forked from TrueCloudLab/rclone
doc: fix typos throughout docs and code
This commit is contained in:
parent
5f71d186b2
commit
4aee962233
96 changed files with 174 additions and 174 deletions
|
@ -158,7 +158,7 @@ with modules beneath.
|
||||||
* fserrors - rclone specific error handling
|
* fserrors - rclone specific error handling
|
||||||
* fshttp - http handling for rclone
|
* fshttp - http handling for rclone
|
||||||
* fspath - path handling for rclone
|
* fspath - path handling for rclone
|
||||||
* hash - defines rclones hash types and functions
|
* hash - defines rclone's hash types and functions
|
||||||
* list - list a remote
|
* list - list a remote
|
||||||
* log - logging facilities
|
* log - logging facilities
|
||||||
* march - iterates directories in lock step
|
* march - iterates directories in lock step
|
||||||
|
@ -295,7 +295,7 @@ If you need to update a dependency then run
|
||||||
GO111MODULE=on go get -u github.com/pkg/errors
|
GO111MODULE=on go get -u github.com/pkg/errors
|
||||||
GO111MODULE=on go mod vendor
|
GO111MODULE=on go mod vendor
|
||||||
|
|
||||||
Check in in a single commit as above.
|
Check in a single commit as above.
|
||||||
|
|
||||||
## Updating all the dependencies ##
|
## Updating all the dependencies ##
|
||||||
|
|
||||||
|
|
|
@ -169,7 +169,7 @@ type Fs struct {
|
||||||
tokenRenewer *oauthutil.Renew // renew the token on expiry
|
tokenRenewer *oauthutil.Renew // renew the token on expiry
|
||||||
}
|
}
|
||||||
|
|
||||||
// Object describes a acd object
|
// Object describes an acd object
|
||||||
//
|
//
|
||||||
// Will definitely have info but maybe not meta
|
// Will definitely have info but maybe not meta
|
||||||
type Object struct {
|
type Object struct {
|
||||||
|
@ -229,7 +229,7 @@ func (f *Fs) shouldRetry(resp *http.Response, err error) (bool, error) {
|
||||||
}
|
}
|
||||||
// Work around receiving this error sporadically on authentication
|
// Work around receiving this error sporadically on authentication
|
||||||
//
|
//
|
||||||
// HTTP code 403: "403 Forbidden", reponse body: {"message":"Authorization header requires 'Credential' parameter. Authorization header requires 'Signature' parameter. Authorization header requires 'SignedHeaders' parameter. Authorization header requires existence of either a 'X-Amz-Date' or a 'Date' header. Authorization=Bearer"}
|
// HTTP code 403: "403 Forbidden", response body: {"message":"Authorization header requires 'Credential' parameter. Authorization header requires 'Signature' parameter. Authorization header requires 'SignedHeaders' parameter. Authorization header requires existence of either a 'X-Amz-Date' or a 'Date' header. Authorization=Bearer"}
|
||||||
if resp.StatusCode == 403 && strings.Contains(err.Error(), "Authorization header requires") {
|
if resp.StatusCode == 403 && strings.Contains(err.Error(), "Authorization header requires") {
|
||||||
fs.Debugf(f, "403 \"Authorization header requires...\" error received - retry")
|
fs.Debugf(f, "403 \"Authorization header requires...\" error received - retry")
|
||||||
return true, err
|
return true, err
|
||||||
|
|
|
@ -201,7 +201,7 @@ type Fs struct {
|
||||||
pool *pool.Pool // memory pool
|
pool *pool.Pool // memory pool
|
||||||
}
|
}
|
||||||
|
|
||||||
// Object describes a azure object
|
// Object describes an azure object
|
||||||
type Object struct {
|
type Object struct {
|
||||||
fs *Fs // what this object is part of
|
fs *Fs // what this object is part of
|
||||||
remote string // The remote path
|
remote string // The remote path
|
||||||
|
@ -338,7 +338,7 @@ func (f *Fs) setUploadCutoff(cs fs.SizeSuffix) (old fs.SizeSuffix, err error) {
|
||||||
}
|
}
|
||||||
|
|
||||||
// httpClientFactory creates a Factory object that sends HTTP requests
|
// httpClientFactory creates a Factory object that sends HTTP requests
|
||||||
// to a rclone's http.Client.
|
// to an rclone's http.Client.
|
||||||
//
|
//
|
||||||
// copied from azblob.newDefaultHTTPClientFactory
|
// copied from azblob.newDefaultHTTPClientFactory
|
||||||
func httpClientFactory(client *http.Client) pipeline.Factory {
|
func httpClientFactory(client *http.Client) pipeline.Factory {
|
||||||
|
|
|
@ -296,7 +296,7 @@ func (f *Fs) Features() *fs.Features {
|
||||||
return f.features
|
return f.features
|
||||||
}
|
}
|
||||||
|
|
||||||
// parsePath parses an box 'url'
|
// parsePath parses a box 'url'
|
||||||
func parsePath(path string) (root string) {
|
func parsePath(path string) (root string) {
|
||||||
root = strings.Trim(path, "/")
|
root = strings.Trim(path, "/")
|
||||||
return
|
return
|
||||||
|
|
|
@ -217,7 +217,7 @@ func decodeFileName(in string) ([]byte, error) {
|
||||||
// 2003 paper "A Parallelizable Enciphering Mode" by Halevi and
|
// 2003 paper "A Parallelizable Enciphering Mode" by Halevi and
|
||||||
// Rogaway.
|
// Rogaway.
|
||||||
//
|
//
|
||||||
// This makes for determinstic encryption which is what we want - the
|
// This makes for deterministic encryption which is what we want - the
|
||||||
// same filename must encrypt to the same thing.
|
// same filename must encrypt to the same thing.
|
||||||
//
|
//
|
||||||
// This means that
|
// This means that
|
||||||
|
|
|
@ -929,7 +929,7 @@ func TestNewDecrypterSeekLimit(t *testing.T) {
|
||||||
assert.Equal(t, 0, n)
|
assert.Equal(t, 0, n)
|
||||||
}
|
}
|
||||||
|
|
||||||
// Now try decoding it with a open/seek
|
// Now try decoding it with an open/seek
|
||||||
for _, offset := range trials {
|
for _, offset := range trials {
|
||||||
for _, limit := range limits {
|
for _, limit := range limits {
|
||||||
if offset+limit > len(plaintext) {
|
if offset+limit > len(plaintext) {
|
||||||
|
|
|
@ -241,7 +241,7 @@ func (f *Fs) add(entries *fs.DirEntries, obj fs.Object) {
|
||||||
*entries = append(*entries, f.newObject(obj))
|
*entries = append(*entries, f.newObject(obj))
|
||||||
}
|
}
|
||||||
|
|
||||||
// Encrypt an directory file name to entries.
|
// Encrypt a directory file name to entries.
|
||||||
func (f *Fs) addDir(ctx context.Context, entries *fs.DirEntries, dir fs.Directory) {
|
func (f *Fs) addDir(ctx context.Context, entries *fs.DirEntries, dir fs.Directory) {
|
||||||
remote := dir.Remote()
|
remote := dir.Remote()
|
||||||
decryptedRemote, err := f.cipher.DecryptDirName(remote)
|
decryptedRemote, err := f.cipher.DecryptDirName(remote)
|
||||||
|
@ -943,7 +943,7 @@ func (o *ObjectInfo) Hash(ctx context.Context, hash hash.Type) (string, error) {
|
||||||
if srcObj, ok = o.ObjectInfo.(fs.Object); ok {
|
if srcObj, ok = o.ObjectInfo.(fs.Object); ok {
|
||||||
// Prefer direct interface assertion
|
// Prefer direct interface assertion
|
||||||
} else if do, ok := o.ObjectInfo.(fs.ObjectUnWrapper); ok {
|
} else if do, ok := o.ObjectInfo.(fs.ObjectUnWrapper); ok {
|
||||||
// Otherwise likely is a operations.OverrideRemote
|
// Otherwise likely is an operations.OverrideRemote
|
||||||
srcObj = do.UnWrap()
|
srcObj = do.UnWrap()
|
||||||
} else {
|
} else {
|
||||||
return "", nil
|
return "", nil
|
||||||
|
|
|
@ -82,7 +82,7 @@ func testObjectInfo(t *testing.T, f *Fs, wrap bool) {
|
||||||
|
|
||||||
var oi fs.ObjectInfo = obj
|
var oi fs.ObjectInfo = obj
|
||||||
if wrap {
|
if wrap {
|
||||||
// wrap the object in a fs.ObjectUnwrapper if required
|
// wrap the object in an fs.ObjectUnwrapper if required
|
||||||
oi = testWrapper{oi}
|
oi = testWrapper{oi}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
|
@ -1220,7 +1220,7 @@ func (f *Fs) getFileFields() (fields googleapi.Field) {
|
||||||
return fields
|
return fields
|
||||||
}
|
}
|
||||||
|
|
||||||
// newRegularObject creates a fs.Object for a normal drive.File
|
// newRegularObject creates an fs.Object for a normal drive.File
|
||||||
func (f *Fs) newRegularObject(remote string, info *drive.File) fs.Object {
|
func (f *Fs) newRegularObject(remote string, info *drive.File) fs.Object {
|
||||||
// wipe checksum if SkipChecksumGphotos and file is type Photo or Video
|
// wipe checksum if SkipChecksumGphotos and file is type Photo or Video
|
||||||
if f.opt.SkipChecksumGphotos {
|
if f.opt.SkipChecksumGphotos {
|
||||||
|
@ -1239,7 +1239,7 @@ func (f *Fs) newRegularObject(remote string, info *drive.File) fs.Object {
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
// newDocumentObject creates a fs.Object for a google docs drive.File
|
// newDocumentObject creates an fs.Object for a google docs drive.File
|
||||||
func (f *Fs) newDocumentObject(remote string, info *drive.File, extension, exportMimeType string) (fs.Object, error) {
|
func (f *Fs) newDocumentObject(remote string, info *drive.File, extension, exportMimeType string) (fs.Object, error) {
|
||||||
mediaType, _, err := mime.ParseMediaType(exportMimeType)
|
mediaType, _, err := mime.ParseMediaType(exportMimeType)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
|
@ -1270,7 +1270,7 @@ func (f *Fs) newDocumentObject(remote string, info *drive.File, extension, expor
|
||||||
}, nil
|
}, nil
|
||||||
}
|
}
|
||||||
|
|
||||||
// newLinkObject creates a fs.Object that represents a link a google docs drive.File
|
// newLinkObject creates an fs.Object that represents a link a google docs drive.File
|
||||||
func (f *Fs) newLinkObject(remote string, info *drive.File, extension, exportMimeType string) (fs.Object, error) {
|
func (f *Fs) newLinkObject(remote string, info *drive.File, extension, exportMimeType string) (fs.Object, error) {
|
||||||
t := linkTemplate(exportMimeType)
|
t := linkTemplate(exportMimeType)
|
||||||
if t == nil {
|
if t == nil {
|
||||||
|
@ -1296,9 +1296,9 @@ func (f *Fs) newLinkObject(remote string, info *drive.File, extension, exportMim
|
||||||
}, nil
|
}, nil
|
||||||
}
|
}
|
||||||
|
|
||||||
// newObjectWithInfo creates a fs.Object for any drive.File
|
// newObjectWithInfo creates an fs.Object for any drive.File
|
||||||
//
|
//
|
||||||
// When the drive.File cannot be represented as a fs.Object it will return (nil, nil).
|
// When the drive.File cannot be represented as an fs.Object it will return (nil, nil).
|
||||||
func (f *Fs) newObjectWithInfo(remote string, info *drive.File) (fs.Object, error) {
|
func (f *Fs) newObjectWithInfo(remote string, info *drive.File) (fs.Object, error) {
|
||||||
// If item has MD5 sum or a length it is a file stored on drive
|
// If item has MD5 sum or a length it is a file stored on drive
|
||||||
if info.Md5Checksum != "" || info.Size > 0 {
|
if info.Md5Checksum != "" || info.Size > 0 {
|
||||||
|
@ -1309,9 +1309,9 @@ func (f *Fs) newObjectWithInfo(remote string, info *drive.File) (fs.Object, erro
|
||||||
return f.newObjectWithExportInfo(remote, info, extension, exportName, exportMimeType, isDocument)
|
return f.newObjectWithExportInfo(remote, info, extension, exportName, exportMimeType, isDocument)
|
||||||
}
|
}
|
||||||
|
|
||||||
// newObjectWithExportInfo creates a fs.Object for any drive.File and the result of findExportFormat
|
// newObjectWithExportInfo creates an fs.Object for any drive.File and the result of findExportFormat
|
||||||
//
|
//
|
||||||
// When the drive.File cannot be represented as a fs.Object it will return (nil, nil).
|
// When the drive.File cannot be represented as an fs.Object it will return (nil, nil).
|
||||||
func (f *Fs) newObjectWithExportInfo(
|
func (f *Fs) newObjectWithExportInfo(
|
||||||
remote string, info *drive.File,
|
remote string, info *drive.File,
|
||||||
extension, exportName, exportMimeType string, isDocument bool) (o fs.Object, err error) {
|
extension, exportName, exportMimeType string, isDocument bool) (o fs.Object, err error) {
|
||||||
|
@ -1629,7 +1629,7 @@ func (s listRSlices) Less(i, j int) bool {
|
||||||
return s.dirs[i] < s.dirs[j]
|
return s.dirs[i] < s.dirs[j]
|
||||||
}
|
}
|
||||||
|
|
||||||
// listRRunner will read dirIDs from the in channel, perform the file listing an call cb with each DirEntry.
|
// listRRunner will read dirIDs from the in channel, perform the file listing and call cb with each DirEntry.
|
||||||
//
|
//
|
||||||
// In each cycle it will read up to grouping entries from the in channel without blocking.
|
// In each cycle it will read up to grouping entries from the in channel without blocking.
|
||||||
// If an error occurs it will be send to the out channel and then return. Once the in channel is closed,
|
// If an error occurs it will be send to the out channel and then return. Once the in channel is closed,
|
||||||
|
@ -1788,7 +1788,7 @@ func (f *Fs) ListR(ctx context.Context, dir string, callback fs.ListRCallback) (
|
||||||
for len(overflow) > 0 {
|
for len(overflow) > 0 {
|
||||||
mu.Lock()
|
mu.Lock()
|
||||||
l := len(overflow)
|
l := len(overflow)
|
||||||
// only fill half of the channel to prevent entries beeing put into overflow again
|
// only fill half of the channel to prevent entries being put into overflow again
|
||||||
if l > inputBuffer/2 {
|
if l > inputBuffer/2 {
|
||||||
l = inputBuffer / 2
|
l = inputBuffer / 2
|
||||||
}
|
}
|
||||||
|
@ -1922,8 +1922,8 @@ func (f *Fs) resolveShortcut(item *drive.File) (newItem *drive.File, err error)
|
||||||
return newItem, nil
|
return newItem, nil
|
||||||
}
|
}
|
||||||
|
|
||||||
// itemToDirEntry converts a drive.File to a fs.DirEntry.
|
// itemToDirEntry converts a drive.File to an fs.DirEntry.
|
||||||
// When the drive.File cannot be represented as a fs.DirEntry
|
// When the drive.File cannot be represented as an fs.DirEntry
|
||||||
// (nil, nil) is returned.
|
// (nil, nil) is returned.
|
||||||
func (f *Fs) itemToDirEntry(remote string, item *drive.File) (entry fs.DirEntry, err error) {
|
func (f *Fs) itemToDirEntry(remote string, item *drive.File) (entry fs.DirEntry, err error) {
|
||||||
switch {
|
switch {
|
||||||
|
@ -3144,7 +3144,7 @@ func (o *baseObject) httpResponse(ctx context.Context, url, method string, optio
|
||||||
return req, res, nil
|
return req, res, nil
|
||||||
}
|
}
|
||||||
|
|
||||||
// openDocumentFile represents an documentObject open for reading.
|
// openDocumentFile represents a documentObject open for reading.
|
||||||
// Updates the object size after read successfully.
|
// Updates the object size after read successfully.
|
||||||
type openDocumentFile struct {
|
type openDocumentFile struct {
|
||||||
o *documentObject // Object we are reading for
|
o *documentObject // Object we are reading for
|
||||||
|
|
|
@ -72,7 +72,7 @@ func init() {
|
||||||
Name: config.ConfigEncoding,
|
Name: config.ConfigEncoding,
|
||||||
Help: config.ConfigEncodingHelp,
|
Help: config.ConfigEncodingHelp,
|
||||||
Advanced: true,
|
Advanced: true,
|
||||||
// The FTP protocal can't handle trailing spaces (for instance
|
// The FTP protocol can't handle trailing spaces (for instance
|
||||||
// pureftpd turns them into _)
|
// pureftpd turns them into _)
|
||||||
//
|
//
|
||||||
// proftpd can't handle '*' in file names
|
// proftpd can't handle '*' in file names
|
||||||
|
|
|
@ -17,7 +17,7 @@ type Error struct {
|
||||||
Details ErrorDetails `json:"error"`
|
Details ErrorDetails `json:"error"`
|
||||||
}
|
}
|
||||||
|
|
||||||
// Error statisfies error interface
|
// Error satisfies error interface
|
||||||
func (e *Error) Error() string {
|
func (e *Error) Error() string {
|
||||||
return fmt.Sprintf("%s (%d %s)", e.Details.Message, e.Details.Code, e.Details.Status)
|
return fmt.Sprintf("%s (%d %s)", e.Details.Message, e.Details.Code, e.Details.Status)
|
||||||
}
|
}
|
||||||
|
|
|
@ -224,7 +224,7 @@ func (ds dirPatterns) mustCompile() dirPatterns {
|
||||||
return ds
|
return ds
|
||||||
}
|
}
|
||||||
|
|
||||||
// match finds the path passed in in the matching structure and
|
// match finds the path passed in the matching structure and
|
||||||
// returns the parameters and a pointer to the match, or nil.
|
// returns the parameters and a pointer to the match, or nil.
|
||||||
func (ds dirPatterns) match(root string, itemPath string, isFile bool) (match []string, prefix string, pattern *dirPattern) {
|
func (ds dirPatterns) match(root string, itemPath string, isFile bool) (match []string, prefix string, pattern *dirPattern) {
|
||||||
itemPath = strings.Trim(itemPath, "/")
|
itemPath = strings.Trim(itemPath, "/")
|
||||||
|
|
|
@ -21,7 +21,7 @@ func newAuth(f *Fs) *auth {
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
// Request constructs a http.Request for authentication
|
// Request constructs an http.Request for authentication
|
||||||
//
|
//
|
||||||
// returns nil for not needed
|
// returns nil for not needed
|
||||||
func (a *auth) Request(*swift.Connection) (r *http.Request, err error) {
|
func (a *auth) Request(*swift.Connection) (r *http.Request, err error) {
|
||||||
|
|
|
@ -235,7 +235,7 @@ func (f *Fs) Features() *fs.Features {
|
||||||
return f.features
|
return f.features
|
||||||
}
|
}
|
||||||
|
|
||||||
// parsePath parses an box 'url'
|
// parsePath parses a box 'url'
|
||||||
func parsePath(path string) (root string) {
|
func parsePath(path string) (root string) {
|
||||||
root = strings.Trim(path, "/")
|
root = strings.Trim(path, "/")
|
||||||
return
|
return
|
||||||
|
@ -454,7 +454,7 @@ func errorHandler(resp *http.Response) error {
|
||||||
return errResponse
|
return errResponse
|
||||||
}
|
}
|
||||||
|
|
||||||
// Jottacloud want's '+' to be URL encoded even though the RFC states it's not reserved
|
// Jottacloud wants '+' to be URL encoded even though the RFC states it's not reserved
|
||||||
func urlPathEscape(in string) string {
|
func urlPathEscape(in string) string {
|
||||||
return strings.Replace(rest.URLPathEscape(in), "+", "%2B", -1)
|
return strings.Replace(rest.URLPathEscape(in), "+", "%2B", -1)
|
||||||
}
|
}
|
||||||
|
@ -464,7 +464,7 @@ func (f *Fs) filePathRaw(file string) string {
|
||||||
return path.Join(f.endpointURL, f.opt.Enc.FromStandardPath(path.Join(f.root, file)))
|
return path.Join(f.endpointURL, f.opt.Enc.FromStandardPath(path.Join(f.root, file)))
|
||||||
}
|
}
|
||||||
|
|
||||||
// filePath returns a escaped file path (f.root, file)
|
// filePath returns an escaped file path (f.root, file)
|
||||||
func (f *Fs) filePath(file string) string {
|
func (f *Fs) filePath(file string) string {
|
||||||
return urlPathEscape(f.filePathRaw(file))
|
return urlPathEscape(f.filePathRaw(file))
|
||||||
}
|
}
|
||||||
|
@ -493,7 +493,7 @@ func NewFs(name, root string, m configmap.Mapper) (fs.Fs, error) {
|
||||||
return nil, errors.New("Outdated config - please reconfigure this backend")
|
return nil, errors.New("Outdated config - please reconfigure this backend")
|
||||||
}
|
}
|
||||||
|
|
||||||
// if custome endpoints are set use them else stick with defaults
|
// if custom endpoints are set use them else stick with defaults
|
||||||
if tokenURL, ok := m.Get(configTokenURL); ok {
|
if tokenURL, ok := m.Get(configTokenURL); ok {
|
||||||
oauthConfig.Endpoint.TokenURL = tokenURL
|
oauthConfig.Endpoint.TokenURL = tokenURL
|
||||||
// jottacloud is weird. we need to use the tokenURL as authURL
|
// jottacloud is weird. we need to use the tokenURL as authURL
|
||||||
|
@ -1105,7 +1105,7 @@ func (o *Object) Remote() string {
|
||||||
return o.remote
|
return o.remote
|
||||||
}
|
}
|
||||||
|
|
||||||
// filePath returns a escaped file path (f.root, remote)
|
// filePath returns an escaped file path (f.root, remote)
|
||||||
func (o *Object) filePath() string {
|
func (o *Object) filePath() string {
|
||||||
return o.fs.filePath(o.remote)
|
return o.fs.filePath(o.remote)
|
||||||
}
|
}
|
||||||
|
|
|
@ -421,7 +421,7 @@ func translateErrorsObject(err error) error {
|
||||||
}
|
}
|
||||||
|
|
||||||
// mkdir creates a directory at the given remote path. Creates ancestors if
|
// mkdir creates a directory at the given remote path. Creates ancestors if
|
||||||
// neccessary
|
// necessary
|
||||||
func (f *Fs) mkdir(fullPath string) error {
|
func (f *Fs) mkdir(fullPath string) error {
|
||||||
if fullPath == "/" {
|
if fullPath == "/" {
|
||||||
return nil
|
return nil
|
||||||
|
|
|
@ -402,7 +402,7 @@ func (q *quirks) parseQuirks(option string) {
|
||||||
// "Accept-Encoding: gzip" header. However, enabling compression
|
// "Accept-Encoding: gzip" header. However, enabling compression
|
||||||
// might be good for performance.
|
// might be good for performance.
|
||||||
// Use this quirk to investigate the performance impact.
|
// Use this quirk to investigate the performance impact.
|
||||||
// Remove this quirk if perfomance does not improve.
|
// Remove this quirk if performance does not improve.
|
||||||
q.gzip = true
|
q.gzip = true
|
||||||
case "insecure":
|
case "insecure":
|
||||||
// The mailru disk-o protocol is not documented. To compare HTTP
|
// The mailru disk-o protocol is not documented. To compare HTTP
|
||||||
|
|
|
@ -150,7 +150,7 @@ func (f *Fs) Features() *fs.Features {
|
||||||
return f.features
|
return f.features
|
||||||
}
|
}
|
||||||
|
|
||||||
// parsePath parses an mega 'url'
|
// parsePath parses a mega 'url'
|
||||||
func parsePath(path string) (root string) {
|
func parsePath(path string) (root string) {
|
||||||
root = strings.Trim(path, "/")
|
root = strings.Trim(path, "/")
|
||||||
return
|
return
|
||||||
|
|
|
@ -272,19 +272,19 @@ type CreateShareLinkResponse struct {
|
||||||
} `json:"link"`
|
} `json:"link"`
|
||||||
}
|
}
|
||||||
|
|
||||||
// AsyncOperationStatus provides information on the status of a asynchronous job progress.
|
// AsyncOperationStatus provides information on the status of an asynchronous job progress.
|
||||||
//
|
//
|
||||||
// The following API calls return AsyncOperationStatus resources:
|
// The following API calls return AsyncOperationStatus resources:
|
||||||
//
|
//
|
||||||
// Copy Item
|
// Copy Item
|
||||||
// Upload From URL
|
// Upload From URL
|
||||||
type AsyncOperationStatus struct {
|
type AsyncOperationStatus struct {
|
||||||
PercentageComplete float64 `json:"percentageComplete"` // An float value between 0 and 100 that indicates the percentage complete.
|
PercentageComplete float64 `json:"percentageComplete"` // A float value between 0 and 100 that indicates the percentage complete.
|
||||||
Status string `json:"status"` // A string value that maps to an enumeration of possible values about the status of the job. "notStarted | inProgress | completed | updating | failed | deletePending | deleteFailed | waiting"
|
Status string `json:"status"` // A string value that maps to an enumeration of possible values about the status of the job. "notStarted | inProgress | completed | updating | failed | deletePending | deleteFailed | waiting"
|
||||||
}
|
}
|
||||||
|
|
||||||
// GetID returns a normalized ID of the item
|
// GetID returns a normalized ID of the item
|
||||||
// If DriveID is known it will be prefixed to the ID with # seperator
|
// If DriveID is known it will be prefixed to the ID with # separator
|
||||||
// Can be parsed using onedrive.parseNormalizedID(normalizedID)
|
// Can be parsed using onedrive.parseNormalizedID(normalizedID)
|
||||||
func (i *Item) GetID() string {
|
func (i *Item) GetID() string {
|
||||||
if i.IsRemote() && i.RemoteItem.ID != "" {
|
if i.IsRemote() && i.RemoteItem.ID != "" {
|
||||||
|
|
|
@ -396,7 +396,7 @@ func (f *Fs) Features() *fs.Features {
|
||||||
return f.features
|
return f.features
|
||||||
}
|
}
|
||||||
|
|
||||||
// parsePath parses an one drive 'url'
|
// parsePath parses a one drive 'url'
|
||||||
func parsePath(path string) (root string) {
|
func parsePath(path string) (root string) {
|
||||||
root = strings.Trim(path, "/")
|
root = strings.Trim(path, "/")
|
||||||
return
|
return
|
||||||
|
@ -1310,7 +1310,7 @@ func (f *Fs) Hashes() hash.Set {
|
||||||
return hash.Set(QuickXorHashType)
|
return hash.Set(QuickXorHashType)
|
||||||
}
|
}
|
||||||
|
|
||||||
// PublicLink returns a link for downloading without accout.
|
// PublicLink returns a link for downloading without account.
|
||||||
func (f *Fs) PublicLink(ctx context.Context, remote string) (link string, err error) {
|
func (f *Fs) PublicLink(ctx context.Context, remote string) (link string, err error) {
|
||||||
info, _, err := f.readMetaDataForPath(ctx, f.rootPath(remote))
|
info, _, err := f.readMetaDataForPath(ctx, f.rootPath(remote))
|
||||||
if err != nil {
|
if err != nil {
|
||||||
|
|
|
@ -677,7 +677,7 @@ func (f *Fs) Put(ctx context.Context, in io.Reader, src fs.ObjectInfo, options .
|
||||||
}
|
}
|
||||||
|
|
||||||
if "" == o.id {
|
if "" == o.id {
|
||||||
// We need to create a ID for this file
|
// We need to create an ID for this file
|
||||||
var resp *http.Response
|
var resp *http.Response
|
||||||
response := createFileResponse{}
|
response := createFileResponse{}
|
||||||
err := o.fs.pacer.Call(func() (bool, error) {
|
err := o.fs.pacer.Call(func() (bool, error) {
|
||||||
|
|
|
@ -18,13 +18,13 @@ func (e *Error) Error() string {
|
||||||
return fmt.Sprintf("%s (Error %d)", e.Info.Message, e.Info.Code)
|
return fmt.Sprintf("%s (Error %d)", e.Info.Message, e.Info.Code)
|
||||||
}
|
}
|
||||||
|
|
||||||
// Account describes a OpenDRIVE account
|
// Account describes an OpenDRIVE account
|
||||||
type Account struct {
|
type Account struct {
|
||||||
Username string `json:"username"`
|
Username string `json:"username"`
|
||||||
Password string `json:"passwd"`
|
Password string `json:"passwd"`
|
||||||
}
|
}
|
||||||
|
|
||||||
// UserSessionInfo describes a OpenDRIVE session
|
// UserSessionInfo describes an OpenDRIVE session
|
||||||
type UserSessionInfo struct {
|
type UserSessionInfo struct {
|
||||||
Username string `json:"username"`
|
Username string `json:"username"`
|
||||||
Password string `json:"passwd"`
|
Password string `json:"passwd"`
|
||||||
|
@ -45,7 +45,7 @@ type UserSessionInfo struct {
|
||||||
PartnerUsersDomain string `json:"PartnerUsersDomain"`
|
PartnerUsersDomain string `json:"PartnerUsersDomain"`
|
||||||
}
|
}
|
||||||
|
|
||||||
// FolderList describes a OpenDRIVE listing
|
// FolderList describes an OpenDRIVE listing
|
||||||
type FolderList struct {
|
type FolderList struct {
|
||||||
// DirUpdateTime string `json:"DirUpdateTime,string"`
|
// DirUpdateTime string `json:"DirUpdateTime,string"`
|
||||||
Name string `json:"Name"`
|
Name string `json:"Name"`
|
||||||
|
@ -56,7 +56,7 @@ type FolderList struct {
|
||||||
Files []File `json:"Files"`
|
Files []File `json:"Files"`
|
||||||
}
|
}
|
||||||
|
|
||||||
// Folder describes a OpenDRIVE folder
|
// Folder describes an OpenDRIVE folder
|
||||||
type Folder struct {
|
type Folder struct {
|
||||||
FolderID string `json:"FolderID"`
|
FolderID string `json:"FolderID"`
|
||||||
Name string `json:"Name"`
|
Name string `json:"Name"`
|
||||||
|
@ -109,7 +109,7 @@ type removeFolder struct {
|
||||||
FolderID string `json:"folder_id"`
|
FolderID string `json:"folder_id"`
|
||||||
}
|
}
|
||||||
|
|
||||||
// File describes a OpenDRIVE file
|
// File describes an OpenDRIVE file
|
||||||
type File struct {
|
type File struct {
|
||||||
FileID string `json:"FileId"`
|
FileID string `json:"FileId"`
|
||||||
FileHash string `json:"FileHash"`
|
FileHash string `json:"FileHash"`
|
||||||
|
|
|
@ -152,7 +152,7 @@ func (f *Fs) Features() *fs.Features {
|
||||||
return f.features
|
return f.features
|
||||||
}
|
}
|
||||||
|
|
||||||
// parsePath parses an pcloud 'url'
|
// parsePath parses a pcloud 'url'
|
||||||
func parsePath(path string) (root string) {
|
func parsePath(path string) (root string) {
|
||||||
root = strings.Trim(path, "/")
|
root = strings.Trim(path, "/")
|
||||||
return
|
return
|
||||||
|
|
|
@ -10,7 +10,7 @@ type Response struct {
|
||||||
Status string `json:"status"`
|
Status string `json:"status"`
|
||||||
}
|
}
|
||||||
|
|
||||||
// Error statisfies the error interface
|
// Error satisfies the error interface
|
||||||
func (e *Response) Error() string {
|
func (e *Response) Error() string {
|
||||||
return fmt.Sprintf("%s: %s", e.Status, e.Message)
|
return fmt.Sprintf("%s: %s", e.Status, e.Message)
|
||||||
}
|
}
|
||||||
|
|
|
@ -203,7 +203,7 @@ func (o *Object) split() (bucket, bucketPath string) {
|
||||||
return o.fs.split(o.remote)
|
return o.fs.split(o.remote)
|
||||||
}
|
}
|
||||||
|
|
||||||
// Split an URL into three parts: protocol host and port
|
// Split a URL into three parts: protocol host and port
|
||||||
func qsParseEndpoint(endpoint string) (protocol, host, port string, err error) {
|
func qsParseEndpoint(endpoint string) (protocol, host, port string, err error) {
|
||||||
/*
|
/*
|
||||||
Pattern to match an endpoint,
|
Pattern to match an endpoint,
|
||||||
|
|
|
@ -22,7 +22,7 @@ const (
|
||||||
// maxSinglePartSize = 1024 * 1024 * 1024 * 5 // The maximum allowed size when uploading a single object to QingStor
|
// maxSinglePartSize = 1024 * 1024 * 1024 * 5 // The maximum allowed size when uploading a single object to QingStor
|
||||||
// maxMultiPartSize = 1024 * 1024 * 1024 * 1 // The maximum allowed part size when uploading a part to QingStor
|
// maxMultiPartSize = 1024 * 1024 * 1024 * 1 // The maximum allowed part size when uploading a part to QingStor
|
||||||
minMultiPartSize = 1024 * 1024 * 4 // The minimum allowed part size when uploading a part to QingStor
|
minMultiPartSize = 1024 * 1024 * 4 // The minimum allowed part size when uploading a part to QingStor
|
||||||
maxMultiParts = 10000 // The maximum allowed number of parts in an multi-part upload
|
maxMultiParts = 10000 // The maximum allowed number of parts in a multi-part upload
|
||||||
)
|
)
|
||||||
|
|
||||||
const (
|
const (
|
||||||
|
@ -168,7 +168,7 @@ func (u *uploader) singlePartUpload(buf io.Reader, size int64) error {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
|
||||||
// Upload upload a object into QingStor
|
// Upload upload an object into QingStor
|
||||||
func (u *uploader) upload() error {
|
func (u *uploader) upload() error {
|
||||||
u.init()
|
u.init()
|
||||||
|
|
||||||
|
@ -297,7 +297,7 @@ func (mu *multiUploader) send(c chunk) error {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
|
||||||
// complete complete an multipart upload
|
// complete complete a multipart upload
|
||||||
func (mu *multiUploader) complete() error {
|
func (mu *multiUploader) complete() error {
|
||||||
var err error
|
var err error
|
||||||
if err = mu.getErr(); err != nil {
|
if err = mu.getErr(); err != nil {
|
||||||
|
@ -324,7 +324,7 @@ func (mu *multiUploader) complete() error {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
|
||||||
// abort abort an multipart upload
|
// abort abort a multipart upload
|
||||||
func (mu *multiUploader) abort() error {
|
func (mu *multiUploader) abort() error {
|
||||||
var err error
|
var err error
|
||||||
bucketInit, _ := mu.bucketInit()
|
bucketInit, _ := mu.bucketInit()
|
||||||
|
@ -342,7 +342,7 @@ func (mu *multiUploader) abort() error {
|
||||||
|
|
||||||
// multiPartUpload upload a multiple object into QingStor
|
// multiPartUpload upload a multiple object into QingStor
|
||||||
func (mu *multiUploader) multiPartUpload(firstBuf io.ReadSeeker) (err error) {
|
func (mu *multiUploader) multiPartUpload(firstBuf io.ReadSeeker) (err error) {
|
||||||
// Initiate an multi-part upload
|
// Initiate a multi-part upload
|
||||||
if err = mu.initiate(); err != nil {
|
if err = mu.initiate(); err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
|
|
@ -677,7 +677,7 @@ isn't set then "acl" is used instead.`,
|
||||||
}},
|
}},
|
||||||
}, {
|
}, {
|
||||||
Name: "sse_customer_key",
|
Name: "sse_customer_key",
|
||||||
Help: "If using SSE-C you must provide the secret encyption key used to encrypt/decrypt your data.",
|
Help: "If using SSE-C you must provide the secret encryption key used to encrypt/decrypt your data.",
|
||||||
Provider: "AWS,Ceph,Minio",
|
Provider: "AWS,Ceph,Minio",
|
||||||
Advanced: true,
|
Advanced: true,
|
||||||
Examples: []fs.OptionExample{{
|
Examples: []fs.OptionExample{{
|
||||||
|
|
|
@ -212,7 +212,7 @@ func NewFs(name, root string, m configmap.Mapper) (fs.Fs, error) {
|
||||||
}
|
}
|
||||||
fs.Debugf(nil, "Seafile server version %s", serverInfo.Version)
|
fs.Debugf(nil, "Seafile server version %s", serverInfo.Version)
|
||||||
|
|
||||||
// We don't support bellow seafile v6.0 (version 6.0 is already more than 3 years old)
|
// We don't support lower than seafile v6.0 (version 6.0 is already more than 3 years old)
|
||||||
serverVersion := semver.New(serverInfo.Version)
|
serverVersion := semver.New(serverInfo.Version)
|
||||||
if serverVersion.Major < 6 {
|
if serverVersion.Major < 6 {
|
||||||
return nil, errors.New("unsupported Seafile server (version < 6.0)")
|
return nil, errors.New("unsupported Seafile server (version < 6.0)")
|
||||||
|
|
|
@ -1058,7 +1058,7 @@ func (f *Fs) renameFileAPIv2(ctx context.Context, libraryID, filePath, newname s
|
||||||
// No luck with JSON input with the older api2
|
// No luck with JSON input with the older api2
|
||||||
postParameters := url.Values{
|
postParameters := url.Values{
|
||||||
"operation": {"rename"},
|
"operation": {"rename"},
|
||||||
"reloaddir": {"true"}, // This is an undocumented trick to avoid a http code 301 response (found in https://github.com/haiwen/seahub/blob/master/seahub/api2/views.py)
|
"reloaddir": {"true"}, // This is an undocumented trick to avoid an http code 301 response (found in https://github.com/haiwen/seahub/blob/master/seahub/api2/views.py)
|
||||||
"newname": {f.opt.Enc.FromStandardName(newname)},
|
"newname": {f.opt.Enc.FromStandardName(newname)},
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
|
@ -485,7 +485,7 @@ func NewFs(name, root string, m configmap.Mapper) (fs.Fs, error) {
|
||||||
return NewFsWithConnection(ctx, name, root, m, opt, sshConfig)
|
return NewFsWithConnection(ctx, name, root, m, opt, sshConfig)
|
||||||
}
|
}
|
||||||
|
|
||||||
// NewFsWithConnection creates a new Fs object from the name and root and a ssh.ClientConfig. It connects to
|
// NewFsWithConnection creates a new Fs object from the name and root and an ssh.ClientConfig. It connects to
|
||||||
// the host specified in the ssh.ClientConfig
|
// the host specified in the ssh.ClientConfig
|
||||||
func NewFsWithConnection(ctx context.Context, name string, root string, m configmap.Mapper, opt *Options, sshConfig *ssh.ClientConfig) (fs.Fs, error) {
|
func NewFsWithConnection(ctx context.Context, name string, root string, m configmap.Mapper, opt *Options, sshConfig *ssh.ClientConfig) (fs.Fs, error) {
|
||||||
f := &Fs{
|
f := &Fs{
|
||||||
|
@ -1036,7 +1036,7 @@ func parseHash(bytes []byte) string {
|
||||||
|
|
||||||
// Parses the byte array output from the SSH session
|
// Parses the byte array output from the SSH session
|
||||||
// returned by an invocation of df into
|
// returned by an invocation of df into
|
||||||
// the disk size, used space, and avaliable space on the disk, in that order.
|
// the disk size, used space, and available space on the disk, in that order.
|
||||||
// Only works when `df` has output info on only one disk
|
// Only works when `df` has output info on only one disk
|
||||||
func parseUsage(bytes []byte) (spaceTotal int64, spaceUsed int64, spaceAvail int64) {
|
func parseUsage(bytes []byte) (spaceTotal int64, spaceUsed int64, spaceAvail int64) {
|
||||||
spaceTotal, spaceUsed, spaceAvail = -1, -1, -1
|
spaceTotal, spaceUsed, spaceAvail = -1, -1, -1
|
||||||
|
|
|
@ -102,7 +102,7 @@ type UploadSpecification struct {
|
||||||
MaxNumberOfThreads int `json:"MaxNumberOfThreads"` // Specifies the max number of chunks that can be sent simultaneously for threaded uploads
|
MaxNumberOfThreads int `json:"MaxNumberOfThreads"` // Specifies the max number of chunks that can be sent simultaneously for threaded uploads
|
||||||
}
|
}
|
||||||
|
|
||||||
// UploadFinishResponse is returnes from calling UploadSpecification.FinishURI
|
// UploadFinishResponse is returns from calling UploadSpecification.FinishURI
|
||||||
type UploadFinishResponse struct {
|
type UploadFinishResponse struct {
|
||||||
Error bool `json:"error"`
|
Error bool `json:"error"`
|
||||||
ErrorMessage string `json:"errorMessage"`
|
ErrorMessage string `json:"errorMessage"`
|
||||||
|
|
|
@ -284,7 +284,7 @@ var retryErrorCodes = []int{
|
||||||
// shouldRetry returns a boolean as to whether this err deserves to be
|
// shouldRetry returns a boolean as to whether this err deserves to be
|
||||||
// retried. It returns the err as a convenience
|
// retried. It returns the err as a convenience
|
||||||
func shouldRetry(err error) (bool, error) {
|
func shouldRetry(err error) (bool, error) {
|
||||||
// If this is an swift.Error object extract the HTTP error code
|
// If this is a swift.Error object extract the HTTP error code
|
||||||
if swiftError, ok := err.(*swift.Error); ok {
|
if swiftError, ok := err.(*swift.Error); ok {
|
||||||
for _, e := range retryErrorCodes {
|
for _, e := range retryErrorCodes {
|
||||||
if swiftError.StatusCode == e {
|
if swiftError.StatusCode == e {
|
||||||
|
@ -1253,7 +1253,7 @@ func deleteChunks(o *Object, segmentsContainer string, segmentInfos []string) {
|
||||||
fs.Debugf(o, "Delete segment file %q on %q", v, segmentsContainer)
|
fs.Debugf(o, "Delete segment file %q on %q", v, segmentsContainer)
|
||||||
e := o.fs.c.ObjectDelete(segmentsContainer, v)
|
e := o.fs.c.ObjectDelete(segmentsContainer, v)
|
||||||
if e != nil {
|
if e != nil {
|
||||||
fs.Errorf(o, "Error occured in delete segment file %q on %q , error: %q", v, segmentsContainer, e)
|
fs.Errorf(o, "Error occurred in delete segment file %q on %q , error: %q", v, segmentsContainer, e)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
|
@ -669,7 +669,7 @@ func (f *Fs) Rmdir(ctx context.Context, relative string) (err error) {
|
||||||
// requirements. In particular, libuplink requires a trailing slash for
|
// requirements. In particular, libuplink requires a trailing slash for
|
||||||
// listings, but rclone does not always provide one. Further, depending on how
|
// listings, but rclone does not always provide one. Further, depending on how
|
||||||
// the path was initially path normalization may have removed it (e.g. a
|
// the path was initially path normalization may have removed it (e.g. a
|
||||||
// trailing slash from the CLI is removed before it ever get's to the backend
|
// trailing slash from the CLI is removed before it ever gets to the backend
|
||||||
// code).
|
// code).
|
||||||
func newPrefix(prefix string) string {
|
func newPrefix(prefix string) string {
|
||||||
if prefix == "" {
|
if prefix == "" {
|
||||||
|
|
|
@ -33,7 +33,7 @@ func (e Errors) FilterNil() Errors {
|
||||||
return ne
|
return ne
|
||||||
}
|
}
|
||||||
|
|
||||||
// Err returns a error interface that filtered nil,
|
// Err returns an error interface that filtered nil,
|
||||||
// or nil if no non-nil Error is presented.
|
// or nil if no non-nil Error is presented.
|
||||||
func (e Errors) Err() error {
|
func (e Errors) Err() error {
|
||||||
ne := e.FilterNil()
|
ne := e.FilterNil()
|
||||||
|
|
|
@ -31,7 +31,7 @@ func (p *All) Create(ctx context.Context, upstreams []*upstream.Fs, path string)
|
||||||
return upstreams, nil
|
return upstreams, nil
|
||||||
}
|
}
|
||||||
|
|
||||||
// CreateEntries is CREATE category policy but receving a set of candidate entries
|
// CreateEntries is CREATE category policy but receiving a set of candidate entries
|
||||||
func (p *All) CreateEntries(entries ...upstream.Entry) ([]upstream.Entry, error) {
|
func (p *All) CreateEntries(entries ...upstream.Entry) ([]upstream.Entry, error) {
|
||||||
if len(entries) == 0 {
|
if len(entries) == 0 {
|
||||||
return nil, fs.ErrorObjectNotFound
|
return nil, fs.ErrorObjectNotFound
|
||||||
|
|
|
@ -61,7 +61,7 @@ func (p *EpAll) Action(ctx context.Context, upstreams []*upstream.Fs, path strin
|
||||||
return p.epall(ctx, upstreams, path)
|
return p.epall(ctx, upstreams, path)
|
||||||
}
|
}
|
||||||
|
|
||||||
// ActionEntries is ACTION category policy but receving a set of candidate entries
|
// ActionEntries is ACTION category policy but receivng a set of candidate entries
|
||||||
func (p *EpAll) ActionEntries(entries ...upstream.Entry) ([]upstream.Entry, error) {
|
func (p *EpAll) ActionEntries(entries ...upstream.Entry) ([]upstream.Entry, error) {
|
||||||
if len(entries) == 0 {
|
if len(entries) == 0 {
|
||||||
return nil, fs.ErrorObjectNotFound
|
return nil, fs.ErrorObjectNotFound
|
||||||
|
@ -86,7 +86,7 @@ func (p *EpAll) Create(ctx context.Context, upstreams []*upstream.Fs, path strin
|
||||||
return upstreams, err
|
return upstreams, err
|
||||||
}
|
}
|
||||||
|
|
||||||
// CreateEntries is CREATE category policy but receving a set of candidate entries
|
// CreateEntries is CREATE category policy but receiving a set of candidate entries
|
||||||
func (p *EpAll) CreateEntries(entries ...upstream.Entry) ([]upstream.Entry, error) {
|
func (p *EpAll) CreateEntries(entries ...upstream.Entry) ([]upstream.Entry, error) {
|
||||||
if len(entries) == 0 {
|
if len(entries) == 0 {
|
||||||
return nil, fs.ErrorObjectNotFound
|
return nil, fs.ErrorObjectNotFound
|
||||||
|
|
|
@ -61,7 +61,7 @@ func (p *EpFF) Action(ctx context.Context, upstreams []*upstream.Fs, path string
|
||||||
return []*upstream.Fs{u}, err
|
return []*upstream.Fs{u}, err
|
||||||
}
|
}
|
||||||
|
|
||||||
// ActionEntries is ACTION category policy but receving a set of candidate entries
|
// ActionEntries is ACTION category policy but receiving a set of candidate entries
|
||||||
func (p *EpFF) ActionEntries(entries ...upstream.Entry) ([]upstream.Entry, error) {
|
func (p *EpFF) ActionEntries(entries ...upstream.Entry) ([]upstream.Entry, error) {
|
||||||
if len(entries) == 0 {
|
if len(entries) == 0 {
|
||||||
return nil, fs.ErrorObjectNotFound
|
return nil, fs.ErrorObjectNotFound
|
||||||
|
@ -86,7 +86,7 @@ func (p *EpFF) Create(ctx context.Context, upstreams []*upstream.Fs, path string
|
||||||
return []*upstream.Fs{u}, err
|
return []*upstream.Fs{u}, err
|
||||||
}
|
}
|
||||||
|
|
||||||
// CreateEntries is CREATE category policy but receving a set of candidate entries
|
// CreateEntries is CREATE category policy but receiving a set of candidate entries
|
||||||
func (p *EpFF) CreateEntries(entries ...upstream.Entry) ([]upstream.Entry, error) {
|
func (p *EpFF) CreateEntries(entries ...upstream.Entry) ([]upstream.Entry, error) {
|
||||||
if len(entries) == 0 {
|
if len(entries) == 0 {
|
||||||
return nil, fs.ErrorObjectNotFound
|
return nil, fs.ErrorObjectNotFound
|
||||||
|
@ -106,7 +106,7 @@ func (p *EpFF) Search(ctx context.Context, upstreams []*upstream.Fs, path string
|
||||||
return p.epff(ctx, upstreams, path)
|
return p.epff(ctx, upstreams, path)
|
||||||
}
|
}
|
||||||
|
|
||||||
// SearchEntries is SEARCH category policy but receving a set of candidate entries
|
// SearchEntries is SEARCH category policy but receiving a set of candidate entries
|
||||||
func (p *EpFF) SearchEntries(entries ...upstream.Entry) (upstream.Entry, error) {
|
func (p *EpFF) SearchEntries(entries ...upstream.Entry) (upstream.Entry, error) {
|
||||||
if len(entries) == 0 {
|
if len(entries) == 0 {
|
||||||
return nil, fs.ErrorObjectNotFound
|
return nil, fs.ErrorObjectNotFound
|
||||||
|
|
|
@ -65,7 +65,7 @@ func (p *EpLfs) Action(ctx context.Context, upstreams []*upstream.Fs, path strin
|
||||||
return []*upstream.Fs{u}, err
|
return []*upstream.Fs{u}, err
|
||||||
}
|
}
|
||||||
|
|
||||||
// ActionEntries is ACTION category policy but receving a set of candidate entries
|
// ActionEntries is ACTION category policy but receiving a set of candidate entries
|
||||||
func (p *EpLfs) ActionEntries(entries ...upstream.Entry) ([]upstream.Entry, error) {
|
func (p *EpLfs) ActionEntries(entries ...upstream.Entry) ([]upstream.Entry, error) {
|
||||||
entries, err := p.EpAll.ActionEntries(entries...)
|
entries, err := p.EpAll.ActionEntries(entries...)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
|
@ -85,7 +85,7 @@ func (p *EpLfs) Create(ctx context.Context, upstreams []*upstream.Fs, path strin
|
||||||
return []*upstream.Fs{u}, err
|
return []*upstream.Fs{u}, err
|
||||||
}
|
}
|
||||||
|
|
||||||
// CreateEntries is CREATE category policy but receving a set of candidate entries
|
// CreateEntries is CREATE category policy but receiving a set of candidate entries
|
||||||
func (p *EpLfs) CreateEntries(entries ...upstream.Entry) ([]upstream.Entry, error) {
|
func (p *EpLfs) CreateEntries(entries ...upstream.Entry) ([]upstream.Entry, error) {
|
||||||
entries, err := p.EpAll.CreateEntries(entries...)
|
entries, err := p.EpAll.CreateEntries(entries...)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
|
@ -107,7 +107,7 @@ func (p *EpLfs) Search(ctx context.Context, upstreams []*upstream.Fs, path strin
|
||||||
return p.lfs(upstreams)
|
return p.lfs(upstreams)
|
||||||
}
|
}
|
||||||
|
|
||||||
// SearchEntries is SEARCH category policy but receving a set of candidate entries
|
// SearchEntries is SEARCH category policy but receiving a set of candidate entries
|
||||||
func (p *EpLfs) SearchEntries(entries ...upstream.Entry) (upstream.Entry, error) {
|
func (p *EpLfs) SearchEntries(entries ...upstream.Entry) (upstream.Entry, error) {
|
||||||
if len(entries) == 0 {
|
if len(entries) == 0 {
|
||||||
return nil, fs.ErrorObjectNotFound
|
return nil, fs.ErrorObjectNotFound
|
||||||
|
|
|
@ -65,7 +65,7 @@ func (p *EpLno) Action(ctx context.Context, upstreams []*upstream.Fs, path strin
|
||||||
return []*upstream.Fs{u}, err
|
return []*upstream.Fs{u}, err
|
||||||
}
|
}
|
||||||
|
|
||||||
// ActionEntries is ACTION category policy but receving a set of candidate entries
|
// ActionEntries is ACTION category policy but receiving a set of candidate entries
|
||||||
func (p *EpLno) ActionEntries(entries ...upstream.Entry) ([]upstream.Entry, error) {
|
func (p *EpLno) ActionEntries(entries ...upstream.Entry) ([]upstream.Entry, error) {
|
||||||
entries, err := p.EpAll.ActionEntries(entries...)
|
entries, err := p.EpAll.ActionEntries(entries...)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
|
@ -85,7 +85,7 @@ func (p *EpLno) Create(ctx context.Context, upstreams []*upstream.Fs, path strin
|
||||||
return []*upstream.Fs{u}, err
|
return []*upstream.Fs{u}, err
|
||||||
}
|
}
|
||||||
|
|
||||||
// CreateEntries is CREATE category policy but receving a set of candidate entries
|
// CreateEntries is CREATE category policy but receiving a set of candidate entries
|
||||||
func (p *EpLno) CreateEntries(entries ...upstream.Entry) ([]upstream.Entry, error) {
|
func (p *EpLno) CreateEntries(entries ...upstream.Entry) ([]upstream.Entry, error) {
|
||||||
entries, err := p.EpAll.CreateEntries(entries...)
|
entries, err := p.EpAll.CreateEntries(entries...)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
|
@ -107,7 +107,7 @@ func (p *EpLno) Search(ctx context.Context, upstreams []*upstream.Fs, path strin
|
||||||
return p.lno(upstreams)
|
return p.lno(upstreams)
|
||||||
}
|
}
|
||||||
|
|
||||||
// SearchEntries is SEARCH category policy but receving a set of candidate entries
|
// SearchEntries is SEARCH category policy but receiving a set of candidate entries
|
||||||
func (p *EpLno) SearchEntries(entries ...upstream.Entry) (upstream.Entry, error) {
|
func (p *EpLno) SearchEntries(entries ...upstream.Entry) (upstream.Entry, error) {
|
||||||
if len(entries) == 0 {
|
if len(entries) == 0 {
|
||||||
return nil, fs.ErrorObjectNotFound
|
return nil, fs.ErrorObjectNotFound
|
||||||
|
|
|
@ -65,7 +65,7 @@ func (p *EpLus) Action(ctx context.Context, upstreams []*upstream.Fs, path strin
|
||||||
return []*upstream.Fs{u}, err
|
return []*upstream.Fs{u}, err
|
||||||
}
|
}
|
||||||
|
|
||||||
// ActionEntries is ACTION category policy but receving a set of candidate entries
|
// ActionEntries is ACTION category policy but receiving a set of candidate entries
|
||||||
func (p *EpLus) ActionEntries(entries ...upstream.Entry) ([]upstream.Entry, error) {
|
func (p *EpLus) ActionEntries(entries ...upstream.Entry) ([]upstream.Entry, error) {
|
||||||
entries, err := p.EpAll.ActionEntries(entries...)
|
entries, err := p.EpAll.ActionEntries(entries...)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
|
@ -85,7 +85,7 @@ func (p *EpLus) Create(ctx context.Context, upstreams []*upstream.Fs, path strin
|
||||||
return []*upstream.Fs{u}, err
|
return []*upstream.Fs{u}, err
|
||||||
}
|
}
|
||||||
|
|
||||||
// CreateEntries is CREATE category policy but receving a set of candidate entries
|
// CreateEntries is CREATE category policy but receiving a set of candidate entries
|
||||||
func (p *EpLus) CreateEntries(entries ...upstream.Entry) ([]upstream.Entry, error) {
|
func (p *EpLus) CreateEntries(entries ...upstream.Entry) ([]upstream.Entry, error) {
|
||||||
entries, err := p.EpAll.CreateEntries(entries...)
|
entries, err := p.EpAll.CreateEntries(entries...)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
|
@ -107,7 +107,7 @@ func (p *EpLus) Search(ctx context.Context, upstreams []*upstream.Fs, path strin
|
||||||
return p.lus(upstreams)
|
return p.lus(upstreams)
|
||||||
}
|
}
|
||||||
|
|
||||||
// SearchEntries is SEARCH category policy but receving a set of candidate entries
|
// SearchEntries is SEARCH category policy but receiving a set of candidate entries
|
||||||
func (p *EpLus) SearchEntries(entries ...upstream.Entry) (upstream.Entry, error) {
|
func (p *EpLus) SearchEntries(entries ...upstream.Entry) (upstream.Entry, error) {
|
||||||
if len(entries) == 0 {
|
if len(entries) == 0 {
|
||||||
return nil, fs.ErrorObjectNotFound
|
return nil, fs.ErrorObjectNotFound
|
||||||
|
|
|
@ -64,7 +64,7 @@ func (p *EpMfs) Action(ctx context.Context, upstreams []*upstream.Fs, path strin
|
||||||
return []*upstream.Fs{u}, err
|
return []*upstream.Fs{u}, err
|
||||||
}
|
}
|
||||||
|
|
||||||
// ActionEntries is ACTION category policy but receving a set of candidate entries
|
// ActionEntries is ACTION category policy but receiving a set of candidate entries
|
||||||
func (p *EpMfs) ActionEntries(entries ...upstream.Entry) ([]upstream.Entry, error) {
|
func (p *EpMfs) ActionEntries(entries ...upstream.Entry) ([]upstream.Entry, error) {
|
||||||
entries, err := p.EpAll.ActionEntries(entries...)
|
entries, err := p.EpAll.ActionEntries(entries...)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
|
@ -84,7 +84,7 @@ func (p *EpMfs) Create(ctx context.Context, upstreams []*upstream.Fs, path strin
|
||||||
return []*upstream.Fs{u}, err
|
return []*upstream.Fs{u}, err
|
||||||
}
|
}
|
||||||
|
|
||||||
// CreateEntries is CREATE category policy but receving a set of candidate entries
|
// CreateEntries is CREATE category policy but receiving a set of candidate entries
|
||||||
func (p *EpMfs) CreateEntries(entries ...upstream.Entry) ([]upstream.Entry, error) {
|
func (p *EpMfs) CreateEntries(entries ...upstream.Entry) ([]upstream.Entry, error) {
|
||||||
entries, err := p.EpAll.CreateEntries(entries...)
|
entries, err := p.EpAll.CreateEntries(entries...)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
|
@ -106,7 +106,7 @@ func (p *EpMfs) Search(ctx context.Context, upstreams []*upstream.Fs, path strin
|
||||||
return p.mfs(upstreams)
|
return p.mfs(upstreams)
|
||||||
}
|
}
|
||||||
|
|
||||||
// SearchEntries is SEARCH category policy but receving a set of candidate entries
|
// SearchEntries is SEARCH category policy but receivng a set of candidate entries
|
||||||
func (p *EpMfs) SearchEntries(entries ...upstream.Entry) (upstream.Entry, error) {
|
func (p *EpMfs) SearchEntries(entries ...upstream.Entry) (upstream.Entry, error) {
|
||||||
if len(entries) == 0 {
|
if len(entries) == 0 {
|
||||||
return nil, fs.ErrorObjectNotFound
|
return nil, fs.ErrorObjectNotFound
|
||||||
|
|
|
@ -38,7 +38,7 @@ func (p *EpRand) Action(ctx context.Context, upstreams []*upstream.Fs, path stri
|
||||||
return []*upstream.Fs{p.rand(upstreams)}, nil
|
return []*upstream.Fs{p.rand(upstreams)}, nil
|
||||||
}
|
}
|
||||||
|
|
||||||
// ActionEntries is ACTION category policy but receving a set of candidate entries
|
// ActionEntries is ACTION category policy but receiving a set of candidate entries
|
||||||
func (p *EpRand) ActionEntries(entries ...upstream.Entry) ([]upstream.Entry, error) {
|
func (p *EpRand) ActionEntries(entries ...upstream.Entry) ([]upstream.Entry, error) {
|
||||||
entries, err := p.EpAll.ActionEntries(entries...)
|
entries, err := p.EpAll.ActionEntries(entries...)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
|
@ -56,7 +56,7 @@ func (p *EpRand) Create(ctx context.Context, upstreams []*upstream.Fs, path stri
|
||||||
return []*upstream.Fs{p.rand(upstreams)}, nil
|
return []*upstream.Fs{p.rand(upstreams)}, nil
|
||||||
}
|
}
|
||||||
|
|
||||||
// CreateEntries is CREATE category policy but receving a set of candidate entries
|
// CreateEntries is CREATE category policy but receiving a set of candidate entries
|
||||||
func (p *EpRand) CreateEntries(entries ...upstream.Entry) ([]upstream.Entry, error) {
|
func (p *EpRand) CreateEntries(entries ...upstream.Entry) ([]upstream.Entry, error) {
|
||||||
entries, err := p.EpAll.CreateEntries(entries...)
|
entries, err := p.EpAll.CreateEntries(entries...)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
|
@ -77,7 +77,7 @@ func (p *EpRand) Search(ctx context.Context, upstreams []*upstream.Fs, path stri
|
||||||
return p.rand(upstreams), nil
|
return p.rand(upstreams), nil
|
||||||
}
|
}
|
||||||
|
|
||||||
// SearchEntries is SEARCH category policy but receving a set of candidate entries
|
// SearchEntries is SEARCH category policy but receiving a set of candidate entries
|
||||||
func (p *EpRand) SearchEntries(entries ...upstream.Entry) (upstream.Entry, error) {
|
func (p *EpRand) SearchEntries(entries ...upstream.Entry) (upstream.Entry, error) {
|
||||||
if len(entries) == 0 {
|
if len(entries) == 0 {
|
||||||
return nil, fs.ErrorObjectNotFound
|
return nil, fs.ErrorObjectNotFound
|
||||||
|
|
|
@ -15,7 +15,7 @@ func init() {
|
||||||
}
|
}
|
||||||
|
|
||||||
// Newest policy picks the file / directory with the largest mtime
|
// Newest policy picks the file / directory with the largest mtime
|
||||||
// It implies the existance of a path
|
// It implies the existence of a path
|
||||||
type Newest struct {
|
type Newest struct {
|
||||||
EpAll
|
EpAll
|
||||||
}
|
}
|
||||||
|
@ -93,7 +93,7 @@ func (p *Newest) Action(ctx context.Context, upstreams []*upstream.Fs, path stri
|
||||||
return []*upstream.Fs{u}, err
|
return []*upstream.Fs{u}, err
|
||||||
}
|
}
|
||||||
|
|
||||||
// ActionEntries is ACTION category policy but receving a set of candidate entries
|
// ActionEntries is ACTION category policy but receiving a set of candidate entries
|
||||||
func (p *Newest) ActionEntries(entries ...upstream.Entry) ([]upstream.Entry, error) {
|
func (p *Newest) ActionEntries(entries ...upstream.Entry) ([]upstream.Entry, error) {
|
||||||
if len(entries) == 0 {
|
if len(entries) == 0 {
|
||||||
return nil, fs.ErrorObjectNotFound
|
return nil, fs.ErrorObjectNotFound
|
||||||
|
@ -119,7 +119,7 @@ func (p *Newest) Create(ctx context.Context, upstreams []*upstream.Fs, path stri
|
||||||
return []*upstream.Fs{u}, err
|
return []*upstream.Fs{u}, err
|
||||||
}
|
}
|
||||||
|
|
||||||
// CreateEntries is CREATE category policy but receving a set of candidate entries
|
// CreateEntries is CREATE category policy but receiving a set of candidate entries
|
||||||
func (p *Newest) CreateEntries(entries ...upstream.Entry) ([]upstream.Entry, error) {
|
func (p *Newest) CreateEntries(entries ...upstream.Entry) ([]upstream.Entry, error) {
|
||||||
if len(entries) == 0 {
|
if len(entries) == 0 {
|
||||||
return nil, fs.ErrorObjectNotFound
|
return nil, fs.ErrorObjectNotFound
|
||||||
|
@ -140,7 +140,7 @@ func (p *Newest) Search(ctx context.Context, upstreams []*upstream.Fs, path stri
|
||||||
return p.newest(ctx, upstreams, path)
|
return p.newest(ctx, upstreams, path)
|
||||||
}
|
}
|
||||||
|
|
||||||
// SearchEntries is SEARCH category policy but receving a set of candidate entries
|
// SearchEntries is SEARCH category policy but receiving a set of candidate entries
|
||||||
func (p *Newest) SearchEntries(entries ...upstream.Entry) (upstream.Entry, error) {
|
func (p *Newest) SearchEntries(entries ...upstream.Entry) (upstream.Entry, error) {
|
||||||
if len(entries) == 0 {
|
if len(entries) == 0 {
|
||||||
return nil, fs.ErrorObjectNotFound
|
return nil, fs.ErrorObjectNotFound
|
||||||
|
|
|
@ -26,13 +26,13 @@ type Policy interface {
|
||||||
// Search category policy, governing the access to files and directories
|
// Search category policy, governing the access to files and directories
|
||||||
Search(ctx context.Context, upstreams []*upstream.Fs, path string) (*upstream.Fs, error)
|
Search(ctx context.Context, upstreams []*upstream.Fs, path string) (*upstream.Fs, error)
|
||||||
|
|
||||||
// ActionEntries is ACTION category policy but receving a set of candidate entries
|
// ActionEntries is ACTION category policy but receiving a set of candidate entries
|
||||||
ActionEntries(entries ...upstream.Entry) ([]upstream.Entry, error)
|
ActionEntries(entries ...upstream.Entry) ([]upstream.Entry, error)
|
||||||
|
|
||||||
// CreateEntries is CREATE category policy but receving a set of candidate entries
|
// CreateEntries is CREATE category policy but receiving a set of candidate entries
|
||||||
CreateEntries(entries ...upstream.Entry) ([]upstream.Entry, error)
|
CreateEntries(entries ...upstream.Entry) ([]upstream.Entry, error)
|
||||||
|
|
||||||
// SearchEntries is SEARCH category policy but receving a set of candidate entries
|
// SearchEntries is SEARCH category policy but receiving a set of candidate entries
|
||||||
SearchEntries(entries ...upstream.Entry) (upstream.Entry, error)
|
SearchEntries(entries ...upstream.Entry) (upstream.Entry, error)
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
|
@ -35,7 +35,7 @@ func (p *Rand) Action(ctx context.Context, upstreams []*upstream.Fs, path string
|
||||||
return []*upstream.Fs{p.rand(upstreams)}, nil
|
return []*upstream.Fs{p.rand(upstreams)}, nil
|
||||||
}
|
}
|
||||||
|
|
||||||
// ActionEntries is ACTION category policy but receving a set of candidate entries
|
// ActionEntries is ACTION category policy but receiving a set of candidate entries
|
||||||
func (p *Rand) ActionEntries(entries ...upstream.Entry) ([]upstream.Entry, error) {
|
func (p *Rand) ActionEntries(entries ...upstream.Entry) ([]upstream.Entry, error) {
|
||||||
entries, err := p.All.ActionEntries(entries...)
|
entries, err := p.All.ActionEntries(entries...)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
|
@ -53,7 +53,7 @@ func (p *Rand) Create(ctx context.Context, upstreams []*upstream.Fs, path string
|
||||||
return []*upstream.Fs{p.rand(upstreams)}, nil
|
return []*upstream.Fs{p.rand(upstreams)}, nil
|
||||||
}
|
}
|
||||||
|
|
||||||
// CreateEntries is CREATE category policy but receving a set of candidate entries
|
// CreateEntries is CREATE category policy but receiving a set of candidate entries
|
||||||
func (p *Rand) CreateEntries(entries ...upstream.Entry) ([]upstream.Entry, error) {
|
func (p *Rand) CreateEntries(entries ...upstream.Entry) ([]upstream.Entry, error) {
|
||||||
entries, err := p.All.CreateEntries(entries...)
|
entries, err := p.All.CreateEntries(entries...)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
|
@ -74,7 +74,7 @@ func (p *Rand) Search(ctx context.Context, upstreams []*upstream.Fs, path string
|
||||||
return p.rand(upstreams), nil
|
return p.rand(upstreams), nil
|
||||||
}
|
}
|
||||||
|
|
||||||
// SearchEntries is SEARCH category policy but receving a set of candidate entries
|
// SearchEntries is SEARCH category policy but receiving a set of candidate entries
|
||||||
func (p *Rand) SearchEntries(entries ...upstream.Entry) (upstream.Entry, error) {
|
func (p *Rand) SearchEntries(entries ...upstream.Entry) (upstream.Entry, error) {
|
||||||
if len(entries) == 0 {
|
if len(entries) == 0 {
|
||||||
return nil, fs.ErrorObjectNotFound
|
return nil, fs.ErrorObjectNotFound
|
||||||
|
|
|
@ -100,7 +100,7 @@ func New(remote, root string, cacheTime time.Duration) (*Fs, error) {
|
||||||
return f, err
|
return f, err
|
||||||
}
|
}
|
||||||
|
|
||||||
// WrapDirectory wraps a fs.Directory to include the info
|
// WrapDirectory wraps an fs.Directory to include the info
|
||||||
// of the upstream Fs
|
// of the upstream Fs
|
||||||
func (f *Fs) WrapDirectory(e fs.Directory) *Directory {
|
func (f *Fs) WrapDirectory(e fs.Directory) *Directory {
|
||||||
if e == nil {
|
if e == nil {
|
||||||
|
@ -112,7 +112,7 @@ func (f *Fs) WrapDirectory(e fs.Directory) *Directory {
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
// WrapObject wraps a fs.Object to include the info
|
// WrapObject wraps an fs.Object to include the info
|
||||||
// of the upstream Fs
|
// of the upstream Fs
|
||||||
func (f *Fs) WrapObject(o fs.Object) *Object {
|
func (f *Fs) WrapObject(o fs.Object) *Object {
|
||||||
if o == nil {
|
if o == nil {
|
||||||
|
@ -124,7 +124,7 @@ func (f *Fs) WrapObject(o fs.Object) *Object {
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
// WrapEntry wraps a fs.DirEntry to include the info
|
// WrapEntry wraps an fs.DirEntry to include the info
|
||||||
// of the upstream Fs
|
// of the upstream Fs
|
||||||
func (f *Fs) WrapEntry(e fs.DirEntry) (Entry, error) {
|
func (f *Fs) WrapEntry(e fs.DirEntry) (Entry, error) {
|
||||||
switch e.(type) {
|
switch e.(type) {
|
||||||
|
|
|
@ -48,7 +48,7 @@ type SuccessResponseBody struct {
|
||||||
Token string `xml:"RequestSecurityTokenResponse>RequestedSecurityToken>BinarySecurityToken"`
|
Token string `xml:"RequestSecurityTokenResponse>RequestedSecurityToken>BinarySecurityToken"`
|
||||||
}
|
}
|
||||||
|
|
||||||
// SharepointError holds a error response microsoft login
|
// SharepointError holds an error response microsoft login
|
||||||
type SharepointError struct {
|
type SharepointError struct {
|
||||||
XMLName xml.Name `xml:"Envelope"`
|
XMLName xml.Name `xml:"Envelope"`
|
||||||
Body ErrorResponseBody `xml:"Body"`
|
Body ErrorResponseBody `xml:"Body"`
|
||||||
|
@ -58,7 +58,7 @@ func (e *SharepointError) Error() string {
|
||||||
return fmt.Sprintf("%s: %s (%s)", e.Body.FaultCode, e.Body.Reason, e.Body.Detail)
|
return fmt.Sprintf("%s: %s (%s)", e.Body.FaultCode, e.Body.Reason, e.Body.Detail)
|
||||||
}
|
}
|
||||||
|
|
||||||
// ErrorResponseBody contains the body of a erroneous repsonse
|
// ErrorResponseBody contains the body of an erroneous response
|
||||||
type ErrorResponseBody struct {
|
type ErrorResponseBody struct {
|
||||||
XMLName xml.Name
|
XMLName xml.Name
|
||||||
FaultCode string `xml:"Fault>Code>Subcode>Value"`
|
FaultCode string `xml:"Fault>Code>Subcode>Value"`
|
||||||
|
|
|
@ -200,12 +200,12 @@ func (f *Fs) setRoot(root string) {
|
||||||
f.diskRoot = diskRoot
|
f.diskRoot = diskRoot
|
||||||
}
|
}
|
||||||
|
|
||||||
// filePath returns a escaped file path (f.root, file)
|
// filePath returns an escaped file path (f.root, file)
|
||||||
func (f *Fs) filePath(file string) string {
|
func (f *Fs) filePath(file string) string {
|
||||||
return path.Join(f.diskRoot, file)
|
return path.Join(f.diskRoot, file)
|
||||||
}
|
}
|
||||||
|
|
||||||
// dirPath returns a escaped file path (f.root, file) ending with '/'
|
// dirPath returns an escaped file path (f.root, file) ending with '/'
|
||||||
func (f *Fs) dirPath(file string) string {
|
func (f *Fs) dirPath(file string) string {
|
||||||
return path.Join(f.diskRoot, file) + "/"
|
return path.Join(f.diskRoot, file) + "/"
|
||||||
}
|
}
|
||||||
|
@ -502,7 +502,7 @@ func (f *Fs) mkDirs(ctx context.Context, path string) (err error) {
|
||||||
|
|
||||||
if err = f.CreateDir(ctx, dirString); err != nil {
|
if err = f.CreateDir(ctx, dirString); err != nil {
|
||||||
if apiErr, ok := err.(*api.ErrorResponse); ok {
|
if apiErr, ok := err.(*api.ErrorResponse); ok {
|
||||||
// allready exists
|
// already exists
|
||||||
if apiErr.ErrorName != "DiskPathPointsToExistentDirectoryError" {
|
if apiErr.ErrorName != "DiskPathPointsToExistentDirectoryError" {
|
||||||
// 2 if it fails then create all directories in the path from root.
|
// 2 if it fails then create all directories in the path from root.
|
||||||
dirs := strings.Split(dirString, "/") //path separator
|
dirs := strings.Split(dirString, "/") //path separator
|
||||||
|
|
|
@ -1,4 +1,4 @@
|
||||||
// Package cmount implents a FUSE mounting system for rclone remotes.
|
// Package cmount implements a FUSE mounting system for rclone remotes.
|
||||||
//
|
//
|
||||||
// This uses the cgo based cgofuse library
|
// This uses the cgo based cgofuse library
|
||||||
|
|
||||||
|
|
|
@ -33,7 +33,7 @@ var commandDefinition = &cobra.Command{
|
||||||
Download a URL's content and copy it to the destination without saving
|
Download a URL's content and copy it to the destination without saving
|
||||||
it in temporary storage.
|
it in temporary storage.
|
||||||
|
|
||||||
Setting --auto-filename will cause the file name to be retreived from
|
Setting --auto-filename will cause the file name to be retrieved from
|
||||||
the from URL (after any redirections) and used in the destination
|
the from URL (after any redirections) and used in the destination
|
||||||
path.
|
path.
|
||||||
|
|
||||||
|
|
|
@ -1,4 +1,4 @@
|
||||||
// Package mount implents a FUSE mounting system for rclone remotes.
|
// Package mount implements a FUSE mounting system for rclone remotes.
|
||||||
|
|
||||||
// +build linux,go1.13 darwin,go1.13 freebsd,go1.13
|
// +build linux,go1.13 darwin,go1.13 freebsd,go1.13
|
||||||
|
|
||||||
|
|
|
@ -1,4 +1,4 @@
|
||||||
// Package mount implents a FUSE mounting system for rclone remotes.
|
// Package mount implements a FUSE mounting system for rclone remotes.
|
||||||
|
|
||||||
// +build linux darwin,amd64
|
// +build linux darwin,amd64
|
||||||
|
|
||||||
|
|
|
@ -85,7 +85,7 @@ func TestRc(t *testing.T) {
|
||||||
require.NoError(t, err)
|
require.NoError(t, err)
|
||||||
assert.Equal(t, int64(5), fi.Size())
|
assert.Equal(t, int64(5), fi.Size())
|
||||||
|
|
||||||
// FIXME the OS somtimes appears to be using the mount
|
// FIXME the OS sometimes appears to be using the mount
|
||||||
// immediately after it appears so wait a moment
|
// immediately after it appears so wait a moment
|
||||||
time.Sleep(100 * time.Millisecond)
|
time.Sleep(100 * time.Millisecond)
|
||||||
|
|
||||||
|
|
|
@ -181,7 +181,7 @@ func (cds *contentDirectoryService) readContainer(o object, host string) (ret []
|
||||||
// Given a list of nodes, separate them into potential media items and any associated resources (external subtitles,
|
// Given a list of nodes, separate them into potential media items and any associated resources (external subtitles,
|
||||||
// for example.)
|
// for example.)
|
||||||
//
|
//
|
||||||
// The result is a a slice of potential media nodes (in their original order) and a map containing associated
|
// The result is a slice of potential media nodes (in their original order) and a map containing associated
|
||||||
// resources nodes of each media node, if any.
|
// resources nodes of each media node, if any.
|
||||||
func mediaWithResources(nodes vfs.Nodes) (vfs.Nodes, map[vfs.Node]vfs.Nodes) {
|
func mediaWithResources(nodes vfs.Nodes) (vfs.Nodes, map[vfs.Node]vfs.Nodes) {
|
||||||
media, mediaResources := vfs.Nodes{}, make(map[vfs.Node]vfs.Nodes)
|
media, mediaResources := vfs.Nodes{}, make(map[vfs.Node]vfs.Nodes)
|
||||||
|
|
|
@ -34,7 +34,7 @@ func init() {
|
||||||
var Command = &cobra.Command{
|
var Command = &cobra.Command{
|
||||||
Use: "dlna remote:path",
|
Use: "dlna remote:path",
|
||||||
Short: `Serve remote:path over DLNA`,
|
Short: `Serve remote:path over DLNA`,
|
||||||
Long: `rclone serve dlna is a DLNA media server for media stored in a rclone remote. Many
|
Long: `rclone serve dlna is a DLNA media server for media stored in an rclone remote. Many
|
||||||
devices, such as the Xbox and PlayStation, can automatically discover this server in the LAN
|
devices, such as the Xbox and PlayStation, can automatically discover this server in the LAN
|
||||||
and play audio/video from it. VLC is also supported. Service discovery uses UDP multicast
|
and play audio/video from it. VLC is also supported. Service discovery uses UDP multicast
|
||||||
packets (SSDP) and will thus only work on LANs.
|
packets (SSDP) and will thus only work on LANs.
|
||||||
|
|
|
@ -123,7 +123,7 @@ func (d *Directory) AddEntry(remote string, isDir bool) {
|
||||||
})
|
})
|
||||||
}
|
}
|
||||||
|
|
||||||
// Error logs the error and if a ResponseWriter is given it writes a http.StatusInternalServerError
|
// Error logs the error and if a ResponseWriter is given it writes an http.StatusInternalServerError
|
||||||
func Error(what interface{}, w http.ResponseWriter, text string, err error) {
|
func Error(what interface{}, w http.ResponseWriter, text string, err error) {
|
||||||
err = fs.CountError(err)
|
err = fs.CountError(err)
|
||||||
fs.Errorf(what, "%s: %v", text, err)
|
fs.Errorf(what, "%s: %v", text, err)
|
||||||
|
@ -132,7 +132,7 @@ func Error(what interface{}, w http.ResponseWriter, text string, err error) {
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
// ProcessQueryParams takes and sorts/orders based on the request sort/order parameters and defailt is namedirfist/asc
|
// ProcessQueryParams takes and sorts/orders based on the request sort/order parameters and default is namedirfist/asc
|
||||||
func (d *Directory) ProcessQueryParams(sortParm string, orderParm string) *Directory {
|
func (d *Directory) ProcessQueryParams(sortParm string, orderParm string) *Directory {
|
||||||
d.Sort = sortParm
|
d.Sort = sortParm
|
||||||
d.Order = orderParm
|
d.Order = orderParm
|
||||||
|
|
|
@ -89,7 +89,7 @@ that since |_obscure| is set to |pass|, rclone will obscure the |pass|
|
||||||
parameter before creating the backend (which is required for sftp
|
parameter before creating the backend (which is required for sftp
|
||||||
backends).
|
backends).
|
||||||
|
|
||||||
The progam can manipulate the supplied |user| in any way, for example
|
The program can manipulate the supplied |user| in any way, for example
|
||||||
to make proxy to many different sftp backends, you could make the
|
to make proxy to many different sftp backends, you could make the
|
||||||
|user| be |user@example.com| and then set the |host| to |example.com|
|
|user| be |user@example.com| and then set the |host| to |example.com|
|
||||||
in the output and the user to |user|. For security you'd probably want
|
in the output and the user to |user|. For security you'd probably want
|
||||||
|
|
|
@ -51,7 +51,7 @@ type conn struct {
|
||||||
what string
|
what string
|
||||||
}
|
}
|
||||||
|
|
||||||
// execCommand implements an extrememly limited number of commands to
|
// execCommand implements an extremely limited number of commands to
|
||||||
// interoperate with the rclone sftp backend
|
// interoperate with the rclone sftp backend
|
||||||
func (c *conn) execCommand(ctx context.Context, out io.Writer, command string) (err error) {
|
func (c *conn) execCommand(ctx context.Context, out io.Writer, command string) (err error) {
|
||||||
binary, args := command, ""
|
binary, args := command, ""
|
||||||
|
|
|
@ -143,7 +143,7 @@ func Tree(fsrc fs.Fs, outFile io.Writer, opts *tree.Options) error {
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
// FileInfo maps a fs.DirEntry into an os.FileInfo
|
// FileInfo maps an fs.DirEntry into an os.FileInfo
|
||||||
type FileInfo struct {
|
type FileInfo struct {
|
||||||
entry fs.DirEntry
|
entry fs.DirEntry
|
||||||
}
|
}
|
||||||
|
|
|
@ -222,7 +222,7 @@ There are a couple of issues with Windows `mount` functionality that still requi
|
||||||
It should be considered as experimental thus far as fixes come in for this OS.
|
It should be considered as experimental thus far as fixes come in for this OS.
|
||||||
|
|
||||||
Most of the issues seem to be related to the difference between filesystems
|
Most of the issues seem to be related to the difference between filesystems
|
||||||
on Linux flavors and Windows as cache is heavily dependant on them.
|
on Linux flavors and Windows as cache is heavily dependent on them.
|
||||||
|
|
||||||
Any reports or feedback on how cache behaves on this OS is greatly appreciated.
|
Any reports or feedback on how cache behaves on this OS is greatly appreciated.
|
||||||
|
|
||||||
|
|
|
@ -376,7 +376,7 @@ date: "2020-02-01"
|
||||||
* march: Fix checking sub-directories when using `--no-traverse` (buengese)
|
* march: Fix checking sub-directories when using `--no-traverse` (buengese)
|
||||||
* rc
|
* rc
|
||||||
* Fix unmarshalable http.AuthFn in options and put in test for marshalability (Nick Craig-Wood)
|
* Fix unmarshalable http.AuthFn in options and put in test for marshalability (Nick Craig-Wood)
|
||||||
* Move job expire flags to rc to fix initalization problem (Nick Craig-Wood)
|
* Move job expire flags to rc to fix initialization problem (Nick Craig-Wood)
|
||||||
* Fix `--loopback` with rc/list and others (Nick Craig-Wood)
|
* Fix `--loopback` with rc/list and others (Nick Craig-Wood)
|
||||||
* rcat: Fix slowdown on systems with multiple hashes (Nick Craig-Wood)
|
* rcat: Fix slowdown on systems with multiple hashes (Nick Craig-Wood)
|
||||||
* rcd: Fix permissions problems on cache directory with web gui download (Nick Craig-Wood)
|
* rcd: Fix permissions problems on cache directory with web gui download (Nick Craig-Wood)
|
||||||
|
@ -515,7 +515,7 @@ date: "2020-02-01"
|
||||||
* Onedrive
|
* Onedrive
|
||||||
* More accurately check if root is found (Cnly)
|
* More accurately check if root is found (Cnly)
|
||||||
* S3
|
* S3
|
||||||
* Suppport S3 Accelerated endpoints with `--s3-use-accelerate-endpoint` (Nick Craig-Wood)
|
* Support S3 Accelerated endpoints with `--s3-use-accelerate-endpoint` (Nick Craig-Wood)
|
||||||
* Add config info for Wasabi's EU Central endpoint (Robert Marko)
|
* Add config info for Wasabi's EU Central endpoint (Robert Marko)
|
||||||
* Make SetModTime work for GLACIER while syncing (Philip Harvey)
|
* Make SetModTime work for GLACIER while syncing (Philip Harvey)
|
||||||
* SFTP
|
* SFTP
|
||||||
|
@ -1295,18 +1295,18 @@ Point release to fix hubic and azureblob backends.
|
||||||
* Rclone no longer has any working keys - disable integration tests
|
* Rclone no longer has any working keys - disable integration tests
|
||||||
* Implement DirChangeNotify to notify cache/vfs/mount of changes
|
* Implement DirChangeNotify to notify cache/vfs/mount of changes
|
||||||
* Azureblob
|
* Azureblob
|
||||||
* Don't check for bucket/container presense if listing was OK
|
* Don't check for bucket/container presence if listing was OK
|
||||||
* this makes rclone do one less request per invocation
|
* this makes rclone do one less request per invocation
|
||||||
* Improve accounting for chunked uploads
|
* Improve accounting for chunked uploads
|
||||||
* Backblaze B2
|
* Backblaze B2
|
||||||
* Don't check for bucket/container presense if listing was OK
|
* Don't check for bucket/container presence if listing was OK
|
||||||
* this makes rclone do one less request per invocation
|
* this makes rclone do one less request per invocation
|
||||||
* Box
|
* Box
|
||||||
* Improve accounting for chunked uploads
|
* Improve accounting for chunked uploads
|
||||||
* Dropbox
|
* Dropbox
|
||||||
* Fix custom oauth client parameters
|
* Fix custom oauth client parameters
|
||||||
* Google Cloud Storage
|
* Google Cloud Storage
|
||||||
* Don't check for bucket/container presense if listing was OK
|
* Don't check for bucket/container presence if listing was OK
|
||||||
* this makes rclone do one less request per invocation
|
* this makes rclone do one less request per invocation
|
||||||
* Google Drive
|
* Google Drive
|
||||||
* Migrate to api v3 (Fabian Möller)
|
* Migrate to api v3 (Fabian Möller)
|
||||||
|
@ -1329,13 +1329,13 @@ Point release to fix hubic and azureblob backends.
|
||||||
* Pcloud
|
* Pcloud
|
||||||
* Remove unused chunked upload flag and code
|
* Remove unused chunked upload flag and code
|
||||||
* Qingstor
|
* Qingstor
|
||||||
* Don't check for bucket/container presense if listing was OK
|
* Don't check for bucket/container presence if listing was OK
|
||||||
* this makes rclone do one less request per invocation
|
* this makes rclone do one less request per invocation
|
||||||
* S3
|
* S3
|
||||||
* Support hashes for multipart files (Chris Redekop)
|
* Support hashes for multipart files (Chris Redekop)
|
||||||
* Initial support for IBM COS (S3) (Giri Badanahatti)
|
* Initial support for IBM COS (S3) (Giri Badanahatti)
|
||||||
* Update docs to discourage use of v2 auth with CEPH and others
|
* Update docs to discourage use of v2 auth with CEPH and others
|
||||||
* Don't check for bucket/container presense if listing was OK
|
* Don't check for bucket/container presence if listing was OK
|
||||||
* this makes rclone do one less request per invocation
|
* this makes rclone do one less request per invocation
|
||||||
* Fix server side copy and set modtime on files with + in
|
* Fix server side copy and set modtime on files with + in
|
||||||
* SFTP
|
* SFTP
|
||||||
|
@ -1350,7 +1350,7 @@ Point release to fix hubic and azureblob backends.
|
||||||
* Fix refresh of authentication token
|
* Fix refresh of authentication token
|
||||||
* in v1.39 a bug was introduced which ignored new tokens - this fixes it
|
* in v1.39 a bug was introduced which ignored new tokens - this fixes it
|
||||||
* Fix extra HEAD transaction when uploading a new file
|
* Fix extra HEAD transaction when uploading a new file
|
||||||
* Don't check for bucket/container presense if listing was OK
|
* Don't check for bucket/container presence if listing was OK
|
||||||
* this makes rclone do one less request per invocation
|
* this makes rclone do one less request per invocation
|
||||||
* Webdav
|
* Webdav
|
||||||
* Add new time formats to support mydrive.ch and others
|
* Add new time formats to support mydrive.ch and others
|
||||||
|
@ -1375,7 +1375,7 @@ Point release to fix hubic and azureblob backends.
|
||||||
* curl install for rclone (Filip Bartodziej)
|
* curl install for rclone (Filip Bartodziej)
|
||||||
* --stats now shows percentage, size, rate and ETA in condensed form (Ishuah Kariuki)
|
* --stats now shows percentage, size, rate and ETA in condensed form (Ishuah Kariuki)
|
||||||
* --exclude-if-present to exclude a directory if a file is present (Iakov Davydov)
|
* --exclude-if-present to exclude a directory if a file is present (Iakov Davydov)
|
||||||
* rmdirs: add --leave-root flag (lewpam)
|
* rmdirs: add --leave-root flag (lewapm)
|
||||||
* move: add --delete-empty-src-dirs flag to remove dirs after move (Ishuah Kariuki)
|
* move: add --delete-empty-src-dirs flag to remove dirs after move (Ishuah Kariuki)
|
||||||
* Add --dump flag, introduce --dump requests, responses and remove --dump-auth, --dump-filters
|
* Add --dump flag, introduce --dump requests, responses and remove --dump-auth, --dump-filters
|
||||||
* Obscure X-Auth-Token: from headers when dumping too
|
* Obscure X-Auth-Token: from headers when dumping too
|
||||||
|
@ -2086,7 +2086,7 @@ Point release to fix hubic and azureblob backends.
|
||||||
* New features
|
* New features
|
||||||
* Amazon Drive support
|
* Amazon Drive support
|
||||||
* Oauth support redone - fix many bugs and improve usability
|
* Oauth support redone - fix many bugs and improve usability
|
||||||
* Use "golang.org/x/oauth2" as oauth libary of choice
|
* Use "golang.org/x/oauth2" as oauth library of choice
|
||||||
* Improve oauth usability for smoother initial signup
|
* Improve oauth usability for smoother initial signup
|
||||||
* drive, googlecloudstorage: optionally use auto config for the oauth token
|
* drive, googlecloudstorage: optionally use auto config for the oauth token
|
||||||
* Implement --dump-headers and --dump-bodies debug flags
|
* Implement --dump-headers and --dump-bodies debug flags
|
||||||
|
|
|
@ -7,7 +7,7 @@ date: "2018-08-07"
|
||||||
<i class="fa fa-cloud"></i> Jottacloud
|
<i class="fa fa-cloud"></i> Jottacloud
|
||||||
-----------------------------------------
|
-----------------------------------------
|
||||||
|
|
||||||
Jottacoud is a cloud storage service provider from a Norwegian company, using its own datacenters in Norway.
|
Jottacloud is a cloud storage service provider from a Norwegian company, using its own datacenters in Norway.
|
||||||
|
|
||||||
In addition to the official service at [jottacloud.com](https://www.jottacloud.com/), there are
|
In addition to the official service at [jottacloud.com](https://www.jottacloud.com/), there are
|
||||||
also several whitelabel versions which should work with this backend.
|
also several whitelabel versions which should work with this backend.
|
||||||
|
|
|
@ -359,7 +359,7 @@ func (acc *Account) progress() (bytes, size int64) {
|
||||||
}
|
}
|
||||||
|
|
||||||
// speed returns the speed of the current file transfer
|
// speed returns the speed of the current file transfer
|
||||||
// in bytes per second, as well a an exponentially weighted moving average
|
// in bytes per second, as well an exponentially weighted moving average
|
||||||
// If no read has completed yet, 0 is returned for both values.
|
// If no read has completed yet, 0 is returned for both values.
|
||||||
func (acc *Account) speed() (bps, current float64) {
|
func (acc *Account) speed() (bps, current float64) {
|
||||||
if acc == nil {
|
if acc == nil {
|
||||||
|
|
|
@ -166,7 +166,7 @@ Returns the following values:
|
||||||
"bytes": total transferred bytes for this file,
|
"bytes": total transferred bytes for this file,
|
||||||
"checked": if the transfer is only checked (skipped, deleted),
|
"checked": if the transfer is only checked (skipped, deleted),
|
||||||
"timestamp": integer representing millisecond unix epoch,
|
"timestamp": integer representing millisecond unix epoch,
|
||||||
"error": string description of the error (empty if successfull),
|
"error": string description of the error (empty if successful),
|
||||||
"jobid": id of the job that this transfer belongs to
|
"jobid": id of the job that this transfer belongs to
|
||||||
}
|
}
|
||||||
]
|
]
|
||||||
|
|
6
fs/cache/cache.go
vendored
6
fs/cache/cache.go
vendored
|
@ -37,7 +37,7 @@ func addMapping(fsString, canonicalName string) {
|
||||||
mu.Unlock()
|
mu.Unlock()
|
||||||
}
|
}
|
||||||
|
|
||||||
// GetFn gets a fs.Fs named fsString either from the cache or creates
|
// GetFn gets an fs.Fs named fsString either from the cache or creates
|
||||||
// it afresh with the create function
|
// it afresh with the create function
|
||||||
func GetFn(fsString string, create func(fsString string) (fs.Fs, error)) (f fs.Fs, err error) {
|
func GetFn(fsString string, create func(fsString string) (fs.Fs, error)) (f fs.Fs, err error) {
|
||||||
fsString = canonicalize(fsString)
|
fsString = canonicalize(fsString)
|
||||||
|
@ -77,7 +77,7 @@ func Unpin(f fs.Fs) {
|
||||||
c.Pin(fs.ConfigString(f))
|
c.Pin(fs.ConfigString(f))
|
||||||
}
|
}
|
||||||
|
|
||||||
// Get gets a fs.Fs named fsString either from the cache or creates it afresh
|
// Get gets an fs.Fs named fsString either from the cache or creates it afresh
|
||||||
func Get(fsString string) (f fs.Fs, err error) {
|
func Get(fsString string) (f fs.Fs, err error) {
|
||||||
return GetFn(fsString, fs.NewFs)
|
return GetFn(fsString, fs.NewFs)
|
||||||
}
|
}
|
||||||
|
@ -89,7 +89,7 @@ func Put(fsString string, f fs.Fs) {
|
||||||
addMapping(fsString, canonicalName)
|
addMapping(fsString, canonicalName)
|
||||||
}
|
}
|
||||||
|
|
||||||
// Clear removes everything from the cahce
|
// Clear removes everything from the cache
|
||||||
func Clear() {
|
func Clear() {
|
||||||
c.Clear()
|
c.Clear()
|
||||||
}
|
}
|
||||||
|
|
|
@ -19,7 +19,7 @@ var (
|
||||||
// ChunkedReader is a reader for a Object with the possibility
|
// ChunkedReader is a reader for a Object with the possibility
|
||||||
// of reading the source in chunks of given size
|
// of reading the source in chunks of given size
|
||||||
//
|
//
|
||||||
// A initialChunkSize of <= 0 will disable chunked reading.
|
// An initialChunkSize of <= 0 will disable chunked reading.
|
||||||
type ChunkedReader struct {
|
type ChunkedReader struct {
|
||||||
ctx context.Context
|
ctx context.Context
|
||||||
mu sync.Mutex // protects following fields
|
mu sync.Mutex // protects following fields
|
||||||
|
@ -36,7 +36,7 @@ type ChunkedReader struct {
|
||||||
|
|
||||||
// New returns a ChunkedReader for the Object.
|
// New returns a ChunkedReader for the Object.
|
||||||
//
|
//
|
||||||
// A initialChunkSize of <= 0 will disable chunked reading.
|
// An initialChunkSize of <= 0 will disable chunked reading.
|
||||||
// If maxChunkSize is greater than initialChunkSize, the chunk size will be
|
// If maxChunkSize is greater than initialChunkSize, the chunk size will be
|
||||||
// doubled after each chunk read with a maximun of maxChunkSize.
|
// doubled after each chunk read with a maximun of maxChunkSize.
|
||||||
// A Seek or RangeSeek will reset the chunk size to it's initial value
|
// A Seek or RangeSeek will reset the chunk size to it's initial value
|
||||||
|
|
|
@ -156,7 +156,7 @@ func NewConfig() *ConfigInfo {
|
||||||
return c
|
return c
|
||||||
}
|
}
|
||||||
|
|
||||||
// ConfigToEnv converts an config section and name, eg ("myremote",
|
// ConfigToEnv converts a config section and name, eg ("myremote",
|
||||||
// "ignore-size") into an environment name
|
// "ignore-size") into an environment name
|
||||||
// "RCLONE_CONFIG_MYREMOTE_IGNORE_SIZE"
|
// "RCLONE_CONFIG_MYREMOTE_IGNORE_SIZE"
|
||||||
func ConfigToEnv(section, name string) string {
|
func ConfigToEnv(section, name string) string {
|
||||||
|
|
|
@ -426,7 +426,7 @@ func (f *Filter) IncludeDirectory(ctx context.Context, fs fs.Fs) func(string) (b
|
||||||
}
|
}
|
||||||
|
|
||||||
// DirContainsExcludeFile checks if exclude file is present in a
|
// DirContainsExcludeFile checks if exclude file is present in a
|
||||||
// directroy. If fs is nil, it works properly if ExcludeFile is an
|
// directory. If fs is nil, it works properly if ExcludeFile is an
|
||||||
// empty string (for testing).
|
// empty string (for testing).
|
||||||
func (f *Filter) DirContainsExcludeFile(ctx context.Context, fremote fs.Fs, remote string) (bool, error) {
|
func (f *Filter) DirContainsExcludeFile(ctx context.Context, fremote fs.Fs, remote string) (bool, error) {
|
||||||
if len(f.Opt.ExcludeFile) > 0 {
|
if len(f.Opt.ExcludeFile) > 0 {
|
||||||
|
|
4
fs/fs.go
4
fs/fs.go
|
@ -1079,7 +1079,7 @@ type CommandHelp struct {
|
||||||
Opts map[string]string // maps option name to a single line help
|
Opts map[string]string // maps option name to a single line help
|
||||||
}
|
}
|
||||||
|
|
||||||
// Commander is an iterface to wrap the Command function
|
// Commander is an interface to wrap the Command function
|
||||||
type Commander interface {
|
type Commander interface {
|
||||||
// Command the backend to run a named command
|
// Command the backend to run a named command
|
||||||
//
|
//
|
||||||
|
@ -1137,7 +1137,7 @@ func UnWrapObject(o Object) Object {
|
||||||
return o
|
return o
|
||||||
}
|
}
|
||||||
|
|
||||||
// Find looks for an RegInfo object for the name passed in. The name
|
// Find looks for a RegInfo object for the name passed in. The name
|
||||||
// can be either the Name or the Prefix.
|
// can be either the Name or the Prefix.
|
||||||
//
|
//
|
||||||
// Services are looked up in the config file
|
// Services are looked up in the config file
|
||||||
|
|
|
@ -360,7 +360,7 @@ func Cause(cause error) (retriable bool, err error) {
|
||||||
}
|
}
|
||||||
|
|
||||||
// retriableErrorStrings is a list of phrases which when we find it
|
// retriableErrorStrings is a list of phrases which when we find it
|
||||||
// in an an error, we know it is a networking error which should be
|
// in an error, we know it is a networking error which should be
|
||||||
// retried.
|
// retried.
|
||||||
//
|
//
|
||||||
// This is incredibly ugly - if only errors.Cause worked for all
|
// This is incredibly ugly - if only errors.Cause worked for all
|
||||||
|
|
|
@ -215,7 +215,7 @@ func NewClient(ci *fs.ConfigInfo) *http.Client {
|
||||||
return client
|
return client
|
||||||
}
|
}
|
||||||
|
|
||||||
// Transport is a our http Transport which wraps an http.Transport
|
// Transport is our http Transport which wraps an http.Transport
|
||||||
// * Sets the User Agent
|
// * Sets the User Agent
|
||||||
// * Does logging
|
// * Does logging
|
||||||
type Transport struct {
|
type Transport struct {
|
||||||
|
|
|
@ -15,7 +15,7 @@ type CallerHook struct {
|
||||||
levels []logrus.Level
|
levels []logrus.Level
|
||||||
}
|
}
|
||||||
|
|
||||||
// NewCallerHook use to make an hook
|
// NewCallerHook use to make a hook
|
||||||
func NewCallerHook(levels ...logrus.Level) logrus.Hook {
|
func NewCallerHook(levels ...logrus.Level) logrus.Hook {
|
||||||
hook := CallerHook{
|
hook := CallerHook{
|
||||||
Field: "source",
|
Field: "source",
|
||||||
|
@ -39,7 +39,7 @@ func (h *CallerHook) Fire(entry *logrus.Entry) error {
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
// findCaller ignores the caller relevent to logrus or fslog then find out the exact caller
|
// findCaller ignores the caller relevant to logrus or fslog then find out the exact caller
|
||||||
func findCaller(skip int) string {
|
func findCaller(skip int) string {
|
||||||
file := ""
|
file := ""
|
||||||
line := 0
|
line := 0
|
||||||
|
|
|
@ -418,7 +418,7 @@ command:
|
||||||
|
|
||||||
rclone backend noop . -o echo=yes -o blue path1 path2
|
rclone backend noop . -o echo=yes -o blue path1 path2
|
||||||
|
|
||||||
Note that arguments must be preceeded by the "-a" flag
|
Note that arguments must be preceded by the "-a" flag
|
||||||
|
|
||||||
See the [backend](/commands/rclone_backend/) command for more information.
|
See the [backend](/commands/rclone_backend/) command for more information.
|
||||||
`,
|
`,
|
||||||
|
|
|
@ -19,7 +19,7 @@ var _ io.ReadCloser = (*ReOpen)(nil)
|
||||||
|
|
||||||
var errorTestError = errors.New("test error")
|
var errorTestError = errors.New("test error")
|
||||||
|
|
||||||
// this is a wrapper for an mockobject with a custom Open function
|
// this is a wrapper for a mockobject with a custom Open function
|
||||||
//
|
//
|
||||||
// breaks indicate the number of bytes to read before returning an
|
// breaks indicate the number of bytes to read before returning an
|
||||||
// error
|
// error
|
||||||
|
|
|
@ -141,7 +141,7 @@ func (o *RangeOption) Decode(size int64) (offset, limit int64) {
|
||||||
func FixRangeOption(options []OpenOption, size int64) {
|
func FixRangeOption(options []OpenOption, size int64) {
|
||||||
if size == 0 {
|
if size == 0 {
|
||||||
// if size 0 then remove RangeOption~s
|
// if size 0 then remove RangeOption~s
|
||||||
// replacing with an NullOptions~s which won't be rendered
|
// replacing with a NullOptions~s which won't be rendered
|
||||||
for i := range options {
|
for i := range options {
|
||||||
if _, ok := options[i].(*RangeOption); ok {
|
if _, ok := options[i].(*RangeOption); ok {
|
||||||
options[i] = NullOption{}
|
options[i] = NullOption{}
|
||||||
|
|
|
@ -7,7 +7,7 @@ import (
|
||||||
"github.com/rclone/rclone/fs/cache"
|
"github.com/rclone/rclone/fs/cache"
|
||||||
)
|
)
|
||||||
|
|
||||||
// GetFsNamed gets a fs.Fs named fsName either from the cache or creates it afresh
|
// GetFsNamed gets an fs.Fs named fsName either from the cache or creates it afresh
|
||||||
func GetFsNamed(in Params, fsName string) (f fs.Fs, err error) {
|
func GetFsNamed(in Params, fsName string) (f fs.Fs, err error) {
|
||||||
fsString, err := in.GetString(fsName)
|
fsString, err := in.GetString(fsName)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
|
@ -17,7 +17,7 @@ func GetFsNamed(in Params, fsName string) (f fs.Fs, err error) {
|
||||||
return cache.Get(fsString)
|
return cache.Get(fsString)
|
||||||
}
|
}
|
||||||
|
|
||||||
// GetFs gets a fs.Fs named "fs" either from the cache or creates it afresh
|
// GetFs gets an fs.Fs named "fs" either from the cache or creates it afresh
|
||||||
func GetFs(in Params) (f fs.Fs, err error) {
|
func GetFs(in Params) (f fs.Fs, err error) {
|
||||||
return GetFsNamed(in, "fs")
|
return GetFsNamed(in, "fs")
|
||||||
}
|
}
|
||||||
|
|
|
@ -16,7 +16,7 @@ import (
|
||||||
"github.com/rclone/rclone/fs/rc"
|
"github.com/rclone/rclone/fs/rc"
|
||||||
)
|
)
|
||||||
|
|
||||||
// Job describes a asynchronous task started via the rc package
|
// Job describes an asynchronous task started via the rc package
|
||||||
type Job struct {
|
type Job struct {
|
||||||
mu sync.Mutex
|
mu sync.Mutex
|
||||||
ID int64 `json:"id"`
|
ID int64 `json:"id"`
|
||||||
|
|
|
@ -202,7 +202,7 @@ func unzip(src, dest string) (err error) {
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
func exists(path string) (existance bool, stat os.FileInfo, err error) {
|
func exists(path string) (existence bool, stat os.FileInfo, err error) {
|
||||||
stat, err = os.Stat(path)
|
stat, err = os.Stat(path)
|
||||||
if err == nil {
|
if err == nil {
|
||||||
return true, stat, nil
|
return true, stat, nil
|
||||||
|
|
|
@ -76,7 +76,7 @@ func (p *pipe) Pop() interface{} {
|
||||||
return item
|
return item
|
||||||
}
|
}
|
||||||
|
|
||||||
// Put an pair into the pipe
|
// Put a pair into the pipe
|
||||||
//
|
//
|
||||||
// It returns ok = false if the context was cancelled
|
// It returns ok = false if the context was cancelled
|
||||||
//
|
//
|
||||||
|
|
|
@ -616,7 +616,7 @@ func Run(t *testing.T, opt *Opt) {
|
||||||
}
|
}
|
||||||
})
|
})
|
||||||
|
|
||||||
// TestFsNewObjectNotFound tests not finding a object
|
// TestFsNewObjectNotFound tests not finding an object
|
||||||
t.Run("FsNewObjectNotFound", func(t *testing.T) {
|
t.Run("FsNewObjectNotFound", func(t *testing.T) {
|
||||||
skipIfNotOk(t)
|
skipIfNotOk(t)
|
||||||
// Object in an existing directory
|
// Object in an existing directory
|
||||||
|
|
|
@ -102,7 +102,7 @@ type ContentMockObject struct {
|
||||||
unknownSize bool
|
unknownSize bool
|
||||||
}
|
}
|
||||||
|
|
||||||
// WithContent returns a fs.Object with the given content.
|
// WithContent returns an fs.Object with the given content.
|
||||||
func (o Object) WithContent(content []byte, mode SeekMode) *ContentMockObject {
|
func (o Object) WithContent(content []byte, mode SeekMode) *ContentMockObject {
|
||||||
return &ContentMockObject{
|
return &ContentMockObject{
|
||||||
Object: o,
|
Object: o,
|
||||||
|
|
|
@ -48,7 +48,7 @@ var (
|
||||||
// if matches then is definitely OK in the shell
|
// if matches then is definitely OK in the shell
|
||||||
var shellOK = regexp.MustCompile("^[A-Za-z0-9./_:-]+$")
|
var shellOK = regexp.MustCompile("^[A-Za-z0-9./_:-]+$")
|
||||||
|
|
||||||
// converts a argv style input into a shell command
|
// converts an argv style input into a shell command
|
||||||
func toShell(args []string) (result string) {
|
func toShell(args []string) (result string) {
|
||||||
for _, arg := range args {
|
for _, arg := range args {
|
||||||
if result != "" {
|
if result != "" {
|
||||||
|
|
|
@ -57,7 +57,7 @@ func Unregister(handle FnHandle) {
|
||||||
delete(fns, handle)
|
delete(fns, handle)
|
||||||
}
|
}
|
||||||
|
|
||||||
// IgnoreSignals disables the signal handler and prevents Run from beeing executed automatically
|
// IgnoreSignals disables the signal handler and prevents Run from being executed automatically
|
||||||
func IgnoreSignals() {
|
func IgnoreSignals() {
|
||||||
registerOnce.Do(func() {})
|
registerOnce.Do(func() {})
|
||||||
if exitChan != nil {
|
if exitChan != nil {
|
||||||
|
|
|
@ -88,7 +88,7 @@ func (c *Cache) Create(bucket string, create CreateFn, exists ExistsFn) (err err
|
||||||
c.mu.Lock()
|
c.mu.Lock()
|
||||||
defer c.mu.Unlock()
|
defer c.mu.Unlock()
|
||||||
|
|
||||||
// if have exists fuction and bucket has been deleted, check
|
// if have exists function and bucket has been deleted, check
|
||||||
// it still exists
|
// it still exists
|
||||||
if created, ok := c.status[bucket]; ok && !created && exists != nil {
|
if created, ok := c.status[bucket]; ok && !created && exists != nil {
|
||||||
found, err := exists()
|
found, err := exists()
|
||||||
|
|
4
lib/cache/cache.go
vendored
4
lib/cache/cache.go
vendored
|
@ -95,7 +95,7 @@ func (c *Cache) Unpin(key string) {
|
||||||
c.addPin(key, -1)
|
c.addPin(key, -1)
|
||||||
}
|
}
|
||||||
|
|
||||||
// Put puts an value named key into the cache
|
// Put puts a value named key into the cache
|
||||||
func (c *Cache) Put(key string, value interface{}) {
|
func (c *Cache) Put(key string, value interface{}) {
|
||||||
c.mu.Lock()
|
c.mu.Lock()
|
||||||
defer c.mu.Unlock()
|
defer c.mu.Unlock()
|
||||||
|
@ -159,7 +159,7 @@ func (c *Cache) cacheExpire() {
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
// Clear removes everything from the cahce
|
// Clear removes everything from the cache
|
||||||
func (c *Cache) Clear() {
|
func (c *Cache) Clear() {
|
||||||
c.mu.Lock()
|
c.mu.Lock()
|
||||||
for k := range c.cache {
|
for k := range c.cache {
|
||||||
|
|
|
@ -2,7 +2,7 @@
|
||||||
Translate file names for usage on restrictive storage systems
|
Translate file names for usage on restrictive storage systems
|
||||||
|
|
||||||
The restricted set of characters are mapped to a unicode equivalent version
|
The restricted set of characters are mapped to a unicode equivalent version
|
||||||
(most to their FULLWIDTH variant) to increase compatability with other
|
(most to their FULLWIDTH variant) to increase compatibility with other
|
||||||
storage systems.
|
storage systems.
|
||||||
See: http://unicode-search.net/unicode-namesearch.pl?term=FULLWIDTH
|
See: http://unicode-search.net/unicode-namesearch.pl?term=FULLWIDTH
|
||||||
|
|
||||||
|
|
|
@ -600,7 +600,7 @@ func runePos(r rune, s []rune) int {
|
||||||
return -1
|
return -1
|
||||||
}
|
}
|
||||||
|
|
||||||
// quotedToString returns a string for the chars slice where a encoder.QuoteRune is
|
// quotedToString returns a string for the chars slice where an encoder.QuoteRune is
|
||||||
// inserted before a char[i] when quoted[i] is true.
|
// inserted before a char[i] when quoted[i] is true.
|
||||||
func quotedToString(chars []rune, quoted []bool) string {
|
func quotedToString(chars []rune, quoted []bool) string {
|
||||||
var out strings.Builder
|
var out strings.Builder
|
||||||
|
|
|
@ -82,7 +82,7 @@ func NewRepeatableReaderSized(r io.Reader, size int) *RepeatableReader {
|
||||||
}
|
}
|
||||||
|
|
||||||
// NewRepeatableLimitReader create new repeatable reader from Reader r
|
// NewRepeatableLimitReader create new repeatable reader from Reader r
|
||||||
// with an initial buffer of size wrapped in a io.LimitReader to read
|
// with an initial buffer of size wrapped in an io.LimitReader to read
|
||||||
// only size.
|
// only size.
|
||||||
func NewRepeatableLimitReader(r io.Reader, size int) *RepeatableReader {
|
func NewRepeatableLimitReader(r io.Reader, size int) *RepeatableReader {
|
||||||
return NewRepeatableReaderSized(io.LimitReader(r, int64(size)), size)
|
return NewRepeatableReaderSized(io.LimitReader(r, int64(size)), size)
|
||||||
|
@ -98,7 +98,7 @@ func NewRepeatableReaderBuffer(r io.Reader, buf []byte) *RepeatableReader {
|
||||||
}
|
}
|
||||||
|
|
||||||
// NewRepeatableLimitReaderBuffer create new repeatable reader from
|
// NewRepeatableLimitReaderBuffer create new repeatable reader from
|
||||||
// Reader r and buf wrapped in a io.LimitReader to read only size.
|
// Reader r and buf wrapped in an io.LimitReader to read only size.
|
||||||
func NewRepeatableLimitReaderBuffer(r io.Reader, buf []byte, size int64) *RepeatableReader {
|
func NewRepeatableLimitReaderBuffer(r io.Reader, buf []byte, size int64) *RepeatableReader {
|
||||||
return NewRepeatableReaderBuffer(io.LimitReader(r, size), buf)
|
return NewRepeatableReaderBuffer(io.LimitReader(r, size), buf)
|
||||||
}
|
}
|
||||||
|
|
|
@ -90,7 +90,7 @@ func TestRepeatableReader(t *testing.T) {
|
||||||
assert.Nil(t, err)
|
assert.Nil(t, err)
|
||||||
require.Equal(t, 2, int(pos))
|
require.Equal(t, 2, int(pos))
|
||||||
|
|
||||||
// Should read from seek postion and past it
|
// Should read from seek position and past it
|
||||||
dst = make([]byte, 5)
|
dst = make([]byte, 5)
|
||||||
n, err = io.ReadFull(r, dst)
|
n, err = io.ReadFull(r, dst)
|
||||||
assert.Nil(t, err)
|
assert.Nil(t, err)
|
||||||
|
|
|
@ -111,7 +111,7 @@ func (api *Client) SetUserPass(UserName, Password string) *Client {
|
||||||
return api
|
return api
|
||||||
}
|
}
|
||||||
|
|
||||||
// SetCookie creates an Cookies Header for all requests with the supplied
|
// SetCookie creates a Cookies Header for all requests with the supplied
|
||||||
// cookies passed in.
|
// cookies passed in.
|
||||||
// All cookies have to be supplied at once, all cookies will be overwritten
|
// All cookies have to be supplied at once, all cookies will be overwritten
|
||||||
// on a new call to the method
|
// on a new call to the method
|
||||||
|
@ -407,7 +407,7 @@ func (api *Client) CallJSON(ctx context.Context, opts *Opts, request interface{}
|
||||||
return api.callCodec(ctx, opts, request, response, json.Marshal, DecodeJSON, "application/json")
|
return api.callCodec(ctx, opts, request, response, json.Marshal, DecodeJSON, "application/json")
|
||||||
}
|
}
|
||||||
|
|
||||||
// CallXML runs Call and decodes the body as a XML object into response (if not nil)
|
// CallXML runs Call and decodes the body as an XML object into response (if not nil)
|
||||||
//
|
//
|
||||||
// If request is not nil then it will be XML encoded as the body of the request
|
// If request is not nil then it will be XML encoded as the body of the request
|
||||||
//
|
//
|
||||||
|
|
|
@ -54,7 +54,7 @@ type File struct {
|
||||||
appendMode bool // file was opened with O_APPEND
|
appendMode bool // file was opened with O_APPEND
|
||||||
sys interface{} // user defined info to be attached here
|
sys interface{} // user defined info to be attached here
|
||||||
|
|
||||||
muRW sync.Mutex // synchonize RWFileHandle.openPending(), RWFileHandle.close() and File.Remove
|
muRW sync.Mutex // synchronize RWFileHandle.openPending(), RWFileHandle.close() and File.Remove
|
||||||
}
|
}
|
||||||
|
|
||||||
// newFile creates a new File
|
// newFile creates a new File
|
||||||
|
|
|
@ -300,7 +300,7 @@ func testFileRename(t *testing.T, mode vfscommon.CacheMode) {
|
||||||
}
|
}
|
||||||
|
|
||||||
// now try renaming it with the file open
|
// now try renaming it with the file open
|
||||||
// first open it and write to it but dont close it
|
// first open it and write to it but don't close it
|
||||||
fd, err := file.Open(os.O_WRONLY | os.O_TRUNC)
|
fd, err := file.Open(os.O_WRONLY | os.O_TRUNC)
|
||||||
require.NoError(t, err)
|
require.NoError(t, err)
|
||||||
newContents := []byte("this is some new contents")
|
newContents := []byte("this is some new contents")
|
||||||
|
|
|
@ -117,7 +117,7 @@ func (fh *ReadFileHandle) seek(offset int64, reopen bool) (err error) {
|
||||||
fh.hash = nil
|
fh.hash = nil
|
||||||
if !reopen {
|
if !reopen {
|
||||||
ar := fh.r.GetAsyncReader()
|
ar := fh.r.GetAsyncReader()
|
||||||
// try to fullfill the seek with buffer discard
|
// try to fulfill the seek with buffer discard
|
||||||
if ar != nil && ar.SkipBytes(int(offset-fh.offset)) {
|
if ar != nil && ar.SkipBytes(int(offset-fh.offset)) {
|
||||||
fh.offset = offset
|
fh.offset = offset
|
||||||
return nil
|
return nil
|
||||||
|
@ -252,7 +252,7 @@ func waitSequential(what string, remote string, cond *sync.Cond, maxWait time.Du
|
||||||
// Implementation of ReadAt - call with lock held
|
// Implementation of ReadAt - call with lock held
|
||||||
func (fh *ReadFileHandle) readAt(p []byte, off int64) (n int, err error) {
|
func (fh *ReadFileHandle) readAt(p []byte, off int64) (n int, err error) {
|
||||||
// defer log.Trace(fh.remote, "p[%d], off=%d", len(p), off)("n=%d, err=%v", &n, &err)
|
// defer log.Trace(fh.remote, "p[%d], off=%d", len(p), off)("n=%d, err=%v", &n, &err)
|
||||||
err = fh.openPending() // FIXME pending open could be more efficient in the presense of seek (and retries)
|
err = fh.openPending() // FIXME pending open could be more efficient in the presence of seek (and retries)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return 0, err
|
return 0, err
|
||||||
}
|
}
|
||||||
|
|
|
@ -105,7 +105,7 @@ func (fh *RWFileHandle) openPending(truncate bool) (err error) {
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
// try to open a exising cache file
|
// try to open an existing cache file
|
||||||
fd, err = file.OpenFile(fh.file.osPath(), cacheFileOpenFlags&^os.O_CREATE, 0600)
|
fd, err = file.OpenFile(fh.file.osPath(), cacheFileOpenFlags&^os.O_CREATE, 0600)
|
||||||
if os.IsNotExist(err) {
|
if os.IsNotExist(err) {
|
||||||
// cache file does not exist, so need to fetch it if we have an object to fetch
|
// cache file does not exist, so need to fetch it if we have an object to fetch
|
||||||
|
@ -151,7 +151,7 @@ func (fh *RWFileHandle) openPending(truncate bool) (err error) {
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
// Windows doesn't seem to deal well with O_TRUNC and
|
// Windows doesn't seem to deal well with O_TRUNC and
|
||||||
// certain access modes so so truncate the file if it
|
// certain access modes so truncate the file if it
|
||||||
// exists in these cases.
|
// exists in these cases.
|
||||||
if runtime.GOOS == "windows" && fh.flags&os.O_APPEND != 0 {
|
if runtime.GOOS == "windows" && fh.flags&os.O_APPEND != 0 {
|
||||||
cacheFileOpenFlags &^= os.O_TRUNC
|
cacheFileOpenFlags &^= os.O_TRUNC
|
||||||
|
|
|
@ -162,7 +162,7 @@ func TestCacheNew(t *testing.T) {
|
||||||
|
|
||||||
// try purging with file closed
|
// try purging with file closed
|
||||||
c.purgeOld(10 * time.Second)
|
c.purgeOld(10 * time.Second)
|
||||||
// ...nothing should happend
|
// ...nothing should happen
|
||||||
_, err = os.Stat(p)
|
_, err = os.Stat(p)
|
||||||
assert.NoError(t, err)
|
assert.NoError(t, err)
|
||||||
|
|
||||||
|
|
|
@ -42,7 +42,7 @@ var DefaultOpt = Options{
|
||||||
ReadOnly: false,
|
ReadOnly: false,
|
||||||
Umask: 0,
|
Umask: 0,
|
||||||
UID: ^uint32(0), // these values instruct WinFSP-FUSE to use the current user
|
UID: ^uint32(0), // these values instruct WinFSP-FUSE to use the current user
|
||||||
GID: ^uint32(0), // overriden for non windows in mount_unix.go
|
GID: ^uint32(0), // overridden for non windows in mount_unix.go
|
||||||
DirPerms: os.FileMode(0777),
|
DirPerms: os.FileMode(0777),
|
||||||
FilePerms: os.FileMode(0666),
|
FilePerms: os.FileMode(0666),
|
||||||
CacheMode: CacheModeOff,
|
CacheMode: CacheModeOff,
|
||||||
|
|
|
@ -192,7 +192,7 @@ func (fh *WriteFileHandle) close() (err error) {
|
||||||
fh.file.delWriter(fh, false)
|
fh.file.delWriter(fh, false)
|
||||||
fh.file.finishWriterClose()
|
fh.file.finishWriterClose()
|
||||||
}()
|
}()
|
||||||
// If file not opened and not safe to truncate then then leave file intact
|
// If file not opened and not safe to truncate then leave file intact
|
||||||
if !fh.opened && !fh.safeToTruncate() {
|
if !fh.opened && !fh.safeToTruncate() {
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
Loading…
Reference in a new issue