphRuleChainStorage().AddMorphRuleChain(chain.Ingress, engine.NamespaceTarget(namespace2), &chain.Chain{
+		Rules: []chain.Rule{
+			{ // Deny all expect "native::object::get" for all objects expect "native::object::abc/xyz".
+				Status:    chain.AccessDenied,
+				Actions:   chain.Actions{Inverted: true, Names: []string{"native::object::get"}},
+				Resources: chain.Resources{Inverted: true, Names: []string{object}},
+			},
+		},
+	})
+
+	_, it, err = s.MorphRuleChainStorage().ListTargetsIterator(engine.Namespace)
+	require.NoError(t, err)
+	itemStacksEqual(t, it.Values, toStackItems(namespace, namespace2))
+
+	s.MorphRuleChainStorage().AddMorphRuleChain(chain.Ingress, engine.ContainerTarget(container), &chain.Chain{
+		Rules: []chain.Rule{
+			{ // Allow to actor2 to get objects from the specific container only if they have `Department=HR` attribute.
+				Status:    chain.Allow,
+				Actions:   chain.Actions{Names: []string{"native::object::get"}},
+				Resources: chain.Resources{Names: []string{"native::object::abc/*"}},
+				Condition: []chain.Condition{
+					{
+						Op:    chain.CondStringEquals,
+						Kind:  chain.KindResource,
+						Key:   "Department",
+						Value: "HR",
+					},
+					{
+						Op:    chain.CondStringEquals,
+						Kind:  chain.KindRequest,
+						Key:   "Actor",
+						Value: actor2,
+					},
+				},
+			},
+		},
+	})
+
+	_, it, err = s.MorphRuleChainStorage().ListTargetsIterator(engine.Namespace)
+	require.NoError(t, err)
+	itemStacksEqual(t, it.Values, toStackItems(namespace, namespace2))
+
+	_, it, err = s.MorphRuleChainStorage().ListTargetsIterator(engine.Container)
+	require.NoError(t, err)
+	itemStacksEqual(t, it.Values, toStackItems(container))
+
+	t.Run("bad subnet, namespace deny", func(t *testing.T) {
+		// Request initiating from the untrusted subnet.
+		reqBadIP := resourcetest.NewRequest("native::object::put", res, map[string]string{
+			"SourceIP": "10.122.1.20",
+			"Actor":    actor1,
+		})
+		status, ok, _ := s.IsAllowed(chain.Ingress, engine.NewRequestTarget(namespace, container), reqBadIP)
+		require.Equal(t, chain.AccessDenied, status)
+		require.True(t, ok)
+	})
+	t.Run("bad actor, namespace deny", func(t *testing.T) {
+		// Request initiating from the untrusted actor.
+		reqBadActor := resourcetest.NewRequest("native::object::put", res, map[string]string{
+			"SourceIP": "10.1.1.13",
+			"Actor":    actor2,
+		})
+		status, ok, _ := s.IsAllowed(chain.Ingress, engine.NewRequestTarget(namespace, container), reqBadActor)
+		require.Equal(t, chain.AccessDenied, status)
+		require.True(t, ok)
+	})
+	t.Run("bad object, container deny", func(t *testing.T) {
+		objGood := resourcetest.NewResource("native::object::abc/id1", map[string]string{"Department": "HR"})
+		objBadAttr := resourcetest.NewResource("native::object::abc/id2", map[string]string{"Department": "Support"})
+
+		status, ok, _ := s.IsAllowed(chain.Ingress, engine.NewRequestTarget(namespace, container), resourcetest.NewRequest("native::object::get", objGood, map[string]string{
+			"SourceIP": "10.1.1.14",
+			"Actor":    actor2,
+		}))
+		require.Equal(t, chain.Allow, status)
+		require.True(t, ok)
+
+		status, ok, _ = s.IsAllowed(chain.Ingress, engine.NewRequestTarget(namespace, container), resourcetest.NewRequest("native::object::get", objBadAttr, map[string]string{
+			"SourceIP": "10.1.1.14",
+			"Actor":    actor2,
+		}))
+		require.Equal(t, chain.NoRuleFound, status)
+		require.False(t, ok)
+	})
+	t.Run("bad operation, namespace deny", func(t *testing.T) {
+		// Request with the forbidden operation.
+		reqBadOperation := resourcetest.NewRequest("native::object::delete", res, map[string]string{
+			"SourceIP": "10.1.1.12",
+			"Actor":    actor1,
+		})
+		status, ok, _ := s.IsAllowed(chain.Ingress, engine.NewRequestTarget(namespace, container), reqBadOperation)
+		require.Equal(t, chain.AccessDenied, status)
+		require.True(t, ok)
+	})
+	t.Run("inverted rules", func(t *testing.T) {
+		req := resourcetest.NewRequest("native::object::put", resourcetest.NewResource(object, nil), nil)
+		status, ok, _ = s.IsAllowed(chain.Ingress, engine.NewRequestTarget(namespace2, container), req)
+		require.Equal(t, chain.NoRuleFound, status)
+		require.False(t, ok)
+
+		req = resourcetest.NewRequest("native::object::put", resourcetest.NewResource("native::object::cba/def", nil), nil)
+		status, ok, _ = s.IsAllowed(chain.Ingress, engine.NewRequestTarget(namespace2, container), req)
+		require.Equal(t, chain.AccessDenied, status)
+		require.True(t, ok)
+
+		req = resourcetest.NewRequest("native::object::get", resourcetest.NewResource("native::object::cba/def", nil), nil)
+		status, ok, _ = s.IsAllowed(chain.Ingress, engine.NewRequestTarget(namespace2, container), req)
+		require.Equal(t, chain.NoRuleFound, status)
+		require.False(t, ok)
+	})
+	t.Run("good", func(t *testing.T) {
+		status, ok, _ = s.IsAllowed(chain.Ingress, engine.NewRequestTarget(namespace, container), reqGood)
+		require.Equal(t, chain.NoRuleFound, status)
+		require.False(t, ok)
+
+		t.Run("quota on a different container", func(t *testing.T) {
+			s.LocalStorage().AddOverride(chain.Ingress, engine.ContainerTarget(container), &chain.Chain{
+				Rules: []chain.Rule{{
+					Status:    chain.QuotaLimitReached,
+					Actions:   chain.Actions{Names: []string{"native::object::put"}},
+					Resources: chain.Resources{Names: []string{"native::object::cba/*"}},
+				}},
+			})
+
+			_, it, err = s.MorphRuleChainStorage().ListTargetsIterator(engine.Namespace)
+			require.NoError(t, err)
+			itemStacksEqual(t, it.Values, toStackItems(namespace, namespace2))
+
+			_, it, err = s.MorphRuleChainStorage().ListTargetsIterator(engine.Container)
+			require.NoError(t, err)
+			itemStacksEqual(t, it.Values, toStackItems(container))
+
+			status, ok, _ = s.IsAllowed(chain.Ingress, engine.NewRequestTarget(namespace, container), reqGood)
+			require.Equal(t, chain.NoRuleFound, status)
+			require.False(t, ok)
+		})
+
+		var quotaRuleChainID chain.ID
+		t.Run("quota on the request container", func(t *testing.T) {
+			quotaRuleChainID, _ = s.LocalStorage().AddOverride(chain.Ingress, engine.ContainerTarget(container), &chain.Chain{
+				Rules: []chain.Rule{{
+					Status:    chain.QuotaLimitReached,
+					Actions:   chain.Actions{Names: []string{"native::object::put"}},
+					Resources: chain.Resources{Names: []string{"native::object::abc/*"}},
+				}},
+			})
+
+			_, it, err = s.MorphRuleChainStorage().ListTargetsIterator(engine.Namespace)
+			require.NoError(t, err)
+			itemStacksEqual(t, it.Values, toStackItems(namespace, namespace2))
+
+			_, it, err = s.MorphRuleChainStorage().ListTargetsIterator(engine.Container)
+			require.NoError(t, err)
+			itemStacksEqual(t, it.Values, toStackItems(container))
+
+			status, ok, _ = s.IsAllowed(chain.Ingress, engine.NewRequestTarget(namespace, container), reqGood)
+			require.Equal(t, chain.QuotaLimitReached, status)
+			require.True(t, ok)
+		})
+		t.Run("removed quota on the request container", func(t *testing.T) {
+			err := s.LocalStorage().RemoveOverride(chain.Ingress, engine.ContainerTarget(container), quotaRuleChainID)
+			require.NoError(t, err)
+
+			_, it, err = s.MorphRuleChainStorage().ListTargetsIterator(engine.Namespace)
+			require.NoError(t, err)
+			itemStacksEqual(t, it.Values, toStackItems(namespace, namespace2))
+
+			_, it, err = s.MorphRuleChainStorage().ListTargetsIterator(engine.Container)
+			require.NoError(t, err)
+			itemStacksEqual(t, it.Values, toStackItems(container))
+
+			status, ok, _ = s.IsAllowed(chain.Ingress, engine.NewRequestTarget(namespace, container), reqGood)
+			require.Equal(t, chain.NoRuleFound, status)
+			require.False(t, ok)
+		})
+	})
+
+	t.Run("remove all", func(t *testing.T) {
+		s := NewInMemoryLocalOverrides()
+		_, _, err := s.MorphRuleChainStorage().AddMorphRuleChain(chain.Ingress, engine.NamespaceTarget(namespace), &chain.Chain{
+			Rules: []chain.Rule{
+				{
+					Status:    chain.AccessDenied,
+					Actions:   chain.Actions{Inverted: true, Names: []string{"native::object::get"}},
+					Resources: chain.Resources{Inverted: true, Names: []string{object}},
+				},
+			},
+		})
+		require.NoError(t, err)
+		_, _, err = s.MorphRuleChainStorage().AddMorphRuleChain(chain.Ingress, engine.NamespaceTarget(namespace2), &chain.Chain{
+			Rules: []chain.Rule{
+				{
+					Status:    chain.Allow,
+					Actions:   chain.Actions{Inverted: true, Names: []string{"native::object::get"}},
+					Resources: chain.Resources{Inverted: true, Names: []string{object}},
+				},
+			},
+		})
+		require.NoError(t, err)
+		_, _, err = s.MorphRuleChainStorage().AddMorphRuleChain(chain.Ingress, engine.NamespaceTarget(namespace2), &chain.Chain{
+			Rules: []chain.Rule{
+				{
+					Status:    chain.AccessDenied,
+					Actions:   chain.Actions{Inverted: true, Names: []string{"native::object::get"}},
+					Resources: chain.Resources{Inverted: true, Names: []string{object}},
+				},
+			},
+		})
+		require.NoError(t, err)
+		_, _, err = s.MorphRuleChainStorage().RemoveMorphRuleChainsByTarget(chain.Ingress, engine.NamespaceTarget(namespace2))
+		require.NoError(t, err)
+		chains, err := s.MorphRuleChainStorage().ListMorphRuleChains(chain.Ingress, engine.NamespaceTarget(namespace2))
+		require.NoError(t, err)
+		require.Equal(t, 0, len(chains))
+		chains, err = s.MorphRuleChainStorage().ListMorphRuleChains(chain.Ingress, engine.NamespaceTarget(namespace))
+		require.NoError(t, err)
+		require.Equal(t, 1, len(chains))
+	})
+}
+
+func itemStacksEqual(t *testing.T, got []stackitem.Item, expected []stackitem.Item) {
+next:
+	for _, exp := range expected {
+		expBytes, err := exp.TryBytes()
+		require.NoError(t, err)
+		for _, v := range got {
+			vBytes, err := v.TryBytes()
+			require.NoError(t, err)
+			if bytes.Equal(vBytes, expBytes) {
+				continue next
+			}
+		}
+		t.Fatalf("not found %s", exp)
+	}
+}
+
+func toStackItems(names ...string) []stackitem.Item {
+	var items []stackitem.Item
+	for _, name := range names {
+		items = append(items, stackitem.NewByteArray([]byte(name)))
+	}
+	return items
+}

pkg/engine/inmemory/local_storage.go

@@ -0,0 +1,180 @@
+package inmemory
+
+import (
+	"bytes"
+	"fmt"
+	"math/rand"
+	"strings"
+	"sync"
+
+	"git.frostfs.info/TrueCloudLab/policy-engine/pkg/chain"
+	"git.frostfs.info/TrueCloudLab/policy-engine/pkg/engine"
+	"git.frostfs.info/TrueCloudLab/policy-engine/util"
+)
+
+type targetToChain map[engine.Target][]*chain.Chain
+
+type inmemoryLocalStorage struct {
+	usedChainID          map[string]struct{}
+	nameToResourceChains map[chain.Name]targetToChain
+	guard                *sync.RWMutex
+}
+
+func NewInmemoryLocalStorage() engine.LocalOverrideStorage {
+	return &inmemoryLocalStorage{
+		usedChainID:          map[string]struct{}{},
+		nameToResourceChains: make(map[chain.Name]targetToChain),
+		guard:                &sync.RWMutex{},
+	}
+}
+
+func (s *inmemoryLocalStorage) generateChainID(name chain.Name, target engine.Target) chain.ID {
+	var id chain.ID
+	for {
+		suffix := rand.Uint32() % 100
+		sid := fmt.Sprintf("%s:%s/%d", name, target.Name, suffix)
+		sid = strings.ReplaceAll(sid, "*", "")
+		sid = strings.ReplaceAll(sid, "/", ":")
+		sid = strings.ReplaceAll(sid, "::", ":")
+		_, ok := s.usedChainID[sid]
+		if ok {
+			continue
+		}
+		s.usedChainID[sid] = struct{}{}
+
+		id = chain.ID(sid)
+		break
+	}
+	return id
+}
+
+func (s *inmemoryLocalStorage) AddOverride(name chain.Name, target engine.Target, c *chain.Chain) (chain.ID, error) {
+	s.guard.Lock()
+	defer s.guard.Unlock()
+
+	if target.Name == "" {
+		target.Name = "root"
+	}
+
+	// AddOverride assigns generated chain ID if it has not been assigned.
+	if len(c.ID) == 0 {
+		c.ID = s.generateChainID(name, target)
+	}
+	if s.nameToResourceChains[name] == nil {
+		s.nameToResourceChains[name] = make(targetToChain)
+	}
+	rc := s.nameToResourceChains[name]
+	for i := range rc[target] {
+		if bytes.Equal(rc[target][i].ID, c.ID) {
+			rc[target][i] = c
+			return c.ID, nil
+		}
+	}
+	rc[target] = append(rc[target], c)
+	return c.ID, nil
+}
+
+func (s *inmemoryLocalStorage) GetOverride(name chain.Name, target engine.Target, chainID chain.ID) (*chain.Chain, error) {
+	s.guard.RLock()
+	defer s.guard.RUnlock()
+
+	if _, ok := s.nameToResourceChains[name]; !ok {
+		return nil, engine.ErrChainNameNotFound
+	}
+	if target.Name == "" {
+		target.Name = "root"
+	}
+	chains, ok := s.nameToResourceChains[name][target]
+	if !ok {
+		return nil, engine.ErrResourceNotFound
+	}
+	for _, c := range chains {
+		if bytes.Equal(c.ID, chainID) {
+			return c, nil
+		}
+	}
+	return nil, engine.ErrChainNotFound
+}
+
+func (s *inmemoryLocalStorage) RemoveOverride(name chain.Name, target engine.Target, chainID chain.ID) error {
+	s.guard.Lock()
+	defer s.guard.Unlock()
+
+	if _, ok := s.nameToResourceChains[name]; !ok {
+		return engine.ErrChainNameNotFound
+	}
+	if target.Name == "" {
+		target.Name = "root"
+	}
+	chains, ok := s.nameToResourceChains[name][target]
+	if !ok {
+		return engine.ErrResourceNotFound
+	}
+	for i, c := range chains {
+		if bytes.Equal(c.ID, chainID) {
+			s.nameToResourceChains[name][target] = append(chains[:i], chains[i+1:]...)
+			return nil
+		}
+	}
+	return engine.ErrChainNotFound
+}
+
+func (s *inmemoryLocalStorage) RemoveOverridesByTarget(name chain.Name, target engine.Target) error {
+	s.guard.Lock()
+	defer s.guard.Unlock()
+
+	if _, ok := s.nameToResourceChains[name]; !ok {
+		return engine.ErrChainNameNotFound
+	}
+	if target.Name == "" {
+		target.Name = "root"
+	}
+	_, ok := s.nameToResourceChains[name][target]
+	if ok {
+		delete(s.nameToResourceChains[name], target)
+		return nil
+	}
+	return engine.ErrResourceNotFound
+}
+
+func (s *inmemoryLocalStorage) ListOverrides(name chain.Name, target engine.Target) ([]*chain.Chain, error) {
+	s.guard.RLock()
+	defer s.guard.RUnlock()
+
+	rcs, ok := s.nameToResourceChains[name]
+	if !ok {
+		return []*chain.Chain{}, nil
+	}
+	if target.Name == "" {
+		target.Name = "root"
+	}
+	for t, chains := range rcs {
+		if t.Type != target.Type {
+			continue
+		}
+		if !util.GlobMatch(target.Name, t.Name) {
+			continue
+		}
+		return chains, nil
+	}
+	return []*chain.Chain{}, nil
+}
+
+func (s *inmemoryLocalStorage) DropAllOverrides(name chain.Name) error {
+	s.guard.Lock()
+	defer s.guard.Unlock()
+
+	s.nameToResourceChains[name] = make(targetToChain)
+	return nil
+}
+
+func (s *inmemoryLocalStorage) ListOverrideDefinedTargets(name chain.Name) ([]engine.Target, error) {
+	s.guard.RLock()
+	defer s.guard.RUnlock()
+	ttc := s.nameToResourceChains[name]
+	var keys []engine.Target
+	for k := range ttc {
+		keys = append(keys, k)
+	}
+	return keys, nil
+}

pkg/engine/inmemory/local_storage_test.go

@@ -0,0 +1,268 @@
+package inmemory
+
+import (
+	"testing"
+
+	"git.frostfs.info/TrueCloudLab/policy-engine/pkg/chain"
+	"git.frostfs.info/TrueCloudLab/policy-engine/pkg/engine"
+	"github.com/stretchr/testify/require"
+)
+
+const (
+	container       = "native:::object/ExYw/*"
+	chainID         = "ingress:ExYw"
+	nonExistChainId = "ingress:LxGyWyL"
+)
+
+var resrc = engine.ContainerTarget(container)
+
+func testInmemLocalStorage() *inmemoryLocalStorage {
+	return NewInmemoryLocalStorage().(*inmemoryLocalStorage)
+}
+
+func TestAddOverride(t *testing.T) {
+	inmem := testInmemLocalStorage()
+
+	inmem.AddOverride(chain.Ingress, resrc, &chain.Chain{
+		Rules: []chain.Rule{
+			{
+				Status:    chain.AccessDenied,
+				Actions:   chain.Actions{Names: []string{"native::object::delete"}},
+				Resources: chain.Resources{Names: []string{"native::object::*"}},
+			},
+		},
+	})
+
+	ingressChains, ok := inmem.nameToResourceChains[chain.Ingress]
+	require.True(t, ok)
+	resourceChains, ok := ingressChains[resrc]
+	require.True(t, ok)
+	require.Len(t, resourceChains, 1)
+	require.Len(t, resourceChains[0].Rules, 1)
+
+	inmem.AddOverride(chain.Ingress, resrc, &chain.Chain{
+		Rules: []chain.Rule{
+			{
+				Status:    chain.QuotaLimitReached,
+				Actions:   chain.Actions{Names: []string{"native::object::put"}},
+				Resources: chain.Resources{Names: []string{"native::object::*"}},
+			},
+			{
+				Status:    chain.AccessDenied,
+				Actions:   chain.Actions{Names: []string{"native::object::get"}},
+				Resources: chain.Resources{Names: []string{"native::object::*"}},
+			},
+		},
+	})
+
+	ingressChains, ok = inmem.nameToResourceChains[chain.Ingress]
+	require.True(t, ok)
+	resourceChains, ok = ingressChains[resrc]
+	require.True(t, ok)
+	require.Len(t, resourceChains, 2)
+	require.Len(t, resourceChains[1].Rules, 2)
+}
+
+func TestRemoveOverride(t *testing.T) {
+	t.Run("remove from empty storage", func(t *testing.T) {
+		inmem := testInmemLocalStorage()
+		err := inmem.RemoveOverride(chain.Ingress, resrc, chain.ID(chainID))
+		require.ErrorIs(t, err, engine.ErrChainNameNotFound)
+	})
+
+	t.Run("remove not added chain id", func(t *testing.T) {
+		inmem := testInmemLocalStorage()
+		inmem.AddOverride(chain.Ingress, resrc, &chain.Chain{
+			ID: chain.ID(chainID),
+			Rules: []chain.Rule{
+				{ // Restrict to remove ANY object from the namespace.
+					Status:    chain.AccessDenied,
+					Actions:   chain.Actions{Names: []string{"native::object::delete"}},
+					Resources: chain.Resources{Names: []string{"native::object::*"}},
+				},
+			},
+		})
+
+		err := inmem.RemoveOverride(chain.Ingress, resrc, chain.ID(nonExistChainId))
+		require.ErrorIs(t, err, engine.ErrChainNotFound)
+	})
+
+	t.Run("remove existing chain id", func(t *testing.T) {
+		inmem := testInmemLocalStorage()
+		inmem.AddOverride(chain.Ingress, resrc, &chain.Chain{
+			ID: chain.ID(chainID),
+			Rules: []chain.Rule{
+				{ // Restrict to remove ANY object from the namespace.
+					Status:    chain.AccessDenied,
+					Actions:   chain.Actions{Names: []string{"native::object::delete"}},
+					Resources: chain.Resources{Names: []string{"native::object::*"}},
+				},
+			},
+		})
+
+		err := inmem.RemoveOverride(chain.Ingress, resrc, chain.ID(chainID))
+		require.NoError(t, err)
+
+		ingressChains, ok := inmem.nameToResourceChains[chain.Ingress]
+		require.True(t, ok)
+		require.Len(t, ingressChains, 1)
+		resourceChains, ok := ingressChains[resrc]
+		require.True(t, ok)
+		require.Len(t, resourceChains, 0)
+	})
+
+	t.Run("remove by target", func(t *testing.T) {
+		inmem := testInmemLocalStorage()
+		t0 := engine.ContainerTarget("name0")
+		t1 := engine.ContainerTarget("name1")
+		inmem.AddOverride(chain.Ingress, t0, &chain.Chain{
+			ID: chain.ID(chainID),
+			Rules: []chain.Rule{
+				{
+					Status:    chain.AccessDenied,
+					Actions:   chain.Actions{Names: []string{"native::object::delete"}},
+					Resources: chain.Resources{Names: []string{"native::object::*"}},
+				},
+			},
+		})
+		inmem.AddOverride(chain.Ingress, t0, &chain.Chain{
+			ID: chain.ID(chainID),
+			Rules: []chain.Rule{
+				{
+					Status:    chain.Allow,
+					Actions:   chain.Actions{Names: []string{"native::object::delete"}},
+					Resources: chain.Resources{Names: []string{"native::object::*"}},
+				},
+			},
+		})
+		inmem.AddOverride(chain.Ingress, t1, &chain.Chain{
+			ID: chain.ID(chainID),
+			Rules: []chain.Rule{
+				{
+					Status:    chain.Allow,
+					Actions:   chain.Actions{Names: []string{"native::object::delete"}},
+					Resources: chain.Resources{Names: []string{"native::object::*"}},
+				},
+			},
+		})
+
+		err := inmem.RemoveOverridesByTarget(chain.Ingress, t0)
+		require.NoError(t, err)
+
+		ingressChains, ok := inmem.nameToResourceChains[chain.Ingress]
+		require.True(t, ok)
+		require.Len(t, ingressChains, 1)
+		resourceChains, ok := ingressChains[t1]
+		require.True(t, ok)
+		require.Len(t, resourceChains, 1)
+	})
+}
+
+func TestGetOverride(t *testing.T) {
+	addChain := &chain.Chain{
+		ID: chain.ID(chainID),
+		Rules: []chain.Rule{
+			{ // Restrict to remove ANY object from the namespace.
+				Status:    chain.AccessDenied,
+				Actions:   chain.Actions{Names: []string{"native::object::delete"}},
+				Resources: chain.Resources{Names: []string{"native::object::*"}},
+			},
+		},
+	}
+
+	t.Run("get from empty storage", func(t *testing.T) {
+		inmem := testInmemLocalStorage()
+		_, err := inmem.GetOverride(chain.Ingress, resrc, chain.ID(chainID))
+		require.ErrorIs(t, err, engine.ErrChainNameNotFound)
+	})
+
+	t.Run("get not added chain id", func(t *testing.T) {
+		inmem := testInmemLocalStorage()
+		inmem.AddOverride(chain.Ingress, resrc, addChain)
+
+		const nonExistingChainID = "ingress:LxGyWyL"
+
+		_, err := inmem.GetOverride(chain.Ingress, resrc, chain.ID(nonExistingChainID))
+		require.ErrorIs(t, err, engine.ErrChainNotFound)
+	})
+
+	t.Run("get existing chain id", func(t *testing.T) {
+		inmem := testInmemLocalStorage()
+		inmem.AddOverride(chain.Ingress, resrc, addChain)
+
+		c, err := inmem.GetOverride(chain.Ingress, resrc, chain.ID(chainID))
+		require.NoError(t, err)
+		require.EqualValues(t, *addChain, *c)
+	})
+
+	t.Run("get removed chain id", func(t *testing.T) {
+		inmem := testInmemLocalStorage()
+		inmem.AddOverride(chain.Ingress, resrc, addChain)
+
+		err := inmem.RemoveOverride(chain.Ingress, resrc, chain.ID(chainID))
+		require.NoError(t, err)
+
+		_, err = inmem.GetOverride(chain.Ingress, resrc, chain.ID(chainID))
+		require.ErrorIs(t, err, engine.ErrChainNotFound)
+	})
+}
+
+func TestListOverrides(t *testing.T) {
+	addChain := &chain.Chain{
+		ID: chain.ID(chainID),
+		Rules: []chain.Rule{
+			{ // Restrict to remove ANY object from the namespace.
+				Status:    chain.AccessDenied,
+				Actions:   chain.Actions{Names: []string{"native::object::delete"}},
+				Resources: chain.Resources{Names: []string{"native::object::*"}},
+			},
+		},
+	}
+
+	t.Run("list empty storage", func(t *testing.T) {
+		inmem := testInmemLocalStorage()
+		l, _ := inmem.ListOverrides(chain.Ingress, resrc)
+		require.Len(t, l, 0)
+	})
+
+	t.Run("list with one added resource", func(t *testing.T) {
+		inmem := testInmemLocalStorage()
+		inmem.AddOverride(chain.Ingress, resrc, addChain)
+		l, _ := inmem.ListOverrides(chain.Ingress, resrc)
+		require.Len(t, l, 1)
+		targets, err := inmem.ListOverrideDefinedTargets(chain.Ingress)
+		require.NoError(t, err)
+		require.Equal(t, []engine.Target{resrc}, targets)
+	})
+
+	t.Run("list after drop", func(t *testing.T) {
+		inmem := testInmemLocalStorage()
+		inmem.AddOverride(chain.Ingress, resrc, addChain)
+		l, _ := inmem.ListOverrides(chain.Ingress, resrc)
+		require.Len(t, l, 1)
+
+		_ = inmem.DropAllOverrides(chain.Ingress)
+		l, _ = inmem.ListOverrides(chain.Ingress, resrc)
+		require.Len(t, l, 0)
+	})
+}
+
+func TestGenerateID(t *testing.T) {
+	inmem := testInmemLocalStorage()
+	ids := make([]chain.ID, 0, 100)
+	for i := 0; i < 100; i++ {
+		ids = append(ids, inmem.generateChainID(chain.Ingress, resrc))
+	}
+	require.False(t, hasDuplicates(ids))
+}
+
+func hasDuplicates(ids []chain.ID) bool {
+	seen := make(map[string]bool)
+	for _, id := range ids {
+		if seen[string(id)] {
+			return true
+		}
+		seen[string(id)] = true
+	}
+	return false
+}

pkg/engine/inmemory/morph_storage.go

@@ -0,0 +1,112 @@
+package inmemory
+
+import (
+	"git.frostfs.info/TrueCloudLab/policy-engine/pkg/chain"
+	"git.frostfs.info/TrueCloudLab/policy-engine/pkg/engine"
+	"github.com/google/uuid"
+	"github.com/nspcc-dev/neo-go/pkg/neorpc/result"
+	"github.com/nspcc-dev/neo-go/pkg/util"
+	"github.com/nspcc-dev/neo-go/pkg/vm/stackitem"
+)
+
+type inmemoryMorphRuleChainStorage struct {
+	storage engine.LocalOverrideStorage
+}
+
+func NewInmemoryMorphRuleChainStorage() engine.MorphRuleChainStorage {
+	return &inmemoryMorphRuleChainStorage{
+		storage: NewInmemoryLocalStorage(),
+	}
+}
+
+func (s *inmemoryMorphRuleChainStorage) AddMorphRuleChain(name chain.Name, target engine.Target, c *chain.Chain) (_ util.Uint256, _ uint32, err error) {
+	switch target.Type {
+	case engine.Namespace, engine.Container, engine.User, engine.Group:
+		_, err = s.storage.AddOverride(name, target, c)
+	default:
+		err = engine.ErrUnknownTarget
+	}
+	return
+}
+
+func (s *inmemoryMorphRuleChainStorage) RemoveMorphRuleChain(name chain.Name, target engine.Target, chainID chain.ID) (_ util.Uint256, _ uint32, err error) {
+	switch target.Type {
+	case engine.Namespace, engine.Container, engine.User, engine.Group:
+		err = s.storage.RemoveOverride(name, target, chainID)
+	default:
+		err = engine.ErrUnknownTarget
+	}
+	return
+}
+
+func (s *inmemoryMorphRuleChainStorage) RemoveMorphRuleChainsByTarget(name chain.Name, target engine.Target) (_ util.Uint256, _ uint32, err error) {
+	switch target.Type {
+	case engine.Namespace, engine.Container, engine.User, engine.Group:
+		err = s.storage.RemoveOverridesByTarget(name, target)
+	default:
+		err = engine.ErrUnknownTarget
+	}
+	return
+}
+
+func (s *inmemoryMorphRuleChainStorage) ListMorphRuleChains(name chain.Name, target engine.Target) ([]*chain.Chain, error) {
+	switch target.Type {
+	case engine.Namespace, engine.Container, engine.User, engine.Group:
+		return s.storage.ListOverrides(name, target)
+	default:
+	}
+	return nil, engine.ErrUnknownTarget
+}
+
+func (s *inmemoryMorphRuleChainStorage) GetAdmin() (util.Uint160, error) {
+	panic("not implemented")
+}
+
+func (s *inmemoryMorphRuleChainStorage) SetAdmin(_ util.Uint160) (util.Uint256, uint32, error) {
+	panic("not implemented")
+}
+
+func (s *inmemoryMorphRuleChainStorage) ListTargetsIterator(targetType engine.TargetType) (uuid uuid.UUID, it result.Iterator, err error) {
+	it.Values = make([]stackitem.Item, 0)
+
+	switch targetType {
+	case engine.Namespace:
+		// Listing targets may look bizarre, because inmemory rule chain storage use inmemory local overrides where
+		// targets are listed by chain names.
+		var targets []engine.Target
+		targets, err = s.storage.ListOverrideDefinedTargets(chain.Ingress)
+		if err != nil {
+			return
+		}
+		for _, t := range targets {
+			it.Values = append(it.Values, stackitem.NewByteArray([]byte(t.Name)))
+		}
+
+		targets, err = s.storage.ListOverrideDefinedTargets(chain.S3)
+		if err != nil {
+			return
+		}
+		for _, t := range targets {
+			it.Values = append(it.Values, stackitem.NewByteArray([]byte(t.Name)))
+		}
+	case engine.Container:
+		var targets []engine.Target
+		targets, err = s.storage.ListOverrideDefinedTargets(chain.Ingress)
+		if err != nil {
+			return
+		}
+		for _, t := range targets {
+			it.Values = append(it.Values, stackitem.NewByteArray([]byte(t.Name)))
+		}
+
+		targets, err = s.storage.ListOverrideDefinedTargets(chain.S3)
+		if err != nil {
+			return
+		}
+		for _, t := range targets {
+			it.Values = append(it.Values, stackitem.NewByteArray([]byte(t.Name)))
+		}
+	default:
+	}
+	return
+}

pkg/engine/interface.go

@@ -0,0 +1,185 @@
+package engine
+
+import (
+	"git.frostfs.info/TrueCloudLab/policy-engine/pkg/chain"
+	"git.frostfs.info/TrueCloudLab/policy-engine/pkg/resource"
+	"github.com/google/uuid"
+	"github.com/nspcc-dev/neo-go/pkg/neorpc/result"
+	"github.com/nspcc-dev/neo-go/pkg/util"
+)
+
+type ChainRouter interface {
+	// IsAllowed returns status for the operation after all checks.
+	// The second return value signifies whether a matching rule was found.
+	IsAllowed(name chain.Name, reqTarget RequestTarget, r resource.Request) (status chain.Status, found bool, err error)
+}
+
+// LocalOverrideStorage is the interface to manage local overrides defined
+// for a node. Local overrides have a higher priority than chains got from morph storage.
+type LocalOverrideStorage interface {
+	AddOverride(name chain.Name, target Target, c *chain.Chain) (chain.ID, error)
+
+	GetOverride(name chain.Name, target Target, chainID chain.ID) (*chain.Chain, error)
+
+	RemoveOverride(name chain.Name, target Target, chainID chain.ID) error
+
+	RemoveOverridesByTarget(name chain.Name, target Target) error
+
+	ListOverrides(name chain.Name, target Target) ([]*chain.Chain, error)
+
+	DropAllOverrides(name chain.Name) error
+
+	ListOverrideDefinedTargets(name chain.Name) ([]Target, error)
+}
+
+type TargetType rune
+
+const (
+	Namespace TargetType = 'n'
+	Container TargetType = 'c'
+	User      TargetType = 'u'
+	Group     TargetType = 'g'
+)
+
+type Target struct {
+	Type TargetType
+	Name string
+}
+
+// RequestTarget combines several targets on which the request is performed.
+type RequestTarget struct {
+	Namespace *Target
+	Container *Target
+	User      *Target
+	Groups    []Target
+}
+
+func NewRequestTargetWithNamespace(namespace string) RequestTarget {
+	nt := NamespaceTarget(namespace)
+	return RequestTarget{
+		Namespace: &nt,
+	}
+}
+
+func NewRequestTargetWithContainer(container string) RequestTarget {
+	ct := ContainerTarget(container)
+	return RequestTarget{
+		Container: &ct,
+	}
+}
+
+func NewRequestTarget(namespace, container string) RequestTarget {
+	nt := NamespaceTarget(namespace)
+	ct := ContainerTarget(container)
+	return RequestTarget{
+		Namespace: &nt,
+		Container: &ct,
+	}
+}
+
+func NewRequestTargetExtended(namespace, container, user string, groups []string) RequestTarget {
+	nt := NamespaceTarget(namespace)
+	ct := ContainerTarget(container)
+	u := UserTarget(user)
+	rt := RequestTarget{
+		Namespace: &nt,
+		Container: &ct,
+		User:      &u,
+	}
+	if len(groups) != 0 {
+		rt.Groups = make([]Target, len(groups))
+		for i := range groups {
+			rt.Groups[i] = GroupTarget(groups[i])
+		}
+	}
+	return rt
+}
+
+func (rt *RequestTarget) Targets() (targets []Target) {
+	if rt.Namespace != nil {
+		targets = append(targets, *rt.Namespace)
+	}
+	if rt.Container != nil {
+		targets = append(targets, *rt.Container)
+	}
+	if rt.User != nil {
+		targets = append(targets, *rt.User)
+	}
+	if len(rt.Groups) != 0 {
+		targets = append(targets, rt.Groups...)
+	}
+	return
+}
+
+func NamespaceTarget(namespace string) Target {
+	return Target{
+		Type: Namespace,
+		Name: namespace,
+	}
+}
+
+func ContainerTarget(container string) Target {
+	return Target{
+		Type: Container,
+		Name: container,
+	}
+}
+
+func UserTarget(user string) Target {
+	return Target{
+		Type: User,
+		Name: user,
+	}
+}
+
+func GroupTarget(group string) Target {
+	return Target{
+		Type: Group,
+		Name: group,
+	}
+}
+
+// MorphRuleChainStorageReader is the interface that provides read-only methods to receive
+// data like chains, target or admin from a chain storage.
+type MorphRuleChainStorageReader interface {
+	// ListMorphRuleChains just lists deserialized chains.
+	ListMorphRuleChains(name chain.Name, target Target) ([]*chain.Chain, error)
+
+	GetAdmin() (util.Uint160, error)
+
+	// ListTargetsIterator provides an iterator to list targets for which rules are defined.
+	ListTargetsIterator(targetType TargetType) (uuid.UUID, result.Iterator, error)
+}
+
+// MorphRuleChainStorage is the interface to read and manage data within a chain storage.
+// Basically, this implies that the storage manages rules stored in policy contract.
+type MorphRuleChainStorage interface {
+	MorphRuleChainStorageReader
+
+	// AddMorphRuleChain adds a chain rule to the policy contract and returns transaction hash, VUB and error.
+	AddMorphRuleChain(name chain.Name, target Target, c *chain.Chain) (util.Uint256, uint32, error)
+
+	// RemoveMorphRuleChain removes a chain rule to the policy contract and returns transaction hash, VUB and error.
+	RemoveMorphRuleChain(name chain.Name, target Target, chainID chain.ID) (util.Uint256, uint32, error)
+
+	// RemoveMorphRuleChainsByTarget removes all chains by target and returns transaction hash, VUB and error.
+	RemoveMorphRuleChainsByTarget(name chain.Name, target Target) (util.Uint256, uint32, error)
+
+	SetAdmin(addr util.Uint160) (util.Uint256, uint32, error)
+}
+
+// Engine is the interface that provides methods to check request permissions checking
+// chain rules from morph client - this implies using the policy contract.
+type Engine interface {
+	ChainRouter
+
+	MorphRuleChainStorage() MorphRuleChainStorage
+}
+
+// LocalOverrideEngine is extended Engine that also provides methods to manage a local
+// chain rule storage. Local overrides must have the highest priority during request checking.
+type LocalOverrideEngine interface {
+	Engine
+
+	LocalStorage() LocalOverrideStorage
+}

pkg/marshal/marshal.go

@@ -0,0 +1,267 @@
+package marshal
+
+import (
+	"encoding/binary"
+	"fmt"
+)
+
+const (
+	Version byte = 0 // increase if breaking change
+
+	ByteSize  int = 1
+	UInt8Size int = ByteSize
+	BoolSize  int = ByteSize
+
+	nilSlice     int64 = -1
+	nilSliceSize int   = 1
+
+	byteTrue  uint8 = 1
+	byteFalse uint8 = 0
+
+	// maxSliceLen taken from https://github.com/neo-project/neo/blob/38218bbee5bbe8b33cd8f9453465a19381c9a547/src/Neo/IO/Helper.cs#L77
+	maxSliceLen = 0x1000000
+)
+
+type MarshallerError struct {
+	errMsg string
+	offset int
+}
+
+func (e *MarshallerError) Error() string {
+	if e == nil {
+		return ""
+	}
+	if e.offset < 0 {
+		return e.errMsg
+	}
+	return fmt.Sprintf("%s (offset: %d)", e.errMsg, e.offset)
+}
+
+func errBufTooSmall(t string, marshal bool, offset int) error {
+	action := "unmarshal"
+	if marshal {
+		action = "marshal"
+	}
+	return &MarshallerError{
+		errMsg: fmt.Sprintf("not enough bytes left to %s value of type '%s'", action, t),
+		offset: offset,
+	}
+}
+
+func VerifyMarshal(buf []byte, lastOffset int) error {
+	if len(buf) != lastOffset {
+		return &MarshallerError{
+			errMsg: "actual data size differs from expected",
+			offset: -1,
+		}
+	}
+	return nil
+}
+
+func VerifyUnmarshal(buf []byte, lastOffset int) error {
+	if len(buf) != lastOffset {
+		return &MarshallerError{
+			errMsg: "unmarshalled bytes left",
+		}
+	}
+	return nil
+}
+
+func SliceSize[T any](slice []T, sizeOf func(T) int) int {
+	if slice == nil {
+		return nilSliceSize
+	}
+	s := Int64Size(int64(len(slice)))
+	for _, v := range slice {
+		s += sizeOf(v)
+	}
+	return s
+}
+
+func SliceMarshal[T any](buf []byte, offset int, slice []T, marshalT func([]byte, int, T) (int, error)) (int, error) {
+	if slice == nil {
+		return Int64Marshal(buf, offset, nilSlice)
+	}
+	if len(slice) > maxSliceLen {
+		return 0, &MarshallerError{
+			errMsg: fmt.Sprintf("slice size if too big: '%d'", len(slice)),
+			offset: offset,
+		}
+	}
+	offset, err := Int64Marshal(buf, offset, int64(len(slice)))
+	if err != nil {
+		return 0, err
+	}
+	for _, v := range slice {
+		offset, err = marshalT(buf, offset, v)
+		if err != nil {
+			return 0, err
+		}
+	}
+	return offset, nil
+}
+
+func SliceUnmarshal[T any](buf []byte, offset int, unmarshalT func(buf []byte, offset int) (T, int, error)) ([]T, int, error) {
+	size, offset, err := Int64Unmarshal(buf, offset)
+	if err != nil {
+		return nil, 0, err
+	}
+	if size == nilSlice {
+		return nil, offset, nil
+	}
+	if size > maxSliceLen {
+		return nil, 0, &MarshallerError{
+			errMsg: fmt.Sprintf("slice size if too big: '%d'", size),
+			offset: offset,
+		}
+	}
+	if size < 0 {
+		return nil, 0, &MarshallerError{
+			errMsg: fmt.Sprintf("invalid slice size: '%d'", size),
+			offset: offset,
+		}
+	}
+	result := make([]T, size)
+	for idx := 0; idx < len(result); idx++ {
+		result[idx], offset, err = unmarshalT(buf, offset)
+		if err != nil {
+			return nil, 0, err
+		}
+	}
+	return result, offset, nil
+}
+
+func Int64Size(v int64) int {
+	// https://cs.opensource.google/go/go/+/master:src/encoding/binary/varint.go;l=92;drc=dac9b9ddbd5160c5f4552410f5f8281bd5eed38c
+	// and
+	// https://cs.opensource.google/go/go/+/master:src/encoding/binary/varint.go;l=41;drc=dac9b9ddbd5160c5f4552410f5f8281bd5eed38c
+	ux := uint64(v) << 1
+	if v < 0 {
+		ux = ^ux
+	}
+	s := 0
+	for ux >= 0x80 {
+		s++
+		ux >>= 7
+	}
+	return s + 1
+}
+
+func Int64Marshal(buf []byte, offset int, v int64) (int, error) {
+	if len(buf)-offset < Int64Size(v) {
+		return 0, errBufTooSmall("int64", true, offset)
+	}
+	return offset + binary.PutVarint(buf[offset:], v), nil
+}
+
+func Int64Unmarshal(buf []byte, offset int) (int64, int, error) {
+	v, read := binary.Varint(buf[offset:])
+	if read == 0 {
+		return 0, 0, errBufTooSmall("int64", false, offset)
+	}
+	if read < 0 {
+		return 0, 0, &MarshallerError{
+			errMsg: "int64 unmarshal overflow",
+			offset: offset,
+		}
+	}
+	return v, offset + read, nil
+}
+
+func StringSize(s string) int {
+	return Int64Size(int64(len(s))) + len(s)
+}
+
+func StringMarshal(buf []byte, offset int, s string) (int, error) {
+	if len(s) > maxSliceLen {
+		return 0, &MarshallerError{
+			errMsg: fmt.Sprintf("string is too long: '%d'", len(s)),
+			offset: offset,
+		}
+	}
+	if len(buf)-offset < Int64Size(int64(len(s)))+len(s) {
+		return 0, errBufTooSmall("string", true, offset)
+	}
+
+	offset, err := Int64Marshal(buf, offset, int64(len(s)))
+	if err != nil {
+		return 0, err
+	}
+	if s == "" {
+		return offset, nil
+	}
+	return offset + copy(buf[offset:], s), nil
+}
+
+func StringUnmarshal(buf []byte, offset int) (string, int, error) {
+	size, offset, err := Int64Unmarshal(buf, offset)
+	if err != nil {
+		return "", 0, err
+	}
+	if size == 0 {
+		return "", offset, nil
+	}
+	if size > maxSliceLen {
+		return "", 0, &MarshallerError{
+			errMsg: fmt.Sprintf("string is too long: '%d'", size),
+			offset: offset,
+		}
+	}
+	if size < 0 {
+		return "", 0, &MarshallerError{
+			errMsg: fmt.Sprintf("invalid string size: '%d'", size),
+			offset: offset,
+		}
+	}
+	if len(buf)-offset < int(size) {
+		return "", 0, errBufTooSmall("string", false, offset)
+	}
+	return string(buf[offset : offset+int(size)]), offset + int(size), nil
+}
+
+func UInt8Marshal(buf []byte, offset int, value uint8) (int, error) {
+	if len(buf)-offset < 1 {
+		return 0, errBufTooSmall("uint8", true, offset)
+	}
+	buf[offset] = value
+	return offset + 1, nil
+}
+
+func UInt8Unmarshal(buf []byte, offset int) (uint8, int, error) {
+	if len(buf)-offset < 1 {
+		return 0, 0, errBufTooSmall("uint8", false, offset)
+	}
+	return buf[offset], offset + 1, nil
+}
+
+func ByteMarshal(buf []byte, offset int, value byte) (int, error) {
+	return UInt8Marshal(buf, offset, value)
+}
+
+func ByteUnmarshal(buf []byte, offset int) (byte, int, error) {
+	return UInt8Unmarshal(buf, offset)
+}
+
+func BoolMarshal(buf []byte, offset int, value bool) (int, error) {
+	if value {
+		return UInt8Marshal(buf, offset, byteTrue)
+	}
+	return UInt8Marshal(buf, offset, byteFalse)
+}
+
+func BoolUnmarshal(buf []byte, offset int) (bool, int, error) {
+	v, offset, err := UInt8Unmarshal(buf, offset)
+	if err != nil {
+		return false, 0, err
+	}
+	if v == byteTrue {
+		return true, offset, nil
+	}
+	if v == byteFalse {
+		return false, offset, nil
+	}
+	return false, 0, &MarshallerError{
+		errMsg: fmt.Sprintf("invalid marshalled value for bool: %d", v),
+		offset: offset - BoolSize,
+	}
+}

pkg/marshal/marshal_test.go

@@ -0,0 +1,313 @@
+package marshal
+
+import (
+	"encoding/binary"
+	"math"
+	"testing"
+
+	"github.com/stretchr/testify/require"
+)
+
+func TestMarshalling(t *testing.T) {
+	t.Parallel()
+	t.Run("slice", func(t *testing.T) {
+		t.Parallel()
+		t.Run("nil slice", func(t *testing.T) {
+			t.Parallel()
+
+			var int64s []int64
+			expectedSize := SliceSize(int64s, Int64Size)
+			require.Equal(t, 1, expectedSize)
+			buf := make([]byte, expectedSize)
+			offset, err := SliceMarshal(buf, 0, int64s, Int64Marshal)
+			require.NoError(t, err)
+			require.NoError(t, VerifyMarshal(buf, offset))
+
+			result, offset, err := SliceUnmarshal(buf, 0, Int64Unmarshal)
+			require.NoError(t, err)
+			require.NoError(t, VerifyUnmarshal(buf, offset))
+			require.Nil(t, result)
+		})
+
+		t.Run("empty slice", func(t *testing.T) {
+			t.Parallel()
+
+			int64s := make([]int64, 0)
+			expectedSize := SliceSize(int64s, Int64Size)
+			require.Equal(t, 1, expectedSize)
+			buf := make([]byte, expectedSize)
+			offset, err := SliceMarshal(buf, 0, int64s, Int64Marshal)
+			require.NoError(t, err)
+			require.NoError(t, VerifyMarshal(buf, offset))
+
+			result, offset, err := SliceUnmarshal(buf, 0, Int64Unmarshal)
+			require.NoError(t, err)
+			require.NoError(t, VerifyUnmarshal(buf, offset))
+			require.NotNil(t, result)
+			require.Len(t, result, 0)
+		})
+
+		t.Run("non empty slice", func(t *testing.T) {
+			t.Parallel()
+
+			int64s := make([]int64, 100)
+			for i := range int64s {
+				int64s[i] = int64(i)
+			}
+			expectedSize := SliceSize(int64s, Int64Size)
+			buf := make([]byte, expectedSize)
+			offset, err := SliceMarshal(buf, 0, int64s, Int64Marshal)
+			require.NoError(t, err)
+			require.NoError(t, VerifyMarshal(buf, offset))
+
+			result, offset, err := SliceUnmarshal(buf, 0, Int64Unmarshal)
+			require.NoError(t, err)
+			require.NoError(t, VerifyUnmarshal(buf, offset))
+			require.Equal(t, int64s, result)
+		})
+
+		t.Run("corrupted slice size", func(t *testing.T) {
+			t.Parallel()
+
+			int64s := make([]int64, 100)
+			for i := range int64s {
+				int64s[i] = int64(i)
+			}
+			expectedSize := SliceSize(int64s, Int64Size)
+			buf := make([]byte, expectedSize)
+			offset, err := SliceMarshal(buf, 0, int64s, Int64Marshal)
+			require.NoError(t, err)
+			require.NoError(t, VerifyMarshal(buf, offset))
+
+			for i := 0; i < binary.MaxVarintLen64; i++ {
+				buf[i] = 129
+			}
+
+			_, _, err = SliceUnmarshal(buf, 0, Int64Unmarshal)
+			var mErr *MarshallerError
+			require.ErrorAs(t, err, &mErr)
+
+			for i := 0; i < binary.MaxVarintLen64; i++ {
+				buf[i] = 127
+			}
+			_, _, err = SliceUnmarshal(buf, 0, Int64Unmarshal)
+			require.ErrorAs(t, err, &mErr)
+		})
+
+		t.Run("corrupted slice item", func(t *testing.T) {
+			t.Parallel()
+
+			int64s := make([]int64, 100)
+			for i := range int64s {
+				int64s[i] = int64(i)
+			}
+			expectedSize := SliceSize(int64s, Int64Size)
+			buf := make([]byte, expectedSize)
+			offset, err := SliceMarshal(buf, 0, int64s, Int64Marshal)
+			require.NoError(t, err)
+			require.NoError(t, VerifyMarshal(buf, offset))
+
+			for i := 2; i < binary.MaxVarintLen64+2; i++ {
+				buf[i] = 129
+			}
+
+			_, _, err = SliceUnmarshal(buf, 0, Int64Unmarshal)
+			var mErr *MarshallerError
+			require.ErrorAs(t, err, &mErr)
+		})
+
+		t.Run("small buffer", func(t *testing.T) {
+			t.Parallel()
+
+			int64s := make([]int64, 100)
+			for i := range int64s {
+				int64s[i] = int64(i)
+			}
+			buf := make([]byte, 1)
+			_, err := SliceMarshal(buf, 0, int64s, Int64Marshal)
+			var mErr *MarshallerError
+			require.ErrorAs(t, err, &mErr)
+
+			buf = make([]byte, 10)
+			_, err = SliceMarshal(buf, 0, int64s, Int64Marshal)
+			require.ErrorAs(t, err, &mErr)
+		})
+	})
+
+	t.Run("int64", func(t *testing.T) {
+		t.Parallel()
+
+		t.Run("success", func(t *testing.T) {
+			t.Parallel()
+
+			require.Equal(t, 1, Int64Size(0))
+			require.Equal(t, binary.MaxVarintLen64, Int64Size(math.MaxInt64))
+			require.Equal(t, binary.MaxVarintLen64, Int64Size(math.MinInt64))
+
+			for _, v := range []int64{0, math.MinInt64, math.MaxInt64} {
+				size := Int64Size(v)
+				buf := make([]byte, size)
+				offset, err := Int64Marshal(buf, 0, v)
+				require.NoError(t, err)
+				require.NoError(t, VerifyMarshal(buf, offset))
+
+				uv, offset, err := Int64Unmarshal(buf, 0)
+				require.NoError(t, err)
+				require.NoError(t, VerifyUnmarshal(buf, offset))
+				require.Equal(t, v, uv)
+			}
+		})
+
+		t.Run("invalid buffer", func(t *testing.T) {
+			t.Parallel()
+
+			var mErr *MarshallerError
+
+			_, err := Int64Marshal([]byte{}, 0, 100500)
+			require.ErrorAs(t, err, &mErr)
+
+			_, _, err = Int64Unmarshal(nil, 0)
+			require.ErrorAs(t, err, &mErr)
+		})
+
+		t.Run("overflow", func(t *testing.T) {
+			t.Parallel()
+
+			var mErr *MarshallerError
+
+			var v int64 = math.MaxInt64
+			buf := make([]byte, Int64Size(v))
+			_, err := Int64Marshal(buf, 0, v)
+			require.NoError(t, err)
+
+			buf[9] = 2
+
+			_, _, err = Int64Unmarshal(buf, 0)
+			require.ErrorAs(t, err, &mErr)
+		})
+	})
+
+	t.Run("string", func(t *testing.T) {
+		t.Parallel()
+
+		t.Run("success", func(t *testing.T) {
+			t.Parallel()
+			for _, v := range []string{
+				"", "arn:aws:iam::namespace:group/some_group", "$Object:homomorphicHash",
+				"native:container/ns/9LPLUFZpEmfidG4n44vi2cjXKXSqWT492tCvLJiJ8W1J",
+			} {
+				size := StringSize(v)
+				buf := make([]byte, size)
+				offset, err := StringMarshal(buf, 0, v)
+				require.NoError(t, err)
+				require.NoError(t, VerifyMarshal(buf, offset))
+
+				uv, offset, err := StringUnmarshal(buf, 0)
+				require.NoError(t, err)
+				require.NoError(t, VerifyUnmarshal(buf, offset))
+				require.Equal(t, v, uv)
+			}
+		})
+
+		t.Run("invalid buffer", func(t *testing.T) {
+			t.Parallel()
+
+			str := "avada kedavra"
+
+			var mErr *MarshallerError
+			_, err := StringMarshal(nil, 0, str)
+			require.ErrorAs(t, err, &mErr)
+
+			_, _, err = StringUnmarshal(nil, 0)
+			require.ErrorAs(t, err, &mErr)
+
+			buf := make([]byte, StringSize(str))
+			offset, err := StringMarshal(buf, 0, str)
+			require.NoError(t, err)
+			require.NoError(t, VerifyMarshal(buf, offset))
+			buf = buf[:len(buf)-1]
+			_, _, err = StringUnmarshal(buf, 0)
+			require.ErrorAs(t, err, &mErr)
+		})
+	})
+
+	t.Run("uint8, byte", func(t *testing.T) {
+		t.Parallel()
+
+		for _, v := range []byte{0, 8, 16, 32, 64, 128, 255} {
+			buf := make([]byte, ByteSize)
+			offset, err := ByteMarshal(buf, 0, v)
+			require.NoError(t, err)
+			require.NoError(t, VerifyMarshal(buf, offset))
+
+			ub, offset, err := ByteUnmarshal(buf, 0)
+			require.NoError(t, err)
+			require.NoError(t, VerifyUnmarshal(buf, offset))
+			require.Equal(t, v, ub)
+
+			buf = make([]byte, UInt8Size)
+			offset, err = UInt8Marshal(buf, 0, v)
+			require.NoError(t, err)
+			require.NoError(t, VerifyMarshal(buf, offset))
+
+			uu, offset, err := UInt8Unmarshal(buf, 0)
+			require.NoError(t, err)
+			require.NoError(t, VerifyUnmarshal(buf, offset))
+			require.Equal(t, v, uu)
+		}
+	})
+
+	t.Run("bool", func(t *testing.T) {
+		t.Parallel()
+
+		t.Run("success", func(t *testing.T) {
+			t.Parallel()
+			for _, v := range []bool{false, true} {
+				buf := make([]byte, BoolSize)
+				offset, err := BoolMarshal(buf, 0, v)
+				require.NoError(t, err)
+				require.NoError(t, VerifyMarshal(buf, offset))
+
+				ub, offset, err := BoolUnmarshal(buf, 0)
+				require.NoError(t, err)
+				require.NoError(t, VerifyUnmarshal(buf, offset))
+				require.Equal(t, v, ub)
+			}
+		})
+
+		t.Run("invalid value", func(t *testing.T) {
+			t.Parallel()
+			buf := make([]byte, BoolSize)
+			offset, err := BoolMarshal(buf, 0, true)
+			require.NoError(t, err)
+			require.NoError(t, VerifyMarshal(buf, offset))
+
+			buf[0] = 2
+
+			_, _, err = BoolUnmarshal(buf, 0)
+			var mErr *MarshallerError
+			require.ErrorAs(t, err, &mErr)
+		})
+
+		t.Run("invalid buffer", func(t *testing.T) {
+			t.Parallel()
+			var mErr *MarshallerError
+
+			_, err := BoolMarshal(nil, 0, true)
+			require.ErrorAs(t, err, &mErr)
+
+			buf := append(make([]byte, BoolSize), 100)
+			offset, err := BoolMarshal(buf, 0, true)
+			require.NoError(t, err)
+			require.ErrorAs(t, VerifyMarshal(buf, offset), &mErr)
+
+			v, offset, err := BoolUnmarshal(buf, 0)
+			require.NoError(t, err)
+			require.True(t, v)
+			require.ErrorAs(t, VerifyUnmarshal(buf, offset), &mErr)
+
+			_, _, err = BoolUnmarshal(nil, 0)
+			require.ErrorAs(t, err, &mErr)
+		})
+	})
+}

pkg/morph/policy/policy_contract_storage.go

@@ -0,0 +1,248 @@
+package policy
+
+import (
+	"errors"
+	"fmt"
+	"math/big"
+	"strings"
+
+	"git.frostfs.info/TrueCloudLab/frostfs-contract/commonclient"
+	"git.frostfs.info/TrueCloudLab/frostfs-contract/policy"
+	client "git.frostfs.info/TrueCloudLab/frostfs-contract/rpcclient/policy"
+	"git.frostfs.info/TrueCloudLab/policy-engine/pkg/chain"
+	"git.frostfs.info/TrueCloudLab/policy-engine/pkg/engine"
+	"github.com/google/uuid"
+	"github.com/nspcc-dev/neo-go/pkg/neorpc/result"
+	"github.com/nspcc-dev/neo-go/pkg/rpcclient/actor"
+	neoinvoker "github.com/nspcc-dev/neo-go/pkg/rpcclient/invoker"
+	"github.com/nspcc-dev/neo-go/pkg/util"
+	"github.com/nspcc-dev/neo-go/pkg/vm/stackitem"
+	"github.com/nspcc-dev/neo-go/pkg/wallet"
+)
+
+var (
+	ErrEmptyChainID = errors.New("chain id is not set")
+
+	ErrEngineTargetTypeUnsupported = errors.New("this target type is not supported yet")
+)
+
+// ContractStorage is the interface to manage chain rules within Policy contract.
+type ContractStorage struct {
+	hash util.Uint160
+
+	actor ContractStorageActor
+
+	contractInterface *client.Contract
+}
+
+var _ engine.MorphRuleChainStorage = (*ContractStorage)(nil)
+
+// ContractStorageReader is the interface to read data from Policy contract.
+type ContractStorageReader struct {
+	hash util.Uint160
+
+	invoker ContractStorageInvoker
+
+	contractReaderInterface *client.ContractReader
+}
+
+type ContractStorageActor interface {
+	client.Actor
+	GetRPCInvoker() neoinvoker.RPCInvoke
+}
+
+var _ engine.MorphRuleChainStorageReader = (*ContractStorageReader)(nil)
+
+func NewContractStorage(actor ContractStorageActor, contract util.Uint160) *ContractStorage {
+	return &ContractStorage{
+		hash:              contract,
+		actor:             actor,
+		contractInterface: client.New(actor, contract),
+	}
+}
+
+type contractStorageActorImpl struct {
+	client.Actor
+	rpcActor actor.RPCActor
+}
+
+var _ ContractStorageActor = &contractStorageActorImpl{}
+
+func (c *contractStorageActorImpl) GetRPCInvoker() neoinvoker.RPCInvoke {
+	return c.rpcActor
+}
+
+// NewContractStorageWithSimpleActor constructs core actor from `rpcActor`.
+//
+// Note: NewContractStorageWithSimpleActor is appropriate only for call-only-once cases (for example, in CLIs). Otherwise, it is unsafe,
+// because core actor may use invalidated `rpcActor` if some connection errors occurred.
+func NewContractStorageWithSimpleActor(rpcActor actor.RPCActor, acc *wallet.Account, contract util.Uint160) (*ContractStorage, error) {
+	act, err := actor.NewSimple(rpcActor, acc)
+	if err != nil {
+		return nil, fmt.Errorf("failed to create simple actor: %w", err)
+	}
+	return NewContractStorage(&contractStorageActorImpl{Actor: act, rpcActor: rpcActor}, contract), nil
+}
+
+func (s *ContractStorage) AddMorphRuleChain(name chain.Name, target engine.Target, c *chain.Chain) (txHash util.Uint256, vub uint32, err error) {
+	if len(c.ID) == 0 {
+		err = ErrEmptyChainID
+		return
+	}
+
+	var kind policy.Kind
+	kind, err = policyKind(target.Type)
+	if err != nil {
+		return
+	}
+	fullName := prefixedChainName(name, c.ID)
+
+	txHash, vub, err = s.contractInterface.AddChain(big.NewInt(int64(kind)), target.Name, fullName, c.Bytes())
+	return
+}
+
+func (s *ContractStorage) RemoveMorphRuleChain(name chain.Name, target engine.Target, chainID chain.ID) (txHash util.Uint256, vub uint32, err error) {
+	if len(chainID) == 0 {
+		err = ErrEmptyChainID
+		return
+	}
+
+	var kind policy.Kind
+	kind, err = policyKind(target.Type)
+	if err != nil {
+		return
+	}
+	fullName := prefixedChainName(name, chainID)
+
+	txHash, vub, err = s.contractInterface.RemoveChain(big.NewInt(int64(kind)), target.Name, fullName)
+	return
+}
+
+func (s *ContractStorage) RemoveMorphRuleChainsByTarget(name chain.Name, target engine.Target) (txHash util.Uint256, vub uint32, err error) {
+	var kind policy.Kind
+	kind, err = policyKind(target.Type)
+	if err != nil {
+		return
+	}
+	fullName := prefixedChainName(name, nil)
+
+	txHash, vub, err = s.contractInterface.RemoveChainsByPrefix(big.NewInt(int64(kind)), target.Name, fullName)
+	return
+}
+
+func listChains(name chain.Name, target engine.Target, rpcInvoker neoinvoker.RPCInvoke, hash util.Uint160) ([]*chain.Chain, error) {
+	kind, err := policyKind(target.Type)
+	if err != nil {
+		return nil, err
+	}
+
+	const (
+		method    = "iteratorChainsByPrefix"
+		batchSize = neoinvoker.DefaultIteratorResultItems
+	)
+
+	inv := neoinvoker.New(rpcInvoker, nil)
+	params := []any{
+		big.NewInt(int64(kind)), target.Name, []byte(name),
+	}
+
+	items, err := commonclient.ReadIteratorItems(inv, batchSize, hash, method, params...)
+	if err != nil {
+		return nil, fmt.Errorf("read items error: %w", err)
+	}
+	var chains []*chain.Chain
+	for _, item := range items {
+		serialized, err := bytesFromStackItem(item)
+		if err != nil {
+			return nil, err
+		}
+		c := new(chain.Chain)
+		if err := c.DecodeBytes(serialized); err != nil {
+			return nil, err
+		}
+		chains = append(chains, c)
+	}
+	return chains, nil
+}
+
+func (s *ContractStorage) ListMorphRuleChains(name chain.Name, target engine.Target) ([]*chain.Chain, error) {
+	return listChains(name, target, s.actor.GetRPCInvoker(), s.hash)
+}
+
+func (s *ContractStorage) ListTargetsIterator(targetType engine.TargetType) (uuid.UUID, result.Iterator, error) {
+	kind, err := policyKind(targetType)
+	if err != nil {
+		return uuid.UUID{}, result.Iterator{}, err
+	}
+	return s.contractInterface.ListTargets(big.NewInt(int64(kind)))
+}
+
+func (s *ContractStorage) GetAdmin() (util.Uint160, error) {
+	return s.contractInterface.GetAdmin()
+}
+
+func (s *ContractStorage) SetAdmin(addr util.Uint160) (util.Uint256, uint32, error) {
+	return s.contractInterface.SetAdmin(addr)
+}
+
+type ContractStorageInvoker interface {
+	client.Invoker
+	GetRPCInvoker() neoinvoker.RPCInvoke
+}
+
+func NewContractStorageReader(inv ContractStorageInvoker, contract util.Uint160) *ContractStorageReader {
+	return &ContractStorageReader{
+		hash:                    contract,
+		invoker:                 inv,
+		contractReaderInterface: client.NewReader(inv, contract),
+	}
+}
+
+func (s *ContractStorageReader) ListMorphRuleChains(name chain.Name, target engine.Target) ([]*chain.Chain, error) {
+	return listChains(name, target, s.invoker.GetRPCInvoker(), s.hash)
+}
+
+func (s *ContractStorageReader) GetAdmin() (util.Uint160, error) {
+	return s.contractReaderInterface.GetAdmin()
+}
+
+func (s *ContractStorageReader) ListTargetsIterator(targetType engine.TargetType) (uuid.UUID, result.Iterator, error) {
+	kind, err := policyKind(targetType)
+	if err != nil {
+		return uuid.UUID{}, result.Iterator{}, err
+	}
+	return s.contractReaderInterface.ListTargets(big.NewInt(int64(kind)))
+}
+
+func bytesFromStackItem(param stackitem.Item) ([]byte, error) {
+	switch param.Type() {
+	case stackitem.BufferT, stackitem.ByteArrayT, stackitem.IntegerT:
+		return param.TryBytes()
+	case stackitem.AnyT:
+		if param.Value() == nil {
+			return nil, nil
+		}
+		fallthrough
+	default:
+		return nil, fmt.Errorf("chain/client: %s is not a byte array type", param.Type())
+	}
+}
+
+func prefixedChainName(name chain.Name, chainID chain.ID) []byte {
+	return []byte(strings.ToLower(fmt.Sprintf("%s:%s", name, chainID)))
+}
+
+func policyKind(typ engine.TargetType) (policy.Kind, error) {
+	switch typ {
+	case engine.Namespace:
+		return policy.Namespace, nil
+	case engine.Container:
+		return policy.Container, nil
+	case engine.User:
+		return policy.Kind(engine.User), nil
+	case engine.Group:
+		return policy.Kind(engine.Group), nil
+	default:
+		return policy.Kind(0), ErrEngineTargetTypeUnsupported
+	}
+}

pkg/resource/resource.go

@@ -1,4 +1,4 @@
-package policyengine
+package resource
 
 // Request represents generic named resource (bucket, container etc.).
 // Name is resource depenent but should be globally unique for any given

pkg/resource/testutil/resource.go

@@ -0,0 +1,53 @@
+package testutil
+
+import (
+	resourcepkg "git.frostfs.info/TrueCloudLab/policy-engine/pkg/resource"
+)
+
+type Resource struct {
+	name       string
+	properties map[string]string
+}
+
+func (r *Resource) Name() string {
+	return r.name
+}
+
+func (r *Resource) Property(name string) string {
+	return r.properties[name]
+}
+
+func NewResource(name string, properties map[string]string) *Resource {
+	if properties == nil {
+		properties = make(map[string]string)
+	}
+	return &Resource{name: name, properties: properties}
+}
+
+type Request struct {
+	operation  string
+	properties map[string]string
+	resource   *Resource
+}
+
+var _ resourcepkg.Request = (*Request)(nil)
+
+func (r *Request) Operation() string {
+	return r.operation
+}
+
+func (r *Request) Resource() resourcepkg.Resource {
+	return r.resource
+}
+
+func (r *Request) Property(name string) string {
+	return r.properties[name]
+}
+
+func NewRequest(op string, r *Resource, properties map[string]string) *Request {
+	return &Request{
+		operation:  op,
+		properties: properties,
+		resource:   r,
+	}
+}

resource_test.go

@@ -1,49 +0,0 @@
-package policyengine
-
-type resource struct {
-	name       string
-	properties map[string]string
-}
-
-func (r *resource) Name() string {
-	return r.name
-}
-
-func (r *resource) Property(name string) string {
-	return r.properties[name]
-}
-
-func newResource(name string, properties map[string]string) *resource {
-	if properties == nil {
-		properties = make(map[string]string)
-	}
-	return &resource{name: name, properties: properties}
-}
-
-type request struct {
-	operation  string
-	properties map[string]string
-	resource   *resource
-}
-
-var _ Request = (*request)(nil)
-
-func (r *request) Operation() string {
-	return r.operation
-}
-
-func (r *request) Resource() Resource {
-	return r.resource
-}
-
-func (r *request) Property(name string) string {
-	return r.properties[name]
-}
-
-func newRequest(op string, r *resource, properties map[string]string) *request {
-	return &request{
-		operation:  op,
-		properties: properties,
-		resource:   r,
-	}
-}

schema/common/consts.go

@@ -0,0 +1,11 @@
+package common
+
+const (
+	PropertyKeyFrostFSIDGroupID = "frostfsid:groupID"
+
+	PropertyKeyFrostFSSourceIP = "frostfs:sourceIP"
+
+	PropertyKeyFormatFrostFSIDUserClaim = "frostfsid:userClaim/%s"
+
+	PropertyKeyFrostFSXHeader = "frostfs:xheader/%s"
+)

schema/native/consts.go

@@ -0,0 +1,60 @@
+package native
+
+const (
+	MethodGetObject    = "GetObject"
+	MethodPutObject    = "PutObject"
+	MethodHeadObject   = "HeadObject"
+	MethodDeleteObject = "DeleteObject"
+	MethodSearchObject = "SearchObject"
+	MethodRangeObject  = "RangeObject"
+	MethodHashObject   = "HashObject"
+	MethodPatchObject  = "PatchObject"
+
+	MethodPutContainer     = "PutContainer"
+	MethodDeleteContainer  = "DeleteContainer"
+	MethodGetContainer     = "GetContainer"
+	MethodListContainers   = "ListContainers"
+	MethodSetContainerEACL = "SetContainerEACL"
+	MethodGetContainerEACL = "GetContainerEACL"
+
+	ObjectPrefix    = "native:object"
+	ContainerPrefix = "native:container"
+
+	ResourceFormatNamespaceObjects          = "native:object/%s/*"
+	ResourceFormatNamespaceContainerObjects = "native:object/%s/%s/*"
+	ResourceFormatNamespaceContainerObject  = "native:object/%s/%s/%s"
+
+	ResourceFormatRootObjects          = "native:object//*"
+	ResourceFormatRootContainerObjects = "native:object//%s/*"
+	ResourceFormatRootContainerObject  = "native:object//%s/%s"
+
+	ResourceFormatAllObjects = "native:object/*"
+
+	ResourceFormatNamespaceContainer  = "native:container/%s/%s"
+	ResourceFormatNamespaceContainers = "native:container/%s/*"
+
+	ResourceFormatRootContainer  = "native:container//%s"
+	ResourceFormatRootContainers = "native:container//*"
+
+	ResourceFormatAllContainers = "native:container/*"
+
+	PropertyKeyActorPublicKey = "$Actor:publicKey"
+	PropertyKeyActorRole      = "$Actor:role"
+
+	PropertyKeyObjectVersion         = "$Object:version"
+	PropertyKeyObjectID              = "$Object:objectID"
+	PropertyKeyObjectContainerID     = "$Object:containerID"
+	PropertyKeyObjectOwnerID         = "$Object:ownerID"
+	PropertyKeyObjectCreationEpoch   = "$Object:creationEpoch"
+	PropertyKeyObjectPayloadLength   = "$Object:payloadLength"
+	PropertyKeyObjectPayloadHash     = "$Object:payloadHash"
+	PropertyKeyObjectType            = "$Object:objectType"
+	PropertyKeyObjectHomomorphicHash = "$Object:homomorphicHash"
+
+	PropertyKeyContainerOwnerID = "$Container:ownerID"
+
+	PropertyValueContainerRoleOwner     = "owner"
+	PropertyValueContainerRoleIR        = "ir"
+	PropertyValueContainerRoleContainer = "container"
+	PropertyValueContainerRoleOthers    = "others"
+)

schema/native/util/validation.go

@@ -0,0 +1,45 @@
+package util
+
+import (
+	"strings"
+
+	"git.frostfs.info/TrueCloudLab/policy-engine/schema/native"
+)
+
+var nativePatterns = []string{
+	native.ResourceFormatNamespaceObjects, native.ResourceFormatNamespaceContainerObjects,
+	native.ResourceFormatNamespaceContainerObject, native.ResourceFormatRootObjects,
+	native.ResourceFormatRootContainerObjects, native.ResourceFormatRootContainerObject,
+	native.ResourceFormatAllObjects, native.ResourceFormatNamespaceContainer,
+	native.ResourceFormatNamespaceContainers, native.ResourceFormatRootContainer,
+	native.ResourceFormatRootContainers, native.ResourceFormatAllContainers,
+}
+
+func match(resource, pattern string) bool {
+	rTokens := strings.Split(resource, "/")
+	pToken := strings.Split(pattern, "/")
+
+	if len(rTokens) != len(pToken) {
+		return false
+	}
+
+	for i := range rTokens {
+		if pToken[i] == "%s" {
+			continue
+		}
+		if pToken[i] != rTokens[i] {
+			return false
+		}
+	}
+
+	return true
+}
+
+func IsNativeResourceNameValid(resource string) bool {
+	for _, pattern := range nativePatterns {
+		if match(resource, pattern) {
+			return true
+		}
+	}
+	return false
+}

schema/native/util/validation_test.go

@@ -0,0 +1,97 @@
+package util
+
+import (
+	"testing"
+
+	"github.com/stretchr/testify/require"
+)
+
+var tests = []struct {
+	name     string
+	expected bool
+	resource string
+}{
+	{
+		name:     "ResourceFormatNamespaceObjects",
+		expected: true,
+		resource: "native:object/RootNamespace/*",
+	},
+	{
+		name:     "ResourceFormatNamespaceContainerObjects",
+		expected: true,
+		resource: "native:object/RootNamespace/BzQw5HH3feoxFDD5tCT87Y1726qzgLfxEE7wgtoRzB3R/*",
+	},
+	{
+		name:     "ResourceFormatNamespaceContainerObject",
+		expected: true,
+		resource: "native:object/RootNamespace/BzQw5HH3feoxFDD5tCT87Y1726qzgLfxEE7wgtoRzB3R/AeZa5HH3feoxFDD5tCT87Y1726qzgLfxEE7wgtoRzB4E",
+	},
+	{
+		name:     "ResourceFormatRootObjects",
+		expected: true,
+		resource: "native:object//*",
+	},
+	{
+		name:     "ResourceFormatRootContainerObjects",
+		expected: true,
+		resource: "native:object//BzQw5HH3feoxFDD5tCT87Y1726qzgLfxEE7wgtoRzB3R/*",
+	},
+	{
+		name:     "ResourceFormatRootContainerObject",
+		expected: true,
+		resource: "native:object//BzQw5HH3feoxFDD5tCT87Y1726qzgLfxEE7wgtoRzB3R/AeZa5HH3feoxFDD5tCT87Y1726qzgLfxEE7wgtoRzB4E",
+	},
+	{
+		name:     "ResourceFormatAllObjects",
+		expected: true,
+		resource: "native:object/*",
+	},
+	{
+		name:     "ResourceFormatNamespaceContainer",
+		expected: true,
+		resource: "native:container/RootNamespace/BzQw5HH3feoxFDD5tCT87Y1726qzgLfxEE7wgtoRzB3R",
+	},
+	{
+		name:     "ResourceFormatNamespaceContainers",
+		expected: true,
+		resource: "native:container/RootNamespace/*",
+	},
+	{
+		name:     "ResourceFormatRootContainers",
+		expected: true,
+		resource: "native:container//*",
+	},
+	{
+		name:     "ResourceFormatAllContainers",
+		expected: true,
+		resource: "native:container/*",
+	},
+	{
+		name:     "Invalid resource 1",
+		expected: false,
+		resource: "native:::container/*",
+	},
+	{
+		name:     "Invalid resource 2",
+		expected: false,
+		resource: "native:container/RootNamespace/w5HH3feoxFDD5tCTtoRzB3R/Bz726qzgLfxEE7wgtoRzB3R/RootNamespace",
+	},
+}
+
+func TestIsNativeResourceNameValid(t *testing.T) {
+	for _, test := range tests {
+		t.Run(test.name, func(t *testing.T) {
+			require.Equal(t, test.expected, IsNativeResourceNameValid(test.resource))
+		})
+	}
+}
+
+func BenchmarkIsNativeResourceNameValid(b *testing.B) {
+	for _, test := range tests {
+		b.Run(test.name, func(b *testing.B) {
+			for i := 0; i < b.N; i++ {
+				_ = IsNativeResourceNameValid(test.resource)
+			}
+		})
+	}
+}

schema/s3/consts.go

@@ -0,0 +1,24 @@
+package s3
+
+const (
+	PropertyKeyOwner = "Owner"
+
+	PropertyKeyDelimiter = "s3:delimiter"
+	PropertyKeyPrefix    = "s3:prefix"
+	PropertyKeyVersionID = "s3:VersionId"
+	PropertyKeyMaxKeys   = "s3:max-keys"
+
+	PropertyKeyFormatResourceTag = "aws:ResourceTag/%s"
+	PropertyKeyFormatRequestTag  = "aws:RequestTag/%s"
+
+	PropertyKeyAccessBoxAttrMFA    = "AccessBox-Attribute/IAM-MFA"
+	PropertyKeyFormatAccessBoxAttr = "AccessBox-Attribute/%s"
+
+	ResourceFormatS3All           = "arn:aws:s3:::*"
+	ResourceFormatS3Bucket        = "arn:aws:s3:::%s"
+	ResourceFormatS3BucketObjects = "arn:aws:s3:::%s/*"
+	ResourceFormatS3BucketObject  = "arn:aws:s3:::%s/%s"
+
+	ResourceFormatIAMNamespaceUser  = "arn:aws:iam::%s:user/%s"
+	ResourceFormatIAMNamespaceGroup = "arn:aws:iam::%s:group/%s"
+)

util/glob.go

@@ -1,4 +1,4 @@
-package policyengine
+package util
 
 import (
 	"strings"
@@ -9,7 +9,7 @@ import (
 // ? in pattern correspond to any symbol.
 // * in pattern correspond to any sequence of symbols.
 // Currently only '*' in the suffix is supported.
-func globMatch(s, pattern string) bool {
+func GlobMatch(s, pattern string) bool {
 	index := strings.IndexByte(pattern, '*')
 	switch index {
 	default: